diff --git a/glide.lock b/glide.lock index 26ac421e..72f20c81 100644 --- a/glide.lock +++ b/glide.lock @@ -1,5 +1,5 @@ -hash: e1c100879f58ef4902c4e13d6710505f0ec62fbb5eaa237abeff8faf0ddf30f1 -updated: 2016-09-17T15:49:39.168380014+02:00 +hash: d966770b8886be2e6e94f299dc52f7b6f64597a6e036b70aa361108d0aa5a5aa +updated: 2016-09-17T17:51:57.682909454+02:00 imports: - name: github.com/containernetworking/cni version: 9d5e6e60e79491207834ae8439e80c943db65a69 @@ -8,7 +8,8 @@ imports: - pkg/invoke - pkg/types - name: github.com/containers/image - version: f6f11ab5cf8b1e70ef4aa3f8b6fdb4b671d16abd + version: 5a72b5908c6978a8eee293fdd654395da29015fe + repo: git@github.com:nalind/image subpackages: - directory - image @@ -19,8 +20,44 @@ imports: - docker - oci/layout - openshift + - storage - docker/policyconfiguration - version +- name: github.com/containers/storage + version: 32264f11f3b997e8d2ba032a6a13ebdfcddc2897 + subpackages: + - pkg/archive + - pkg/ioutils + - storage + - pkg/fileutils + - pkg/idtools + - pkg/pools + - pkg/promise + - pkg/system + - pkg/longpath + - drivers + - drivers/register + - pkg/stringid + - storageversion + - pkg/chrootarchive + - pkg/mount + - pkg/plugins + - drivers/aufs + - drivers/btrfs + - drivers/devmapper + - drivers/overlay + - drivers/overlay2 + - drivers/vfs + - drivers/windows + - drivers/zfs + - pkg/random + - pkg/reexec + - pkg/plugins/transport + - pkg/directory + - pkg/parsers + - pkg/devicemapper + - pkg/loopback + - pkg/parsers/kernel - name: github.com/docker/distribution version: cd27f179f2c10c5d300e6d09025b538c475b0d51 subpackages: @@ -126,8 +163,17 @@ imports: version: ff3ca3d616518087dc20180f69bb4038379f1028 subpackages: - pkg/kubelet/api/v1alpha1/runtime +- name: github.com/mattn/go-shellwords + version: 525bedee691b5a8df547cb5cf9f86b7fb1883e24 - name: github.com/Microsoft/go-winio version: 8f9387ea7efabb228a981b9c381142be7667967f + subpackages: + - archive/tar + - backuptar +- name: github.com/Microsoft/hcsshim + version: d8e08e7d31d4f441646638b35f423a760d6dfbcd +- name: github.com/mistifyio/go-zfs + version: 1b4ae6fb4e77b095934d4430860ff202060169f8 - name: github.com/opencontainers/image-spec version: 287772a24ab02d5d2fe3fbbba4f13dff9b9ce003 subpackages: @@ -160,6 +206,8 @@ imports: version: 7dab1a245d3e13d0ad03b77409d0bf7e00a6ada4 subpackages: - specs-go +- name: github.com/pborman/uuid + version: ca53cad383cad2479bbba7f7a1a05797ec1386e4 - name: github.com/rajatchopra/ocicni version: daea0034a4bc2d193d9bf5031bace0403094011a - name: github.com/Sirupsen/logrus diff --git a/glide.yaml b/glide.yaml index ad94b396..5fedfd04 100644 --- a/glide.yaml +++ b/glide.yaml @@ -3,6 +3,8 @@ import: - package: github.com/Sirupsen/logrus version: ~0.10.0 - package: github.com/containers/image + version: add-storage-transport + repo: git@github.com:nalind/image subpackages: - directory - image diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE b/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE new file mode 100644 index 00000000..74487567 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2012 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/common.go b/vendor/github.com/Microsoft/go-winio/archive/tar/common.go new file mode 100644 index 00000000..5141bf92 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/common.go @@ -0,0 +1,342 @@ +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package tar implements access to tar archives. +// It aims to cover most of the variations, including those produced +// by GNU and BSD tars. +// +// References: +// http://www.freebsd.org/cgi/man.cgi?query=tar&sektion=5 +// http://www.gnu.org/software/tar/manual/html_node/Standard.html +// http://pubs.opengroup.org/onlinepubs/9699919799/utilities/pax.html +package tar + +import ( + "bytes" + "errors" + "fmt" + "os" + "path" + "time" +) + +const ( + blockSize = 512 + + // Types + TypeReg = '0' // regular file + TypeRegA = '\x00' // regular file + TypeLink = '1' // hard link + TypeSymlink = '2' // symbolic link + TypeChar = '3' // character device node + TypeBlock = '4' // block device node + TypeDir = '5' // directory + TypeFifo = '6' // fifo node + TypeCont = '7' // reserved + TypeXHeader = 'x' // extended header + TypeXGlobalHeader = 'g' // global extended header + TypeGNULongName = 'L' // Next file has a long name + TypeGNULongLink = 'K' // Next file symlinks to a file w/ a long name + TypeGNUSparse = 'S' // sparse file +) + +// A Header represents a single header in a tar archive. +// Some fields may not be populated. +type Header struct { + Name string // name of header file entry + Mode int64 // permission and mode bits + Uid int // user id of owner + Gid int // group id of owner + Size int64 // length in bytes + ModTime time.Time // modified time + Typeflag byte // type of header entry + Linkname string // target name of link + Uname string // user name of owner + Gname string // group name of owner + Devmajor int64 // major number of character or block device + Devminor int64 // minor number of character or block device + AccessTime time.Time // access time + ChangeTime time.Time // status change time + Xattrs map[string]string + Winheaders map[string]string +} + +// File name constants from the tar spec. +const ( + fileNameSize = 100 // Maximum number of bytes in a standard tar name. + fileNamePrefixSize = 155 // Maximum number of ustar extension bytes. +) + +// FileInfo returns an os.FileInfo for the Header. +func (h *Header) FileInfo() os.FileInfo { + return headerFileInfo{h} +} + +// headerFileInfo implements os.FileInfo. +type headerFileInfo struct { + h *Header +} + +func (fi headerFileInfo) Size() int64 { return fi.h.Size } +func (fi headerFileInfo) IsDir() bool { return fi.Mode().IsDir() } +func (fi headerFileInfo) ModTime() time.Time { return fi.h.ModTime } +func (fi headerFileInfo) Sys() interface{} { return fi.h } + +// Name returns the base name of the file. +func (fi headerFileInfo) Name() string { + if fi.IsDir() { + return path.Base(path.Clean(fi.h.Name)) + } + return path.Base(fi.h.Name) +} + +// Mode returns the permission and mode bits for the headerFileInfo. +func (fi headerFileInfo) Mode() (mode os.FileMode) { + // Set file permission bits. + mode = os.FileMode(fi.h.Mode).Perm() + + // Set setuid, setgid and sticky bits. + if fi.h.Mode&c_ISUID != 0 { + // setuid + mode |= os.ModeSetuid + } + if fi.h.Mode&c_ISGID != 0 { + // setgid + mode |= os.ModeSetgid + } + if fi.h.Mode&c_ISVTX != 0 { + // sticky + mode |= os.ModeSticky + } + + // Set file mode bits. + // clear perm, setuid, setgid and sticky bits. + m := os.FileMode(fi.h.Mode) &^ 07777 + if m == c_ISDIR { + // directory + mode |= os.ModeDir + } + if m == c_ISFIFO { + // named pipe (FIFO) + mode |= os.ModeNamedPipe + } + if m == c_ISLNK { + // symbolic link + mode |= os.ModeSymlink + } + if m == c_ISBLK { + // device file + mode |= os.ModeDevice + } + if m == c_ISCHR { + // Unix character device + mode |= os.ModeDevice + mode |= os.ModeCharDevice + } + if m == c_ISSOCK { + // Unix domain socket + mode |= os.ModeSocket + } + + switch fi.h.Typeflag { + case TypeSymlink: + // symbolic link + mode |= os.ModeSymlink + case TypeChar: + // character device node + mode |= os.ModeDevice + mode |= os.ModeCharDevice + case TypeBlock: + // block device node + mode |= os.ModeDevice + case TypeDir: + // directory + mode |= os.ModeDir + case TypeFifo: + // fifo node + mode |= os.ModeNamedPipe + } + + return mode +} + +// sysStat, if non-nil, populates h from system-dependent fields of fi. +var sysStat func(fi os.FileInfo, h *Header) error + +// Mode constants from the tar spec. +const ( + c_ISUID = 04000 // Set uid + c_ISGID = 02000 // Set gid + c_ISVTX = 01000 // Save text (sticky bit) + c_ISDIR = 040000 // Directory + c_ISFIFO = 010000 // FIFO + c_ISREG = 0100000 // Regular file + c_ISLNK = 0120000 // Symbolic link + c_ISBLK = 060000 // Block special file + c_ISCHR = 020000 // Character special file + c_ISSOCK = 0140000 // Socket +) + +// Keywords for the PAX Extended Header +const ( + paxAtime = "atime" + paxCharset = "charset" + paxComment = "comment" + paxCtime = "ctime" // please note that ctime is not a valid pax header. + paxGid = "gid" + paxGname = "gname" + paxLinkpath = "linkpath" + paxMtime = "mtime" + paxPath = "path" + paxSize = "size" + paxUid = "uid" + paxUname = "uname" + paxXattr = "SCHILY.xattr." + paxWindows = "MSWINDOWS." + paxNone = "" +) + +// FileInfoHeader creates a partially-populated Header from fi. +// If fi describes a symlink, FileInfoHeader records link as the link target. +// If fi describes a directory, a slash is appended to the name. +// Because os.FileInfo's Name method returns only the base name of +// the file it describes, it may be necessary to modify the Name field +// of the returned header to provide the full path name of the file. +func FileInfoHeader(fi os.FileInfo, link string) (*Header, error) { + if fi == nil { + return nil, errors.New("tar: FileInfo is nil") + } + fm := fi.Mode() + h := &Header{ + Name: fi.Name(), + ModTime: fi.ModTime(), + Mode: int64(fm.Perm()), // or'd with c_IS* constants later + } + switch { + case fm.IsRegular(): + h.Mode |= c_ISREG + h.Typeflag = TypeReg + h.Size = fi.Size() + case fi.IsDir(): + h.Typeflag = TypeDir + h.Mode |= c_ISDIR + h.Name += "/" + case fm&os.ModeSymlink != 0: + h.Typeflag = TypeSymlink + h.Mode |= c_ISLNK + h.Linkname = link + case fm&os.ModeDevice != 0: + if fm&os.ModeCharDevice != 0 { + h.Mode |= c_ISCHR + h.Typeflag = TypeChar + } else { + h.Mode |= c_ISBLK + h.Typeflag = TypeBlock + } + case fm&os.ModeNamedPipe != 0: + h.Typeflag = TypeFifo + h.Mode |= c_ISFIFO + case fm&os.ModeSocket != 0: + h.Mode |= c_ISSOCK + default: + return nil, fmt.Errorf("archive/tar: unknown file mode %v", fm) + } + if fm&os.ModeSetuid != 0 { + h.Mode |= c_ISUID + } + if fm&os.ModeSetgid != 0 { + h.Mode |= c_ISGID + } + if fm&os.ModeSticky != 0 { + h.Mode |= c_ISVTX + } + // If possible, populate additional fields from OS-specific + // FileInfo fields. + if sys, ok := fi.Sys().(*Header); ok { + // This FileInfo came from a Header (not the OS). Use the + // original Header to populate all remaining fields. + h.Uid = sys.Uid + h.Gid = sys.Gid + h.Uname = sys.Uname + h.Gname = sys.Gname + h.AccessTime = sys.AccessTime + h.ChangeTime = sys.ChangeTime + if sys.Xattrs != nil { + h.Xattrs = make(map[string]string) + for k, v := range sys.Xattrs { + h.Xattrs[k] = v + } + } + if sys.Typeflag == TypeLink { + // hard link + h.Typeflag = TypeLink + h.Size = 0 + h.Linkname = sys.Linkname + } + } + if sysStat != nil { + return h, sysStat(fi, h) + } + return h, nil +} + +var zeroBlock = make([]byte, blockSize) + +// POSIX specifies a sum of the unsigned byte values, but the Sun tar uses signed byte values. +// We compute and return both. +func checksum(header []byte) (unsigned int64, signed int64) { + for i := 0; i < len(header); i++ { + if i == 148 { + // The chksum field (header[148:156]) is special: it should be treated as space bytes. + unsigned += ' ' * 8 + signed += ' ' * 8 + i += 7 + continue + } + unsigned += int64(header[i]) + signed += int64(int8(header[i])) + } + return +} + +type slicer []byte + +func (sp *slicer) next(n int) (b []byte) { + s := *sp + b, *sp = s[0:n], s[n:] + return +} + +func isASCII(s string) bool { + for _, c := range s { + if c >= 0x80 { + return false + } + } + return true +} + +func toASCII(s string) string { + if isASCII(s) { + return s + } + var buf bytes.Buffer + for _, c := range s { + if c < 0x80 { + buf.WriteByte(byte(c)) + } + } + return buf.String() +} + +// isHeaderOnlyType checks if the given type flag is of the type that has no +// data section even if a size is specified. +func isHeaderOnlyType(flag byte) bool { + switch flag { + case TypeLink, TypeSymlink, TypeChar, TypeBlock, TypeDir, TypeFifo: + return true + default: + return false + } +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/reader.go b/vendor/github.com/Microsoft/go-winio/archive/tar/reader.go new file mode 100644 index 00000000..6aee36c1 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/reader.go @@ -0,0 +1,996 @@ +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package tar + +// TODO(dsymonds): +// - pax extensions + +import ( + "bytes" + "errors" + "io" + "io/ioutil" + "math" + "os" + "strconv" + "strings" + "time" +) + +var ( + ErrHeader = errors.New("archive/tar: invalid tar header") +) + +const maxNanoSecondIntSize = 9 + +// A Reader provides sequential access to the contents of a tar archive. +// A tar archive consists of a sequence of files. +// The Next method advances to the next file in the archive (including the first), +// and then it can be treated as an io.Reader to access the file's data. +type Reader struct { + r io.Reader + err error + pad int64 // amount of padding (ignored) after current file entry + curr numBytesReader // reader for current file entry + hdrBuff [blockSize]byte // buffer to use in readHeader +} + +type parser struct { + err error // Last error seen +} + +// A numBytesReader is an io.Reader with a numBytes method, returning the number +// of bytes remaining in the underlying encoded data. +type numBytesReader interface { + io.Reader + numBytes() int64 +} + +// A regFileReader is a numBytesReader for reading file data from a tar archive. +type regFileReader struct { + r io.Reader // underlying reader + nb int64 // number of unread bytes for current file entry +} + +// A sparseFileReader is a numBytesReader for reading sparse file data from a +// tar archive. +type sparseFileReader struct { + rfr numBytesReader // Reads the sparse-encoded file data + sp []sparseEntry // The sparse map for the file + pos int64 // Keeps track of file position + total int64 // Total size of the file +} + +// A sparseEntry holds a single entry in a sparse file's sparse map. +// +// Sparse files are represented using a series of sparseEntrys. +// Despite the name, a sparseEntry represents an actual data fragment that +// references data found in the underlying archive stream. All regions not +// covered by a sparseEntry are logically filled with zeros. +// +// For example, if the underlying raw file contains the 10-byte data: +// var compactData = "abcdefgh" +// +// And the sparse map has the following entries: +// var sp = []sparseEntry{ +// {offset: 2, numBytes: 5} // Data fragment for [2..7] +// {offset: 18, numBytes: 3} // Data fragment for [18..21] +// } +// +// Then the content of the resulting sparse file with a "real" size of 25 is: +// var sparseData = "\x00"*2 + "abcde" + "\x00"*11 + "fgh" + "\x00"*4 +type sparseEntry struct { + offset int64 // Starting position of the fragment + numBytes int64 // Length of the fragment +} + +// Keywords for GNU sparse files in a PAX extended header +const ( + paxGNUSparseNumBlocks = "GNU.sparse.numblocks" + paxGNUSparseOffset = "GNU.sparse.offset" + paxGNUSparseNumBytes = "GNU.sparse.numbytes" + paxGNUSparseMap = "GNU.sparse.map" + paxGNUSparseName = "GNU.sparse.name" + paxGNUSparseMajor = "GNU.sparse.major" + paxGNUSparseMinor = "GNU.sparse.minor" + paxGNUSparseSize = "GNU.sparse.size" + paxGNUSparseRealSize = "GNU.sparse.realsize" +) + +// Keywords for old GNU sparse headers +const ( + oldGNUSparseMainHeaderOffset = 386 + oldGNUSparseMainHeaderIsExtendedOffset = 482 + oldGNUSparseMainHeaderNumEntries = 4 + oldGNUSparseExtendedHeaderIsExtendedOffset = 504 + oldGNUSparseExtendedHeaderNumEntries = 21 + oldGNUSparseOffsetSize = 12 + oldGNUSparseNumBytesSize = 12 +) + +// NewReader creates a new Reader reading from r. +func NewReader(r io.Reader) *Reader { return &Reader{r: r} } + +// Next advances to the next entry in the tar archive. +// +// io.EOF is returned at the end of the input. +func (tr *Reader) Next() (*Header, error) { + if tr.err != nil { + return nil, tr.err + } + + var hdr *Header + var extHdrs map[string]string + + // Externally, Next iterates through the tar archive as if it is a series of + // files. Internally, the tar format often uses fake "files" to add meta + // data that describes the next file. These meta data "files" should not + // normally be visible to the outside. As such, this loop iterates through + // one or more "header files" until it finds a "normal file". +loop: + for { + tr.err = tr.skipUnread() + if tr.err != nil { + return nil, tr.err + } + + hdr = tr.readHeader() + if tr.err != nil { + return nil, tr.err + } + + // Check for PAX/GNU special headers and files. + switch hdr.Typeflag { + case TypeXHeader: + extHdrs, tr.err = parsePAX(tr) + if tr.err != nil { + return nil, tr.err + } + continue loop // This is a meta header affecting the next header + case TypeGNULongName, TypeGNULongLink: + var realname []byte + realname, tr.err = ioutil.ReadAll(tr) + if tr.err != nil { + return nil, tr.err + } + + // Convert GNU extensions to use PAX headers. + if extHdrs == nil { + extHdrs = make(map[string]string) + } + var p parser + switch hdr.Typeflag { + case TypeGNULongName: + extHdrs[paxPath] = p.parseString(realname) + case TypeGNULongLink: + extHdrs[paxLinkpath] = p.parseString(realname) + } + if p.err != nil { + tr.err = p.err + return nil, tr.err + } + continue loop // This is a meta header affecting the next header + default: + mergePAX(hdr, extHdrs) + + // Check for a PAX format sparse file + sp, err := tr.checkForGNUSparsePAXHeaders(hdr, extHdrs) + if err != nil { + tr.err = err + return nil, err + } + if sp != nil { + // Current file is a PAX format GNU sparse file. + // Set the current file reader to a sparse file reader. + tr.curr, tr.err = newSparseFileReader(tr.curr, sp, hdr.Size) + if tr.err != nil { + return nil, tr.err + } + } + break loop // This is a file, so stop + } + } + return hdr, nil +} + +// checkForGNUSparsePAXHeaders checks the PAX headers for GNU sparse headers. If they are found, then +// this function reads the sparse map and returns it. Unknown sparse formats are ignored, causing the file to +// be treated as a regular file. +func (tr *Reader) checkForGNUSparsePAXHeaders(hdr *Header, headers map[string]string) ([]sparseEntry, error) { + var sparseFormat string + + // Check for sparse format indicators + major, majorOk := headers[paxGNUSparseMajor] + minor, minorOk := headers[paxGNUSparseMinor] + sparseName, sparseNameOk := headers[paxGNUSparseName] + _, sparseMapOk := headers[paxGNUSparseMap] + sparseSize, sparseSizeOk := headers[paxGNUSparseSize] + sparseRealSize, sparseRealSizeOk := headers[paxGNUSparseRealSize] + + // Identify which, if any, sparse format applies from which PAX headers are set + if majorOk && minorOk { + sparseFormat = major + "." + minor + } else if sparseNameOk && sparseMapOk { + sparseFormat = "0.1" + } else if sparseSizeOk { + sparseFormat = "0.0" + } else { + // Not a PAX format GNU sparse file. + return nil, nil + } + + // Check for unknown sparse format + if sparseFormat != "0.0" && sparseFormat != "0.1" && sparseFormat != "1.0" { + return nil, nil + } + + // Update hdr from GNU sparse PAX headers + if sparseNameOk { + hdr.Name = sparseName + } + if sparseSizeOk { + realSize, err := strconv.ParseInt(sparseSize, 10, 0) + if err != nil { + return nil, ErrHeader + } + hdr.Size = realSize + } else if sparseRealSizeOk { + realSize, err := strconv.ParseInt(sparseRealSize, 10, 0) + if err != nil { + return nil, ErrHeader + } + hdr.Size = realSize + } + + // Set up the sparse map, according to the particular sparse format in use + var sp []sparseEntry + var err error + switch sparseFormat { + case "0.0", "0.1": + sp, err = readGNUSparseMap0x1(headers) + case "1.0": + sp, err = readGNUSparseMap1x0(tr.curr) + } + return sp, err +} + +// mergePAX merges well known headers according to PAX standard. +// In general headers with the same name as those found +// in the header struct overwrite those found in the header +// struct with higher precision or longer values. Esp. useful +// for name and linkname fields. +func mergePAX(hdr *Header, headers map[string]string) error { + for k, v := range headers { + switch k { + case paxPath: + hdr.Name = v + case paxLinkpath: + hdr.Linkname = v + case paxGname: + hdr.Gname = v + case paxUname: + hdr.Uname = v + case paxUid: + uid, err := strconv.ParseInt(v, 10, 0) + if err != nil { + return err + } + hdr.Uid = int(uid) + case paxGid: + gid, err := strconv.ParseInt(v, 10, 0) + if err != nil { + return err + } + hdr.Gid = int(gid) + case paxAtime: + t, err := parsePAXTime(v) + if err != nil { + return err + } + hdr.AccessTime = t + case paxMtime: + t, err := parsePAXTime(v) + if err != nil { + return err + } + hdr.ModTime = t + case paxCtime: + t, err := parsePAXTime(v) + if err != nil { + return err + } + hdr.ChangeTime = t + case paxSize: + size, err := strconv.ParseInt(v, 10, 0) + if err != nil { + return err + } + hdr.Size = int64(size) + default: + if strings.HasPrefix(k, paxXattr) { + if hdr.Xattrs == nil { + hdr.Xattrs = make(map[string]string) + } + hdr.Xattrs[k[len(paxXattr):]] = v + } else if strings.HasPrefix(k, paxWindows) { + if hdr.Winheaders == nil { + hdr.Winheaders = make(map[string]string) + } + hdr.Winheaders[k[len(paxWindows):]] = v + } + } + } + return nil +} + +// parsePAXTime takes a string of the form %d.%d as described in +// the PAX specification. +func parsePAXTime(t string) (time.Time, error) { + buf := []byte(t) + pos := bytes.IndexByte(buf, '.') + var seconds, nanoseconds int64 + var err error + if pos == -1 { + seconds, err = strconv.ParseInt(t, 10, 0) + if err != nil { + return time.Time{}, err + } + } else { + seconds, err = strconv.ParseInt(string(buf[:pos]), 10, 0) + if err != nil { + return time.Time{}, err + } + nano_buf := string(buf[pos+1:]) + // Pad as needed before converting to a decimal. + // For example .030 -> .030000000 -> 30000000 nanoseconds + if len(nano_buf) < maxNanoSecondIntSize { + // Right pad + nano_buf += strings.Repeat("0", maxNanoSecondIntSize-len(nano_buf)) + } else if len(nano_buf) > maxNanoSecondIntSize { + // Right truncate + nano_buf = nano_buf[:maxNanoSecondIntSize] + } + nanoseconds, err = strconv.ParseInt(string(nano_buf), 10, 0) + if err != nil { + return time.Time{}, err + } + } + ts := time.Unix(seconds, nanoseconds) + return ts, nil +} + +// parsePAX parses PAX headers. +// If an extended header (type 'x') is invalid, ErrHeader is returned +func parsePAX(r io.Reader) (map[string]string, error) { + buf, err := ioutil.ReadAll(r) + if err != nil { + return nil, err + } + sbuf := string(buf) + + // For GNU PAX sparse format 0.0 support. + // This function transforms the sparse format 0.0 headers into sparse format 0.1 headers. + var sparseMap bytes.Buffer + + headers := make(map[string]string) + // Each record is constructed as + // "%d %s=%s\n", length, keyword, value + for len(sbuf) > 0 { + key, value, residual, err := parsePAXRecord(sbuf) + if err != nil { + return nil, ErrHeader + } + sbuf = residual + + keyStr := string(key) + if keyStr == paxGNUSparseOffset || keyStr == paxGNUSparseNumBytes { + // GNU sparse format 0.0 special key. Write to sparseMap instead of using the headers map. + sparseMap.WriteString(value) + sparseMap.Write([]byte{','}) + } else { + // Normal key. Set the value in the headers map. + headers[keyStr] = string(value) + } + } + if sparseMap.Len() != 0 { + // Add sparse info to headers, chopping off the extra comma + sparseMap.Truncate(sparseMap.Len() - 1) + headers[paxGNUSparseMap] = sparseMap.String() + } + return headers, nil +} + +// parsePAXRecord parses the input PAX record string into a key-value pair. +// If parsing is successful, it will slice off the currently read record and +// return the remainder as r. +// +// A PAX record is of the following form: +// "%d %s=%s\n" % (size, key, value) +func parsePAXRecord(s string) (k, v, r string, err error) { + // The size field ends at the first space. + sp := strings.IndexByte(s, ' ') + if sp == -1 { + return "", "", s, ErrHeader + } + + // Parse the first token as a decimal integer. + n, perr := strconv.ParseInt(s[:sp], 10, 0) // Intentionally parse as native int + if perr != nil || n < 5 || int64(len(s)) < n { + return "", "", s, ErrHeader + } + + // Extract everything between the space and the final newline. + rec, nl, rem := s[sp+1:n-1], s[n-1:n], s[n:] + if nl != "\n" { + return "", "", s, ErrHeader + } + + // The first equals separates the key from the value. + eq := strings.IndexByte(rec, '=') + if eq == -1 { + return "", "", s, ErrHeader + } + return rec[:eq], rec[eq+1:], rem, nil +} + +// parseString parses bytes as a NUL-terminated C-style string. +// If a NUL byte is not found then the whole slice is returned as a string. +func (*parser) parseString(b []byte) string { + n := 0 + for n < len(b) && b[n] != 0 { + n++ + } + return string(b[0:n]) +} + +// parseNumeric parses the input as being encoded in either base-256 or octal. +// This function may return negative numbers. +// If parsing fails or an integer overflow occurs, err will be set. +func (p *parser) parseNumeric(b []byte) int64 { + // Check for base-256 (binary) format first. + // If the first bit is set, then all following bits constitute a two's + // complement encoded number in big-endian byte order. + if len(b) > 0 && b[0]&0x80 != 0 { + // Handling negative numbers relies on the following identity: + // -a-1 == ^a + // + // If the number is negative, we use an inversion mask to invert the + // data bytes and treat the value as an unsigned number. + var inv byte // 0x00 if positive or zero, 0xff if negative + if b[0]&0x40 != 0 { + inv = 0xff + } + + var x uint64 + for i, c := range b { + c ^= inv // Inverts c only if inv is 0xff, otherwise does nothing + if i == 0 { + c &= 0x7f // Ignore signal bit in first byte + } + if (x >> 56) > 0 { + p.err = ErrHeader // Integer overflow + return 0 + } + x = x<<8 | uint64(c) + } + if (x >> 63) > 0 { + p.err = ErrHeader // Integer overflow + return 0 + } + if inv == 0xff { + return ^int64(x) + } + return int64(x) + } + + // Normal case is base-8 (octal) format. + return p.parseOctal(b) +} + +func (p *parser) parseOctal(b []byte) int64 { + // Because unused fields are filled with NULs, we need + // to skip leading NULs. Fields may also be padded with + // spaces or NULs. + // So we remove leading and trailing NULs and spaces to + // be sure. + b = bytes.Trim(b, " \x00") + + if len(b) == 0 { + return 0 + } + x, perr := strconv.ParseUint(p.parseString(b), 8, 64) + if perr != nil { + p.err = ErrHeader + } + return int64(x) +} + +// skipUnread skips any unread bytes in the existing file entry, as well as any +// alignment padding. It returns io.ErrUnexpectedEOF if any io.EOF is +// encountered in the data portion; it is okay to hit io.EOF in the padding. +// +// Note that this function still works properly even when sparse files are being +// used since numBytes returns the bytes remaining in the underlying io.Reader. +func (tr *Reader) skipUnread() error { + dataSkip := tr.numBytes() // Number of data bytes to skip + totalSkip := dataSkip + tr.pad // Total number of bytes to skip + tr.curr, tr.pad = nil, 0 + + // If possible, Seek to the last byte before the end of the data section. + // Do this because Seek is often lazy about reporting errors; this will mask + // the fact that the tar stream may be truncated. We can rely on the + // io.CopyN done shortly afterwards to trigger any IO errors. + var seekSkipped int64 // Number of bytes skipped via Seek + if sr, ok := tr.r.(io.Seeker); ok && dataSkip > 1 { + // Not all io.Seeker can actually Seek. For example, os.Stdin implements + // io.Seeker, but calling Seek always returns an error and performs + // no action. Thus, we try an innocent seek to the current position + // to see if Seek is really supported. + pos1, err := sr.Seek(0, os.SEEK_CUR) + if err == nil { + // Seek seems supported, so perform the real Seek. + pos2, err := sr.Seek(dataSkip-1, os.SEEK_CUR) + if err != nil { + tr.err = err + return tr.err + } + seekSkipped = pos2 - pos1 + } + } + + var copySkipped int64 // Number of bytes skipped via CopyN + copySkipped, tr.err = io.CopyN(ioutil.Discard, tr.r, totalSkip-seekSkipped) + if tr.err == io.EOF && seekSkipped+copySkipped < dataSkip { + tr.err = io.ErrUnexpectedEOF + } + return tr.err +} + +func (tr *Reader) verifyChecksum(header []byte) bool { + if tr.err != nil { + return false + } + + var p parser + given := p.parseOctal(header[148:156]) + unsigned, signed := checksum(header) + return p.err == nil && (given == unsigned || given == signed) +} + +// readHeader reads the next block header and assumes that the underlying reader +// is already aligned to a block boundary. +// +// The err will be set to io.EOF only when one of the following occurs: +// * Exactly 0 bytes are read and EOF is hit. +// * Exactly 1 block of zeros is read and EOF is hit. +// * At least 2 blocks of zeros are read. +func (tr *Reader) readHeader() *Header { + header := tr.hdrBuff[:] + copy(header, zeroBlock) + + if _, tr.err = io.ReadFull(tr.r, header); tr.err != nil { + return nil // io.EOF is okay here + } + + // Two blocks of zero bytes marks the end of the archive. + if bytes.Equal(header, zeroBlock[0:blockSize]) { + if _, tr.err = io.ReadFull(tr.r, header); tr.err != nil { + return nil // io.EOF is okay here + } + if bytes.Equal(header, zeroBlock[0:blockSize]) { + tr.err = io.EOF + } else { + tr.err = ErrHeader // zero block and then non-zero block + } + return nil + } + + if !tr.verifyChecksum(header) { + tr.err = ErrHeader + return nil + } + + // Unpack + var p parser + hdr := new(Header) + s := slicer(header) + + hdr.Name = p.parseString(s.next(100)) + hdr.Mode = p.parseNumeric(s.next(8)) + hdr.Uid = int(p.parseNumeric(s.next(8))) + hdr.Gid = int(p.parseNumeric(s.next(8))) + hdr.Size = p.parseNumeric(s.next(12)) + hdr.ModTime = time.Unix(p.parseNumeric(s.next(12)), 0) + s.next(8) // chksum + hdr.Typeflag = s.next(1)[0] + hdr.Linkname = p.parseString(s.next(100)) + + // The remainder of the header depends on the value of magic. + // The original (v7) version of tar had no explicit magic field, + // so its magic bytes, like the rest of the block, are NULs. + magic := string(s.next(8)) // contains version field as well. + var format string + switch { + case magic[:6] == "ustar\x00": // POSIX tar (1003.1-1988) + if string(header[508:512]) == "tar\x00" { + format = "star" + } else { + format = "posix" + } + case magic == "ustar \x00": // old GNU tar + format = "gnu" + } + + switch format { + case "posix", "gnu", "star": + hdr.Uname = p.parseString(s.next(32)) + hdr.Gname = p.parseString(s.next(32)) + devmajor := s.next(8) + devminor := s.next(8) + if hdr.Typeflag == TypeChar || hdr.Typeflag == TypeBlock { + hdr.Devmajor = p.parseNumeric(devmajor) + hdr.Devminor = p.parseNumeric(devminor) + } + var prefix string + switch format { + case "posix", "gnu": + prefix = p.parseString(s.next(155)) + case "star": + prefix = p.parseString(s.next(131)) + hdr.AccessTime = time.Unix(p.parseNumeric(s.next(12)), 0) + hdr.ChangeTime = time.Unix(p.parseNumeric(s.next(12)), 0) + } + if len(prefix) > 0 { + hdr.Name = prefix + "/" + hdr.Name + } + } + + if p.err != nil { + tr.err = p.err + return nil + } + + nb := hdr.Size + if isHeaderOnlyType(hdr.Typeflag) { + nb = 0 + } + if nb < 0 { + tr.err = ErrHeader + return nil + } + + // Set the current file reader. + tr.pad = -nb & (blockSize - 1) // blockSize is a power of two + tr.curr = ®FileReader{r: tr.r, nb: nb} + + // Check for old GNU sparse format entry. + if hdr.Typeflag == TypeGNUSparse { + // Get the real size of the file. + hdr.Size = p.parseNumeric(header[483:495]) + if p.err != nil { + tr.err = p.err + return nil + } + + // Read the sparse map. + sp := tr.readOldGNUSparseMap(header) + if tr.err != nil { + return nil + } + + // Current file is a GNU sparse file. Update the current file reader. + tr.curr, tr.err = newSparseFileReader(tr.curr, sp, hdr.Size) + if tr.err != nil { + return nil + } + } + + return hdr +} + +// readOldGNUSparseMap reads the sparse map as stored in the old GNU sparse format. +// The sparse map is stored in the tar header if it's small enough. If it's larger than four entries, +// then one or more extension headers are used to store the rest of the sparse map. +func (tr *Reader) readOldGNUSparseMap(header []byte) []sparseEntry { + var p parser + isExtended := header[oldGNUSparseMainHeaderIsExtendedOffset] != 0 + spCap := oldGNUSparseMainHeaderNumEntries + if isExtended { + spCap += oldGNUSparseExtendedHeaderNumEntries + } + sp := make([]sparseEntry, 0, spCap) + s := slicer(header[oldGNUSparseMainHeaderOffset:]) + + // Read the four entries from the main tar header + for i := 0; i < oldGNUSparseMainHeaderNumEntries; i++ { + offset := p.parseNumeric(s.next(oldGNUSparseOffsetSize)) + numBytes := p.parseNumeric(s.next(oldGNUSparseNumBytesSize)) + if p.err != nil { + tr.err = p.err + return nil + } + if offset == 0 && numBytes == 0 { + break + } + sp = append(sp, sparseEntry{offset: offset, numBytes: numBytes}) + } + + for isExtended { + // There are more entries. Read an extension header and parse its entries. + sparseHeader := make([]byte, blockSize) + if _, tr.err = io.ReadFull(tr.r, sparseHeader); tr.err != nil { + return nil + } + isExtended = sparseHeader[oldGNUSparseExtendedHeaderIsExtendedOffset] != 0 + s = slicer(sparseHeader) + for i := 0; i < oldGNUSparseExtendedHeaderNumEntries; i++ { + offset := p.parseNumeric(s.next(oldGNUSparseOffsetSize)) + numBytes := p.parseNumeric(s.next(oldGNUSparseNumBytesSize)) + if p.err != nil { + tr.err = p.err + return nil + } + if offset == 0 && numBytes == 0 { + break + } + sp = append(sp, sparseEntry{offset: offset, numBytes: numBytes}) + } + } + return sp +} + +// readGNUSparseMap1x0 reads the sparse map as stored in GNU's PAX sparse format +// version 1.0. The format of the sparse map consists of a series of +// newline-terminated numeric fields. The first field is the number of entries +// and is always present. Following this are the entries, consisting of two +// fields (offset, numBytes). This function must stop reading at the end +// boundary of the block containing the last newline. +// +// Note that the GNU manual says that numeric values should be encoded in octal +// format. However, the GNU tar utility itself outputs these values in decimal. +// As such, this library treats values as being encoded in decimal. +func readGNUSparseMap1x0(r io.Reader) ([]sparseEntry, error) { + var cntNewline int64 + var buf bytes.Buffer + var blk = make([]byte, blockSize) + + // feedTokens copies data in numBlock chunks from r into buf until there are + // at least cnt newlines in buf. It will not read more blocks than needed. + var feedTokens = func(cnt int64) error { + for cntNewline < cnt { + if _, err := io.ReadFull(r, blk); err != nil { + if err == io.EOF { + err = io.ErrUnexpectedEOF + } + return err + } + buf.Write(blk) + for _, c := range blk { + if c == '\n' { + cntNewline++ + } + } + } + return nil + } + + // nextToken gets the next token delimited by a newline. This assumes that + // at least one newline exists in the buffer. + var nextToken = func() string { + cntNewline-- + tok, _ := buf.ReadString('\n') + return tok[:len(tok)-1] // Cut off newline + } + + // Parse for the number of entries. + // Use integer overflow resistant math to check this. + if err := feedTokens(1); err != nil { + return nil, err + } + numEntries, err := strconv.ParseInt(nextToken(), 10, 0) // Intentionally parse as native int + if err != nil || numEntries < 0 || int(2*numEntries) < int(numEntries) { + return nil, ErrHeader + } + + // Parse for all member entries. + // numEntries is trusted after this since a potential attacker must have + // committed resources proportional to what this library used. + if err := feedTokens(2 * numEntries); err != nil { + return nil, err + } + sp := make([]sparseEntry, 0, numEntries) + for i := int64(0); i < numEntries; i++ { + offset, err := strconv.ParseInt(nextToken(), 10, 64) + if err != nil { + return nil, ErrHeader + } + numBytes, err := strconv.ParseInt(nextToken(), 10, 64) + if err != nil { + return nil, ErrHeader + } + sp = append(sp, sparseEntry{offset: offset, numBytes: numBytes}) + } + return sp, nil +} + +// readGNUSparseMap0x1 reads the sparse map as stored in GNU's PAX sparse format +// version 0.1. The sparse map is stored in the PAX headers. +func readGNUSparseMap0x1(extHdrs map[string]string) ([]sparseEntry, error) { + // Get number of entries. + // Use integer overflow resistant math to check this. + numEntriesStr := extHdrs[paxGNUSparseNumBlocks] + numEntries, err := strconv.ParseInt(numEntriesStr, 10, 0) // Intentionally parse as native int + if err != nil || numEntries < 0 || int(2*numEntries) < int(numEntries) { + return nil, ErrHeader + } + + // There should be two numbers in sparseMap for each entry. + sparseMap := strings.Split(extHdrs[paxGNUSparseMap], ",") + if int64(len(sparseMap)) != 2*numEntries { + return nil, ErrHeader + } + + // Loop through the entries in the sparse map. + // numEntries is trusted now. + sp := make([]sparseEntry, 0, numEntries) + for i := int64(0); i < numEntries; i++ { + offset, err := strconv.ParseInt(sparseMap[2*i], 10, 64) + if err != nil { + return nil, ErrHeader + } + numBytes, err := strconv.ParseInt(sparseMap[2*i+1], 10, 64) + if err != nil { + return nil, ErrHeader + } + sp = append(sp, sparseEntry{offset: offset, numBytes: numBytes}) + } + return sp, nil +} + +// numBytes returns the number of bytes left to read in the current file's entry +// in the tar archive, or 0 if there is no current file. +func (tr *Reader) numBytes() int64 { + if tr.curr == nil { + // No current file, so no bytes + return 0 + } + return tr.curr.numBytes() +} + +// Read reads from the current entry in the tar archive. +// It returns 0, io.EOF when it reaches the end of that entry, +// until Next is called to advance to the next entry. +// +// Calling Read on special types like TypeLink, TypeSymLink, TypeChar, +// TypeBlock, TypeDir, and TypeFifo returns 0, io.EOF regardless of what +// the Header.Size claims. +func (tr *Reader) Read(b []byte) (n int, err error) { + if tr.err != nil { + return 0, tr.err + } + if tr.curr == nil { + return 0, io.EOF + } + + n, err = tr.curr.Read(b) + if err != nil && err != io.EOF { + tr.err = err + } + return +} + +func (rfr *regFileReader) Read(b []byte) (n int, err error) { + if rfr.nb == 0 { + // file consumed + return 0, io.EOF + } + if int64(len(b)) > rfr.nb { + b = b[0:rfr.nb] + } + n, err = rfr.r.Read(b) + rfr.nb -= int64(n) + + if err == io.EOF && rfr.nb > 0 { + err = io.ErrUnexpectedEOF + } + return +} + +// numBytes returns the number of bytes left to read in the file's data in the tar archive. +func (rfr *regFileReader) numBytes() int64 { + return rfr.nb +} + +// newSparseFileReader creates a new sparseFileReader, but validates all of the +// sparse entries before doing so. +func newSparseFileReader(rfr numBytesReader, sp []sparseEntry, total int64) (*sparseFileReader, error) { + if total < 0 { + return nil, ErrHeader // Total size cannot be negative + } + + // Validate all sparse entries. These are the same checks as performed by + // the BSD tar utility. + for i, s := range sp { + switch { + case s.offset < 0 || s.numBytes < 0: + return nil, ErrHeader // Negative values are never okay + case s.offset > math.MaxInt64-s.numBytes: + return nil, ErrHeader // Integer overflow with large length + case s.offset+s.numBytes > total: + return nil, ErrHeader // Region extends beyond the "real" size + case i > 0 && sp[i-1].offset+sp[i-1].numBytes > s.offset: + return nil, ErrHeader // Regions can't overlap and must be in order + } + } + return &sparseFileReader{rfr: rfr, sp: sp, total: total}, nil +} + +// readHole reads a sparse hole ending at endOffset. +func (sfr *sparseFileReader) readHole(b []byte, endOffset int64) int { + n64 := endOffset - sfr.pos + if n64 > int64(len(b)) { + n64 = int64(len(b)) + } + n := int(n64) + for i := 0; i < n; i++ { + b[i] = 0 + } + sfr.pos += n64 + return n +} + +// Read reads the sparse file data in expanded form. +func (sfr *sparseFileReader) Read(b []byte) (n int, err error) { + // Skip past all empty fragments. + for len(sfr.sp) > 0 && sfr.sp[0].numBytes == 0 { + sfr.sp = sfr.sp[1:] + } + + // If there are no more fragments, then it is possible that there + // is one last sparse hole. + if len(sfr.sp) == 0 { + // This behavior matches the BSD tar utility. + // However, GNU tar stops returning data even if sfr.total is unmet. + if sfr.pos < sfr.total { + return sfr.readHole(b, sfr.total), nil + } + return 0, io.EOF + } + + // In front of a data fragment, so read a hole. + if sfr.pos < sfr.sp[0].offset { + return sfr.readHole(b, sfr.sp[0].offset), nil + } + + // In a data fragment, so read from it. + // This math is overflow free since we verify that offset and numBytes can + // be safely added when creating the sparseFileReader. + endPos := sfr.sp[0].offset + sfr.sp[0].numBytes // End offset of fragment + bytesLeft := endPos - sfr.pos // Bytes left in fragment + if int64(len(b)) > bytesLeft { + b = b[:bytesLeft] + } + + n, err = sfr.rfr.Read(b) + sfr.pos += int64(n) + if err == io.EOF { + if sfr.pos < endPos { + err = io.ErrUnexpectedEOF // There was supposed to be more data + } else if sfr.pos < sfr.total { + err = nil // There is still an implicit sparse hole at the end + } + } + + if sfr.pos == endPos { + sfr.sp = sfr.sp[1:] // We are done with this fragment, so pop it + } + return n, err +} + +// numBytes returns the number of bytes left to read in the sparse file's +// sparse-encoded data in the tar archive. +func (sfr *sparseFileReader) numBytes() int64 { + return sfr.rfr.numBytes() +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atim.go b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atim.go new file mode 100644 index 00000000..cf9cc79c --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atim.go @@ -0,0 +1,20 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build linux dragonfly openbsd solaris + +package tar + +import ( + "syscall" + "time" +) + +func statAtime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Atim.Unix()) +} + +func statCtime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Ctim.Unix()) +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atimespec.go b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atimespec.go new file mode 100644 index 00000000..6f17dbe3 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_atimespec.go @@ -0,0 +1,20 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build darwin freebsd netbsd + +package tar + +import ( + "syscall" + "time" +) + +func statAtime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Atimespec.Unix()) +} + +func statCtime(st *syscall.Stat_t) time.Time { + return time.Unix(st.Ctimespec.Unix()) +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go new file mode 100644 index 00000000..cb843db4 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/stat_unix.go @@ -0,0 +1,32 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build linux darwin dragonfly freebsd openbsd netbsd solaris + +package tar + +import ( + "os" + "syscall" +) + +func init() { + sysStat = statUnix +} + +func statUnix(fi os.FileInfo, h *Header) error { + sys, ok := fi.Sys().(*syscall.Stat_t) + if !ok { + return nil + } + h.Uid = int(sys.Uid) + h.Gid = int(sys.Gid) + // TODO(bradfitz): populate username & group. os/user + // doesn't cache LookupId lookups, and lacks group + // lookup functions. + h.AccessTime = statAtime(sys) + h.ChangeTime = statCtime(sys) + // TODO(bradfitz): major/minor device numbers? + return nil +} diff --git a/vendor/github.com/Microsoft/go-winio/archive/tar/writer.go b/vendor/github.com/Microsoft/go-winio/archive/tar/writer.go new file mode 100644 index 00000000..05027a35 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/archive/tar/writer.go @@ -0,0 +1,419 @@ +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package tar + +// TODO(dsymonds): +// - catch more errors (no first header, etc.) + +import ( + "bytes" + "errors" + "fmt" + "io" + "path" + "sort" + "strconv" + "strings" + "time" +) + +var ( + ErrWriteTooLong = errors.New("archive/tar: write too long") + ErrFieldTooLong = errors.New("archive/tar: header field too long") + ErrWriteAfterClose = errors.New("archive/tar: write after close") + errInvalidHeader = errors.New("archive/tar: header field too long or contains invalid values") +) + +// A Writer provides sequential writing of a tar archive in POSIX.1 format. +// A tar archive consists of a sequence of files. +// Call WriteHeader to begin a new file, and then call Write to supply that file's data, +// writing at most hdr.Size bytes in total. +type Writer struct { + w io.Writer + err error + nb int64 // number of unwritten bytes for current file entry + pad int64 // amount of padding to write after current file entry + closed bool + usedBinary bool // whether the binary numeric field extension was used + preferPax bool // use pax header instead of binary numeric header + hdrBuff [blockSize]byte // buffer to use in writeHeader when writing a regular header + paxHdrBuff [blockSize]byte // buffer to use in writeHeader when writing a pax header +} + +type formatter struct { + err error // Last error seen +} + +// NewWriter creates a new Writer writing to w. +func NewWriter(w io.Writer) *Writer { return &Writer{w: w} } + +// Flush finishes writing the current file (optional). +func (tw *Writer) Flush() error { + if tw.nb > 0 { + tw.err = fmt.Errorf("archive/tar: missed writing %d bytes", tw.nb) + return tw.err + } + + n := tw.nb + tw.pad + for n > 0 && tw.err == nil { + nr := n + if nr > blockSize { + nr = blockSize + } + var nw int + nw, tw.err = tw.w.Write(zeroBlock[0:nr]) + n -= int64(nw) + } + tw.nb = 0 + tw.pad = 0 + return tw.err +} + +// Write s into b, terminating it with a NUL if there is room. +func (f *formatter) formatString(b []byte, s string) { + if len(s) > len(b) { + f.err = ErrFieldTooLong + return + } + ascii := toASCII(s) + copy(b, ascii) + if len(ascii) < len(b) { + b[len(ascii)] = 0 + } +} + +// Encode x as an octal ASCII string and write it into b with leading zeros. +func (f *formatter) formatOctal(b []byte, x int64) { + s := strconv.FormatInt(x, 8) + // leading zeros, but leave room for a NUL. + for len(s)+1 < len(b) { + s = "0" + s + } + f.formatString(b, s) +} + +// fitsInBase256 reports whether x can be encoded into n bytes using base-256 +// encoding. Unlike octal encoding, base-256 encoding does not require that the +// string ends with a NUL character. Thus, all n bytes are available for output. +// +// If operating in binary mode, this assumes strict GNU binary mode; which means +// that the first byte can only be either 0x80 or 0xff. Thus, the first byte is +// equivalent to the sign bit in two's complement form. +func fitsInBase256(n int, x int64) bool { + var binBits = uint(n-1) * 8 + return n >= 9 || (x >= -1<= 0; i-- { + b[i] = byte(x) + x >>= 8 + } + b[0] |= 0x80 // Highest bit indicates binary format + return + } + + f.formatOctal(b, 0) // Last resort, just write zero + f.err = ErrFieldTooLong +} + +var ( + minTime = time.Unix(0, 0) + // There is room for 11 octal digits (33 bits) of mtime. + maxTime = minTime.Add((1<<33 - 1) * time.Second) +) + +// WriteHeader writes hdr and prepares to accept the file's contents. +// WriteHeader calls Flush if it is not the first header. +// Calling after a Close will return ErrWriteAfterClose. +func (tw *Writer) WriteHeader(hdr *Header) error { + return tw.writeHeader(hdr, true) +} + +// WriteHeader writes hdr and prepares to accept the file's contents. +// WriteHeader calls Flush if it is not the first header. +// Calling after a Close will return ErrWriteAfterClose. +// As this method is called internally by writePax header to allow it to +// suppress writing the pax header. +func (tw *Writer) writeHeader(hdr *Header, allowPax bool) error { + if tw.closed { + return ErrWriteAfterClose + } + if tw.err == nil { + tw.Flush() + } + if tw.err != nil { + return tw.err + } + + // a map to hold pax header records, if any are needed + paxHeaders := make(map[string]string) + + // TODO(shanemhansen): we might want to use PAX headers for + // subsecond time resolution, but for now let's just capture + // too long fields or non ascii characters + + var f formatter + var header []byte + + // We need to select which scratch buffer to use carefully, + // since this method is called recursively to write PAX headers. + // If allowPax is true, this is the non-recursive call, and we will use hdrBuff. + // If allowPax is false, we are being called by writePAXHeader, and hdrBuff is + // already being used by the non-recursive call, so we must use paxHdrBuff. + header = tw.hdrBuff[:] + if !allowPax { + header = tw.paxHdrBuff[:] + } + copy(header, zeroBlock) + s := slicer(header) + + // Wrappers around formatter that automatically sets paxHeaders if the + // argument extends beyond the capacity of the input byte slice. + var formatString = func(b []byte, s string, paxKeyword string) { + needsPaxHeader := paxKeyword != paxNone && len(s) > len(b) || !isASCII(s) + if needsPaxHeader { + paxHeaders[paxKeyword] = s + return + } + f.formatString(b, s) + } + var formatNumeric = func(b []byte, x int64, paxKeyword string) { + // Try octal first. + s := strconv.FormatInt(x, 8) + if len(s) < len(b) { + f.formatOctal(b, x) + return + } + + // If it is too long for octal, and PAX is preferred, use a PAX header. + if paxKeyword != paxNone && tw.preferPax { + f.formatOctal(b, 0) + s := strconv.FormatInt(x, 10) + paxHeaders[paxKeyword] = s + return + } + + tw.usedBinary = true + f.formatNumeric(b, x) + } + + // keep a reference to the filename to allow to overwrite it later if we detect that we can use ustar longnames instead of pax + pathHeaderBytes := s.next(fileNameSize) + + formatString(pathHeaderBytes, hdr.Name, paxPath) + + // Handle out of range ModTime carefully. + var modTime int64 + if !hdr.ModTime.Before(minTime) && !hdr.ModTime.After(maxTime) { + modTime = hdr.ModTime.Unix() + } + + f.formatOctal(s.next(8), hdr.Mode) // 100:108 + formatNumeric(s.next(8), int64(hdr.Uid), paxUid) // 108:116 + formatNumeric(s.next(8), int64(hdr.Gid), paxGid) // 116:124 + formatNumeric(s.next(12), hdr.Size, paxSize) // 124:136 + formatNumeric(s.next(12), modTime, paxNone) // 136:148 --- consider using pax for finer granularity + s.next(8) // chksum (148:156) + s.next(1)[0] = hdr.Typeflag // 156:157 + + formatString(s.next(100), hdr.Linkname, paxLinkpath) + + copy(s.next(8), []byte("ustar\x0000")) // 257:265 + formatString(s.next(32), hdr.Uname, paxUname) // 265:297 + formatString(s.next(32), hdr.Gname, paxGname) // 297:329 + formatNumeric(s.next(8), hdr.Devmajor, paxNone) // 329:337 + formatNumeric(s.next(8), hdr.Devminor, paxNone) // 337:345 + + // keep a reference to the prefix to allow to overwrite it later if we detect that we can use ustar longnames instead of pax + prefixHeaderBytes := s.next(155) + formatString(prefixHeaderBytes, "", paxNone) // 345:500 prefix + + // Use the GNU magic instead of POSIX magic if we used any GNU extensions. + if tw.usedBinary { + copy(header[257:265], []byte("ustar \x00")) + } + + _, paxPathUsed := paxHeaders[paxPath] + // try to use a ustar header when only the name is too long + if !tw.preferPax && len(paxHeaders) == 1 && paxPathUsed { + prefix, suffix, ok := splitUSTARPath(hdr.Name) + if ok { + // Since we can encode in USTAR format, disable PAX header. + delete(paxHeaders, paxPath) + + // Update the path fields + formatString(pathHeaderBytes, suffix, paxNone) + formatString(prefixHeaderBytes, prefix, paxNone) + } + } + + // The chksum field is terminated by a NUL and a space. + // This is different from the other octal fields. + chksum, _ := checksum(header) + f.formatOctal(header[148:155], chksum) // Never fails + header[155] = ' ' + + // Check if there were any formatting errors. + if f.err != nil { + tw.err = f.err + return tw.err + } + + if allowPax { + for k, v := range hdr.Xattrs { + paxHeaders[paxXattr+k] = v + } + for k, v := range hdr.Winheaders { + paxHeaders[paxWindows+k] = v + } + } + + if len(paxHeaders) > 0 { + if !allowPax { + return errInvalidHeader + } + if err := tw.writePAXHeader(hdr, paxHeaders); err != nil { + return err + } + } + tw.nb = int64(hdr.Size) + tw.pad = (blockSize - (tw.nb % blockSize)) % blockSize + + _, tw.err = tw.w.Write(header) + return tw.err +} + +// splitUSTARPath splits a path according to USTAR prefix and suffix rules. +// If the path is not splittable, then it will return ("", "", false). +func splitUSTARPath(name string) (prefix, suffix string, ok bool) { + length := len(name) + if length <= fileNameSize || !isASCII(name) { + return "", "", false + } else if length > fileNamePrefixSize+1 { + length = fileNamePrefixSize + 1 + } else if name[length-1] == '/' { + length-- + } + + i := strings.LastIndex(name[:length], "/") + nlen := len(name) - i - 1 // nlen is length of suffix + plen := i // plen is length of prefix + if i <= 0 || nlen > fileNameSize || nlen == 0 || plen > fileNamePrefixSize { + return "", "", false + } + return name[:i], name[i+1:], true +} + +// writePaxHeader writes an extended pax header to the +// archive. +func (tw *Writer) writePAXHeader(hdr *Header, paxHeaders map[string]string) error { + // Prepare extended header + ext := new(Header) + ext.Typeflag = TypeXHeader + // Setting ModTime is required for reader parsing to + // succeed, and seems harmless enough. + ext.ModTime = hdr.ModTime + // The spec asks that we namespace our pseudo files + // with the current pid. However, this results in differing outputs + // for identical inputs. As such, the constant 0 is now used instead. + // golang.org/issue/12358 + dir, file := path.Split(hdr.Name) + fullName := path.Join(dir, "PaxHeaders.0", file) + + ascii := toASCII(fullName) + if len(ascii) > 100 { + ascii = ascii[:100] + } + ext.Name = ascii + // Construct the body + var buf bytes.Buffer + + // Keys are sorted before writing to body to allow deterministic output. + var keys []string + for k := range paxHeaders { + keys = append(keys, k) + } + sort.Strings(keys) + + for _, k := range keys { + fmt.Fprint(&buf, formatPAXRecord(k, paxHeaders[k])) + } + + ext.Size = int64(len(buf.Bytes())) + if err := tw.writeHeader(ext, false); err != nil { + return err + } + if _, err := tw.Write(buf.Bytes()); err != nil { + return err + } + if err := tw.Flush(); err != nil { + return err + } + return nil +} + +// formatPAXRecord formats a single PAX record, prefixing it with the +// appropriate length. +func formatPAXRecord(k, v string) string { + const padding = 3 // Extra padding for ' ', '=', and '\n' + size := len(k) + len(v) + padding + size += len(strconv.Itoa(size)) + record := fmt.Sprintf("%d %s=%s\n", size, k, v) + + // Final adjustment if adding size field increased the record size. + if len(record) != size { + size = len(record) + record = fmt.Sprintf("%d %s=%s\n", size, k, v) + } + return record +} + +// Write writes to the current entry in the tar archive. +// Write returns the error ErrWriteTooLong if more than +// hdr.Size bytes are written after WriteHeader. +func (tw *Writer) Write(b []byte) (n int, err error) { + if tw.closed { + err = ErrWriteAfterClose + return + } + overwrite := false + if int64(len(b)) > tw.nb { + b = b[0:tw.nb] + overwrite = true + } + n, err = tw.w.Write(b) + tw.nb -= int64(n) + if err == nil && overwrite { + err = ErrWriteTooLong + return + } + tw.err = err + return +} + +// Close closes the tar archive, flushing any unwritten +// data to the underlying writer. +func (tw *Writer) Close() error { + if tw.err != nil || tw.closed { + return tw.err + } + tw.Flush() + tw.closed = true + if tw.err != nil { + return tw.err + } + + // trailer: two zero blocks + for i := 0; i < 2; i++ { + _, tw.err = tw.w.Write(zeroBlock) + if tw.err != nil { + break + } + } + return tw.err +} diff --git a/vendor/github.com/Microsoft/go-winio/backuptar/tar.go b/vendor/github.com/Microsoft/go-winio/backuptar/tar.go new file mode 100644 index 00000000..c988574f --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/backuptar/tar.go @@ -0,0 +1,362 @@ +package backuptar + +import ( + "errors" + "fmt" + "io" + "io/ioutil" + "path/filepath" + "strconv" + "strings" + "syscall" + "time" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/go-winio/archive/tar" // until archive/tar supports pax extensions in its interface +) + +const ( + c_ISUID = 04000 // Set uid + c_ISGID = 02000 // Set gid + c_ISVTX = 01000 // Save text (sticky bit) + c_ISDIR = 040000 // Directory + c_ISFIFO = 010000 // FIFO + c_ISREG = 0100000 // Regular file + c_ISLNK = 0120000 // Symbolic link + c_ISBLK = 060000 // Block special file + c_ISCHR = 020000 // Character special file + c_ISSOCK = 0140000 // Socket +) + +const ( + hdrFileAttributes = "fileattr" + hdrAccessTime = "accesstime" + hdrChangeTime = "changetime" + hdrCreateTime = "createtime" + hdrWriteTime = "writetime" + hdrSecurityDescriptor = "sd" + hdrMountPoint = "mountpoint" +) + +func writeZeroes(w io.Writer, count int64) error { + buf := make([]byte, 8192) + c := len(buf) + for i := int64(0); i < count; i += int64(c) { + if int64(c) > count-i { + c = int(count - i) + } + _, err := w.Write(buf[:c]) + if err != nil { + return err + } + } + return nil +} + +func copySparse(t *tar.Writer, br *winio.BackupStreamReader) error { + curOffset := int64(0) + for { + bhdr, err := br.Next() + if err == io.EOF { + err = io.ErrUnexpectedEOF + } + if err != nil { + return err + } + if bhdr.Id != winio.BackupSparseBlock { + return fmt.Errorf("unexpected stream %d", bhdr.Id) + } + + // archive/tar does not support writing sparse files + // so just write zeroes to catch up to the current offset. + err = writeZeroes(t, bhdr.Offset-curOffset) + if bhdr.Size == 0 { + break + } + n, err := io.Copy(t, br) + if err != nil { + return err + } + curOffset = bhdr.Offset + n + } + return nil +} + +func win32TimeFromTar(key string, hdrs map[string]string, unixTime time.Time) syscall.Filetime { + if s, ok := hdrs[key]; ok { + n, err := strconv.ParseUint(s, 10, 64) + if err == nil { + return syscall.Filetime{uint32(n & 0xffffffff), uint32(n >> 32)} + } + } + return syscall.NsecToFiletime(unixTime.UnixNano()) +} + +func win32TimeToTar(ft syscall.Filetime) (string, time.Time) { + return fmt.Sprintf("%d", uint64(ft.LowDateTime)+(uint64(ft.HighDateTime)<<32)), time.Unix(0, ft.Nanoseconds()) +} + +// Writes a file to a tar writer using data from a Win32 backup stream. +// +// This encodes Win32 metadata as tar pax vendor extensions starting with MSWINDOWS. +// +// The additional Win32 metadata is: +// +// MSWINDOWS.fileattr: The Win32 file attributes, as a decimal value +// +// MSWINDOWS.accesstime: The last access time, as a Filetime expressed as a 64-bit decimal value. +// +// MSWINDOWS.createtime: The creation time, as a Filetime expressed as a 64-bit decimal value. +// +// MSWINDOWS.changetime: The creation time, as a Filetime expressed as a 64-bit decimal value. +// +// MSWINDOWS.writetime: The creation time, as a Filetime expressed as a 64-bit decimal value. +// +// MSWINDOWS.sd: The Win32 security descriptor, in SDDL (string) format +// +// MSWINDOWS.mountpoint: If present, this is a mount point and not a symlink, even though the type is '2' (symlink) +func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size int64, fileInfo *winio.FileBasicInfo) error { + name = filepath.ToSlash(name) + hdr := &tar.Header{ + Name: name, + Size: size, + Typeflag: tar.TypeReg, + Winheaders: make(map[string]string), + } + hdr.Winheaders[hdrFileAttributes] = fmt.Sprintf("%d", fileInfo.FileAttributes) + hdr.Winheaders[hdrAccessTime], hdr.AccessTime = win32TimeToTar(fileInfo.LastAccessTime) + hdr.Winheaders[hdrChangeTime], hdr.ChangeTime = win32TimeToTar(fileInfo.ChangeTime) + hdr.Winheaders[hdrCreateTime], _ = win32TimeToTar(fileInfo.CreationTime) + hdr.Winheaders[hdrWriteTime], hdr.ModTime = win32TimeToTar(fileInfo.LastWriteTime) + + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + hdr.Mode |= c_ISDIR + hdr.Size = 0 + hdr.Typeflag = tar.TypeDir + } + + br := winio.NewBackupStreamReader(r) + var dataHdr *winio.BackupHeader + for dataHdr == nil { + bhdr, err := br.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupData: + hdr.Mode |= c_ISREG + dataHdr = bhdr + case winio.BackupSecurity: + sd, err := ioutil.ReadAll(br) + if err != nil { + return err + } + sddl, err := winio.SecurityDescriptorToSddl(sd) + if err != nil { + return err + } + hdr.Winheaders[hdrSecurityDescriptor] = sddl + + case winio.BackupReparseData: + hdr.Mode |= c_ISLNK + hdr.Typeflag = tar.TypeSymlink + reparseBuffer, err := ioutil.ReadAll(br) + rp, err := winio.DecodeReparsePoint(reparseBuffer) + if err != nil { + return err + } + if rp.IsMountPoint { + hdr.Winheaders[hdrMountPoint] = "1" + } + hdr.Linkname = rp.Target + case winio.BackupEaData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData: + // ignore these streams + default: + return fmt.Errorf("%s: unknown stream ID %d", name, bhdr.Id) + } + } + + err := t.WriteHeader(hdr) + if err != nil { + return err + } + + if dataHdr != nil { + // A data stream was found. Copy the data. + if (dataHdr.Attributes & winio.StreamSparseAttributes) == 0 { + if size != dataHdr.Size { + return fmt.Errorf("%s: mismatch between file size %d and header size %d", name, size, dataHdr.Size) + } + _, err = io.Copy(t, br) + if err != nil { + return err + } + } else { + err = copySparse(t, br) + if err != nil { + return err + } + } + } + + // Look for streams after the data stream. The only ones we handle are alternate data streams. + // Other streams may have metadata that could be serialized, but the tar header has already + // been written. In practice, this means that we don't get EA or TXF metadata. + for { + bhdr, err := br.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + switch bhdr.Id { + case winio.BackupAlternateData: + altName := bhdr.Name + if strings.HasSuffix(altName, ":$DATA") { + altName = altName[:len(altName)-len(":$DATA")] + } + if (bhdr.Attributes & winio.StreamSparseAttributes) == 0 { + hdr = &tar.Header{ + Name: name + altName, + Mode: hdr.Mode, + Typeflag: tar.TypeReg, + Size: bhdr.Size, + ModTime: hdr.ModTime, + AccessTime: hdr.AccessTime, + ChangeTime: hdr.ChangeTime, + } + err = t.WriteHeader(hdr) + if err != nil { + return err + } + _, err = io.Copy(t, br) + if err != nil { + return err + } + + } else { + // Unsupported for now, since the size of the alternate stream is not present + // in the backup stream until after the data has been read. + return errors.New("tar of sparse alternate data streams is unsupported") + } + case winio.BackupEaData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData: + // ignore these streams + default: + return fmt.Errorf("%s: unknown stream ID %d after data", name, bhdr.Id) + } + } + return nil +} + +// Retrieves basic Win32 file information from a tar header, using the additional metadata written by +// WriteTarFileFromBackupStream. +func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *winio.FileBasicInfo, err error) { + name = hdr.Name + if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA { + size = hdr.Size + } + fileInfo = &winio.FileBasicInfo{ + LastAccessTime: win32TimeFromTar(hdrAccessTime, hdr.Winheaders, hdr.AccessTime), + LastWriteTime: win32TimeFromTar(hdrWriteTime, hdr.Winheaders, hdr.ModTime), + ChangeTime: win32TimeFromTar(hdrChangeTime, hdr.Winheaders, hdr.ChangeTime), + CreationTime: win32TimeFromTar(hdrCreateTime, hdr.Winheaders, hdr.ModTime), + } + if attrStr, ok := hdr.Winheaders[hdrFileAttributes]; ok { + attr, err := strconv.ParseUint(attrStr, 10, 32) + if err != nil { + return "", 0, nil, err + } + fileInfo.FileAttributes = uintptr(attr) + } else { + if hdr.Typeflag == tar.TypeDir { + fileInfo.FileAttributes |= syscall.FILE_ATTRIBUTE_DIRECTORY + } + } + return +} + +// Writes a Win32 backup stream from the current tar file. Since this function may process multiple +// tar file entries in order to collect all the alternate data streams for the file, it returns the next +// tar file that was not processed, or io.EOF is there are no more. +func WriteBackupStreamFromTarFile(w io.Writer, t *tar.Reader, hdr *tar.Header) (*tar.Header, error) { + bw := winio.NewBackupStreamWriter(w) + if sddl, ok := hdr.Winheaders[hdrSecurityDescriptor]; ok { + sd, err := winio.SddlToSecurityDescriptor(sddl) + if err != nil { + return nil, err + } + bhdr := winio.BackupHeader{ + Id: winio.BackupSecurity, + Size: int64(len(sd)), + } + err = bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = bw.Write(sd) + if err != nil { + return nil, err + } + } + if hdr.Typeflag == tar.TypeSymlink { + _, isMountPoint := hdr.Winheaders[hdrMountPoint] + rp := winio.ReparsePoint{ + Target: hdr.Linkname, + IsMountPoint: isMountPoint, + } + reparse := winio.EncodeReparsePoint(&rp) + bhdr := winio.BackupHeader{ + Id: winio.BackupReparseData, + Size: int64(len(reparse)), + } + err := bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = bw.Write(reparse) + if err != nil { + return nil, err + } + } + if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA { + bhdr := winio.BackupHeader{ + Id: winio.BackupData, + Size: hdr.Size, + } + err := bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = io.Copy(bw, t) + if err != nil { + return nil, err + } + } + // Copy all the alternate data streams and return the next non-ADS header. + for { + ahdr, err := t.Next() + if err != nil { + return nil, err + } + if ahdr.Typeflag != tar.TypeReg || !strings.HasPrefix(ahdr.Name, hdr.Name+":") { + return ahdr, nil + } + bhdr := winio.BackupHeader{ + Id: winio.BackupAlternateData, + Size: ahdr.Size, + Name: ahdr.Name[len(hdr.Name)+1:] + ":$DATA", + } + err = bw.WriteHeader(&bhdr) + if err != nil { + return nil, err + } + _, err = io.Copy(bw, t) + if err != nil { + return nil, err + } + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/LICENSE b/vendor/github.com/Microsoft/hcsshim/LICENSE new file mode 100644 index 00000000..3423e958 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/vendor/github.com/Microsoft/hcsshim/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/activatelayer.go new file mode 100644 index 00000000..efc4d802 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/activatelayer.go @@ -0,0 +1,28 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// ActivateLayer will find the layer with the given id and mount it's filesystem. +// For a read/write layer, the mounted filesystem will appear as a volume on the +// host, while a read-only layer is generally expected to be a no-op. +// An activated layer must later be deactivated via DeactivateLayer. +func ActivateLayer(info DriverInfo, id string) error { + title := "hcsshim::ActivateLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = activateLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/baselayer.go b/vendor/github.com/Microsoft/hcsshim/baselayer.go new file mode 100644 index 00000000..4b04a681 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/baselayer.go @@ -0,0 +1,172 @@ +package hcsshim + +import ( + "errors" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/go-winio" +) + +type baseLayerWriter struct { + root string + f *os.File + bw *winio.BackupFileWriter + err error + hasUtilityVM bool + dirInfo []dirInfo +} + +type dirInfo struct { + path string + fileInfo winio.FileBasicInfo +} + +func (w *baseLayerWriter) closeCurrentFile() error { + if w.f != nil { + err := w.bw.Close() + err2 := w.f.Close() + w.f = nil + w.bw = nil + if err != nil { + return err + } + if err2 != nil { + return err2 + } + } + return nil +} + +func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + if filepath.ToSlash(name) == `UtilityVM/Files` { + w.hasUtilityVM = true + } + + path := filepath.Join(w.root, name) + path, err = makeLongAbsPath(path) + if err != nil { + return err + } + + var f *os.File + defer func() { + if f != nil { + f.Close() + } + }() + + createmode := uint32(syscall.CREATE_NEW) + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { + err := os.Mkdir(path, 0) + if err != nil && !os.IsExist(err) { + return err + } + createmode = syscall.OPEN_EXISTING + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.dirInfo = append(w.dirInfo, dirInfo{path, *fileInfo}) + } + } + + mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) + f, err = winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createmode) + if err != nil { + return makeError(err, "Failed to OpenForBackup", path) + } + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return makeError(err, "Failed to SetFileBasicInfo", path) + } + + w.f = f + w.bw = winio.NewBackupFileWriter(f, true) + f = nil + return nil +} + +func (w *baseLayerWriter) AddLink(name string, target string) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + linkpath, err := makeLongAbsPath(filepath.Join(w.root, name)) + if err != nil { + return err + } + + linktarget, err := makeLongAbsPath(filepath.Join(w.root, target)) + if err != nil { + return err + } + + return os.Link(linktarget, linkpath) +} + +func (w *baseLayerWriter) Remove(name string) error { + return errors.New("base layer cannot have tombstones") +} + +func (w *baseLayerWriter) Write(b []byte) (int, error) { + n, err := w.bw.Write(b) + if err != nil { + w.err = err + } + return n, err +} + +func (w *baseLayerWriter) Close() error { + err := w.closeCurrentFile() + if err != nil { + return err + } + if w.err == nil { + // Restore the file times of all the directories, since they may have + // been modified by creating child directories. + for i := range w.dirInfo { + di := &w.dirInfo[len(w.dirInfo)-i-1] + f, err := winio.OpenForBackup(di.path, uint32(syscall.GENERIC_READ|syscall.GENERIC_WRITE), syscall.FILE_SHARE_READ, syscall.OPEN_EXISTING) + if err != nil { + return makeError(err, "Failed to OpenForBackup", di.path) + } + + err = winio.SetFileBasicInfo(f, &di.fileInfo) + f.Close() + if err != nil { + return makeError(err, "Failed to SetFileBasicInfo", di.path) + } + } + + err = ProcessBaseLayer(w.root) + if err != nil { + return err + } + + if w.hasUtilityVM { + err = ProcessUtilityVMImage(filepath.Join(w.root, "UtilityVM")) + if err != nil { + return err + } + } + } + return w.err +} diff --git a/vendor/github.com/Microsoft/hcsshim/callback.go b/vendor/github.com/Microsoft/hcsshim/callback.go new file mode 100644 index 00000000..e8c2b00c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/callback.go @@ -0,0 +1,79 @@ +package hcsshim + +import ( + "sync" + "syscall" +) + +var ( + nextCallback uintptr + callbackMap = map[uintptr]*notifcationWatcherContext{} + callbackMapLock = sync.RWMutex{} + + notificationWatcherCallback = syscall.NewCallback(notificationWatcher) + + // Notifications for HCS_SYSTEM handles + hcsNotificationSystemExited hcsNotification = 0x00000001 + hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002 + hcsNotificationSystemStartCompleted hcsNotification = 0x00000003 + hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004 + hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005 + + // Notifications for HCS_PROCESS handles + hcsNotificationProcessExited hcsNotification = 0x00010000 + + // Common notifications + hcsNotificationInvalid hcsNotification = 0x00000000 + hcsNotificationServiceDisconnect hcsNotification = 0x01000000 +) + +type hcsNotification uint32 +type notificationChannel chan error + +type notifcationWatcherContext struct { + channels notificationChannels + handle hcsCallback +} + +type notificationChannels map[hcsNotification]notificationChannel + +func newChannels() notificationChannels { + channels := make(notificationChannels) + + channels[hcsNotificationSystemExited] = make(notificationChannel, 1) + channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) + channels[hcsNotificationProcessExited] = make(notificationChannel, 1) + channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) + return channels +} +func closeChannels(channels notificationChannels) { + close(channels[hcsNotificationSystemExited]) + close(channels[hcsNotificationSystemCreateCompleted]) + close(channels[hcsNotificationSystemStartCompleted]) + close(channels[hcsNotificationSystemPauseCompleted]) + close(channels[hcsNotificationSystemResumeCompleted]) + close(channels[hcsNotificationProcessExited]) + close(channels[hcsNotificationServiceDisconnect]) +} + +func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { + var result error + if int32(notificationStatus) < 0 { + result = syscall.Errno(win32FromHresult(notificationStatus)) + } + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return 0 + } + + context.channels[notificationType] <- result + + return 0 +} diff --git a/vendor/github.com/Microsoft/hcsshim/cgo.go b/vendor/github.com/Microsoft/hcsshim/cgo.go new file mode 100644 index 00000000..20033323 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cgo.go @@ -0,0 +1,7 @@ +package hcsshim + +import "C" + +// This import is needed to make the library compile as CGO because HCSSHIM +// only works with CGO due to callbacks from HCS comming back from a C thread +// which is not supported without CGO. See https://github.com/golang/go/issues/10973 diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go new file mode 100644 index 00000000..9e76e332 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -0,0 +1,565 @@ +package hcsshim + +import ( + "encoding/json" + "runtime" + "syscall" + "time" + + "github.com/Sirupsen/logrus" +) + +var ( + defaultTimeout = time.Minute * 4 +) + +const ( + pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}` + statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}` + processListQuery = `{ "PropertyTypes" : ["ProcessList"]}` +) + +type container struct { + handle hcsSystem + id string + callbackNumber uintptr +} + +type containerProperties struct { + ID string `json:"Id"` + Name string + SystemType string + Owner string + SiloGUID string `json:"SiloGuid,omitempty"` + IsDummy bool `json:",omitempty"` + RuntimeID string `json:"RuntimeId,omitempty"` + Stopped bool `json:",omitempty"` + ExitType string `json:",omitempty"` + AreUpdatesPending bool `json:",omitempty"` + ObRoot string `json:",omitempty"` + Statistics Statistics `json:",omitempty"` + ProcessList []ProcessListItem `json:",omitempty"` +} + +// MemoryStats holds the memory statistics for a container +type MemoryStats struct { + UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:",omitempty"` + RuntimeUser100ns uint64 `json:",omitempty"` + RuntimeKernel100ns uint64 `json:",omitempty"` +} + +// StorageStats holds the storage statistics for a container +type StorageStats struct { + ReadCountNormalized uint64 `json:",omitempty"` + ReadSizeBytes uint64 `json:",omitempty"` + WriteCountNormalized uint64 `json:",omitempty"` + WriteSizeBytes uint64 `json:",omitempty"` +} + +// NetworkStats holds the network statistics for a container +type NetworkStats struct { + BytesReceived uint64 `json:",omitempty"` + BytesSent uint64 `json:",omitempty"` + PacketsReceived uint64 `json:",omitempty"` + PacketsSent uint64 `json:",omitempty"` + DroppedPacketsIncoming uint64 `json:",omitempty"` + DroppedPacketsOutgoing uint64 `json:",omitempty"` + EndpointId string `json:",omitempty"` + InstanceId string `json:",omitempty"` +} + +// Statistics is the structure returned by a statistics call on a container +type Statistics struct { + Timestamp time.Time `json:",omitempty"` + ContainerStartTime time.Time `json:",omitempty"` + Uptime100ns uint64 `json:",omitempty"` + Memory MemoryStats `json:",omitempty"` + Processor ProcessorStats `json:",omitempty"` + Storage StorageStats `json:",omitempty"` + Network []NetworkStats `json:",omitempty"` +} + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem struct { + CreateTimestamp time.Time `json:",omitempty"` + ImageName string `json:",omitempty"` + KernelTime100ns uint64 `json:",omitempty"` + MemoryCommitBytes uint64 `json:",omitempty"` + MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` + MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` + ProcessId uint32 `json:",omitempty"` + UserTime100ns uint64 `json:",omitempty"` +} + +// CreateContainer creates a new container with the given configuration but does not start it. +func CreateContainer(id string, c *ContainerConfig) (Container, error) { + operation := "CreateContainer" + title := "HCSShim::" + operation + + container := &container{ + id: id, + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, err + } + + configuration := string(configurationb) + logrus.Debugf(title+" id=%s config=%s", id, configuration) + + var ( + resultp *uint16 + createError error + ) + if hcsCallbacksSupported { + var identity syscall.Handle + createError = hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp) + + if createError == nil || IsPending(createError) { + if err := container.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + } + } else { + createError = hcsCreateComputeSystemTP5(id, configuration, &container.handle, &resultp) + } + + err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout) + if err != nil { + return nil, makeContainerError(container, operation, configuration, err) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle) + runtime.SetFinalizer(container, closeContainer) + return container, nil +} + +// OpenContainer opens an existing container by ID. +func OpenContainer(id string) (Container, error) { + operation := "OpenContainer" + title := "HCSShim::" + operation + logrus.Debugf(title+" id=%s", id) + + container := &container{ + id: id, + } + + var ( + handle hcsSystem + resultp *uint16 + ) + err := hcsOpenComputeSystem(id, &handle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + container.handle = handle + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle) + runtime.SetFinalizer(container, closeContainer) + return container, nil +} + +// Start synchronously starts the container. +func (container *container) Start() error { + operation := "Start" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + var resultp *uint16 + err := hcsStartComputeSystemTP5(container.handle, nil, &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Shutdown requests a container shutdown, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (container *container) Shutdown() error { + operation := "Shutdown" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + var resultp *uint16 + err := hcsShutdownComputeSystemTP5(container.handle, nil, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Terminate requests a container terminate, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (container *container) Terminate() error { + operation := "Terminate" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + var resultp *uint16 + err := hcsTerminateComputeSystemTP5(container.handle, nil, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Wait synchronously waits for the container to shutdown or terminate. +func (container *container) Wait() error { + operation := "Wait" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if hcsCallbacksSupported { + err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil) + if err != nil { + return makeContainerError(container, operation, "", err) + } + } else { + _, err := container.waitTimeoutInternal(syscall.INFINITE) + if err != nil { + return makeContainerError(container, operation, "", err) + } + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +func (container *container) waitTimeoutInternal(timeout uint32) (bool, error) { + return waitTimeoutInternalHelper(container, timeout) +} + +// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. +// If the timeout expires, IsTimeout(err) == true +func (container *container) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if hcsCallbacksSupported { + err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + } else { + finished, err := waitTimeoutHelper(container, timeout) + if !finished { + err = ErrTimeout + } + if err != nil { + return makeContainerError(container, operation, "", err) + } + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +func (container *container) hcsWait(timeout uint32) (bool, error) { + var ( + resultp *uint16 + exitEvent syscall.Handle + ) + + err := hcsCreateComputeSystemWait(container.handle, &exitEvent, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return false, err + } + defer syscall.CloseHandle(exitEvent) + + return waitForSingleObject(exitEvent, timeout) +} + +func (container *container) properties(query string) (*containerProperties, error) { + var ( + resultp *uint16 + propertiesp *uint16 + ) + err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) + properties := &containerProperties{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, err + } + return properties, nil +} + +// HasPendingUpdates returns true if the container has updates pending to install +func (container *container) HasPendingUpdates() (bool, error) { + operation := "HasPendingUpdates" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + properties, err := container.properties(pendingUpdatesQuery) + if err != nil { + return false, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.AreUpdatesPending, nil +} + +// Statistics returns statistics for the container +func (container *container) Statistics() (Statistics, error) { + operation := "Statistics" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + properties, err := container.properties(statisticsQuery) + if err != nil { + return Statistics{}, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.Statistics, nil +} + +// ProcessList returns an array of ProcessListItems for the container +func (container *container) ProcessList() ([]ProcessListItem, error) { + operation := "ProcessList" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + properties, err := container.properties(processListQuery) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.ProcessList, nil +} + +// Pause pauses the execution of the container. This feature is not enabled in TP5. +func (container *container) Pause() error { + operation := "Pause" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + var resultp *uint16 + err := hcsPauseComputeSystemTP5(container.handle, nil, &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Resume resumes the execution of the container. This feature is not enabled in TP5. +func (container *container) Resume() error { + operation := "Resume" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + var ( + resultp *uint16 + ) + + err := hcsResumeComputeSystemTP5(container.handle, nil, &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// CreateProcess launches a new process within the container. +func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { + operation := "CreateProcess" + title := "HCSShim::Container::" + operation + var ( + processInfo hcsProcessInformation + processHandle hcsProcess + resultp *uint16 + ) + + // If we are not emulating a console, ignore any console size passed to us + if !c.EmulateConsole { + c.ConsoleSize[0] = 0 + c.ConsoleSize[1] = 0 + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + configuration := string(configurationb) + logrus.Debugf(title+" id=%s config=%s", container.id, configuration) + + err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, configuration, err) + } + + process := &process{ + handle: processHandle, + processID: int(processInfo.ProcessId), + container: container, + cachedPipes: &cachedPipes{ + stdIn: processInfo.StdInput, + stdOut: processInfo.StdOutput, + stdErr: processInfo.StdError, + }, + } + + if hcsCallbacksSupported { + if err := process.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + } + + logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID) + runtime.SetFinalizer(process, closeProcess) + return process, nil +} + +// OpenProcess gets an interface to an existing process within the container. +func (container *container) OpenProcess(pid int) (Process, error) { + operation := "OpenProcess" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s, processid=%d", container.id, pid) + var ( + processHandle hcsProcess + resultp *uint16 + ) + + err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + process := &process{ + handle: processHandle, + processID: pid, + container: container, + } + + if hcsCallbacksSupported { + if err := process.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + } + + logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID) + runtime.SetFinalizer(process, closeProcess) + return process, nil +} + +// Close cleans up any state associated with the container but does not terminate or wait for it. +func (container *container) Close() error { + operation := "Close" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + // Don't double free this + if container.handle == 0 { + return nil + } + + if hcsCallbacksSupported { + if err := container.unregisterCallback(); err != nil { + return makeContainerError(container, operation, "", err) + } + } + + if err := hcsCloseComputeSystem(container.handle); err != nil { + return makeContainerError(container, operation, "", err) + } + + container.handle = 0 + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// closeContainer wraps container.Close for use by a finalizer +func closeContainer(container *container) { + container.Close() +} + +func (container *container) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + container.callbackNumber = callbackNumber + + return nil +} + +func (container *container) unregisterCallback() error { + callbackNumber := container.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterComputeSystemCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterComputeSystemCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/createlayer.go b/vendor/github.com/Microsoft/hcsshim/createlayer.go new file mode 100644 index 00000000..9ecffb1c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/createlayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// CreateLayer creates a new, empty, read-only layer on the filesystem based on +// the parent layer provided. +func CreateLayer(info DriverInfo, id, parent string) error { + title := "hcsshim::CreateLayer " + logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = createLayer(&infop, id, parent) + if err != nil { + err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go new file mode 100644 index 00000000..b69c3da3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go @@ -0,0 +1,35 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// CreateSandboxLayer creates and populates new read-write layer for use by a container. +// This requires both the id of the direct parent layer, as well as the full list +// of paths to all parent layers up to the base (and including the direct parent +// whose id was provided). +func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + title := "hcsshim::CreateSandboxLayer " + logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = createSandboxLayer(&infop, layerId, parentId, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go new file mode 100644 index 00000000..c02bcb3a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go @@ -0,0 +1,26 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. +func DeactivateLayer(info DriverInfo, id string) error { + title := "hcsshim::DeactivateLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = deactivateLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/destroylayer.go new file mode 100644 index 00000000..91ed269e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/destroylayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// DestroyLayer will remove the on-disk files representing the layer with the given +// id, including that layer's containing folder, if any. +func DestroyLayer(info DriverInfo, id string) error { + title := "hcsshim::DestroyLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = destroyLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go new file mode 100644 index 00000000..0d4dad59 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -0,0 +1,190 @@ +package hcsshim + +import ( + "errors" + "fmt" + "syscall" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists + ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = syscall.Errno(0x490) + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = errors.New("unexpected container exit") + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + + // ErrProcNotFound is an error encountered when the the process cannot be found + ErrProcNotFound = syscall.Errno(0x7f) +) + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + Process *process + Operation string + ExtraInfo string + Err error +} + +// ContainerError is an error encountered in HCS during an operation on a Container object +type ContainerError struct { + Container *container + Operation string + ExtraInfo string + Err error +} + +func (e *ContainerError) Error() string { + if e == nil { + return "" + } + + if e.Container == nil { + return "unexpected nil container for error: " + e.Err.Error() + } + + s := "container " + e.Container.id + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + if e.Err != nil { + s += fmt.Sprintf(" failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err)) + } + + if e.ExtraInfo != "" { + s += " extra info: " + e.ExtraInfo + } + + return s +} + +func makeContainerError(container *container, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ContainerError); ok { + return err + } + containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err} + return containerError +} + +func (e *ProcessError) Error() string { + if e == nil { + return "" + } + + if e.Process == nil { + return "Unexpected nil process for error: " + e.Err.Error() + } + + s := fmt.Sprintf("process %d", e.Process.processID) + + if e.Process.container != nil { + s += " in container " + e.Process.container.id + } + + if e.Operation != "" { + s += " " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(" failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err)) + default: + s += fmt.Sprintf(" failed: %s", e.Error()) + } + + return s +} + +func makeProcessError(process *process, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err} + return processError +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsNotExist(err error) bool { + err = getInnerError(err) + return err == ErrComputeSystemDoesNotExist || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationPending +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + err = getInnerError(err) + return err == ErrTimeout +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsAlreadyStopped(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeAlreadyStopped || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *ContainerError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go new file mode 100644 index 00000000..e1689218 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go @@ -0,0 +1,26 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// ExpandSandboxSize expands the size of a layer to at least size bytes. +func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { + title := "hcsshim::ExpandSandboxSize " + logrus.Debugf(title+"layerId=%s size=%d", layerId, size) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = expandSandboxSize(&infop, layerId, size) + if err != nil { + err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/exportlayer.go new file mode 100644 index 00000000..903e0851 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/exportlayer.go @@ -0,0 +1,158 @@ +package hcsshim + +import ( + "io" + "io/ioutil" + "os" + "runtime" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/Sirupsen/logrus" +) + +// ExportLayer will create a folder at exportFolderPath and fill that folder with +// the transport format version of the layer identified by layerId. This transport +// format includes any metadata required for later importing the layer (using +// ImportLayer), and requires the full list of parent layer paths in order to +// perform the export. +func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ExportLayer " + logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = exportLayer(&infop, layerId, exportFolderPath, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath) + return nil +} + +type LayerReader interface { + Next() (string, int64, *winio.FileBasicInfo, error) + Read(b []byte) (int, error) + Close() error +} + +// FilterLayerReader provides an interface for extracting the contents of an on-disk layer. +type FilterLayerReader struct { + context uintptr +} + +// Next reads the next available file from a layer, ensuring that parent directories are always read +// before child files and directories. +// +// Next returns the file's relative path, size, and basic file metadata. Read() should be used to +// extract a Win32 backup stream with the remainder of the metadata and the data. +func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) { + var fileNamep *uint16 + fileInfo := &winio.FileBasicInfo{} + var deleted uint32 + var fileSize int64 + err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted) + if err != nil { + if err == syscall.ERROR_NO_MORE_FILES { + err = io.EOF + } else { + err = makeError(err, "ExportLayerNext", "") + } + return "", 0, nil, err + } + fileName := convertAndFreeCoTaskMemString(fileNamep) + if deleted != 0 { + fileInfo = nil + } + if fileName[0] == '\\' { + fileName = fileName[1:] + } + return fileName, fileSize, fileInfo, nil +} + +// Read reads from the current file's Win32 backup stream. +func (r *FilterLayerReader) Read(b []byte) (int, error) { + var bytesRead uint32 + err := exportLayerRead(r.context, b, &bytesRead) + if err != nil { + return 0, makeError(err, "ExportLayerRead", "") + } + if bytesRead == 0 { + return 0, io.EOF + } + return int(bytesRead), nil +} + +// Close frees resources associated with the layer reader. It will return an +// error if there was an error while reading the layer or of the layer was not +// completely read. +func (r *FilterLayerReader) Close() (err error) { + if r.context != 0 { + err = exportLayerEnd(r.context) + if err != nil { + err = makeError(err, "ExportLayerEnd", "") + } + r.context = 0 + } + return +} + +// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. +// The caller must have taken the SeBackupPrivilege privilege +// to call this and any methods on the resulting LayerReader. +func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { + if procExportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + path, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + err = ExportLayer(info, layerID, path, parentLayerPaths) + if err != nil { + os.RemoveAll(path) + return nil, err + } + return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil + } + + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + infop, err := convertDriverInfo(info) + if err != nil { + return nil, err + } + r := &FilterLayerReader{} + err = exportLayerBegin(&infop, layerID, layers, &r.context) + if err != nil { + return nil, makeError(err, "ExportLayerBegin", "") + } + runtime.SetFinalizer(r, func(r *FilterLayerReader) { r.Close() }) + return r, err +} + +type legacyLayerReaderWrapper struct { + *legacyLayerReader +} + +func (r *legacyLayerReaderWrapper) Close() error { + err := r.legacyLayerReader.Close() + os.RemoveAll(r.root) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go new file mode 100644 index 00000000..41b57589 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go @@ -0,0 +1,55 @@ +package hcsshim + +import ( + "syscall" + + "github.com/Sirupsen/logrus" +) + +// GetLayerMountPath will look for a mounted layer with the given id and return +// the path at which that layer can be accessed. This path may be a volume path +// if the layer is a mounted read-write layer, otherwise it is expected to be the +// folder path at which the layer is stored. +func GetLayerMountPath(info DriverInfo, id string) (string, error) { + title := "hcsshim::GetLayerMountPath " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return "", err + } + + var mountPathLength uintptr + mountPathLength = 0 + + // Call the procedure itself. + logrus.Debugf("Calling proc (1)") + err = getLayerMountPath(&infop, id, &mountPathLength, nil) + if err != nil { + err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return "", err + } + + // Allocate a mount path of the returned length. + if mountPathLength == 0 { + return "", nil + } + mountPathp := make([]uint16, mountPathLength) + mountPathp[0] = 0 + + // Call the procedure again + logrus.Debugf("Calling proc (2)") + err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0]) + if err != nil { + err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return "", err + } + + path := syscall.UTF16ToString(mountPathp[0:]) + logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path) + return path, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go new file mode 100644 index 00000000..01ab4da3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go @@ -0,0 +1,22 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// GetSharedBaseImages will enumerate the images stored in the common central +// image store and return descriptive info about those images for the purpose +// of registering them with the graphdriver, graph, and tagstore. +func GetSharedBaseImages() (imageData string, err error) { + title := "hcsshim::GetSharedBaseImages " + + logrus.Debugf("Calling proc") + var buffer *uint16 + err = getBaseImages(&buffer) + if err != nil { + err = makeError(err, title, "") + logrus.Error(err) + return + } + imageData = convertAndFreeCoTaskMemString(buffer) + logrus.Debugf(title+" - succeeded output=%s", imageData) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/guid.go b/vendor/github.com/Microsoft/hcsshim/guid.go new file mode 100644 index 00000000..620aba12 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/guid.go @@ -0,0 +1,19 @@ +package hcsshim + +import ( + "crypto/sha1" + "fmt" +) + +type GUID [16]byte + +func NewGUID(source string) *GUID { + h := sha1.Sum([]byte(source)) + var g GUID + copy(g[0:], h[0:16]) + return &g +} + +func (g *GUID) ToString() string { + return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go new file mode 100644 index 00000000..eaecf132 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -0,0 +1,183 @@ +// Shim for the Host Compute Service (HSC) to manage Windows Server +// containers and Hyper-V containers. + +package hcsshim + +import ( + "fmt" + "syscall" + "unsafe" + + "github.com/Sirupsen/logrus" +) + +//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go + +//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree +//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId + +//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? +//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? +//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? +//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? +//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? +//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? +//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? +//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? +//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? +//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? +//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? +//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? +//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid? +//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? +//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? +//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? +//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? + +//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin? +//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext? +//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite? +//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd? + +//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin? +//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext? +//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead? +//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd? + +//sys createComputeSystem(id string, configuration string) (hr error) = vmcompute.CreateComputeSystem? +//sys createProcessWithStdHandlesInComputeSystem(id string, paramsJson string, pid *uint32, stdin *syscall.Handle, stdout *syscall.Handle, stderr *syscall.Handle) (hr error) = vmcompute.CreateProcessWithStdHandlesInComputeSystem? +//sys resizeConsoleInComputeSystem(id string, pid uint32, height uint16, width uint16, flags uint32) (hr error) = vmcompute.ResizeConsoleInComputeSystem? +//sys shutdownComputeSystem(id string, timeout uint32) (hr error) = vmcompute.ShutdownComputeSystem? +//sys startComputeSystem(id string) (hr error) = vmcompute.StartComputeSystem? +//sys terminateComputeSystem(id string) (hr error) = vmcompute.TerminateComputeSystem? +//sys terminateProcessInComputeSystem(id string, pid uint32) (hr error) = vmcompute.TerminateProcessInComputeSystem? +//sys waitForProcessInComputeSystem(id string, pid uint32, timeout uint32, exitCode *uint32) (hr error) = vmcompute.WaitForProcessInComputeSystem? +//sys getComputeSystemProperties(id string, flags uint32, properties **uint16) (hr error) = vmcompute.GetComputeSystemProperties? + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsCreateComputeSystemWait(computeSystem hcsSystem, exitEvent *syscall.Handle, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystemWait? +//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsCreateProcessWait(process hcsProcess, settings *syscall.Handle, result **uint16) (hr error) = vmcompute.HcsCreateProcessWait? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? + +//sys hcsCreateComputeSystemTP5(id string, configuration string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsStartComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? +//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +const ( + // Specific user-visible exit codes + WaitErrExecFailed = 32767 + + ERROR_GEN_FAILURE = syscall.Errno(31) + ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) + WSAEINVAL = syscall.Errno(10022) + + // Timeout on wait calls + TimeoutInfinite = 0xFFFFFFFF +) + +type HcsError struct { + title string + rest string + Err error +} + +type hcsSystem syscall.Handle +type hcsProcess syscall.Handle +type hcsCallback syscall.Handle + +type hcsProcessInformation struct { + ProcessId uint32 + Reserved uint32 + StdInput syscall.Handle + StdOutput syscall.Handle + StdError syscall.Handle +} + +func makeError(err error, title, rest string) error { + // Pass through DLL errors directly since they do not originate from HCS. + if _, ok := err.(*syscall.DLLError); ok { + return err + } + return &HcsError{title, rest, err} +} + +func makeErrorf(err error, title, format string, a ...interface{}) error { + return makeError(err, title, fmt.Sprintf(format, a...)) +} + +func win32FromError(err error) uint32 { + if herr, ok := err.(*HcsError); ok { + return win32FromError(herr.Err) + } + if code, ok := err.(syscall.Errno); ok { + return uint32(code) + } + return uint32(ERROR_GEN_FAILURE) +} + +func win32FromHresult(hr uintptr) uintptr { + if hr&0x1fff0000 == 0x00070000 { + return hr & 0xffff + } + return hr +} + +func (e *HcsError) Error() string { + s := e.title + if len(s) > 0 && s[len(s)-1] != ' ' { + s += " " + } + s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err)) + if e.rest != "" { + if e.rest[0] != ' ' { + s += " " + } + s += e.rest + } + return s +} + +func convertAndFreeCoTaskMemString(buffer *uint16) string { + str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:]) + coTaskMemFree(unsafe.Pointer(buffer)) + return str +} + +func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte { + return []byte(convertAndFreeCoTaskMemString(buffer)) +} + +func processHcsResult(err error, resultp *uint16) error { + if resultp != nil { + result := convertAndFreeCoTaskMemString(resultp) + logrus.Debugf("Result: %s", result) + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go new file mode 100644 index 00000000..7bf46a68 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go @@ -0,0 +1,152 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + "net" + + "github.com/Sirupsen/logrus" +) + +type NatPolicy struct { + Type string + Protocol string + InternalPort uint16 + ExternalPort uint16 +} + +type QosPolicy struct { + Type string + MaximumOutgoingBandwidthInBytes uint64 +} + +type VlanPolicy struct { + Type string + VLAN uint +} + +type VsidPolicy struct { + Type string + VSID uint +} + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet struct { + AddressPrefix string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// HNSNetwork represents a network in HNS +type HNSNetwork struct { + Id string `json:",omitempty"` + Name string `json:",omitempty"` + Type string `json:",omitempty"` + NetworkAdapterName string `json:",omitempty"` + SourceMac string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacPools []MacPool `json:",omitempty"` + Subnets []Subnet `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSServerCompartment uint32 `json:",omitempty"` +} + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint struct { + Id string `json:",omitempty"` + Name string `json:",omitempty"` + VirtualNetwork string `json:",omitempty"` + VirtualNetworkName string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacAddress string `json:",omitempty"` + IPAddress net.IP `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + EnableInternalDNS bool `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` +} + +type hnsNetworkResponse struct { + Success bool + Error string + Output HNSNetwork +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +func hnsCall(method, path, request string, returnResponse interface{}) error { + var responseBuffer *uint16 + err := _hnsCall(method, path, request, &responseBuffer) + if err != nil { + return makeError(err, "hnsCall ", "") + } + response := convertAndFreeCoTaskMemString(responseBuffer) + + hnsresponse := &hnsResponse{} + if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { + return err + } + + if !hnsresponse.Success { + return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + } + + if len(hnsresponse.Output) == 0 { + return nil + } + + logrus.Debugf("Network Response : %s", hnsresponse.Output) + err = json.Unmarshal(hnsresponse.Output, returnResponse) + if err != nil { + return err + } + + return nil +} + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + var network HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return &network, nil +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + var network []HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return network, nil +} + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + endpoint := &HNSEndpoint{} + err := hnsCall(method, "/endpoints/"+path, request, &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/importlayer.go b/vendor/github.com/Microsoft/hcsshim/importlayer.go new file mode 100644 index 00000000..42d72704 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/importlayer.go @@ -0,0 +1,193 @@ +package hcsshim + +import ( + "errors" + "io/ioutil" + "os" + "path/filepath" + "runtime" + + "github.com/Microsoft/go-winio" + "github.com/Sirupsen/logrus" +) + +// ImportLayer will take the contents of the folder at importFolderPath and import +// that into a layer with the id layerId. Note that in order to correctly populate +// the layer and interperet the transport format, all parent layers must already +// be present on the system at the paths provided in parentLayerPaths. +func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ImportLayer " + logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = importLayer(&infop, layerID, importFolderPath, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath) + return nil +} + +// LayerWriter is an interface that supports writing a new container image layer. +type LayerWriter interface { + // Add adds a file to the layer with given metadata. + Add(name string, fileInfo *winio.FileBasicInfo) error + // AddLink adds a hard link to the layer. The target must already have been added. + AddLink(name string, target string) error + // Remove removes a file that was present in a parent layer from the layer. + Remove(name string) error + // Write writes data to the current file. The data must be in the format of a Win32 + // backup stream. + Write(b []byte) (int, error) + // Close finishes the layer writing process and releases any resources. + Close() error +} + +// FilterLayerWriter provides an interface to write the contents of a layer to the file system. +type FilterLayerWriter struct { + context uintptr +} + +// Add adds a file or directory to the layer. The file's parent directory must have already been added. +// +// name contains the file's relative path. fileInfo contains file times and file attributes; the rest +// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method. +// winio.BackupStreamWriter can be used to facilitate this. +func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, fileInfo) + if err != nil { + return makeError(err, "ImportLayerNext", "") + } + return nil +} + +// AddLink adds a hard link to the layer. The target of the link must have already been added. +func (w *FilterLayerWriter) AddLink(name string, target string) error { + return errors.New("hard links not yet supported") +} + +// Remove removes a file from the layer. The file must have been present in the parent layer. +// +// name contains the file's relative path. +func (w *FilterLayerWriter) Remove(name string) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, nil) + if err != nil { + return makeError(err, "ImportLayerNext", "") + } + return nil +} + +// Write writes more backup stream data to the current file. +func (w *FilterLayerWriter) Write(b []byte) (int, error) { + err := importLayerWrite(w.context, b) + if err != nil { + err = makeError(err, "ImportLayerWrite", "") + return 0, err + } + return len(b), err +} + +// Close completes the layer write operation. The error must be checked to ensure that the +// operation was successful. +func (w *FilterLayerWriter) Close() (err error) { + if w.context != 0 { + err = importLayerEnd(w.context) + if err != nil { + err = makeError(err, "ImportLayerEnd", "") + } + w.context = 0 + } + return +} + +type legacyLayerWriterWrapper struct { + *legacyLayerWriter + info DriverInfo + layerID string + path string + parentLayerPaths []string +} + +func (r *legacyLayerWriterWrapper) Close() error { + err := r.legacyLayerWriter.Close() + if err == nil { + var fullPath string + // Use the original path here because ImportLayer does not support long paths for the source in TP5. + // But do use a long path for the destination to work around another bug with directories + // with MAX_PATH - 12 < length < MAX_PATH. + info := r.info + fullPath, err = makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID)) + if err == nil { + info.HomeDir = "" + err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths) + } + } + os.RemoveAll(r.root) + return err +} + +// NewLayerWriter returns a new layer writer for creating a layer on disk. +// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges +// to call this and any methods on the resulting LayerWriter. +func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets imported differently. + return &baseLayerWriter{ + root: filepath.Join(info.HomeDir, layerID), + }, nil + } + + if procImportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + path, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + return &legacyLayerWriterWrapper{ + legacyLayerWriter: newLegacyLayerWriter(path), + info: info, + layerID: layerID, + path: path, + parentLayerPaths: parentLayerPaths, + }, nil + } + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + + infop, err := convertDriverInfo(info) + if err != nil { + return nil, err + } + + w := &FilterLayerWriter{} + err = importLayerBegin(&infop, layerID, layers, &w.context) + if err != nil { + return nil, makeError(err, "ImportLayerStart", "") + } + runtime.SetFinalizer(w, func(w *FilterLayerWriter) { w.Close() }) + return w, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go new file mode 100644 index 00000000..bb6d5978 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -0,0 +1,146 @@ +package hcsshim + +import ( + "io" + "time" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig struct { + ApplicationName string + CommandLine string + WorkingDirectory string + Environment map[string]string + EmulateConsole bool + CreateStdInPipe bool + CreateStdOutPipe bool + CreateStdErrPipe bool + ConsoleSize [2]uint +} + +type Layer struct { + ID string + Path string +} + +type MappedDir struct { + HostPath string + ContainerPath string + ReadOnly bool + BandwidthMaximum uint64 + IOPSMaximum uint64 +} + +type HvRuntime struct { + ImagePath string `json:",omitempty"` + SkipTemplate bool `json:",omitempty"` +} + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig struct { + SystemType string // HCS requires this to be hard-coded to "Container" + Name string // Name of the container. We use the docker ID. + Owner string // The management platform that created this container + IsDummy bool // Used for development purposes. + VolumePath string // Windows volume path for scratch space + IgnoreFlushesDuringBoot bool // Optimization hint for container startup in Windows + LayerFolderPath string // Where the layer folders are located + Layers []Layer // List of storage layers + Credentials string `json:",omitempty"` // Credentials information + ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. + ProcessorWeight uint64 `json:",omitempty"` // CPU Shares 0..10000 on Windows; where 0 will be omitted and HCS will default. + ProcessorMaximum int64 `json:",omitempty"` // CPU maximum usage percent 1..100 + StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS + StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second + StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller + MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes + HostName string // Hostname + MappedDirectories []MappedDir // List of mapped directories (volumes/mounts) + SandboxPath string // Location of unmounted sandbox (used for Hyper-V containers) + HvPartition bool // True if it a Hyper-V Container + EndpointList []string // List of networking endpoints to be attached to container + HvRuntime *HvRuntime // Hyper-V container settings + Servicing bool // True if this container is for servicing + AllowUnqualifiedDNSQuery bool // True to allow unqualified DNS name resolution +} + +// Container represents a created (but not necessarily running) container. +type Container interface { + // Start synchronously starts the container. + Start() error + + // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. + Shutdown() error + + // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. + Terminate() error + + // Waits synchronously waits for the container to shutdown or terminate. + Wait() error + + // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It + // returns false if timeout occurs. + WaitTimeout(time.Duration) error + + // Pause pauses the execution of a container. + Pause() error + + // Resume resumes the execution of a container. + Resume() error + + // HasPendingUpdates returns true if the container has updates pending to install. + HasPendingUpdates() (bool, error) + + // Statistics returns statistics for a container. + Statistics() (Statistics, error) + + // ProcessList returns details for the processes in a container. + ProcessList() ([]ProcessListItem, error) + + // CreateProcess launches a new process within the container. + CreateProcess(c *ProcessConfig) (Process, error) + + // OpenProcess gets an interface to an existing process within the container. + OpenProcess(pid int) (Process, error) + + // Close cleans up any state associated with the container but does not terminate or wait for it. + Close() error +} + +// Process represents a running or exited process. +type Process interface { + // Pid returns the process ID of the process within the container. + Pid() int + + // Kill signals the process to terminate but does not wait for it to finish terminating. + Kill() error + + // Wait waits for the process to exit. + Wait() error + + // WaitTimeout waits for the process to exit or the duration to elapse. It returns + // false if timeout occurs. + WaitTimeout(time.Duration) error + + // ExitCode returns the exit code of the process. The process must have + // already terminated. + ExitCode() (int, error) + + // ResizeConsole resizes the console of the process. + ResizeConsole(width, height uint16) error + + // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing + // these pipes does not close the underlying pipes; it should be possible to + // call this multiple times to get multiple interfaces. + Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) + + // CloseStdin closes the write side of the stdin pipe so that the process is + // notified on the read side that there is no more data in stdin. + CloseStdin() error + + // Close cleans up any state associated with the process but does not kill + // or wait on it. + Close() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerexists.go b/vendor/github.com/Microsoft/hcsshim/layerexists.go new file mode 100644 index 00000000..522d95cc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layerexists.go @@ -0,0 +1,30 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// LayerExists will return true if a layer with the given id exists and is known +// to the system. +func LayerExists(info DriverInfo, id string) (bool, error) { + title := "hcsshim::LayerExists " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return false, err + } + + // Call the procedure itself. + var exists uint32 + + err = layerExists(&infop, id, &exists) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return false, err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists) + return exists != 0, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerutils.go b/vendor/github.com/Microsoft/hcsshim/layerutils.go new file mode 100644 index 00000000..47229d22 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layerutils.go @@ -0,0 +1,111 @@ +package hcsshim + +// This file contains utility functions to support storage (graph) related +// functionality. + +import ( + "path/filepath" + "syscall" + + "github.com/Sirupsen/logrus" +) + +/* To pass into syscall, we need a struct matching the following: +enum GraphDriverType +{ + DiffDriver, + FilterDriver +}; + +struct DriverInfo { + GraphDriverType Flavour; + LPCWSTR HomeDir; +}; +*/ +type DriverInfo struct { + Flavour int + HomeDir string +} + +type driverInfo struct { + Flavour int + HomeDirp *uint16 +} + +func convertDriverInfo(info DriverInfo) (driverInfo, error) { + homedirp, err := syscall.UTF16PtrFromString(info.HomeDir) + if err != nil { + logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error()) + return driverInfo{}, err + } + + return driverInfo{ + Flavour: info.Flavour, + HomeDirp: homedirp, + }, nil +} + +/* To pass into syscall, we need a struct matching the following: +typedef struct _WC_LAYER_DESCRIPTOR { + + // + // The ID of the layer + // + + GUID LayerId; + + // + // Additional flags + // + + union { + struct { + ULONG Reserved : 31; + ULONG Dirty : 1; // Created from sandbox as a result of snapshot + }; + ULONG Value; + } Flags; + + // + // Path to the layer root directory, null-terminated + // + + PCWSTR Path; + +} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; +*/ +type WC_LAYER_DESCRIPTOR struct { + LayerId GUID + Flags uint32 + Pathp *uint16 +} + +func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) { + // Array of descriptors that gets constructed. + var layers []WC_LAYER_DESCRIPTOR + + for i := 0; i < len(parentLayerPaths); i++ { + // Create a layer descriptor, using the folder name + // as the source for a GUID LayerId + _, folderName := filepath.Split(parentLayerPaths[i]) + g, err := NameToGuid(folderName) + if err != nil { + logrus.Debugf("Failed to convert name to guid %s", err) + return nil, err + } + + p, err := syscall.UTF16PtrFromString(parentLayerPaths[i]) + if err != nil { + logrus.Debugf("Failed conversion of parentLayerPath to pointer %s", err) + return nil, err + } + + layers = append(layers, WC_LAYER_DESCRIPTOR{ + LayerId: g, + Flags: 0, + Pathp: p, + }) + } + + return layers, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/legacy.go b/vendor/github.com/Microsoft/hcsshim/legacy.go new file mode 100644 index 00000000..e19ac8a9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/legacy.go @@ -0,0 +1,441 @@ +package hcsshim + +import ( + "bufio" + "encoding/binary" + "errors" + "fmt" + "io" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/Microsoft/go-winio" +) + +var errorIterationCanceled = errors.New("") + +func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) { + return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) +} + +func makeLongAbsPath(path string) (string, error) { + if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { + return path, nil + } + if !filepath.IsAbs(path) { + absPath, err := filepath.Abs(path) + if err != nil { + return "", err + } + path = absPath + } + if strings.HasPrefix(path, `\\`) { + return `\\?\UNC\` + path[2:], nil + } + return `\\?\` + path, nil +} + +type fileEntry struct { + path string + fi os.FileInfo + err error +} + +type legacyLayerReader struct { + root string + result chan *fileEntry + proceed chan bool + currentFile *os.File + backupReader *winio.BackupFileReader + isTP4Format bool +} + +// newLegacyLayerReader returns a new LayerReader that can read the Windows +// TP4 transport format from disk. +func newLegacyLayerReader(root string) *legacyLayerReader { + r := &legacyLayerReader{ + root: root, + result: make(chan *fileEntry), + proceed: make(chan bool), + isTP4Format: IsTP4(), + } + go r.walk() + return r +} + +func readTombstones(path string) (map[string]([]string), error) { + tf, err := os.Open(filepath.Join(path, "tombstones.txt")) + if err != nil { + return nil, err + } + defer tf.Close() + s := bufio.NewScanner(tf) + if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" { + return nil, errors.New("Invalid tombstones file") + } + + ts := make(map[string]([]string)) + for s.Scan() { + t := filepath.Join("Files", s.Text()[1:]) // skip leading `\` + dir := filepath.Dir(t) + ts[dir] = append(ts[dir], t) + } + if err = s.Err(); err != nil { + return nil, err + } + + return ts, nil +} + +func (r *legacyLayerReader) walkUntilCancelled() error { + root, err := makeLongAbsPath(r.root) + if err != nil { + return err + } + + r.root = root + ts, err := readTombstones(r.root) + if err != nil { + return err + } + + err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") { + return nil + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + // List all the tombstones. + if info.IsDir() { + relPath, err := filepath.Rel(r.root, path) + if err != nil { + return err + } + if dts, ok := ts[relPath]; ok { + for _, t := range dts { + r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil} + if !<-r.proceed { + return errorIterationCanceled + } + } + } + } + return nil + }) + if err == errorIterationCanceled { + return nil + } + if err == nil { + return io.EOF + } + return err +} + +func (r *legacyLayerReader) walk() { + defer close(r.result) + if !<-r.proceed { + return + } + + err := r.walkUntilCancelled() + if err != nil { + for { + r.result <- &fileEntry{err: err} + if !<-r.proceed { + return + } + } + } +} + +func (r *legacyLayerReader) reset() { + if r.backupReader != nil { + r.backupReader.Close() + r.backupReader = nil + } + if r.currentFile != nil { + r.currentFile.Close() + r.currentFile = nil + } +} + +func findBackupStreamSize(r io.Reader) (int64, error) { + br := winio.NewBackupStreamReader(r) + for { + hdr, err := br.Next() + if err != nil { + if err == io.EOF { + err = nil + } + return 0, err + } + if hdr.Id == winio.BackupData { + return hdr.Size, nil + } + } +} + +func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) { + r.reset() + r.proceed <- true + fe := <-r.result + if fe == nil { + err = errors.New("LegacyLayerReader closed") + return + } + if fe.err != nil { + err = fe.err + return + } + + path, err = filepath.Rel(r.root, fe.path) + if err != nil { + return + } + + if fe.fi == nil { + // This is a tombstone. Return a nil fileInfo. + return + } + + if fe.fi.IsDir() && strings.HasPrefix(path, `Files\`) { + fe.path += ".$wcidirs$" + } + + f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING) + if err != nil { + return + } + defer func() { + if f != nil { + f.Close() + } + }() + + fileInfo, err = winio.GetFileBasicInfo(f) + if err != nil { + return + } + + if !strings.HasPrefix(path, `Files\`) { + size = fe.fi.Size() + r.backupReader = winio.NewBackupFileReader(f, false) + if path == "Hives" || path == "Files" { + // The Hives directory has a non-deterministic file time because of the + // nature of the import process. Use the times from System_Delta. + var g *os.File + g, err = os.Open(filepath.Join(r.root, `Hives\System_Delta`)) + if err != nil { + return + } + attr := fileInfo.FileAttributes + fileInfo, err = winio.GetFileBasicInfo(g) + g.Close() + if err != nil { + return + } + fileInfo.FileAttributes = attr + } + + // The creation time and access time get reset for files outside of the Files path. + fileInfo.CreationTime = fileInfo.LastWriteTime + fileInfo.LastAccessTime = fileInfo.LastWriteTime + + } else { + beginning := int64(0) + if !r.isTP4Format { + // In TP5, the file attributes were added before the backup stream + var attr uint32 + err = binary.Read(f, binary.LittleEndian, &attr) + if err != nil { + return + } + fileInfo.FileAttributes = uintptr(attr) + beginning = 4 + } + + // Find the accurate file size. + if !fe.fi.IsDir() { + size, err = findBackupStreamSize(f) + if err != nil { + err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err} + return + } + } + + // Return back to the beginning of the backup stream. + _, err = f.Seek(beginning, 0) + if err != nil { + return + } + } + + r.currentFile = f + f = nil + return +} + +func (r *legacyLayerReader) Read(b []byte) (int, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, io.EOF + } + return r.currentFile.Read(b) + } + return r.backupReader.Read(b) +} + +func (r *legacyLayerReader) Close() error { + r.proceed <- false + <-r.result + r.reset() + return nil +} + +type legacyLayerWriter struct { + root string + currentFile *os.File + backupWriter *winio.BackupFileWriter + tombstones []string + isTP4Format bool + pathFixed bool +} + +// newLegacyLayerWriter returns a LayerWriter that can write the TP4 transport format +// to disk. +func newLegacyLayerWriter(root string) *legacyLayerWriter { + return &legacyLayerWriter{ + root: root, + isTP4Format: IsTP4(), + } +} + +func (w *legacyLayerWriter) init() error { + if !w.pathFixed { + path, err := makeLongAbsPath(w.root) + if err != nil { + return err + } + w.root = path + w.pathFixed = true + } + return nil +} + +func (w *legacyLayerWriter) reset() { + if w.backupWriter != nil { + w.backupWriter.Close() + w.backupWriter = nil + } + if w.currentFile != nil { + w.currentFile.Close() + w.currentFile = nil + } +} + +func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + w.reset() + err := w.init() + if err != nil { + return err + } + path := filepath.Join(w.root, name) + + createDisposition := uint32(syscall.CREATE_NEW) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + err := os.Mkdir(path, 0) + if err != nil { + return err + } + path += ".$wcidirs$" + } + + f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, createDisposition) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + os.Remove(path) + } + }() + + strippedFi := *fileInfo + strippedFi.FileAttributes = 0 + err = winio.SetFileBasicInfo(f, &strippedFi) + if err != nil { + return err + } + + if strings.HasPrefix(name, `Hives\`) { + w.backupWriter = winio.NewBackupFileWriter(f, false) + } else { + if !w.isTP4Format { + // In TP5, the file attributes were added to the header + err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes)) + if err != nil { + return err + } + } + } + + w.currentFile = f + f = nil + return nil +} + +func (w *legacyLayerWriter) AddLink(name string, target string) error { + return errors.New("hard links not supported with legacy writer") +} + +func (w *legacyLayerWriter) Remove(name string) error { + if !strings.HasPrefix(name, `Files\`) { + return fmt.Errorf("invalid tombstone %s", name) + } + w.tombstones = append(w.tombstones, name[len(`Files\`):]) + return nil +} + +func (w *legacyLayerWriter) Write(b []byte) (int, error) { + if w.backupWriter == nil { + if w.currentFile == nil { + return 0, errors.New("closed") + } + return w.currentFile.Write(b) + } + return w.backupWriter.Write(b) +} + +func (w *legacyLayerWriter) Close() error { + w.reset() + err := w.init() + if err != nil { + return err + } + tf, err := os.Create(filepath.Join(w.root, "tombstones.txt")) + if err != nil { + return err + } + defer tf.Close() + _, err = tf.Write([]byte("\xef\xbb\xbfVersion 1.0\n")) + if err != nil { + return err + } + for _, t := range w.tombstones { + _, err = tf.Write([]byte(filepath.Join(`\`, t) + "\n")) + if err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go new file mode 100644 index 00000000..a76bb441 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go @@ -0,0 +1,818 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ignore + +/* +mksyscall_windows generates windows system call bodies + +It parses all files specified on command line containing function +prototypes (like syscall_windows.go) and prints system call bodies +to standard output. + +The prototypes are marked by lines beginning with "//sys" and read +like func declarations if //sys is replaced by func, but: + +* The parameter lists must give a name for each argument. This + includes return parameters. + +* The parameter lists must give a type for each argument: + the (x, y, z int) shorthand is not allowed. + +* If the return parameter is an error number, it must be named err. + +* If go func name needs to be different from it's winapi dll name, + the winapi name could be specified at the end, after "=" sign, like + //sys LoadLibrary(libname string) (handle uint32, err error) = LoadLibraryA + +* Each function that returns err needs to supply a condition, that + return value of winapi will be tested against to detect failure. + This would set err to windows "last-error", otherwise it will be nil. + The value can be provided at end of //sys declaration, like + //sys LoadLibrary(libname string) (handle uint32, err error) [failretval==-1] = LoadLibraryA + and is [failretval==0] by default. + +Usage: + mksyscall_windows [flags] [path ...] + +The flags are: + -output + Specify output file name (outputs to console if blank). + -trace + Generate print statement after every syscall. +*/ +package main + +import ( + "bufio" + "bytes" + "errors" + "flag" + "fmt" + "go/format" + "go/parser" + "go/token" + "io" + "io/ioutil" + "log" + "os" + "strconv" + "strings" + "text/template" +) + +var ( + filename = flag.String("output", "", "output file name (standard output if omitted)") + printTraceFlag = flag.Bool("trace", false, "generate print statement after every syscall") +) + +func trim(s string) string { + return strings.Trim(s, " \t") +} + +var packageName string + +func packagename() string { + return packageName +} + +func syscalldot() string { + if packageName == "syscall" { + return "" + } + return "syscall." +} + +// Param is function parameter +type Param struct { + Name string + Type string + fn *Fn + tmpVarIdx int +} + +// tmpVar returns temp variable name that will be used to represent p during syscall. +func (p *Param) tmpVar() string { + if p.tmpVarIdx < 0 { + p.tmpVarIdx = p.fn.curTmpVarIdx + p.fn.curTmpVarIdx++ + } + return fmt.Sprintf("_p%d", p.tmpVarIdx) +} + +// BoolTmpVarCode returns source code for bool temp variable. +func (p *Param) BoolTmpVarCode() string { + const code = `var %s uint32 + if %s { + %s = 1 + } else { + %s = 0 + }` + tmp := p.tmpVar() + return fmt.Sprintf(code, tmp, p.Name, tmp, tmp) +} + +// SliceTmpVarCode returns source code for slice temp variable. +func (p *Param) SliceTmpVarCode() string { + const code = `var %s *%s + if len(%s) > 0 { + %s = &%s[0] + }` + tmp := p.tmpVar() + return fmt.Sprintf(code, tmp, p.Type[2:], p.Name, tmp, p.Name) +} + +// StringTmpVarCode returns source code for string temp variable. +func (p *Param) StringTmpVarCode() string { + errvar := p.fn.Rets.ErrorVarName() + if errvar == "" { + errvar = "_" + } + tmp := p.tmpVar() + const code = `var %s %s + %s, %s = %s(%s)` + s := fmt.Sprintf(code, tmp, p.fn.StrconvType(), tmp, errvar, p.fn.StrconvFunc(), p.Name) + if errvar == "-" { + return s + } + const morecode = ` + if %s != nil { + return + }` + return s + fmt.Sprintf(morecode, errvar) +} + +// TmpVarCode returns source code for temp variable. +func (p *Param) TmpVarCode() string { + switch { + case p.Type == "bool": + return p.BoolTmpVarCode() + case strings.HasPrefix(p.Type, "[]"): + return p.SliceTmpVarCode() + default: + return "" + } +} + +// TmpVarHelperCode returns source code for helper's temp variable. +func (p *Param) TmpVarHelperCode() string { + if p.Type != "string" { + return "" + } + return p.StringTmpVarCode() +} + +// SyscallArgList returns source code fragments representing p parameter +// in syscall. Slices are translated into 2 syscall parameters: pointer to +// the first element and length. +func (p *Param) SyscallArgList() []string { + t := p.HelperType() + var s string + switch { + case t[0] == '*': + s = fmt.Sprintf("unsafe.Pointer(%s)", p.Name) + case t == "bool": + s = p.tmpVar() + case strings.HasPrefix(t, "[]"): + return []string{ + fmt.Sprintf("uintptr(unsafe.Pointer(%s))", p.tmpVar()), + fmt.Sprintf("uintptr(len(%s))", p.Name), + } + default: + s = p.Name + } + return []string{fmt.Sprintf("uintptr(%s)", s)} +} + +// IsError determines if p parameter is used to return error. +func (p *Param) IsError() bool { + return p.Name == "err" && p.Type == "error" +} + +// HelperType returns type of parameter p used in helper function. +func (p *Param) HelperType() string { + if p.Type == "string" { + return p.fn.StrconvType() + } + return p.Type +} + +// join concatenates parameters ps into a string with sep separator. +// Each parameter is converted into string by applying fn to it +// before conversion. +func join(ps []*Param, fn func(*Param) string, sep string) string { + if len(ps) == 0 { + return "" + } + a := make([]string, 0) + for _, p := range ps { + a = append(a, fn(p)) + } + return strings.Join(a, sep) +} + +// Rets describes function return parameters. +type Rets struct { + Name string + Type string + ReturnsError bool + FailCond string +} + +// ErrorVarName returns error variable name for r. +func (r *Rets) ErrorVarName() string { + if r.ReturnsError { + return "err" + } + if r.Type == "error" { + return r.Name + } + return "" +} + +// ToParams converts r into slice of *Param. +func (r *Rets) ToParams() []*Param { + ps := make([]*Param, 0) + if len(r.Name) > 0 { + ps = append(ps, &Param{Name: r.Name, Type: r.Type}) + } + if r.ReturnsError { + ps = append(ps, &Param{Name: "err", Type: "error"}) + } + return ps +} + +// List returns source code of syscall return parameters. +func (r *Rets) List() string { + s := join(r.ToParams(), func(p *Param) string { return p.Name + " " + p.Type }, ", ") + if len(s) > 0 { + s = "(" + s + ")" + } + return s +} + +// PrintList returns source code of trace printing part correspondent +// to syscall return values. +func (r *Rets) PrintList() string { + return join(r.ToParams(), func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) +} + +// SetReturnValuesCode returns source code that accepts syscall return values. +func (r *Rets) SetReturnValuesCode() string { + if r.Name == "" && !r.ReturnsError { + return "" + } + retvar := "r0" + if r.Name == "" { + retvar = "r1" + } + errvar := "_" + if r.ReturnsError { + errvar = "e1" + } + return fmt.Sprintf("%s, _, %s := ", retvar, errvar) +} + +func (r *Rets) useLongHandleErrorCode(retvar string) string { + const code = `if %s { + if e1 != 0 { + err = error(e1) + } else { + err = %sEINVAL + } + }` + cond := retvar + " == 0" + if r.FailCond != "" { + cond = strings.Replace(r.FailCond, "failretval", retvar, 1) + } + return fmt.Sprintf(code, cond, syscalldot()) +} + +// SetErrorCode returns source code that sets return parameters. +func (r *Rets) SetErrorCode() string { + const code = `if r0 != 0 { + %s = %sErrno(r0) + }` + const hrCode = `if int32(r0) < 0 { + %s = %sErrno(win32FromHresult(r0)) + }` + if r.Name == "" && !r.ReturnsError { + return "" + } + if r.Name == "" { + return r.useLongHandleErrorCode("r1") + } + if r.Type == "error" { + if r.Name == "hr" { + return fmt.Sprintf(hrCode, r.Name, syscalldot()) + } else { + return fmt.Sprintf(code, r.Name, syscalldot()) + } + } + s := "" + switch { + case r.Type[0] == '*': + s = fmt.Sprintf("%s = (%s)(unsafe.Pointer(r0))", r.Name, r.Type) + case r.Type == "bool": + s = fmt.Sprintf("%s = r0 != 0", r.Name) + default: + s = fmt.Sprintf("%s = %s(r0)", r.Name, r.Type) + } + if !r.ReturnsError { + return s + } + return s + "\n\t" + r.useLongHandleErrorCode(r.Name) +} + +// Fn describes syscall function. +type Fn struct { + Name string + Params []*Param + Rets *Rets + PrintTrace bool + confirmproc bool + dllname string + dllfuncname string + src string + // TODO: get rid of this field and just use parameter index instead + curTmpVarIdx int // insure tmp variables have uniq names +} + +// extractParams parses s to extract function parameters. +func extractParams(s string, f *Fn) ([]*Param, error) { + s = trim(s) + if s == "" { + return nil, nil + } + a := strings.Split(s, ",") + ps := make([]*Param, len(a)) + for i := range ps { + s2 := trim(a[i]) + b := strings.Split(s2, " ") + if len(b) != 2 { + b = strings.Split(s2, "\t") + if len(b) != 2 { + return nil, errors.New("Could not extract function parameter from \"" + s2 + "\"") + } + } + ps[i] = &Param{ + Name: trim(b[0]), + Type: trim(b[1]), + fn: f, + tmpVarIdx: -1, + } + } + return ps, nil +} + +// extractSection extracts text out of string s starting after start +// and ending just before end. found return value will indicate success, +// and prefix, body and suffix will contain correspondent parts of string s. +func extractSection(s string, start, end rune) (prefix, body, suffix string, found bool) { + s = trim(s) + if strings.HasPrefix(s, string(start)) { + // no prefix + body = s[1:] + } else { + a := strings.SplitN(s, string(start), 2) + if len(a) != 2 { + return "", "", s, false + } + prefix = a[0] + body = a[1] + } + a := strings.SplitN(body, string(end), 2) + if len(a) != 2 { + return "", "", "", false + } + return prefix, a[0], a[1], true +} + +// newFn parses string s and return created function Fn. +func newFn(s string) (*Fn, error) { + s = trim(s) + f := &Fn{ + Rets: &Rets{}, + src: s, + PrintTrace: *printTraceFlag, + } + // function name and args + prefix, body, s, found := extractSection(s, '(', ')') + if !found || prefix == "" { + return nil, errors.New("Could not extract function name and parameters from \"" + f.src + "\"") + } + f.Name = prefix + var err error + f.Params, err = extractParams(body, f) + if err != nil { + return nil, err + } + // return values + _, body, s, found = extractSection(s, '(', ')') + if found { + r, err := extractParams(body, f) + if err != nil { + return nil, err + } + switch len(r) { + case 0: + case 1: + if r[0].IsError() { + f.Rets.ReturnsError = true + } else { + f.Rets.Name = r[0].Name + f.Rets.Type = r[0].Type + } + case 2: + if !r[1].IsError() { + return nil, errors.New("Only last windows error is allowed as second return value in \"" + f.src + "\"") + } + f.Rets.ReturnsError = true + f.Rets.Name = r[0].Name + f.Rets.Type = r[0].Type + default: + return nil, errors.New("Too many return values in \"" + f.src + "\"") + } + } + // fail condition + _, body, s, found = extractSection(s, '[', ']') + if found { + f.Rets.FailCond = body + } + // dll and dll function names + s = trim(s) + if s == "" { + return f, nil + } + if !strings.HasPrefix(s, "=") { + return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") + } + s = trim(s[1:]) + a := strings.Split(s, ".") + switch len(a) { + case 1: + f.dllfuncname = a[0] + case 2: + f.dllname = a[0] + f.dllfuncname = a[1] + default: + return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") + } + if f.dllfuncname[len(f.dllfuncname)-1] == '?' { + f.confirmproc = true + f.dllfuncname = f.dllfuncname[0 : len(f.dllfuncname)-1] + } + return f, nil +} + +// DLLName returns DLL name for function f. +func (f *Fn) DLLName() string { + if f.dllname == "" { + return "kernel32" + } + return f.dllname +} + +// DLLName returns DLL function name for function f. +func (f *Fn) DLLFuncName() string { + if f.dllfuncname == "" { + return f.Name + } + return f.dllfuncname +} + +func (f *Fn) ConfirmProc() bool { + return f.confirmproc +} + +// ParamList returns source code for function f parameters. +func (f *Fn) ParamList() string { + return join(f.Params, func(p *Param) string { return p.Name + " " + p.Type }, ", ") +} + +// HelperParamList returns source code for helper function f parameters. +func (f *Fn) HelperParamList() string { + return join(f.Params, func(p *Param) string { return p.Name + " " + p.HelperType() }, ", ") +} + +// ParamPrintList returns source code of trace printing part correspondent +// to syscall input parameters. +func (f *Fn) ParamPrintList() string { + return join(f.Params, func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) +} + +// ParamCount return number of syscall parameters for function f. +func (f *Fn) ParamCount() int { + n := 0 + for _, p := range f.Params { + n += len(p.SyscallArgList()) + } + return n +} + +// SyscallParamCount determines which version of Syscall/Syscall6/Syscall9/... +// to use. It returns parameter count for correspondent SyscallX function. +func (f *Fn) SyscallParamCount() int { + n := f.ParamCount() + switch { + case n <= 3: + return 3 + case n <= 6: + return 6 + case n <= 9: + return 9 + case n <= 12: + return 12 + case n <= 15: + return 15 + default: + panic("too many arguments to system call") + } +} + +// Syscall determines which SyscallX function to use for function f. +func (f *Fn) Syscall() string { + c := f.SyscallParamCount() + if c == 3 { + return syscalldot() + "Syscall" + } + return syscalldot() + "Syscall" + strconv.Itoa(c) +} + +// SyscallParamList returns source code for SyscallX parameters for function f. +func (f *Fn) SyscallParamList() string { + a := make([]string, 0) + for _, p := range f.Params { + a = append(a, p.SyscallArgList()...) + } + for len(a) < f.SyscallParamCount() { + a = append(a, "0") + } + return strings.Join(a, ", ") +} + +// HelperCallParamList returns source code of call into function f helper. +func (f *Fn) HelperCallParamList() string { + a := make([]string, 0, len(f.Params)) + for _, p := range f.Params { + s := p.Name + if p.Type == "string" { + s = p.tmpVar() + } + a = append(a, s) + } + return strings.Join(a, ", ") +} + +// IsUTF16 is true, if f is W (utf16) function. It is false +// for all A (ascii) functions. +func (_ *Fn) IsUTF16() bool { + return true +} + +// StrconvFunc returns name of Go string to OS string function for f. +func (f *Fn) StrconvFunc() string { + if f.IsUTF16() { + return syscalldot() + "UTF16PtrFromString" + } + return syscalldot() + "BytePtrFromString" +} + +// StrconvType returns Go type name used for OS string for f. +func (f *Fn) StrconvType() string { + if f.IsUTF16() { + return "*uint16" + } + return "*byte" +} + +// HasStringParam is true, if f has at least one string parameter. +// Otherwise it is false. +func (f *Fn) HasStringParam() bool { + for _, p := range f.Params { + if p.Type == "string" { + return true + } + } + return false +} + +var uniqDllFuncName = make(map[string]bool) + +// IsNotDuplicate is true if f is not a duplicated function +func (f *Fn) IsNotDuplicate() bool { + funcName := f.DLLFuncName() + if uniqDllFuncName[funcName] == false { + uniqDllFuncName[funcName] = true + return true + } + + return false +} + +// HelperName returns name of function f helper. +func (f *Fn) HelperName() string { + if !f.HasStringParam() { + return f.Name + } + return "_" + f.Name +} + +// Source files and functions. +type Source struct { + Funcs []*Fn + Files []string +} + +// ParseFiles parses files listed in fs and extracts all syscall +// functions listed in sys comments. It returns source files +// and functions collection *Source if successful. +func ParseFiles(fs []string) (*Source, error) { + src := &Source{ + Funcs: make([]*Fn, 0), + Files: make([]string, 0), + } + for _, file := range fs { + if err := src.ParseFile(file); err != nil { + return nil, err + } + } + return src, nil +} + +// DLLs return dll names for a source set src. +func (src *Source) DLLs() []string { + uniq := make(map[string]bool) + r := make([]string, 0) + for _, f := range src.Funcs { + name := f.DLLName() + if _, found := uniq[name]; !found { + uniq[name] = true + r = append(r, name) + } + } + return r +} + +// ParseFile adds additional file path to a source set src. +func (src *Source) ParseFile(path string) error { + file, err := os.Open(path) + if err != nil { + return err + } + defer file.Close() + + s := bufio.NewScanner(file) + for s.Scan() { + t := trim(s.Text()) + if len(t) < 7 { + continue + } + if !strings.HasPrefix(t, "//sys") { + continue + } + t = t[5:] + if !(t[0] == ' ' || t[0] == '\t') { + continue + } + f, err := newFn(t[1:]) + if err != nil { + return err + } + src.Funcs = append(src.Funcs, f) + } + if err := s.Err(); err != nil { + return err + } + src.Files = append(src.Files, path) + + // get package name + fset := token.NewFileSet() + _, err = file.Seek(0, 0) + if err != nil { + return err + } + pkg, err := parser.ParseFile(fset, "", file, parser.PackageClauseOnly) + if err != nil { + return err + } + packageName = pkg.Name.Name + + return nil +} + +// Generate output source file from a source set src. +func (src *Source) Generate(w io.Writer) error { + funcMap := template.FuncMap{ + "packagename": packagename, + "syscalldot": syscalldot, + } + t := template.Must(template.New("main").Funcs(funcMap).Parse(srcTemplate)) + err := t.Execute(w, src) + if err != nil { + return errors.New("Failed to execute template: " + err.Error()) + } + return nil +} + +func usage() { + fmt.Fprintf(os.Stderr, "usage: mksyscall_windows [flags] [path ...]\n") + flag.PrintDefaults() + os.Exit(1) +} + +func main() { + flag.Usage = usage + flag.Parse() + if len(flag.Args()) <= 0 { + fmt.Fprintf(os.Stderr, "no files to parse provided\n") + usage() + } + + src, err := ParseFiles(flag.Args()) + if err != nil { + log.Fatal(err) + } + + var buf bytes.Buffer + if err := src.Generate(&buf); err != nil { + log.Fatal(err) + } + + data, err := format.Source(buf.Bytes()) + if err != nil { + log.Fatal(err) + } + if *filename == "" { + _, err = os.Stdout.Write(data) + } else { + err = ioutil.WriteFile(*filename, data, 0644) + } + if err != nil { + log.Fatal(err) + } +} + +// TODO: use println instead to print in the following template +const srcTemplate = ` + +{{define "main"}}// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package {{packagename}} + +import "github.com/Microsoft/go-winio" +import "unsafe"{{if syscalldot}} +import "syscall"{{end}} + +var _ unsafe.Pointer + +var ( +{{template "dlls" .}} +{{template "funcnames" .}}) +{{range .Funcs}}{{if .HasStringParam}}{{template "helperbody" .}}{{end}}{{template "funcbody" .}}{{end}} +{{end}} + +{{/* help functions */}} + +{{define "dlls"}}{{range .DLLs}} mod{{.}} = {{syscalldot}}NewLazyDLL("{{.}}.dll") +{{end}}{{end}} + +{{define "funcnames"}}{{range .Funcs}}{{if .IsNotDuplicate}} proc{{.DLLFuncName}} = mod{{.DLLName}}.NewProc("{{.DLLFuncName}}"){{end}} +{{end}}{{end}} + +{{define "helperbody"}} +func {{.Name}}({{.ParamList}}) {{template "results" .}}{ +{{template "helpertmpvars" .}} return {{.HelperName}}({{.HelperCallParamList}}) +} +{{end}} + +{{define "funcbody"}} +func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{ +{{template "tmpvars" .}} {{template "syscallcheck" .}}{{template "syscall" .}} +{{template "seterror" .}}{{template "printtrace" .}} return +} +{{end}} + +{{define "helpertmpvars"}}{{range .Params}}{{if .TmpVarHelperCode}} {{.TmpVarHelperCode}} +{{end}}{{end}}{{end}} + +{{define "tmpvars"}}{{range .Params}}{{if .TmpVarCode}} {{.TmpVarCode}} +{{end}}{{end}}{{end}} + +{{define "results"}}{{if .Rets.List}}{{.Rets.List}} {{end}}{{end}} + +{{define "syscallcheck"}}{{if .ConfirmProc}}if {{.Rets.ErrorVarName}} = proc{{.DLLFuncName}}.Find(); {{.Rets.ErrorVarName}} != nil { + return +} +{{end}}{{end}} + +{{define "syscall"}}{{.Rets.SetReturnValuesCode}}{{.Syscall}}(proc{{.DLLFuncName}}.Addr(), {{.ParamCount}}, {{.SyscallParamList}}){{end}} + +{{define "seterror"}}{{if .Rets.SetErrorCode}} {{.Rets.SetErrorCode}} +{{end}}{{end}} + +{{define "printtrace"}}{{if .PrintTrace}} print("SYSCALL: {{.Name}}(", {{.ParamPrintList}}") (", {{.Rets.PrintList}}")\n") +{{end}}{{end}} + +` diff --git a/vendor/github.com/Microsoft/hcsshim/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/nametoguid.go new file mode 100644 index 00000000..1a522f95 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/nametoguid.go @@ -0,0 +1,20 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// NameToGuid converts the given string into a GUID using the algorithm in the +// Host Compute Service, ensuring GUIDs generated with the same string are common +// across all clients. +func NameToGuid(name string) (id GUID, err error) { + title := "hcsshim::NameToGuid " + logrus.Debugf(title+"Name %s", name) + + err = nameToGuid(name, &id) + if err != nil { + err = makeErrorf(err, title, "name=%s", name) + logrus.Error(err) + return + } + + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/preparelayer.go new file mode 100644 index 00000000..69b5fe04 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/preparelayer.go @@ -0,0 +1,36 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// PrepareLayer finds a mounted read-write layer matching layerId and enables the +// the filesystem filter for use on that layer. This requires the paths to all +// parent layers, and is necessary in order to view or interact with the layer +// as an actual filesystem (reading and writing files, creating directories, etc). +// Disabling the filter must be done via UnprepareLayer. +func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { + title := "hcsshim::PrepareLayer " + logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = prepareLayer(&infop, layerId, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go new file mode 100644 index 00000000..d6e63c92 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -0,0 +1,389 @@ +package hcsshim + +import ( + "encoding/json" + "io" + "syscall" + "time" + + "github.com/Sirupsen/logrus" +) + +// ContainerError is an error encountered in HCS +type process struct { + handle hcsProcess + processID int + container *container + cachedPipes *cachedPipes + callbackNumber uintptr +} + +type cachedPipes struct { + stdIn syscall.Handle + stdOut syscall.Handle + stdErr syscall.Handle +} + +type processModifyRequest struct { + Operation string + ConsoleSize *consoleSize `json:",omitempty"` + CloseHandle *closeHandle `json:",omitempty"` +} + +type consoleSize struct { + Height uint16 + Width uint16 +} + +type closeHandle struct { + Handle string +} + +type processStatus struct { + ProcessID uint32 + Exited bool + ExitCode uint32 + LastWaitResult int32 +} + +const ( + stdIn string = "StdIn" + stdOut string = "StdOut" + stdErr string = "StdErr" +) + +const ( + modifyConsoleSize string = "ConsoleSize" + modifyCloseHandle string = "CloseHandle" +) + +// Pid returns the process ID of the process within the container. +func (process *process) Pid() int { + return process.processID +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *process) Kill() error { + operation := "Kill" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + var resultp *uint16 + err := hcsTerminateProcess(process.handle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Wait waits for the process to exit. +func (process *process) Wait() error { + operation := "Wait" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if hcsCallbacksSupported { + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + return makeProcessError(process, operation, "", err) + } + } else { + _, err := process.waitTimeoutInternal(syscall.INFINITE) + if err != nil { + return makeProcessError(process, operation, "", err) + } + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *process) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if hcsCallbacksSupported { + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) + if err != nil { + return makeProcessError(process, operation, "", err) + } + } else { + finished, err := waitTimeoutHelper(process, timeout) + if !finished { + err = ErrTimeout + } + if err != nil { + return makeProcessError(process, operation, "", err) + } + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *process) hcsWait(timeout uint32) (bool, error) { + var ( + resultp *uint16 + exitEvent syscall.Handle + ) + err := hcsCreateProcessWait(process.handle, &exitEvent, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return false, err + } + defer syscall.CloseHandle(exitEvent) + + return waitForSingleObject(exitEvent, timeout) +} + +func (process *process) waitTimeoutInternal(timeout uint32) (bool, error) { + return waitTimeoutInternalHelper(process, timeout) +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *process) ExitCode() (int, error) { + operation := "ExitCode" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + properties, err := process.properties() + if err != nil { + return 0, makeProcessError(process, operation, "", err) + } + + if properties.Exited == false { + return 0, makeProcessError(process, operation, "", ErrInvalidProcessState) + } + + logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode) + return int(properties.ExitCode), nil +} + +// ResizeConsole resizes the console of the process. +func (process *process) ResizeConsole(width, height uint16) error { + operation := "ResizeConsole" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + modifyRequest := processModifyRequest{ + Operation: modifyConsoleSize, + ConsoleSize: &consoleSize{ + Height: height, + Width: width, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *process) properties() (*processStatus, error) { + operation := "properties" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + var ( + resultp *uint16 + propertiesp *uint16 + ) + err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) + + properties := &processStatus{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, err + } + + logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw) + return properties, nil +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { + operation := "Stdio" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + var stdIn, stdOut, stdErr syscall.Handle + + if process.cachedPipes == nil { + var ( + processInfo hcsProcessInformation + resultp *uint16 + ) + err := hcsGetProcessInfo(process.handle, &processInfo, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, "", err) + } + + stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError + } else { + // Use cached pipes + stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr + + // Invalidate the cache + process.cachedPipes = nil + } + + pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return pipes[0], pipes[1], pipes[2], nil +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *process) CloseStdin() error { + operation := "CloseStdin" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *process) Close() error { + operation := "Close" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + // Don't double free this + if process.handle == 0 { + return nil + } + + if hcsCallbacksSupported { + if err := process.unregisterCallback(); err != nil { + return makeProcessError(process, operation, "", err) + } + } + + if err := hcsCloseProcess(process.handle); err != nil { + return makeProcessError(process, operation, "", err) + } + + process.handle = 0 + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// closeProcess wraps process.Close for use by a finalizer +func closeProcess(process *process) { + process.Close() +} + +func (process *process) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + process.callbackNumber = callbackNumber + + return nil +} + +func (process *process) unregisterCallback() error { + callbackNumber := process.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterProcessCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterProcessCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/processimage.go b/vendor/github.com/Microsoft/hcsshim/processimage.go new file mode 100644 index 00000000..fadb1b92 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/processimage.go @@ -0,0 +1,23 @@ +package hcsshim + +import "os" + +// ProcessBaseLayer post-processes a base layer that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessBaseLayer(path string) error { + err := processBaseImage(path) + if err != nil { + return &os.PathError{Op: "ProcessBaseLayer", Path: path, Err: err} + } + return nil +} + +// ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessUtilityVMImage(path string) error { + err := processUtilityImage(path) + if err != nil { + return &os.PathError{Op: "ProcessUtilityVMImage", Path: path, Err: err} + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go new file mode 100644 index 00000000..d0ead0bd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/Sirupsen/logrus" + +// UnprepareLayer disables the filesystem filter for the read-write layer with +// the given id. +func UnprepareLayer(info DriverInfo, layerId string) error { + title := "hcsshim::UnprepareLayer " + logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = unprepareLayer(&infop, layerId) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/utils.go b/vendor/github.com/Microsoft/hcsshim/utils.go new file mode 100644 index 00000000..c219e2c0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/utils.go @@ -0,0 +1,39 @@ +package hcsshim + +import ( + "io" + "syscall" + + "github.com/Microsoft/go-winio" +) + +var ( + vmcomputedll = syscall.NewLazyDLL("vmcompute.dll") + hcsCallbackAPI = vmcomputedll.NewProc("HcsRegisterComputeSystemCallback") + hcsCallbacksSupported = hcsCallbackAPI.Find() == nil +) + +// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles +// if there is an error. +func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) { + fs := make([]io.ReadWriteCloser, len(hs)) + for i, h := range hs { + if h != syscall.Handle(0) { + if err == nil { + fs[i], err = winio.MakeOpenFile(h) + } + if err != nil { + syscall.Close(h) + } + } + } + if err != nil { + for _, f := range fs { + if f != nil { + f.Close() + } + } + return nil, err + } + return fs, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/version.go b/vendor/github.com/Microsoft/hcsshim/version.go new file mode 100644 index 00000000..ae10c23d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/version.go @@ -0,0 +1,7 @@ +package hcsshim + +// IsTP4 returns whether the currently running Windows build is at least TP4. +func IsTP4() bool { + // HNSCall was not present in TP4 + return procHNSCall.Find() != nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/waithelper.go b/vendor/github.com/Microsoft/hcsshim/waithelper.go new file mode 100644 index 00000000..8ce65ae1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/waithelper.go @@ -0,0 +1,126 @@ +package hcsshim + +import ( + "github.com/Sirupsen/logrus" + "syscall" + "time" +) + +type waitable interface { + waitTimeoutInternal(timeout uint32) (bool, error) + hcsWait(timeout uint32) (bool, error) +} + +func waitTimeoutHelper(object waitable, timeout time.Duration) (bool, error) { + var ( + millis uint32 + ) + + for totalMillis := uint64(timeout / time.Millisecond); totalMillis > 0; totalMillis = totalMillis - uint64(millis) { + if totalMillis >= syscall.INFINITE { + millis = syscall.INFINITE - 1 + } else { + millis = uint32(totalMillis) + } + + result, err := object.waitTimeoutInternal(millis) + + if err != nil { + return result, err + } + } + return true, nil +} + +func waitTimeoutInternalHelper(object waitable, timeout uint32) (bool, error) { + return object.hcsWait(timeout) +} + +func waitForSingleObject(handle syscall.Handle, timeout uint32) (bool, error) { + s, e := syscall.WaitForSingleObject(handle, timeout) + switch s { + case syscall.WAIT_OBJECT_0: + return true, nil + case syscall.WAIT_TIMEOUT: + return false, nil + default: + return false, e + } +} + +func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + err = processHcsResult(err, resultp) + if IsPending(err) { + return waitForNotification(callbackNumber, expectedNotification, timeout) + } + + return err +} + +func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + callbackMapLock.RLock() + channels := callbackMap[callbackNumber].channels + callbackMapLock.RUnlock() + + expectedChannel := channels[expectedNotification] + if expectedChannel == nil { + logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + return ErrInvalidNotificationType + } + + if timeout != nil { + timer := time.NewTimer(*timeout) + defer timer.Stop() + + select { + case err, ok := <-expectedChannel: + if !ok { + return ErrHandleClose + } + return err + case err, ok := <-channels[hcsNotificationSystemExited]: + if !ok { + return ErrHandleClose + } + // If the expected notification is hcsNotificationSystemExited which of the two selects + // chosen is random. Return the raw error if hcsNotificationSystemExited is expected + if channels[hcsNotificationSystemExited] == expectedChannel { + return err + } + return ErrUnexpectedContainerExit + case _, ok := <-channels[hcsNotificationServiceDisconnect]: + if !ok { + return ErrHandleClose + } + // hcsNotificationServiceDisconnect should never be an expected notification + // it does not need the same handling as hcsNotificationSystemExited + return ErrUnexpectedProcessAbort + case <-timer.C: + return ErrTimeout + } + } + select { + case err, ok := <-expectedChannel: + if !ok { + return ErrHandleClose + } + return err + case err, ok := <-channels[hcsNotificationSystemExited]: + if !ok { + return ErrHandleClose + } + // If the expected notification is hcsNotificationSystemExited which of the two selects + // chosen is random. Return the raw error if hcsNotificationSystemExited is expected + if channels[hcsNotificationSystemExited] == expectedChannel { + return err + } + return ErrUnexpectedContainerExit + case _, ok := <-channels[hcsNotificationServiceDisconnect]: + if !ok { + return ErrHandleClose + } + // hcsNotificationServiceDisconnect should never be an expected notification + // it does not need the same handling as hcsNotificationSystemExited + return ErrUnexpectedProcessAbort + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go new file mode 100644 index 00000000..3ae95864 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go @@ -0,0 +1,1317 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hcsshim + +import "github.com/Microsoft/go-winio" +import "unsafe" +import "syscall" + +var _ unsafe.Pointer + +var ( + modole32 = syscall.NewLazyDLL("ole32.dll") + modiphlpapi = syscall.NewLazyDLL("iphlpapi.dll") + modvmcompute = syscall.NewLazyDLL("vmcompute.dll") + + procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") + procActivateLayer = modvmcompute.NewProc("ActivateLayer") + procCopyLayer = modvmcompute.NewProc("CopyLayer") + procCreateLayer = modvmcompute.NewProc("CreateLayer") + procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") + procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") + procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExportLayer = modvmcompute.NewProc("ExportLayer") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procImportLayer = modvmcompute.NewProc("ImportLayer") + procLayerExists = modvmcompute.NewProc("LayerExists") + procNameToGuid = modvmcompute.NewProc("NameToGuid") + procPrepareLayer = modvmcompute.NewProc("PrepareLayer") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") + procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") + procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") + procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin") + procImportLayerNext = modvmcompute.NewProc("ImportLayerNext") + procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite") + procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd") + procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin") + procExportLayerNext = modvmcompute.NewProc("ExportLayerNext") + procExportLayerRead = modvmcompute.NewProc("ExportLayerRead") + procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd") + procCreateComputeSystem = modvmcompute.NewProc("CreateComputeSystem") + procCreateProcessWithStdHandlesInComputeSystem = modvmcompute.NewProc("CreateProcessWithStdHandlesInComputeSystem") + procResizeConsoleInComputeSystem = modvmcompute.NewProc("ResizeConsoleInComputeSystem") + procShutdownComputeSystem = modvmcompute.NewProc("ShutdownComputeSystem") + procStartComputeSystem = modvmcompute.NewProc("StartComputeSystem") + procTerminateComputeSystem = modvmcompute.NewProc("TerminateComputeSystem") + procTerminateProcessInComputeSystem = modvmcompute.NewProc("TerminateProcessInComputeSystem") + procWaitForProcessInComputeSystem = modvmcompute.NewProc("WaitForProcessInComputeSystem") + procGetComputeSystemProperties = modvmcompute.NewProc("GetComputeSystemProperties") + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsCreateComputeSystemWait = modvmcompute.NewProc("HcsCreateComputeSystemWait") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsCreateProcessWait = modvmcompute.NewProc("HcsCreateProcessWait") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") + + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHNSCall = modvmcompute.NewProc("HNSCall") +) + +func coTaskMemFree(buffer unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) + return +} + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func activateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _activateLayer(info, _p0) +} + +func _activateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procActivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(srcId) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(dstId) + if hr != nil { + return + } + return _copyLayer(info, _p0, _p1, descriptors) +} + +func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCopyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createLayer(info *driverInfo, id string, parent string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createLayer(info, _p0, _p1) +} + +func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { + if hr = procCreateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createSandboxLayer(info, _p0, _p1, descriptors) +} + +func _createSandboxLayer(info *driverInfo, id *uint16, parent *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCreateSandboxLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + if hr = procExpandSandboxSize.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func deactivateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _deactivateLayer(info, _p0) +} + +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDeactivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func destroyLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _destroyLayer(info, _p0) +} + +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDestroyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _exportLayer(info, _p0, _p1, descriptors) +} + +func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getLayerMountPath(info, _p0, length, buffer) +} + +func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { + if hr = procGetLayerMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + if hr = procGetBaseImages.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _importLayer(info, _p0, _p1, descriptors) +} + +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + if hr = procLayerExists.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func nameToGuid(name string, guid *GUID) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *GUID) (hr error) { + if hr = procNameToGuid.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procPrepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procUnprepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + if hr = procProcessBaseImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + if hr = procProcessUtilityImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _importLayerBegin(info, _p0, descriptors, context) +} + +func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procImportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(fileName) + if hr != nil { + return + } + return _importLayerNext(context, _p0, fileInfo) +} + +func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) { + if hr = procImportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerWrite(context uintptr, buffer []byte) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procImportLayerWrite.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerEnd(context uintptr) (hr error) { + if hr = procImportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _exportLayerBegin(info, _p0, descriptors, context) +} + +func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procExportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) { + if hr = procExportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procExportLayerRead.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerEnd(context uintptr) (hr error) { + if hr = procExportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createComputeSystem(id string, configuration string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _createComputeSystem(_p0, _p1) +} + +func _createComputeSystem(id *uint16, configuration *uint16) (hr error) { + if hr = procCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateComputeSystem.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createProcessWithStdHandlesInComputeSystem(id string, paramsJson string, pid *uint32, stdin *syscall.Handle, stdout *syscall.Handle, stderr *syscall.Handle) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(paramsJson) + if hr != nil { + return + } + return _createProcessWithStdHandlesInComputeSystem(_p0, _p1, pid, stdin, stdout, stderr) +} + +func _createProcessWithStdHandlesInComputeSystem(id *uint16, paramsJson *uint16, pid *uint32, stdin *syscall.Handle, stdout *syscall.Handle, stderr *syscall.Handle) (hr error) { + if hr = procCreateProcessWithStdHandlesInComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateProcessWithStdHandlesInComputeSystem.Addr(), 6, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(paramsJson)), uintptr(unsafe.Pointer(pid)), uintptr(unsafe.Pointer(stdin)), uintptr(unsafe.Pointer(stdout)), uintptr(unsafe.Pointer(stderr))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func resizeConsoleInComputeSystem(id string, pid uint32, height uint16, width uint16, flags uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _resizeConsoleInComputeSystem(_p0, pid, height, width, flags) +} + +func _resizeConsoleInComputeSystem(id *uint16, pid uint32, height uint16, width uint16, flags uint32) (hr error) { + if hr = procResizeConsoleInComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procResizeConsoleInComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(pid), uintptr(height), uintptr(width), uintptr(flags), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func shutdownComputeSystem(id string, timeout uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _shutdownComputeSystem(_p0, timeout) +} + +func _shutdownComputeSystem(id *uint16, timeout uint32) (hr error) { + if hr = procShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procShutdownComputeSystem.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(timeout), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func startComputeSystem(id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _startComputeSystem(_p0) +} + +func _startComputeSystem(id *uint16) (hr error) { + if hr = procStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procStartComputeSystem.Addr(), 1, uintptr(unsafe.Pointer(id)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func terminateComputeSystem(id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _terminateComputeSystem(_p0) +} + +func _terminateComputeSystem(id *uint16) (hr error) { + if hr = procTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procTerminateComputeSystem.Addr(), 1, uintptr(unsafe.Pointer(id)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func terminateProcessInComputeSystem(id string, pid uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _terminateProcessInComputeSystem(_p0, pid) +} + +func _terminateProcessInComputeSystem(id *uint16, pid uint32) (hr error) { + if hr = procTerminateProcessInComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procTerminateProcessInComputeSystem.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(pid), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func waitForProcessInComputeSystem(id string, pid uint32, timeout uint32, exitCode *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _waitForProcessInComputeSystem(_p0, pid, timeout, exitCode) +} + +func _waitForProcessInComputeSystem(id *uint16, pid uint32, timeout uint32, exitCode *uint32) (hr error) { + if hr = procWaitForProcessInComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procWaitForProcessInComputeSystem.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(pid), uintptr(timeout), uintptr(unsafe.Pointer(exitCode)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getComputeSystemProperties(id string, flags uint32, properties **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getComputeSystemProperties(_p0, flags, properties) +} + +func _getComputeSystemProperties(id *uint16, flags uint32, properties **uint16) (hr error) { + if hr = procGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetComputeSystemProperties.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(flags), uintptr(unsafe.Pointer(properties))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) +} + +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsOpenComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { + if hr = procHcsCloseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { + if hr = procHcsModifyComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateComputeSystemWait(computeSystem hcsSystem, exitEvent *syscall.Handle, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystemWait.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCreateComputeSystemWait.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(exitEvent)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(processParameters) + if hr != nil { + return + } + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) +} + +func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsCreateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsOpenProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCloseProcess(process hcsProcess) (hr error) { + if hr = procHcsCloseProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { + if hr = procHcsGetProcessInfo.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { + if hr = procHcsGetProcessProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateProcessWait(process hcsProcess, settings *syscall.Handle, result **uint16) (hr error) { + if hr = procHcsCreateProcessWait.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCreateProcessWait.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetServiceProperties(_p0, properties, result) +} + +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetServiceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyServiceSettings(_p0, result) +} + +func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyServiceSettings.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateComputeSystemTP5(id string, configuration string, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystemTP5(_p0, _p1, computeSystem, result) +} + +func _hcsCreateComputeSystemTP5(id *uint16, configuration *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsStartComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsShutdownComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsPauseComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsResumeComputeSystemTP5(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} diff --git a/vendor/github.com/containers/image/docker/docker_client.go b/vendor/github.com/containers/image/docker/docker_client.go index 900a4bf8..f5b31841 100644 --- a/vendor/github.com/containers/image/docker/docker_client.go +++ b/vendor/github.com/containers/image/docker/docker_client.go @@ -36,24 +36,23 @@ const ( // dockerClient is configuration for dealing with a single Docker registry. type dockerClient struct { - ctx *types.SystemContext registry string username string password string wwwAuthenticate string // Cache of a value set by ping() if scheme is not empty scheme string // Cache of a value returned by a successful ping() if not empty client *http.Client - signatureBase signatureStorageBase } // newDockerClient returns a new dockerClient instance for refHostname (a host a specified in the Docker image reference, not canonicalized to dockerRegistry) -// “write” specifies whether the client will be used for "write" access (in particular passed to lookaside.go:toplevelFromSection) -func newDockerClient(ctx *types.SystemContext, ref dockerReference, write bool) (*dockerClient, error) { - registry := ref.ref.Hostname() - if registry == dockerHostname { +func newDockerClient(ctx *types.SystemContext, refHostname string) (*dockerClient, error) { + var registry string + if refHostname == dockerHostname { registry = dockerRegistry + } else { + registry = refHostname } - username, password, err := getAuth(ref.ref.Hostname()) + username, password, err := getAuth(refHostname) if err != nil { return nil, err } @@ -79,19 +78,11 @@ func newDockerClient(ctx *types.SystemContext, ref dockerReference, write bool) if tr != nil { client.Transport = tr } - - sigBase, err := configuredSignatureStorageBase(ctx, ref, write) - if err != nil { - return nil, err - } - return &dockerClient{ - ctx: ctx, - registry: registry, - username: username, - password: password, - client: client, - signatureBase: sigBase, + registry: registry, + username: username, + password: password, + client: client, }, nil } @@ -334,9 +325,14 @@ func (c *dockerClient) ping() (*pingResponse, error) { } return pr, nil } - pr, err := ping("https") - if err != nil && c.ctx.DockerInsecureSkipTLSVerify { - pr, err = ping("http") + scheme := "https" + pr, err := ping(scheme) + if err != nil { + scheme = "http" + pr, err = ping(scheme) + if err == nil { + return pr, nil + } } return pr, err } diff --git a/vendor/github.com/containers/image/docker/docker_image_dest.go b/vendor/github.com/containers/image/docker/docker_image_dest.go index a16cf3fb..b0fd5f68 100644 --- a/vendor/github.com/containers/image/docker/docker_image_dest.go +++ b/vendor/github.com/containers/image/docker/docker_image_dest.go @@ -8,9 +8,6 @@ import ( "io" "io/ioutil" "net/http" - "net/url" - "os" - "path/filepath" "strconv" "github.com/Sirupsen/logrus" @@ -21,13 +18,11 @@ import ( type dockerImageDestination struct { ref dockerReference c *dockerClient - // State - manifestDigest string // or "" if not yet known. } // newImageDestination creates a new ImageDestination for the specified image reference. func newImageDestination(ctx *types.SystemContext, ref dockerReference) (types.ImageDestination, error) { - c, err := newDockerClient(ctx, ref, true) + c, err := newDockerClient(ctx, ref.ref.Hostname()) if err != nil { return nil, err } @@ -149,7 +144,6 @@ func (d *dockerImageDestination) PutManifest(m []byte) error { if err != nil { return err } - d.manifestDigest = digest url := fmt.Sprintf(manifestURL, d.ref.ref.RemoteName(), digest) headers := map[string][]string{} @@ -174,91 +168,12 @@ func (d *dockerImageDestination) PutManifest(m []byte) error { } func (d *dockerImageDestination) PutSignatures(signatures [][]byte) error { - // FIXME? This overwrites files one at a time, definitely not atomic. - // A failure when updating signatures with a reordered copy could lose some of them. - - // Skip dealing with the manifest digest if not necessary. - if len(signatures) == 0 { - return nil + if len(signatures) != 0 { + return fmt.Errorf("Pushing signatures to a Docker Registry is not supported") } - if d.c.signatureBase == nil { - return fmt.Errorf("Pushing signatures to a Docker Registry is not supported, and there is no applicable signature storage configured") - } - - // FIXME: This assumption that signatures are stored after the manifest rather breaks the model. - if d.manifestDigest == "" { - return fmt.Errorf("Unknown manifest digest, can't add signatures") - } - - for i, signature := range signatures { - url := signatureStorageURL(d.c.signatureBase, d.manifestDigest, i) - if url == nil { - return fmt.Errorf("Internal error: signatureStorageURL with non-nil base returned nil") - } - err := d.putOneSignature(url, signature) - if err != nil { - return err - } - } - // Remove any other signatures, if present. - // We stop at the first missing signature; if a previous deleting loop aborted - // prematurely, this may not clean up all of them, but one missing signature - // is enough for dockerImageSource to stop looking for other signatures, so that - // is sufficient. - for i := len(signatures); ; i++ { - url := signatureStorageURL(d.c.signatureBase, d.manifestDigest, i) - if url == nil { - return fmt.Errorf("Internal error: signatureStorageURL with non-nil base returned nil") - } - missing, err := d.c.deleteOneSignature(url) - if err != nil { - return err - } - if missing { - break - } - } - return nil } -// putOneSignature stores one signature to url. -func (d *dockerImageDestination) putOneSignature(url *url.URL, signature []byte) error { - switch url.Scheme { - case "file": - logrus.Debugf("Writing to %s", url.Path) - err := os.MkdirAll(filepath.Dir(url.Path), 0755) - if err != nil { - return err - } - err = ioutil.WriteFile(url.Path, signature, 0644) - if err != nil { - return err - } - return nil - - default: - return fmt.Errorf("Unsupported scheme when writing signature to %s", url.String()) - } -} - -// deleteOneSignature deletes a signature from url, if it exists. -// If it successfully determines that the signature does not exist, returns (true, nil) -func (c *dockerClient) deleteOneSignature(url *url.URL) (missing bool, err error) { - switch url.Scheme { - case "file": - logrus.Debugf("Deleting %s", url.Path) - err := os.Remove(url.Path) - if err != nil && os.IsNotExist(err) { - return true, nil - } - return false, err - - default: - return false, fmt.Errorf("Unsupported scheme when deleting signature from %s", url.String()) - } -} - // Commit marks the process of storing the image as successful and asks for the image to be persisted. // WARNING: This does not have any transactional semantics: // - Uploaded data MAY be visible to others before Commit() is called diff --git a/vendor/github.com/containers/image/docker/docker_image_src.go b/vendor/github.com/containers/image/docker/docker_image_src.go index 47d47f72..f0867e05 100644 --- a/vendor/github.com/containers/image/docker/docker_image_src.go +++ b/vendor/github.com/containers/image/docker/docker_image_src.go @@ -6,8 +6,6 @@ import ( "io/ioutil" "mime" "net/http" - "net/url" - "os" "strconv" "github.com/Sirupsen/logrus" @@ -28,9 +26,6 @@ type dockerImageSource struct { ref dockerReference requestedManifestMIMETypes []string c *dockerClient - // State - cachedManifest []byte // nil if not loaded yet - cachedManifestMIMEType string // Only valid if cachedManifest != nil } // newImageSource creates a new ImageSource for the specified image reference, @@ -38,7 +33,7 @@ type dockerImageSource struct { // nil requestedManifestMIMETypes means manifest.DefaultRequestedManifestMIMETypes. // The caller must call .Close() on the returned ImageSource. func newImageSource(ctx *types.SystemContext, ref dockerReference, requestedManifestMIMETypes []string) (*dockerImageSource, error) { - c, err := newDockerClient(ctx, ref, false) + c, err := newDockerClient(ctx, ref.ref.Hostname()) if err != nil { return nil, err } @@ -76,28 +71,9 @@ func simplifyContentType(contentType string) string { } func (s *dockerImageSource) GetManifest() ([]byte, string, error) { - err := s.ensureManifestIsLoaded() - if err != nil { - return nil, "", err - } - return s.cachedManifest, s.cachedManifestMIMEType, nil -} - -// ensureManifestIsLoaded sets s.cachedManifest and s.cachedManifestMIMEType -// -// ImageSource implementations are not required or expected to do any caching, -// but because our signatures are “attached” to the manifest digest, -// we need to ensure that the digest of the manifest returned by GetManifest -// and used by GetSignatures are consistent, otherwise we would get spurious -// signature verification failures when pulling while a tag is being updated. -func (s *dockerImageSource) ensureManifestIsLoaded() error { - if s.cachedManifest != nil { - return nil - } - reference, err := s.ref.tagOrDigest() if err != nil { - return err + return nil, "", err } url := fmt.Sprintf(manifestURL, s.ref.ref.RemoteName(), reference) // TODO(runcom) set manifest version header! schema1 for now - then schema2 etc etc and v1 @@ -106,20 +82,18 @@ func (s *dockerImageSource) ensureManifestIsLoaded() error { headers["Accept"] = s.requestedManifestMIMETypes res, err := s.c.makeRequest("GET", url, headers, nil) if err != nil { - return err + return nil, "", err } defer res.Body.Close() manblob, err := ioutil.ReadAll(res.Body) if err != nil { - return err + return nil, "", err } if res.StatusCode != http.StatusOK { - return errFetchManifest{res.StatusCode, manblob} + return nil, "", errFetchManifest{res.StatusCode, manblob} } // We might validate manblob against the Docker-Content-Digest header here to protect against transport errors. - s.cachedManifest = manblob - s.cachedManifestMIMEType = simplifyContentType(res.Header.Get("Content-Type")) - return nil + return manblob, simplifyContentType(res.Header.Get("Content-Type")), nil } // GetBlob returns a stream for the specified blob, and the blob’s size (or -1 if unknown). @@ -142,77 +116,12 @@ func (s *dockerImageSource) GetBlob(digest string) (io.ReadCloser, int64, error) } func (s *dockerImageSource) GetSignatures() ([][]byte, error) { - if s.c.signatureBase == nil { // Skip dealing with the manifest digest if not necessary. - return [][]byte{}, nil - } - - if err := s.ensureManifestIsLoaded(); err != nil { - return nil, err - } - manifestDigest, err := manifest.Digest(s.cachedManifest) - if err != nil { - return nil, err - } - - signatures := [][]byte{} - for i := 0; ; i++ { - url := signatureStorageURL(s.c.signatureBase, manifestDigest, i) - if url == nil { - return nil, fmt.Errorf("Internal error: signatureStorageURL with non-nil base returned nil") - } - signature, missing, err := s.getOneSignature(url) - if err != nil { - return nil, err - } - if missing { - break - } - signatures = append(signatures, signature) - } - return signatures, nil -} - -// getOneSignature downloads one signature from url. -// If it successfully determines that the signature does not exist, returns with missing set to true and error set to nil. -func (s *dockerImageSource) getOneSignature(url *url.URL) (signature []byte, missing bool, err error) { - switch url.Scheme { - case "file": - logrus.Debugf("Reading %s", url.Path) - sig, err := ioutil.ReadFile(url.Path) - if err != nil { - if os.IsNotExist(err) { - return nil, true, nil - } - return nil, false, err - } - return sig, false, nil - - case "http", "https": - logrus.Debugf("GET %s", url) - res, err := s.c.client.Get(url.String()) - if err != nil { - return nil, false, err - } - defer res.Body.Close() - if res.StatusCode == http.StatusNotFound { - return nil, true, nil - } else if res.StatusCode != http.StatusOK { - return nil, false, fmt.Errorf("Error reading signature from %s: status %d", url.String(), res.StatusCode) - } - sig, err := ioutil.ReadAll(res.Body) - if err != nil { - return nil, false, err - } - return sig, false, nil - - default: - return nil, false, fmt.Errorf("Unsupported scheme when reading signature from %s", url.String()) - } + return [][]byte{}, nil } // deleteImage deletes the named image from the registry, if supported. func deleteImage(ctx *types.SystemContext, ref dockerReference) error { - c, err := newDockerClient(ctx, ref, true) + c, err := newDockerClient(ctx, ref.ref.Hostname()) if err != nil { return err } @@ -232,7 +141,7 @@ func deleteImage(ctx *types.SystemContext, ref dockerReference) error { return err } defer get.Body.Close() - manifestBody, err := ioutil.ReadAll(get.Body) + body, err := ioutil.ReadAll(get.Body) if err != nil { return err } @@ -241,7 +150,7 @@ func deleteImage(ctx *types.SystemContext, ref dockerReference) error { case http.StatusNotFound: return fmt.Errorf("Unable to delete %v. Image may not exist or is not stored with a v2 Schema in a v2 registry.", ref.ref) default: - return fmt.Errorf("Failed to delete %v: %s (%v)", ref.ref, manifestBody, get.Status) + return fmt.Errorf("Failed to delete %v: %s (%v)", ref.ref, string(body), get.Status) } digest := get.Header.Get("Docker-Content-Digest") @@ -255,7 +164,7 @@ func deleteImage(ctx *types.SystemContext, ref dockerReference) error { } defer delete.Body.Close() - body, err := ioutil.ReadAll(delete.Body) + body, err = ioutil.ReadAll(delete.Body) if err != nil { return err } @@ -263,26 +172,5 @@ func deleteImage(ctx *types.SystemContext, ref dockerReference) error { return fmt.Errorf("Failed to delete %v: %s (%v)", deleteURL, string(body), delete.Status) } - if c.signatureBase != nil { - manifestDigest, err := manifest.Digest(manifestBody) - if err != nil { - return err - } - - for i := 0; ; i++ { - url := signatureStorageURL(c.signatureBase, manifestDigest, i) - if url == nil { - return fmt.Errorf("Internal error: signatureStorageURL with non-nil base returned nil") - } - missing, err := c.deleteOneSignature(url) - if err != nil { - return err - } - if missing { - break - } - } - } - return nil } diff --git a/vendor/github.com/containers/image/docker/lookaside.go b/vendor/github.com/containers/image/docker/lookaside.go deleted file mode 100644 index 2cc0a9f4..00000000 --- a/vendor/github.com/containers/image/docker/lookaside.go +++ /dev/null @@ -1,198 +0,0 @@ -package docker - -import ( - "fmt" - "io/ioutil" - "net/url" - "os" - "path" - "path/filepath" - "strings" - - "github.com/ghodss/yaml" - - "github.com/Sirupsen/logrus" - "github.com/containers/image/types" -) - -// systemRegistriesDirPath is the path to registries.d, used for locating lookaside Docker signature storage. -// You can override this at build time with -// -ldflags '-X github.com/containers/image/docker.systemRegistriesDirPath=$your_path' -var systemRegistriesDirPath = builtinRegistriesDirPath - -// builtinRegistriesDirPath is the path to registries.d. -// DO NOT change this, instead see systemRegistriesDirPath above. -const builtinRegistriesDirPath = "/etc/containers/registries.d" - -// registryConfiguration is one of the files in registriesDirPath configuring lookaside locations, or the result of merging them all. -// NOTE: Keep this in sync with docs/registries.d.md! -type registryConfiguration struct { - DefaultDocker *registryNamespace `json:"default-docker"` - // The key is a namespace, using fully-expanded Docker reference format or parent namespaces (per dockerReference.PolicyConfiguration*), - Docker map[string]registryNamespace `json:"docker"` -} - -// registryNamespace defines lookaside locations for a single namespace. -type registryNamespace struct { - SigStore string `json:"sigstore"` // For reading, and if SigStoreStaging is not present, for writing. - SigStoreStaging string `json:"sigstore-staging"` // For writing only. -} - -// signatureStorageBase is an "opaque" type representing a lookaside Docker signature storage. -// Users outside of this file should use configuredSignatureStorageBase and signatureStorageURL below. -type signatureStorageBase *url.URL // The only documented value is nil, meaning storage is not supported. - -// configuredSignatureStorageBase reads configuration to find an appropriate signature storage URL for ref, for write access if “write”. -func configuredSignatureStorageBase(ctx *types.SystemContext, ref dockerReference, write bool) (signatureStorageBase, error) { - // FIXME? Loading and parsing the config could be cached across calls. - dirPath := registriesDirPath(ctx) - logrus.Debugf(`Using registries.d directory %s for sigstore configuration`, dirPath) - config, err := loadAndMergeConfig(dirPath) - if err != nil { - return nil, err - } - - topLevel := config.signatureTopLevel(ref, write) - if topLevel == "" { - return nil, nil - } - - url, err := url.Parse(topLevel) - if err != nil { - return nil, fmt.Errorf("Invalid signature storage URL %s: %v", topLevel, err) - } - // FIXME? Restrict to explicitly supported schemes? - repo := ref.ref.FullName() // Note that this is without a tag or digest. - if path.Clean(repo) != repo { // Coverage: This should not be reachable because /./ and /../ components are not valid in docker references - return nil, fmt.Errorf("Unexpected path elements in Docker reference %s for signature storage", ref.ref.String()) - } - url.Path = url.Path + "/" + repo - return url, nil -} - -// registriesDirPath returns a path to registries.d -func registriesDirPath(ctx *types.SystemContext) string { - if ctx != nil { - if ctx.RegistriesDirPath != "" { - return ctx.RegistriesDirPath - } - if ctx.RootForImplicitAbsolutePaths != "" { - return filepath.Join(ctx.RootForImplicitAbsolutePaths, systemRegistriesDirPath) - } - } - return systemRegistriesDirPath -} - -// loadAndMergeConfig loads configuration files in dirPath -func loadAndMergeConfig(dirPath string) (*registryConfiguration, error) { - mergedConfig := registryConfiguration{Docker: map[string]registryNamespace{}} - dockerDefaultMergedFrom := "" - nsMergedFrom := map[string]string{} - - dir, err := os.Open(dirPath) - if err != nil { - if os.IsNotExist(err) { - return &mergedConfig, nil - } - return nil, err - } - configNames, err := dir.Readdirnames(0) - if err != nil { - return nil, err - } - for _, configName := range configNames { - if !strings.HasSuffix(configName, ".yaml") { - continue - } - configPath := filepath.Join(dirPath, configName) - configBytes, err := ioutil.ReadFile(configPath) - if err != nil { - return nil, err - } - - var config registryConfiguration - err = yaml.Unmarshal(configBytes, &config) - if err != nil { - return nil, fmt.Errorf("Error parsing %s: %v", configPath, err) - } - - if config.DefaultDocker != nil { - if mergedConfig.DefaultDocker != nil { - return nil, fmt.Errorf(`Error parsing signature storage configuration: "default-docker" defined both in "%s" and "%s"`, - dockerDefaultMergedFrom, configPath) - } - mergedConfig.DefaultDocker = config.DefaultDocker - dockerDefaultMergedFrom = configPath - } - - for nsName, nsConfig := range config.Docker { // includes config.Docker == nil - if _, ok := mergedConfig.Docker[nsName]; ok { - return nil, fmt.Errorf(`Error parsing signature storage configuration: "docker" namespace "%s" defined both in "%s" and "%s"`, - nsName, nsMergedFrom[nsName], configPath) - } - mergedConfig.Docker[nsName] = nsConfig - nsMergedFrom[nsName] = configPath - } - } - - return &mergedConfig, nil -} - -// config.signatureTopLevel returns an URL string configured in config for ref, for write access if “write”. -// (the top level of the storage, namespaced by repo.FullName etc.), or "" if no signature storage should be used. -func (config *registryConfiguration) signatureTopLevel(ref dockerReference, write bool) string { - if config.Docker != nil { - // Look for a full match. - identity := ref.PolicyConfigurationIdentity() - if ns, ok := config.Docker[identity]; ok { - logrus.Debugf(` Using "docker" namespace %s`, identity) - if url := ns.signatureTopLevel(write); url != "" { - return url - } - } - - // Look for a match of the possible parent namespaces. - for _, name := range ref.PolicyConfigurationNamespaces() { - if ns, ok := config.Docker[name]; ok { - logrus.Debugf(` Using "docker" namespace %s`, name) - if url := ns.signatureTopLevel(write); url != "" { - return url - } - } - } - } - // Look for a default location - if config.DefaultDocker != nil { - logrus.Debugf(` Using "default-docker" configuration`) - if url := config.DefaultDocker.signatureTopLevel(write); url != "" { - return url - } - } - logrus.Debugf(" No signature storage configuration found for %s", ref.PolicyConfigurationIdentity()) - return "" -} - -// ns.signatureTopLevel returns an URL string configured in ns for ref, for write access if “write”. -// or "" if nothing has been configured. -func (ns registryNamespace) signatureTopLevel(write bool) string { - if write && ns.SigStoreStaging != "" { - logrus.Debugf(` Using %s`, ns.SigStoreStaging) - return ns.SigStoreStaging - } - if ns.SigStore != "" { - logrus.Debugf(` Using %s`, ns.SigStore) - return ns.SigStore - } - return "" -} - -// signatureStorageURL returns an URL usable for acessing signature index in base with known manifestDigest, or nil if not applicable. -// Returns nil iff base == nil. -func signatureStorageURL(base signatureStorageBase, manifestDigest string, index int) *url.URL { - if base == nil { - return nil - } - url := *base - url.Path = fmt.Sprintf("%s@%s/signature-%d", url.Path, manifestDigest, index+1) - return &url -} diff --git a/vendor/github.com/containers/image/oci/layout/oci_dest.go b/vendor/github.com/containers/image/oci/layout/oci_dest.go index 5ea52fd3..1408cd52 100644 --- a/vendor/github.com/containers/image/oci/layout/oci_dest.go +++ b/vendor/github.com/containers/image/oci/layout/oci_dest.go @@ -4,7 +4,6 @@ import ( "crypto/sha256" "encoding/hex" "encoding/json" - "errors" "fmt" "io" "io/ioutil" @@ -107,12 +106,12 @@ func createManifest(m []byte) ([]byte, string, error) { om := imgspecv1.Manifest{} mt := manifest.GuessMIMEType(m) switch mt { - case manifest.DockerV2Schema1MediaType, manifest.DockerV2Schema1SignedMediaType: + case manifest.DockerV2Schema1MediaType: // There a simple reason about not yet implementing this. // OCI image-spec assure about backward compatibility with docker v2s2 but not v2s1 // generating a v2s2 is a migration docker does when upgrading to 1.10.3 // and I don't think we should bother about this now (I don't want to have migration code here in skopeo) - return nil, "", errors.New("can't create an OCI manifest from Docker V2 schema 1 manifest") + return nil, "", fmt.Errorf("can't create OCI manifest from Docker V2 schema 1 manifest") case manifest.DockerV2Schema2MediaType: if err := json.Unmarshal(m, &om); err != nil { return nil, "", err @@ -128,13 +127,13 @@ func createManifest(m []byte) ([]byte, string, error) { } return b, om.MediaType, nil case manifest.DockerV2ListMediaType: - return nil, "", errors.New("can't create an OCI manifest from Docker V2 schema 2 manifest list") + return nil, "", fmt.Errorf("can't create OCI manifest from Docker V2 schema 2 manifest list") case imgspecv1.MediaTypeImageManifestList: - return nil, "", errors.New("can't create an OCI manifest from OCI manifest list") + return nil, "", fmt.Errorf("can't create OCI manifest from OCI manifest list") case imgspecv1.MediaTypeImageManifest: return m, mt, nil } - return nil, "", fmt.Errorf("unrecognized manifest media type %q", mt) + return nil, "", fmt.Errorf("Unrecognized manifest media type") } func (d *ociImageDestination) PutManifest(m []byte) error { diff --git a/vendor/github.com/containers/image/openshift/openshift-copies.go b/vendor/github.com/containers/image/openshift/openshift-copies.go index 84c8ea96..ec0cda76 100644 --- a/vendor/github.com/containers/image/openshift/openshift-copies.go +++ b/vendor/github.com/containers/image/openshift/openshift-copies.go @@ -950,8 +950,7 @@ func (m *clustersMap) UnmarshalJSON(data []byte) error { return err } for _, e := range a { - cluster := e.Cluster // Allocates a new instance in each iteration - (*m)[e.Name] = &cluster + (*m)[e.Name] = &e.Cluster } return nil } @@ -964,8 +963,7 @@ func (m *authInfosMap) UnmarshalJSON(data []byte) error { return err } for _, e := range a { - authInfo := e.AuthInfo // Allocates a new instance in each iteration - (*m)[e.Name] = &authInfo + (*m)[e.Name] = &e.AuthInfo } return nil } @@ -978,8 +976,7 @@ func (m *contextsMap) UnmarshalJSON(data []byte) error { return err } for _, e := range a { - context := e.Context // Allocates a new instance in each iteration - (*m)[e.Name] = &context + (*m)[e.Name] = &e.Context } return nil } diff --git a/vendor/github.com/containers/image/openshift/openshift.go b/vendor/github.com/containers/image/openshift/openshift.go index ecd41306..686c78a9 100644 --- a/vendor/github.com/containers/image/openshift/openshift.go +++ b/vendor/github.com/containers/image/openshift/openshift.go @@ -9,7 +9,6 @@ import ( "io" "io/ioutil" "net/http" - "net/url" "strings" "time" @@ -22,8 +21,7 @@ import ( // openshiftClient is configuration for dealing with a single image stream, for reading or writing. type openshiftClient struct { - ref openshiftReference - baseURL *url.URL + ref openshiftReference // Values from Kubernetes configuration httpClient *http.Client bearerToken string // "" if not used @@ -53,7 +51,9 @@ func newOpenshiftClient(ref openshiftReference) (*openshiftClient, error) { return nil, err } logrus.Debugf("URL: %#v", *baseURL) - + if *baseURL != *ref.baseURL { + return nil, fmt.Errorf("Unexpected baseURL mismatch: default %#v, reference %#v", *baseURL, *ref.baseURL) + } if httpClient == nil { httpClient = http.DefaultClient } @@ -61,7 +61,6 @@ func newOpenshiftClient(ref openshiftReference) (*openshiftClient, error) { return &openshiftClient{ ref: ref, - baseURL: baseURL, httpClient: httpClient, bearerToken: restConfig.BearerToken, username: restConfig.Username, @@ -71,7 +70,7 @@ func newOpenshiftClient(ref openshiftReference) (*openshiftClient, error) { // doRequest performs a correctly authenticated request to a specified path, and returns response body or an error object. func (c *openshiftClient) doRequest(method, path string, requestBody []byte) ([]byte, error) { - url := *c.baseURL + url := *c.ref.baseURL url.Path = path var requestBodyReader io.Reader if requestBody != nil { @@ -154,7 +153,19 @@ func (c *openshiftClient) convertDockerImageReference(ref string) (string, error if len(parts) != 2 { return "", fmt.Errorf("Invalid format of docker reference %s: missing '/'", ref) } - return c.ref.dockerReference.Hostname() + "/" + parts[1], nil + // Sanity check that the reference is at least plausibly similar, i.e. uses the hard-coded port we expect. + if !strings.HasSuffix(parts[0], ":5000") { + return "", fmt.Errorf("Invalid format of docker reference %s: expecting port 5000", ref) + } + return c.dockerRegistryHostPart() + "/" + parts[1], nil +} + +// dockerRegistryHostPart returns the host:port of the embedded Docker Registry API endpoint +// FIXME: There seems to be no way to discover the correct:host port using the API, so hard-code our knowledge +// about how the OpenShift Atomic Registry is configured, per examples/atomic-registry/run.sh: +// -p OPENSHIFT_OAUTH_PROVIDER_URL=https://${INSTALL_HOST}:8443,COCKPIT_KUBE_URL=https://${INSTALL_HOST},REGISTRY_HOST=${INSTALL_HOST}:5000 +func (c *openshiftClient) dockerRegistryHostPart() string { + return strings.SplitN(c.ref.baseURL.Host, ":", 2)[0] + ":5000" } type openshiftImageSource struct { @@ -250,7 +261,7 @@ func (s *openshiftImageSource) ensureImageIsResolved() error { } var te *tagEvent for _, tag := range is.Status.Tags { - if tag.Tag != s.client.ref.dockerReference.Tag() { + if tag.Tag != s.client.ref.tag { continue } if len(tag.Items) > 0 { @@ -297,7 +308,7 @@ func newImageDestination(ctx *types.SystemContext, ref openshiftReference) (type // FIXME: Should this always use a digest, not a tag? Uploading to Docker by tag requires the tag _inside_ the manifest to match, // i.e. a single signed image cannot be available under multiple tags. But with types.ImageDestination, we don't know // the manifest digest at this point. - dockerRefString := fmt.Sprintf("//%s/%s/%s:%s", client.ref.dockerReference.Hostname(), client.ref.namespace, client.ref.stream, client.ref.dockerReference.Tag()) + dockerRefString := fmt.Sprintf("//%s/%s/%s:%s", client.dockerRegistryHostPart(), client.ref.namespace, client.ref.stream, client.ref.tag) dockerRef, err := docker.ParseReference(dockerRefString) if err != nil { return nil, err @@ -359,7 +370,7 @@ func (d *openshiftImageDestination) PutManifest(m []byte) error { } d.imageStreamImageName = manifestDigest // FIXME: We can't do what respositorymiddleware.go does because we don't know the internal address. Does any of this matter? - dockerImageReference := fmt.Sprintf("%s/%s/%s@%s", d.client.ref.dockerReference.Hostname(), d.client.ref.namespace, d.client.ref.stream, manifestDigest) + dockerImageReference := fmt.Sprintf("%s/%s/%s@%s", d.client.dockerRegistryHostPart(), d.client.ref.namespace, d.client.ref.stream, manifestDigest) ism := imageStreamMapping{ typeMeta: typeMeta{ Kind: "ImageStreamMapping", @@ -376,7 +387,7 @@ func (d *openshiftImageDestination) PutManifest(m []byte) error { DockerImageReference: dockerImageReference, DockerImageManifest: string(m), }, - Tag: d.client.ref.dockerReference.Tag(), + Tag: d.client.ref.tag, } body, err := json.Marshal(ism) if err != nil { diff --git a/vendor/github.com/containers/image/openshift/openshift_transport.go b/vendor/github.com/containers/image/openshift/openshift_transport.go index 8e53b1f9..240d05ac 100644 --- a/vendor/github.com/containers/image/openshift/openshift_transport.go +++ b/vendor/github.com/containers/image/openshift/openshift_transport.go @@ -3,9 +3,10 @@ package openshift import ( "errors" "fmt" + "net/url" "regexp" - "strings" + "github.com/Sirupsen/logrus" "github.com/containers/image/docker/policyconfiguration" "github.com/containers/image/types" "github.com/docker/docker/reference" @@ -43,33 +44,67 @@ func (t openshiftTransport) ValidatePolicyConfigurationScope(scope string) error // openshiftReference is an ImageReference for OpenShift images. type openshiftReference struct { - dockerReference reference.NamedTagged - namespace string // Computed from dockerReference in advance. - stream string // Computed from dockerReference in advance. + baseURL *url.URL + namespace string + stream string + tag string + dockerReference reference.Named // Computed from the above in advance, so that later references can not fail. } +// FIXME: Is imageName like this a good way to refer to OpenShift images? +// Keep this in sync with scopeRegexp! +var imageNameRegexp = regexp.MustCompile("^([^:/]*)/([^:/]*):([^:/]*)$") + // ParseReference converts a string, which should not start with the ImageTransport.Name prefix, into an OpenShift ImageReference. -func ParseReference(ref string) (types.ImageReference, error) { - r, err := reference.ParseNamed(ref) +func ParseReference(reference string) (types.ImageReference, error) { + // Overall, this is modelled on openshift/origin/pkg/cmd/util/clientcmd.New().ClientConfig() and openshift/origin/pkg/client. + cmdConfig := defaultClientConfig() + logrus.Debugf("cmdConfig: %#v", cmdConfig) + restConfig, err := cmdConfig.ClientConfig() if err != nil { - return nil, fmt.Errorf("failed to parse image reference %q, %v", ref, err) + return nil, err } - tagged, ok := r.(reference.NamedTagged) - if !ok { - return nil, fmt.Errorf("invalid image reference %s, %#v", ref, r) + // REMOVED: SetOpenShiftDefaults (values are not overridable in config files, so hard-coded these defaults.) + logrus.Debugf("restConfig: %#v", restConfig) + baseURL, _, err := restClientFor(restConfig) + if err != nil { + return nil, err } - return NewReference(tagged) + logrus.Debugf("URL: %#v", *baseURL) + + m := imageNameRegexp.FindStringSubmatch(reference) + if m == nil || len(m) != 4 { + return nil, fmt.Errorf("Invalid image reference %s, %#v", reference, m) + } + + return NewReference(baseURL, m[1], m[2], m[3]) } -// NewReference returns an OpenShift reference for a reference.NamedTagged -func NewReference(dockerRef reference.NamedTagged) (types.ImageReference, error) { - r := strings.SplitN(dockerRef.RemoteName(), "/", 3) - if len(r) != 2 { - return nil, fmt.Errorf("invalid image reference %s", dockerRef.String()) +// NewReference returns an OpenShift reference for a base URL, namespace, stream and tag. +func NewReference(baseURL *url.URL, namespace, stream, tag string) (types.ImageReference, error) { + // Precompute also dockerReference so that later references can not fail. + // + // This discards ref.baseURL.Path, which is unexpected for a “base URL”; + // but openshiftClient.doRequest actually completely overrides url.Path + // (and defaultServerURL rejects non-trivial Path values), so it is OK for + // us to ignore it as well. + // + // FIXME: This is, strictly speaking, a namespace conflict with images placed in a Docker registry running on the same host. + // Do we need to do something else, perhaps disambiguate (port number?) or namespace Docker and OpenShift separately? + dockerRef, err := reference.WithName(fmt.Sprintf("%s/%s/%s", baseURL.Host, namespace, stream)) + if err != nil { + return nil, err } + dockerRef, err = reference.WithTag(dockerRef, tag) + if err != nil { + return nil, err + } + return openshiftReference{ - namespace: r[0], - stream: r[1], + baseURL: baseURL, + namespace: namespace, + stream: stream, + tag: tag, dockerReference: dockerRef, }, nil } @@ -84,7 +119,7 @@ func (ref openshiftReference) Transport() types.ImageTransport { // e.g. default attribute values omitted by the user may be filled in in the return value, or vice versa. // WARNING: Do not use the return value in the UI to describe an image, it does not contain the Transport().Name() prefix. func (ref openshiftReference) StringWithinTransport() string { - return ref.dockerReference.String() + return fmt.Sprintf("%s/%s:%s", ref.namespace, ref.stream, ref.tag) } // DockerReference returns a Docker reference associated with this reference diff --git a/vendor/github.com/containers/image/storage/storage_image.go b/vendor/github.com/containers/image/storage/storage_image.go new file mode 100644 index 00000000..5a8c70ae --- /dev/null +++ b/vendor/github.com/containers/image/storage/storage_image.go @@ -0,0 +1,454 @@ +package storage + +import ( + "bytes" + "crypto/sha256" + "encoding/hex" + "encoding/json" + "errors" + "fmt" + "io" + "io/ioutil" + "strings" + "time" + + "github.com/Sirupsen/logrus" + "github.com/containers/image/image" + "github.com/containers/image/types" + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/ioutils" + "github.com/containers/storage/storage" +) + +var ( + // ErrInvalidBlobDigest is returned when PutBlob() is given a blob + // with a digest-based name that can't be used as a map key. + ErrInvalidBlobDigest = errors.New("invalid blob digest") + // ErrBlobDigestMismatch is returned when PutBlob() is given a blob + // with a digest-based name that doesn't match its contents. + ErrBlobDigestMismatch = errors.New("blob digest mismatch") +) + +type storageImage struct { + store storage.Store + imageRef *storageReference + Tag string `json:"tag,omitempty"` + Created time.Time `json:"created-time,omitempty"` + ID string `json:"id"` + BlobList []string `json:"blob-list,omitempty"` // Ordered list of every blob the image has been told to handle + Layers map[string]string `json:"layers,omitempty"` // Map from names of blobs that are layers to layer IDs + BlobData map[string][]byte `json:"-"` // Map from names of blobs that aren't layers to contents, temporary + SignatureSizes []int `json:"signature-sizes"` // List of sizes of each signature slice +} + +type storageLayerMetadata struct { + ExpectedSize int64 `json:"expected-size,omitempty"` + Digest string `json:"digest,omitempty"` + Size int64 `json:"size,omitempty"` +} + +// newImageSource sets us up to read out an image, which we assume exists. +func newImageSource(imageRef *storageReference) *storageImage { + tag := "" + if imageRef.ID() == "" { + logrus.Errorf("no image matching reference %q found", imageRef.StringWithinTransport()) + return nil + } + img, err := imageRef.store.GetImage(imageRef.ID()) + if err != nil { + logrus.Errorf("error reading image %q: %v", imageRef.ID(), err) + return nil + } + tag = imageRef.StringWithinTransport() + image := storageImage{ + store: imageRef.store, + imageRef: imageRef, + Tag: tag, + Created: time.Now(), + ID: img.ID, + BlobList: []string{}, + Layers: make(map[string]string), + BlobData: make(map[string][]byte), + } + if err := image.loadMetadata(); err != nil { + logrus.Errorf("error decoding metadata for source image: %v", err) + return nil + } + return &image +} + +// newImageDestination sets us up to write a new image. +func newImageDestination(imageRef *storageReference) *storageImage { + // We set the image's ID if the reference we got looked like one, since + // we take that as an indication that it's going to end up with the + // same contents as an image we already have. If the reference looks + // more like a name, we don't know yet if it'll be exactly the same as, + // or be an updated version of, an image we might already have, so we + // have to err on the side of caution and create a new image which will + // be assigned the name as its tag. + image := storageImage{ + store: imageRef.store, + imageRef: imageRef, + Tag: imageRef.StringWithinTransport(), + Created: time.Now(), + ID: imageRef.ID(), + BlobList: []string{}, + Layers: make(map[string]string), + BlobData: make(map[string][]byte), + } + return &image +} + +func newImage(imageRef *storageReference) *storageImage { + return newImageSource(imageRef) +} + +func (s *storageImage) loadMetadata() error { + if s.ID != "" { + image, err := s.store.GetImage(s.ID) + if image != nil && err == nil { + if err := json.Unmarshal([]byte(image.Metadata), s); err != nil { + return err + } + } + } + return nil +} + +func (s *storageImage) saveMetadata() error { + if s.ID != "" { + if metadata, err := json.Marshal(s); len(metadata) != 0 && err == nil { + istore, err := s.store.GetImageStore() + if istore != nil && err == nil { + if err = istore.SetMetadata(s.ID, string(metadata)); err != nil { + logrus.Errorf("error setting metadata for image %q: %v", s.ID, err) + } + } else { + logrus.Errorf("error locating image store: %v", err) + } + return err + } else { + logrus.Errorf("error encoding metadata for image %q: %v", s.ID, err) + return err + } + } + return nil +} + +func (s *storageImage) Reference() types.ImageReference { + return s.imageRef +} + +func (s *storageImage) Close() { +} + +// SupportsSignatures returns an error if we can't expect GetSignatures() to +// return data that was previously supplied to PutSignatures(). +func (s *storageImage) SupportsSignatures() error { + return nil +} + +// PutBlob is used to both store filesystem layers and binary data that is part +// of the image. +func (s *storageImage) PutBlob(stream io.Reader, digest string, expectedSize int64) (actualDigest string, actualSize int64, err error) { + // Try to read an initial snippet of the blob. + header := make([]byte, 10240) + n, err := stream.Read(header) + if err != nil && err != io.EOF { + return "", -1, err + } + // Set up to read the whole blob (the initial snippet, plus the rest) + // while digesting it with sha256. + hasher := sha256.New() + hash := []byte{} + counter := ioutils.NewWriteCounter(hasher) + defragmented := io.MultiReader(bytes.NewBuffer(header[:n]), stream) + multi := io.TeeReader(defragmented, counter) + if (n > 0) && archive.IsArchive(header[:n]) { + // It's a filesystem layer. If it's not the first one in the + // image, we assume that the most recently added layer is its + // parent. + parentLayer := "" + if len(s.BlobList) > 0 { + for _, blob := range s.BlobList { + if layerID, ok := s.Layers[blob]; ok { + parentLayer = layerID + } + } + } + // Now try to figure out if the identifier we have is an ID or + // something else, so that we can do collision detection + // correctly. + names := []string{} + id := digest + if matches := idRegexp.FindStringSubmatch(digest); len(matches) > 1 { + // Looks like a digest. Use the value as a layer ID. + id = matches[len(matches)-1] + } else { + // If it isn't empty, it's a name. + if digest != "" { + names = append(names, digest) + id = "" + } + } + if len(names) == 0 { + names = nil + } + // Attempt to create the identified layer and import its contents. + layer, err := s.store.PutLayer(id, parentLayer, names, "", true, multi) + if err != nil && err != storage.ErrDuplicateID { + logrus.Debugf("error importing layer blob %q: %v", digest, err) + return "", -1, err + } + if err == storage.ErrDuplicateID { + // We specified an ID, and there's already a layer with + // the same ID. Drain the input so that we can look at + // its length and digest. + _, err := io.Copy(ioutil.Discard, multi) + if err != nil && err != io.EOF { + logrus.Debugf("error digesting layer blob %q: %v", digest, err) + return "", -1, err + } + hash = hasher.Sum(nil) + } else { + // Applied the layer, either with a specified ID or a + // new ID. Note the size info and computed digest. + hash = hasher.Sum(nil) + layerdata := storageLayerMetadata{ + ExpectedSize: expectedSize, + Digest: "sha256:" + hex.EncodeToString(hash[:]), + Size: counter.Count, + } + if metadata, err := json.Marshal(layerdata); len(metadata) != 0 && err == nil { + s.store.SetMetadata(layer.ID, string(metadata)) + } + // Hang on to the new layer's ID. + id = layer.ID + } + // If the ID was a digest, verify that our computed sha256sum + // matches the ID. */ + if strings.HasPrefix(digest, "sha256:") && digest != "sha256:"+hex.EncodeToString(hash[:]) { + logrus.Debugf("blob %q digests to %q, rejecting", digest, hex.EncodeToString(hash[:])) + if layer != nil { + // Something's wrong; delete the newly-created layer. + s.store.DeleteLayer(layer.ID) + } + return "", -1, ErrBlobDigestMismatch + } + // If we didn't get a name, we might as well assign one using the hash. + if digest == "" { + digest = "sha256:" + hex.EncodeToString(hash[:]) + } + // Record that this blob is a layer. + s.Layers[digest] = id + s.BlobList = append(s.BlobList, digest) + if layer != nil { + logrus.Debugf("blob %q imported as a filesystem layer", digest) + } else { + logrus.Debugf("layer blob %q already present", digest) + } + } else { + // It's just data. Finish scanning it in, check that our + // computed sha256sum matches the digest, and store it, but + // leave it out of the blob-to-layer-ID map so that we can tell + // that it's not a layer. + blob, err := ioutil.ReadAll(multi) + if err != nil && err != io.EOF { + return "", -1, err + } + actualSize = int64(len(blob)) + hash = hasher.Sum(nil) + // If the ID was a digest, verify that our computed sha256sum + // matches it. */ + if strings.HasPrefix(digest, "sha256:") && digest != "sha256:"+hex.EncodeToString(hash[:]) { + logrus.Debugf("blob %q digests to %q, rejecting", digest, hex.EncodeToString(hash[:])) + return "", -1, ErrBlobDigestMismatch + } + // If we didn't get a name, we might as well assign one using the hash. + if digest == "" { + digest = "sha256:" + hex.EncodeToString(hash[:]) + } + // Save the blob for when we Commit(). + s.BlobData[digest] = blob + s.BlobList = append(s.BlobList, digest) + logrus.Debugf("blob %q imported as opaque data", digest) + } + return digest, actualSize, nil +} + +func (s *storageImage) Commit() error { + if s.ID != "" { + // We started with an image ID, or we've already registered + // this one and gotten one, so no need to do anything more. + if img, err := s.store.GetImage(s.ID); img != nil && err == nil { + return nil + } + } + lastLayer := "" + if len(s.BlobList) > 0 { + for _, blob := range s.BlobList { + if layerID, ok := s.Layers[blob]; ok { + lastLayer = layerID + } + } + } + img, err := s.store.CreateImage(s.ID, nil, lastLayer, "") + if err != nil { + return err + } + logrus.Debugf("created new image ID %q", img.ID) + if s.Tag != "" { + // We started with an image name rather than an ID, so move the + // name to this image. + if err := s.store.SetNames(img.ID, []string{s.Tag}); err != nil { + return err + } + logrus.Debugf("set name of image %q to %q", img.ID, s.Tag) + } + // Save the blob data to disk, and drop the contents from memory. + keys := []string{} + for k, v := range s.BlobData { + if err := s.store.SetImageBigData(img.ID, k, v); err != nil { + return err + } + keys = append(keys, k) + } + for _, key := range keys { + delete(s.BlobData, key) + } + s.ID = img.ID + return nil +} + +func (s *storageImage) PutManifest(manifest []byte) error { + if err := s.Commit(); err != nil { + return err + } + defer s.saveMetadata() + return s.store.SetImageBigData(s.ID, "manifest", manifest) +} + +func (s *storageImage) PutSignatures(signatures [][]byte) error { + if err := s.Commit(); err != nil { + return err + } + sizes := []int{} + sigblob := []byte{} + for _, sig := range signatures { + sizes = append(sizes, len(sig)) + newblob := make([]byte, len(sigblob)+len(sig)) + copy(newblob, sigblob) + copy(newblob[len(sigblob):], sig) + sigblob = newblob + } + s.SignatureSizes = sizes + defer s.saveMetadata() + return s.store.SetImageBigData(s.ID, "signatures", sigblob) +} + +func (s *storageImage) SupportedManifestMIMETypes() []string { + return nil +} + +func (s *storageImage) GetBlob(digest string) (rc io.ReadCloser, n int64, err error) { + if blob, ok := s.BlobData[digest]; ok { + r := bytes.NewReader(blob) + return ioutil.NopCloser(r), r.Size(), nil + } + if _, ok := s.Layers[digest]; !ok { + b, err := s.store.GetImageBigData(s.ID, digest) + if err != nil { + return nil, -1, err + } + r := bytes.NewReader(b) + logrus.Debugf("exporting opaque data as blob %q", digest) + return ioutil.NopCloser(r), r.Size(), nil + } + logrus.Debugf("exporting filesystem layer as blob %q", digest) + return s.diffLayer(s.Layers[digest], true) +} + +func (s *storageImage) diffLayer(layerID string, computeSize bool) (rc io.ReadCloser, n int64, err error) { + layer, err := s.store.GetLayer(layerID) + if err != nil { + return nil, -1, err + } + layerMeta := storageLayerMetadata{ + ExpectedSize: -1, + } + if layer.Metadata != "" { + if err := json.Unmarshal([]byte(layer.Metadata), &layerMeta); err != nil { + logrus.Errorf("error decoding metadata for layer %q: %v", layerID, err) + return nil, -1, err + } + } + if computeSize { + if layerMeta.ExpectedSize == -1 { + n, err = s.store.DiffSize("", layer.ID) + if err != nil { + return nil, -1, err + } + } else { + n = layerMeta.ExpectedSize + } + } else { + n = -1 + } + diff, err := s.store.Diff("", layer.ID) + if err != nil { + return nil, -1, err + } + return diff, n, nil +} + +func (s *storageImage) GetManifest() (manifest []byte, MIMEType string, err error) { + manifest, err = s.store.GetImageBigData(s.ID, "manifest") + return manifest, "", err +} + +func (s *storageImage) GetSignatures() (signatures [][]byte, err error) { + var offset int + if err := s.loadMetadata(); err != nil { + logrus.Errorf("error decoding metadata for image: %v", err) + return nil, err + } + signature, err := s.store.GetImageBigData(s.ID, "signatures") + if err != nil { + return nil, err + } + sigslice := [][]byte{} + for _, length := range s.SignatureSizes { + sigslice = append(sigslice, signature[offset:offset+length]) + offset += length + } + if offset != len(signature) { + return nil, fmt.Errorf("signatures data contained %d extra bytes", len(signatures)-offset) + } + return sigslice, nil +} + +func (s *storageImage) DeleteImage() error { + if s.ID != "" { + if _, err := s.store.DeleteImage(s.ID, true); err != nil { + return err + } + s.ID = "" + } + return nil +} + +func (s *storageImage) Manifest() (manifest []byte, MIMEType string, err error) { + return s.GetManifest() +} + +func (s *storageImage) Signatures() (signatures [][]byte, err error) { + return s.GetSignatures() +} + +func (s *storageImage) BlobDigests() (digests []string, err error) { + return image.FromSource(s).BlobDigests() +} + +func (s *storageImage) Inspect() (info *types.ImageInspectInfo, err error) { + return image.FromSource(s).Inspect() +} diff --git a/vendor/github.com/containers/image/storage/storage_reference.go b/vendor/github.com/containers/image/storage/storage_reference.go new file mode 100644 index 00000000..9c45b9cb --- /dev/null +++ b/vendor/github.com/containers/image/storage/storage_reference.go @@ -0,0 +1,89 @@ +package storage + +import ( + "github.com/Sirupsen/logrus" + "github.com/containers/image/types" + "github.com/containers/storage/storage" + "github.com/docker/docker/reference" +) + +// A storageReference holds a name and/or an ID, which is a 32-byte value +// hex-encoded into a 64-character string. +type storageReference struct { + store storage.Store + transport *storageTransport + reference string + id string +} + +func newReference(store storage.Store, transport *storageTransport, reference, id string) *storageReference { + return &storageReference{ + store: store, + transport: transport, + reference: reference, + id: id, + } +} + +// Resolve the reference's name to an image ID in the storage library if +// there's already one present with the same name or ID. +func (s *storageReference) ID() string { + if s.id == "" { + image, err := s.store.GetImage(s.reference) + if image != nil && err == nil { + s.id = image.ID + } + } + return s.id +} + +func (s *storageReference) Transport() types.ImageTransport { + return s.transport +} + +func (s *storageReference) DockerReference() reference.Named { + return nil +} + +func (s *storageReference) StringWithinTransport() string { + if s.reference == "" { + return s.id + } + return s.reference +} + +func (s *storageReference) PolicyConfigurationIdentity() string { + if s.reference == "" { + return s.id + } + return s.reference +} + +func (s *storageReference) PolicyConfigurationNamespaces() []string { + return nil +} + +func (s *storageReference) NewImage(ctx *types.SystemContext) (types.Image, error) { + return newImage(s), nil +} + +func (s *storageReference) DeleteImage(ctx *types.SystemContext) error { + layers, err := s.store.DeleteImage(s.ID(), true) + if err == nil { + logrus.Debugf("deleted image %q", s.ID()) + s.id = "" + for _, layer := range layers { + logrus.Debugf("deleted layer %q", layer) + } + } + s.id = "" + return err +} + +func (s *storageReference) NewImageSource(ctx *types.SystemContext, requestedManifestMIMETypes []string) (types.ImageSource, error) { + return newImageSource(s), nil +} + +func (s *storageReference) NewImageDestination(ctx *types.SystemContext) (types.ImageDestination, error) { + return newImageDestination(s), nil +} diff --git a/vendor/github.com/containers/image/storage/storage_transport.go b/vendor/github.com/containers/image/storage/storage_transport.go new file mode 100644 index 00000000..6139f40e --- /dev/null +++ b/vendor/github.com/containers/image/storage/storage_transport.go @@ -0,0 +1,79 @@ +package storage + +import ( + "errors" + "regexp" + + "github.com/Sirupsen/logrus" + "github.com/containers/image/types" + "github.com/containers/storage/storage" +) + +var ( + // Transport is an ImageTransport that uses a default storage.Store or + // one that's it's explicitly told to use. + Transport StoreTransport = &storageTransport{} + // ErrInvalidReference is returned when ParseReference() is passed an + // empty reference. + ErrInvalidReference = errors.New("invalid reference") + idRegexp = regexp.MustCompile("^(sha256:)?([0-9a-fA-F]{64})$") +) + +// StoreTransport is an ImageTransport that uses a storage.Store to parse +// references, either its own or one that it's told to use. +type StoreTransport interface { + types.ImageTransport + SetStore(storage.Store) + ParseStoreReference(store storage.Store, reference string) (types.ImageReference, error) +} + +type storageTransport struct { + store storage.Store +} + +func (s *storageTransport) Name() string { + return "oci-storage" +} + +// SetStore sets the Store object which the Transport will use for parsing +// references when a Store is not directly specified. If one is not set, the +// library will attempt to initialize one with default settings when a +// reference needs to be parsed. Calling SetStore does not affect previously +// parsed references. +func (s *storageTransport) SetStore(store storage.Store) { + s.store = store +} + +// ParseStoreReference takes a name or an ID, tries to figure out which it is +// relative to a given store, and returns it in a reference object. +func (s *storageTransport) ParseStoreReference(store storage.Store, reference string) (types.ImageReference, error) { + if reference == "" { + return nil, ErrInvalidReference + } + id := "" + if matches := idRegexp.FindStringSubmatch(reference); len(matches) > 1 { + id = matches[len(matches)-1] + logrus.Debugf("parsed reference %q into ID %q", reference, id) + reference = "" + } else { + logrus.Debugf("treating reference %q as a name", reference) + } + return newReference(store, s, reference, id), nil +} + +// ParseReference initializes the storage library and then takes a name or an +// ID, tries to figure out which it is, and returns it in a reference object. +func (s *storageTransport) ParseReference(reference string) (types.ImageReference, error) { + if s.store == nil { + store, err := storage.MakeStore("", "", "", []string{}, nil, nil) + if err != nil { + return nil, err + } + s.store = store + } + return s.ParseStoreReference(s.store, reference) +} + +func (s *storageTransport) ValidatePolicyConfigurationScope(scope string) error { + return nil +} diff --git a/vendor/github.com/containers/image/transports/transports.go b/vendor/github.com/containers/image/transports/transports.go index 2b7e4f13..20e635f3 100644 --- a/vendor/github.com/containers/image/transports/transports.go +++ b/vendor/github.com/containers/image/transports/transports.go @@ -8,6 +8,7 @@ import ( "github.com/containers/image/docker" ociLayout "github.com/containers/image/oci/layout" "github.com/containers/image/openshift" + "github.com/containers/image/storage" "github.com/containers/image/types" ) @@ -21,6 +22,7 @@ func init() { docker.Transport, ociLayout.Transport, openshift.Transport, + storage.Transport, } { name := t.Name() if _, ok := KnownTransports[name]; ok { diff --git a/vendor/github.com/containers/image/types/types.go b/vendor/github.com/containers/image/types/types.go index 5d3de3b0..a2cdb6fa 100644 --- a/vendor/github.com/containers/image/types/types.go +++ b/vendor/github.com/containers/image/types/types.go @@ -188,18 +188,14 @@ type SystemContext struct { // If not "", prefixed to any absolute paths used by default by the library (e.g. in /etc/). // Not used for any of the more specific path overrides available in this struct. // Not used for any paths specified by users in config files (even if the location of the config file _was_ affected by it). - // NOTE: If this is set, environment-variable overrides of paths are ignored (to keep the semantics simple: to create an /etc replacement, just set RootForImplicitAbsolutePaths . - // and there is no need to worry about the environment.) // NOTE: This does NOT affect paths starting by $HOME. RootForImplicitAbsolutePaths string // === Global configuration overrides === // If not "", overrides the system's default path for signature.Policy configuration. SignaturePolicyPath string - // If not "", overrides the system's default path for registries.d (Docker signature storage configuration) - RegistriesDirPath string // === docker.Transport overrides === DockerCertPath string // If not "", a directory containing "cert.pem" and "key.pem" used when talking to a Docker Registry - DockerInsecureSkipTLSVerify bool // Allow contacting docker registries over HTTP, or HTTPS with failed TLS verification. Note that this does not affect other TLS connections. + DockerInsecureSkipTLSVerify bool } diff --git a/vendor/github.com/containers/storage/LICENSE b/vendor/github.com/containers/storage/LICENSE new file mode 100644 index 00000000..8f3fee62 --- /dev/null +++ b/vendor/github.com/containers/storage/LICENSE @@ -0,0 +1,191 @@ + + Apache License + Version 2.0, January 2004 + https://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + Copyright 2013-2016 Docker, Inc. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + https://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containers/storage/NOTICE b/vendor/github.com/containers/storage/NOTICE new file mode 100644 index 00000000..8a37c1c7 --- /dev/null +++ b/vendor/github.com/containers/storage/NOTICE @@ -0,0 +1,19 @@ +Docker +Copyright 2012-2016 Docker, Inc. + +This product includes software developed at Docker, Inc. (https://www.docker.com). + +This product contains software (https://github.com/kr/pty) developed +by Keith Rarick, licensed under the MIT License. + +The following is courtesy of our legal counsel: + + +Use and transfer of Docker may be subject to certain restrictions by the +United States and other governments. +It is your responsibility to ensure that your use and/or transfer does not +violate applicable laws. + +For more information, please see https://www.bis.doc.gov + +See also https://www.apache.org/dev/crypto.html and/or seek legal counsel. diff --git a/vendor/github.com/containers/storage/drivers/aufs/aufs.go b/vendor/github.com/containers/storage/drivers/aufs/aufs.go new file mode 100644 index 00000000..f9b58bf5 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/aufs/aufs.go @@ -0,0 +1,586 @@ +// +build linux + +/* + +aufs driver directory structure + + . + ├── layers // Metadata of layers + │ ├── 1 + │ ├── 2 + │ └── 3 + ├── diff // Content of the layer + │ ├── 1 // Contains layers that need to be mounted for the id + │ ├── 2 + │ └── 3 + └── mnt // Mount points for the rw layers to be mounted + ├── 1 + ├── 2 + └── 3 + +*/ + +package aufs + +import ( + "bufio" + "fmt" + "io/ioutil" + "os" + "os/exec" + "path" + "path/filepath" + "strings" + "sync" + "syscall" + + "github.com/Sirupsen/logrus" + "github.com/vbatts/tar-split/tar/storage" + + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/chrootarchive" + "github.com/containers/storage/pkg/directory" + "github.com/containers/storage/pkg/idtools" + mountpk "github.com/containers/storage/pkg/mount" + "github.com/containers/storage/pkg/stringid" + + "github.com/opencontainers/runc/libcontainer/label" + rsystem "github.com/opencontainers/runc/libcontainer/system" +) + +var ( + // ErrAufsNotSupported is returned if aufs is not supported by the host. + ErrAufsNotSupported = fmt.Errorf("AUFS was not found in /proc/filesystems") + // ErrAufsNested means aufs cannot be used bc we are in a user namespace + ErrAufsNested = fmt.Errorf("AUFS cannot be used in non-init user namespace") + backingFs = "" + + enableDirpermLock sync.Once + enableDirperm bool +) + +func init() { + graphdriver.Register("aufs", Init) +} + +// Driver contains information about the filesystem mounted. +type Driver struct { + sync.Mutex + root string + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap + ctr *graphdriver.RefCounter + pathCacheLock sync.Mutex + pathCache map[string]string +} + +// Init returns a new AUFS driver. +// An error is returned if AUFS is not supported. +func Init(root string, options []string, uidMaps, gidMaps []idtools.IDMap) (graphdriver.Driver, error) { + + // Try to load the aufs kernel module + if err := supportsAufs(); err != nil { + return nil, graphdriver.ErrNotSupported + } + + fsMagic, err := graphdriver.GetFSMagic(root) + if err != nil { + return nil, err + } + if fsName, ok := graphdriver.FsNames[fsMagic]; ok { + backingFs = fsName + } + + switch fsMagic { + case graphdriver.FsMagicAufs, graphdriver.FsMagicBtrfs, graphdriver.FsMagicEcryptfs: + logrus.Errorf("AUFS is not supported over %s", backingFs) + return nil, graphdriver.ErrIncompatibleFS + } + + paths := []string{ + "mnt", + "diff", + "layers", + } + + a := &Driver{ + root: root, + uidMaps: uidMaps, + gidMaps: gidMaps, + pathCache: make(map[string]string), + ctr: graphdriver.NewRefCounter(graphdriver.NewFsChecker(graphdriver.FsMagicAufs)), + } + + rootUID, rootGID, err := idtools.GetRootUIDGID(uidMaps, gidMaps) + if err != nil { + return nil, err + } + // Create the root aufs driver dir and return + // if it already exists + // If not populate the dir structure + if err := idtools.MkdirAllAs(root, 0700, rootUID, rootGID); err != nil { + if os.IsExist(err) { + return a, nil + } + return nil, err + } + + if err := mountpk.MakePrivate(root); err != nil { + return nil, err + } + + // Populate the dir structure + for _, p := range paths { + if err := idtools.MkdirAllAs(path.Join(root, p), 0700, rootUID, rootGID); err != nil { + return nil, err + } + } + return a, nil +} + +// Return a nil error if the kernel supports aufs +// We cannot modprobe because inside dind modprobe fails +// to run +func supportsAufs() error { + // We can try to modprobe aufs first before looking at + // proc/filesystems for when aufs is supported + exec.Command("modprobe", "aufs").Run() + + if rsystem.RunningInUserNS() { + return ErrAufsNested + } + + f, err := os.Open("/proc/filesystems") + if err != nil { + return err + } + defer f.Close() + + s := bufio.NewScanner(f) + for s.Scan() { + if strings.Contains(s.Text(), "aufs") { + return nil + } + } + return ErrAufsNotSupported +} + +func (a *Driver) rootPath() string { + return a.root +} + +func (*Driver) String() string { + return "aufs" +} + +// Status returns current information about the filesystem such as root directory, number of directories mounted, etc. +func (a *Driver) Status() [][2]string { + ids, _ := loadIds(path.Join(a.rootPath(), "layers")) + return [][2]string{ + {"Root Dir", a.rootPath()}, + {"Backing Filesystem", backingFs}, + {"Dirs", fmt.Sprintf("%d", len(ids))}, + {"Dirperm1 Supported", fmt.Sprintf("%v", useDirperm())}, + } +} + +// GetMetadata not implemented +func (a *Driver) GetMetadata(id string) (map[string]string, error) { + return nil, nil +} + +// Exists returns true if the given id is registered with +// this driver +func (a *Driver) Exists(id string) bool { + if _, err := os.Lstat(path.Join(a.rootPath(), "layers", id)); err != nil { + return false + } + return true +} + +// CreateReadWrite creates a layer that is writable for use as a container +// file system. +func (a *Driver) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + return a.Create(id, parent, mountLabel, storageOpt) +} + +// Create three folders for each id +// mnt, layers, and diff +func (a *Driver) Create(id, parent, mountLabel string, storageOpt map[string]string) error { + + if len(storageOpt) != 0 { + return fmt.Errorf("--storage-opt is not supported for aufs") + } + + if err := a.createDirsFor(id); err != nil { + return err + } + // Write the layers metadata + f, err := os.Create(path.Join(a.rootPath(), "layers", id)) + if err != nil { + return err + } + defer f.Close() + + if parent != "" { + ids, err := getParentIds(a.rootPath(), parent) + if err != nil { + return err + } + + if _, err := fmt.Fprintln(f, parent); err != nil { + return err + } + for _, i := range ids { + if _, err := fmt.Fprintln(f, i); err != nil { + return err + } + } + } + + return nil +} + +// createDirsFor creates two directories for the given id. +// mnt and diff +func (a *Driver) createDirsFor(id string) error { + paths := []string{ + "mnt", + "diff", + } + + rootUID, rootGID, err := idtools.GetRootUIDGID(a.uidMaps, a.gidMaps) + if err != nil { + return err + } + // Directory permission is 0755. + // The path of directories are /mnt/ + // and /diff/ + for _, p := range paths { + if err := idtools.MkdirAllAs(path.Join(a.rootPath(), p, id), 0755, rootUID, rootGID); err != nil { + return err + } + } + return nil +} + +// Remove will unmount and remove the given id. +func (a *Driver) Remove(id string) error { + a.pathCacheLock.Lock() + mountpoint, exists := a.pathCache[id] + a.pathCacheLock.Unlock() + if !exists { + mountpoint = a.getMountpoint(id) + } + if err := a.unmount(mountpoint); err != nil { + // no need to return here, we can still try to remove since the `Rename` will fail below if still mounted + logrus.Debugf("aufs: error while unmounting %s: %v", mountpoint, err) + } + + // Atomically remove each directory in turn by first moving it out of the + // way (so that docker doesn't find it anymore) before doing removal of + // the whole tree. + tmpMntPath := path.Join(a.mntPath(), fmt.Sprintf("%s-removing", id)) + if err := os.Rename(mountpoint, tmpMntPath); err != nil && !os.IsNotExist(err) { + return err + } + defer os.RemoveAll(tmpMntPath) + + tmpDiffpath := path.Join(a.diffPath(), fmt.Sprintf("%s-removing", id)) + if err := os.Rename(a.getDiffPath(id), tmpDiffpath); err != nil && !os.IsNotExist(err) { + return err + } + defer os.RemoveAll(tmpDiffpath) + + // Remove the layers file for the id + if err := os.Remove(path.Join(a.rootPath(), "layers", id)); err != nil && !os.IsNotExist(err) { + return err + } + + a.pathCacheLock.Lock() + delete(a.pathCache, id) + a.pathCacheLock.Unlock() + return nil +} + +// Get returns the rootfs path for the id. +// This will mount the dir at it's given path +func (a *Driver) Get(id, mountLabel string) (string, error) { + parents, err := a.getParentLayerPaths(id) + if err != nil && !os.IsNotExist(err) { + return "", err + } + + a.pathCacheLock.Lock() + m, exists := a.pathCache[id] + a.pathCacheLock.Unlock() + + if !exists { + m = a.getDiffPath(id) + if len(parents) > 0 { + m = a.getMountpoint(id) + } + } + if count := a.ctr.Increment(m); count > 1 { + return m, nil + } + + // If a dir does not have a parent ( no layers )do not try to mount + // just return the diff path to the data + if len(parents) > 0 { + if err := a.mount(id, m, mountLabel, parents); err != nil { + return "", err + } + } + + a.pathCacheLock.Lock() + a.pathCache[id] = m + a.pathCacheLock.Unlock() + return m, nil +} + +// Put unmounts and updates list of active mounts. +func (a *Driver) Put(id string) error { + a.pathCacheLock.Lock() + m, exists := a.pathCache[id] + if !exists { + m = a.getMountpoint(id) + a.pathCache[id] = m + } + a.pathCacheLock.Unlock() + if count := a.ctr.Decrement(m); count > 0 { + return nil + } + + err := a.unmount(m) + if err != nil { + logrus.Debugf("Failed to unmount %s aufs: %v", id, err) + } + return err +} + +// Diff produces an archive of the changes between the specified +// layer and its parent layer which may be "". +func (a *Driver) Diff(id, parent string) (archive.Archive, error) { + // AUFS doesn't need the parent layer to produce a diff. + return archive.TarWithOptions(path.Join(a.rootPath(), "diff", id), &archive.TarOptions{ + Compression: archive.Uncompressed, + ExcludePatterns: []string{archive.WhiteoutMetaPrefix + "*", "!" + archive.WhiteoutOpaqueDir}, + UIDMaps: a.uidMaps, + GIDMaps: a.gidMaps, + }) +} + +type fileGetNilCloser struct { + storage.FileGetter +} + +func (f fileGetNilCloser) Close() error { + return nil +} + +// DiffGetter returns a FileGetCloser that can read files from the directory that +// contains files for the layer differences. Used for direct access for tar-split. +func (a *Driver) DiffGetter(id string) (graphdriver.FileGetCloser, error) { + p := path.Join(a.rootPath(), "diff", id) + return fileGetNilCloser{storage.NewPathFileGetter(p)}, nil +} + +func (a *Driver) applyDiff(id string, diff archive.Reader) error { + return chrootarchive.UntarUncompressed(diff, path.Join(a.rootPath(), "diff", id), &archive.TarOptions{ + UIDMaps: a.uidMaps, + GIDMaps: a.gidMaps, + }) +} + +// DiffSize calculates the changes between the specified id +// and its parent and returns the size in bytes of the changes +// relative to its base filesystem directory. +func (a *Driver) DiffSize(id, parent string) (size int64, err error) { + // AUFS doesn't need the parent layer to calculate the diff size. + return directory.Size(path.Join(a.rootPath(), "diff", id)) +} + +// ApplyDiff extracts the changeset from the given diff into the +// layer with the specified id and parent, returning the size of the +// new layer in bytes. +func (a *Driver) ApplyDiff(id, parent string, diff archive.Reader) (size int64, err error) { + // AUFS doesn't need the parent id to apply the diff. + if err = a.applyDiff(id, diff); err != nil { + return + } + + return a.DiffSize(id, parent) +} + +// Changes produces a list of changes between the specified layer +// and its parent layer. If parent is "", then all changes will be ADD changes. +func (a *Driver) Changes(id, parent string) ([]archive.Change, error) { + // AUFS doesn't have snapshots, so we need to get changes from all parent + // layers. + layers, err := a.getParentLayerPaths(id) + if err != nil { + return nil, err + } + return archive.Changes(layers, path.Join(a.rootPath(), "diff", id)) +} + +func (a *Driver) getParentLayerPaths(id string) ([]string, error) { + parentIds, err := getParentIds(a.rootPath(), id) + if err != nil { + return nil, err + } + layers := make([]string, len(parentIds)) + + // Get the diff paths for all the parent ids + for i, p := range parentIds { + layers[i] = path.Join(a.rootPath(), "diff", p) + } + return layers, nil +} + +func (a *Driver) mount(id string, target string, mountLabel string, layers []string) error { + a.Lock() + defer a.Unlock() + + // If the id is mounted or we get an error return + if mounted, err := a.mounted(target); err != nil || mounted { + return err + } + + rw := a.getDiffPath(id) + + if err := a.aufsMount(layers, rw, target, mountLabel); err != nil { + return fmt.Errorf("error creating aufs mount to %s: %v", target, err) + } + return nil +} + +func (a *Driver) unmount(mountPath string) error { + a.Lock() + defer a.Unlock() + + if mounted, err := a.mounted(mountPath); err != nil || !mounted { + return err + } + if err := Unmount(mountPath); err != nil { + return err + } + return nil +} + +func (a *Driver) mounted(mountpoint string) (bool, error) { + return graphdriver.Mounted(graphdriver.FsMagicAufs, mountpoint) +} + +// Cleanup aufs and unmount all mountpoints +func (a *Driver) Cleanup() error { + var dirs []string + if err := filepath.Walk(a.mntPath(), func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + if !info.IsDir() { + return nil + } + dirs = append(dirs, path) + return nil + }); err != nil { + return err + } + + for _, m := range dirs { + if err := a.unmount(m); err != nil { + logrus.Debugf("aufs error unmounting %s: %s", stringid.TruncateID(m), err) + } + } + return mountpk.Unmount(a.root) +} + +func (a *Driver) aufsMount(ro []string, rw, target, mountLabel string) (err error) { + defer func() { + if err != nil { + Unmount(target) + } + }() + + // Mount options are clipped to page size(4096 bytes). If there are more + // layers then these are remounted individually using append. + + offset := 54 + if useDirperm() { + offset += len("dirperm1") + } + b := make([]byte, syscall.Getpagesize()-len(mountLabel)-offset) // room for xino & mountLabel + bp := copy(b, fmt.Sprintf("br:%s=rw", rw)) + + firstMount := true + i := 0 + + for { + for ; i < len(ro); i++ { + layer := fmt.Sprintf(":%s=ro+wh", ro[i]) + + if firstMount { + if bp+len(layer) > len(b) { + break + } + bp += copy(b[bp:], layer) + } else { + data := label.FormatMountLabel(fmt.Sprintf("append%s", layer), mountLabel) + if err = mount("none", target, "aufs", syscall.MS_REMOUNT, data); err != nil { + return + } + } + } + + if firstMount { + opts := "dio,xino=/dev/shm/aufs.xino" + if useDirperm() { + opts += ",dirperm1" + } + data := label.FormatMountLabel(fmt.Sprintf("%s,%s", string(b[:bp]), opts), mountLabel) + if err = mount("none", target, "aufs", 0, data); err != nil { + return + } + firstMount = false + } + + if i == len(ro) { + break + } + } + + return +} + +// useDirperm checks dirperm1 mount option can be used with the current +// version of aufs. +func useDirperm() bool { + enableDirpermLock.Do(func() { + base, err := ioutil.TempDir("", "docker-aufs-base") + if err != nil { + logrus.Errorf("error checking dirperm1: %v", err) + return + } + defer os.RemoveAll(base) + + union, err := ioutil.TempDir("", "docker-aufs-union") + if err != nil { + logrus.Errorf("error checking dirperm1: %v", err) + return + } + defer os.RemoveAll(union) + + opts := fmt.Sprintf("br:%s,dirperm1,xino=/dev/shm/aufs.xino", base) + if err := mount("none", union, "aufs", 0, opts); err != nil { + return + } + enableDirperm = true + if err := Unmount(union); err != nil { + logrus.Errorf("error checking dirperm1: failed to unmount %v", err) + } + }) + return enableDirperm +} diff --git a/vendor/github.com/containers/storage/drivers/aufs/dirs.go b/vendor/github.com/containers/storage/drivers/aufs/dirs.go new file mode 100644 index 00000000..eb298d9e --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/aufs/dirs.go @@ -0,0 +1,64 @@ +// +build linux + +package aufs + +import ( + "bufio" + "io/ioutil" + "os" + "path" +) + +// Return all the directories +func loadIds(root string) ([]string, error) { + dirs, err := ioutil.ReadDir(root) + if err != nil { + return nil, err + } + out := []string{} + for _, d := range dirs { + if !d.IsDir() { + out = append(out, d.Name()) + } + } + return out, nil +} + +// Read the layers file for the current id and return all the +// layers represented by new lines in the file +// +// If there are no lines in the file then the id has no parent +// and an empty slice is returned. +func getParentIds(root, id string) ([]string, error) { + f, err := os.Open(path.Join(root, "layers", id)) + if err != nil { + return nil, err + } + defer f.Close() + + out := []string{} + s := bufio.NewScanner(f) + + for s.Scan() { + if t := s.Text(); t != "" { + out = append(out, s.Text()) + } + } + return out, s.Err() +} + +func (a *Driver) getMountpoint(id string) string { + return path.Join(a.mntPath(), id) +} + +func (a *Driver) mntPath() string { + return path.Join(a.rootPath(), "mnt") +} + +func (a *Driver) getDiffPath(id string) string { + return path.Join(a.diffPath(), id) +} + +func (a *Driver) diffPath() string { + return path.Join(a.rootPath(), "diff") +} diff --git a/vendor/github.com/containers/storage/drivers/aufs/mount.go b/vendor/github.com/containers/storage/drivers/aufs/mount.go new file mode 100644 index 00000000..da1e892f --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/aufs/mount.go @@ -0,0 +1,21 @@ +// +build linux + +package aufs + +import ( + "os/exec" + "syscall" + + "github.com/Sirupsen/logrus" +) + +// Unmount the target specified. +func Unmount(target string) error { + if err := exec.Command("auplink", target, "flush").Run(); err != nil { + logrus.Warnf("Couldn't run auplink before unmount %s: %s", target, err) + } + if err := syscall.Unmount(target, 0); err != nil { + return err + } + return nil +} diff --git a/vendor/github.com/containers/storage/drivers/aufs/mount_linux.go b/vendor/github.com/containers/storage/drivers/aufs/mount_linux.go new file mode 100644 index 00000000..8062bae4 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/aufs/mount_linux.go @@ -0,0 +1,7 @@ +package aufs + +import "syscall" + +func mount(source string, target string, fstype string, flags uintptr, data string) error { + return syscall.Mount(source, target, fstype, flags, data) +} diff --git a/vendor/github.com/containers/storage/drivers/aufs/mount_unsupported.go b/vendor/github.com/containers/storage/drivers/aufs/mount_unsupported.go new file mode 100644 index 00000000..d030b066 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/aufs/mount_unsupported.go @@ -0,0 +1,12 @@ +// +build !linux + +package aufs + +import "errors" + +// MsRemount declared to specify a non-linux system mount. +const MsRemount = 0 + +func mount(source string, target string, fstype string, flags uintptr, data string) (err error) { + return errors.New("mount is not implemented on this platform") +} diff --git a/vendor/github.com/containers/storage/drivers/btrfs/btrfs.go b/vendor/github.com/containers/storage/drivers/btrfs/btrfs.go new file mode 100644 index 00000000..a85c3c77 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/btrfs/btrfs.go @@ -0,0 +1,520 @@ +// +build linux + +package btrfs + +/* +#include +#include +#include +#include + +static void set_name_btrfs_ioctl_vol_args_v2(struct btrfs_ioctl_vol_args_v2* btrfs_struct, const char* value) { + snprintf(btrfs_struct->name, BTRFS_SUBVOL_NAME_MAX, "%s", value); +} +*/ +import "C" + +import ( + "fmt" + "os" + "path" + "path/filepath" + "strings" + "syscall" + "unsafe" + + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/mount" + "github.com/containers/storage/pkg/parsers" + "github.com/docker/go-units" + "github.com/opencontainers/runc/libcontainer/label" +) + +func init() { + graphdriver.Register("btrfs", Init) +} + +var ( + quotaEnabled = false + userDiskQuota = false +) + +type btrfsOptions struct { + minSpace uint64 + size uint64 +} + +// Init returns a new BTRFS driver. +// An error is returned if BTRFS is not supported. +func Init(home string, options []string, uidMaps, gidMaps []idtools.IDMap) (graphdriver.Driver, error) { + + fsMagic, err := graphdriver.GetFSMagic(home) + if err != nil { + return nil, err + } + + if fsMagic != graphdriver.FsMagicBtrfs { + return nil, graphdriver.ErrPrerequisites + } + + rootUID, rootGID, err := idtools.GetRootUIDGID(uidMaps, gidMaps) + if err != nil { + return nil, err + } + if err := idtools.MkdirAllAs(home, 0700, rootUID, rootGID); err != nil { + return nil, err + } + + if err := mount.MakePrivate(home); err != nil { + return nil, err + } + + opt, err := parseOptions(options) + if err != nil { + return nil, err + } + + if userDiskQuota { + if err := subvolEnableQuota(home); err != nil { + return nil, err + } + quotaEnabled = true + } + + driver := &Driver{ + home: home, + uidMaps: uidMaps, + gidMaps: gidMaps, + options: opt, + } + + return graphdriver.NewNaiveDiffDriver(driver, uidMaps, gidMaps), nil +} + +func parseOptions(opt []string) (btrfsOptions, error) { + var options btrfsOptions + for _, option := range opt { + key, val, err := parsers.ParseKeyValueOpt(option) + if err != nil { + return options, err + } + key = strings.ToLower(key) + switch key { + case "btrfs.min_space": + minSpace, err := units.RAMInBytes(val) + if err != nil { + return options, err + } + userDiskQuota = true + options.minSpace = uint64(minSpace) + default: + return options, fmt.Errorf("Unknown option %s", key) + } + } + return options, nil +} + +// Driver contains information about the filesystem mounted. +type Driver struct { + //root of the file system + home string + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap + options btrfsOptions +} + +// String prints the name of the driver (btrfs). +func (d *Driver) String() string { + return "btrfs" +} + +// Status returns current driver information in a two dimensional string array. +// Output contains "Build Version" and "Library Version" of the btrfs libraries used. +// Version information can be used to check compatibility with your kernel. +func (d *Driver) Status() [][2]string { + status := [][2]string{} + if bv := btrfsBuildVersion(); bv != "-" { + status = append(status, [2]string{"Build Version", bv}) + } + if lv := btrfsLibVersion(); lv != -1 { + status = append(status, [2]string{"Library Version", fmt.Sprintf("%d", lv)}) + } + return status +} + +// GetMetadata returns empty metadata for this driver. +func (d *Driver) GetMetadata(id string) (map[string]string, error) { + return nil, nil +} + +// Cleanup unmounts the home directory. +func (d *Driver) Cleanup() error { + if quotaEnabled { + if err := subvolDisableQuota(d.home); err != nil { + return err + } + } + + return mount.Unmount(d.home) +} + +func free(p *C.char) { + C.free(unsafe.Pointer(p)) +} + +func openDir(path string) (*C.DIR, error) { + Cpath := C.CString(path) + defer free(Cpath) + + dir := C.opendir(Cpath) + if dir == nil { + return nil, fmt.Errorf("Can't open dir") + } + return dir, nil +} + +func closeDir(dir *C.DIR) { + if dir != nil { + C.closedir(dir) + } +} + +func getDirFd(dir *C.DIR) uintptr { + return uintptr(C.dirfd(dir)) +} + +func subvolCreate(path, name string) error { + dir, err := openDir(path) + if err != nil { + return err + } + defer closeDir(dir) + + var args C.struct_btrfs_ioctl_vol_args + for i, c := range []byte(name) { + args.name[i] = C.char(c) + } + + _, _, errno := syscall.Syscall(syscall.SYS_IOCTL, getDirFd(dir), C.BTRFS_IOC_SUBVOL_CREATE, + uintptr(unsafe.Pointer(&args))) + if errno != 0 { + return fmt.Errorf("Failed to create btrfs subvolume: %v", errno.Error()) + } + return nil +} + +func subvolSnapshot(src, dest, name string) error { + srcDir, err := openDir(src) + if err != nil { + return err + } + defer closeDir(srcDir) + + destDir, err := openDir(dest) + if err != nil { + return err + } + defer closeDir(destDir) + + var args C.struct_btrfs_ioctl_vol_args_v2 + args.fd = C.__s64(getDirFd(srcDir)) + + var cs = C.CString(name) + C.set_name_btrfs_ioctl_vol_args_v2(&args, cs) + C.free(unsafe.Pointer(cs)) + + _, _, errno := syscall.Syscall(syscall.SYS_IOCTL, getDirFd(destDir), C.BTRFS_IOC_SNAP_CREATE_V2, + uintptr(unsafe.Pointer(&args))) + if errno != 0 { + return fmt.Errorf("Failed to create btrfs snapshot: %v", errno.Error()) + } + return nil +} + +func isSubvolume(p string) (bool, error) { + var bufStat syscall.Stat_t + if err := syscall.Lstat(p, &bufStat); err != nil { + return false, err + } + + // return true if it is a btrfs subvolume + return bufStat.Ino == C.BTRFS_FIRST_FREE_OBJECTID, nil +} + +func subvolDelete(dirpath, name string) error { + dir, err := openDir(dirpath) + if err != nil { + return err + } + defer closeDir(dir) + fullPath := path.Join(dirpath, name) + + var args C.struct_btrfs_ioctl_vol_args + + // walk the btrfs subvolumes + walkSubvolumes := func(p string, f os.FileInfo, err error) error { + if err != nil { + if os.IsNotExist(err) && p != fullPath { + // missing most likely because the path was a subvolume that got removed in the previous iteration + // since it's gone anyway, we don't care + return nil + } + return fmt.Errorf("error walking subvolumes: %v", err) + } + // we want to check children only so skip itself + // it will be removed after the filepath walk anyways + if f.IsDir() && p != fullPath { + sv, err := isSubvolume(p) + if err != nil { + return fmt.Errorf("Failed to test if %s is a btrfs subvolume: %v", p, err) + } + if sv { + if err := subvolDelete(path.Dir(p), f.Name()); err != nil { + return fmt.Errorf("Failed to destroy btrfs child subvolume (%s) of parent (%s): %v", p, dirpath, err) + } + } + } + return nil + } + if err := filepath.Walk(path.Join(dirpath, name), walkSubvolumes); err != nil { + return fmt.Errorf("Recursively walking subvolumes for %s failed: %v", dirpath, err) + } + + // all subvolumes have been removed + // now remove the one originally passed in + for i, c := range []byte(name) { + args.name[i] = C.char(c) + } + _, _, errno := syscall.Syscall(syscall.SYS_IOCTL, getDirFd(dir), C.BTRFS_IOC_SNAP_DESTROY, + uintptr(unsafe.Pointer(&args))) + if errno != 0 { + return fmt.Errorf("Failed to destroy btrfs snapshot %s for %s: %v", dirpath, name, errno.Error()) + } + return nil +} + +func subvolEnableQuota(path string) error { + dir, err := openDir(path) + if err != nil { + return err + } + defer closeDir(dir) + + var args C.struct_btrfs_ioctl_quota_ctl_args + args.cmd = C.BTRFS_QUOTA_CTL_ENABLE + _, _, errno := syscall.Syscall(syscall.SYS_IOCTL, getDirFd(dir), C.BTRFS_IOC_QUOTA_CTL, + uintptr(unsafe.Pointer(&args))) + if errno != 0 { + return fmt.Errorf("Failed to enable btrfs quota for %s: %v", dir, errno.Error()) + } + + return nil +} + +func subvolDisableQuota(path string) error { + dir, err := openDir(path) + if err != nil { + return err + } + defer closeDir(dir) + + var args C.struct_btrfs_ioctl_quota_ctl_args + args.cmd = C.BTRFS_QUOTA_CTL_DISABLE + _, _, errno := syscall.Syscall(syscall.SYS_IOCTL, getDirFd(dir), C.BTRFS_IOC_QUOTA_CTL, + uintptr(unsafe.Pointer(&args))) + if errno != 0 { + return fmt.Errorf("Failed to disable btrfs quota for %s: %v", dir, errno.Error()) + } + + return nil +} + +func subvolRescanQuota(path string) error { + dir, err := openDir(path) + if err != nil { + return err + } + defer closeDir(dir) + + var args C.struct_btrfs_ioctl_quota_rescan_args + _, _, errno := syscall.Syscall(syscall.SYS_IOCTL, getDirFd(dir), C.BTRFS_IOC_QUOTA_RESCAN_WAIT, + uintptr(unsafe.Pointer(&args))) + if errno != 0 { + return fmt.Errorf("Failed to rescan btrfs quota for %s: %v", dir, errno.Error()) + } + + return nil +} + +func subvolLimitQgroup(path string, size uint64) error { + dir, err := openDir(path) + if err != nil { + return err + } + defer closeDir(dir) + + var args C.struct_btrfs_ioctl_qgroup_limit_args + args.lim.max_referenced = C.__u64(size) + args.lim.flags = C.BTRFS_QGROUP_LIMIT_MAX_RFER + _, _, errno := syscall.Syscall(syscall.SYS_IOCTL, getDirFd(dir), C.BTRFS_IOC_QGROUP_LIMIT, + uintptr(unsafe.Pointer(&args))) + if errno != 0 { + return fmt.Errorf("Failed to limit qgroup for %s: %v", dir, errno.Error()) + } + + return nil +} + +func (d *Driver) subvolumesDir() string { + return path.Join(d.home, "subvolumes") +} + +func (d *Driver) subvolumesDirID(id string) string { + return path.Join(d.subvolumesDir(), id) +} + +// CreateReadWrite creates a layer that is writable for use as a container +// file system. +func (d *Driver) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + return d.Create(id, parent, mountLabel, storageOpt) +} + +// Create the filesystem with given id. +func (d *Driver) Create(id, parent, mountLabel string, storageOpt map[string]string) error { + subvolumes := path.Join(d.home, "subvolumes") + rootUID, rootGID, err := idtools.GetRootUIDGID(d.uidMaps, d.gidMaps) + if err != nil { + return err + } + if err := idtools.MkdirAllAs(subvolumes, 0700, rootUID, rootGID); err != nil { + return err + } + if parent == "" { + if err := subvolCreate(subvolumes, id); err != nil { + return err + } + } else { + parentDir := d.subvolumesDirID(parent) + st, err := os.Stat(parentDir) + if err != nil { + return err + } + if !st.IsDir() { + return fmt.Errorf("%s: not a directory", parentDir) + } + if err := subvolSnapshot(parentDir, subvolumes, id); err != nil { + return err + } + } + + if _, ok := storageOpt["size"]; ok { + driver := &Driver{} + if err := d.parseStorageOpt(storageOpt, driver); err != nil { + return err + } + if err := d.setStorageSize(path.Join(subvolumes, id), driver); err != nil { + return err + } + } + + // if we have a remapped root (user namespaces enabled), change the created snapshot + // dir ownership to match + if rootUID != 0 || rootGID != 0 { + if err := os.Chown(path.Join(subvolumes, id), rootUID, rootGID); err != nil { + return err + } + } + + return label.Relabel(path.Join(subvolumes, id), mountLabel, false) +} + +// Parse btrfs storage options +func (d *Driver) parseStorageOpt(storageOpt map[string]string, driver *Driver) error { + // Read size to change the subvolume disk quota per container + for key, val := range storageOpt { + key := strings.ToLower(key) + switch key { + case "size": + size, err := units.RAMInBytes(val) + if err != nil { + return err + } + driver.options.size = uint64(size) + default: + return fmt.Errorf("Unknown option %s", key) + } + } + + return nil +} + +// Set btrfs storage size +func (d *Driver) setStorageSize(dir string, driver *Driver) error { + if driver.options.size <= 0 { + return fmt.Errorf("btrfs: invalid storage size: %s", units.HumanSize(float64(driver.options.size))) + } + if d.options.minSpace > 0 && driver.options.size < d.options.minSpace { + return fmt.Errorf("btrfs: storage size cannot be less than %s", units.HumanSize(float64(d.options.minSpace))) + } + + if !quotaEnabled { + if err := subvolEnableQuota(d.home); err != nil { + return err + } + quotaEnabled = true + } + + if err := subvolLimitQgroup(dir, driver.options.size); err != nil { + return err + } + + return nil +} + +// Remove the filesystem with given id. +func (d *Driver) Remove(id string) error { + dir := d.subvolumesDirID(id) + if _, err := os.Stat(dir); err != nil { + return err + } + if err := subvolDelete(d.subvolumesDir(), id); err != nil { + return err + } + if err := os.RemoveAll(dir); err != nil && !os.IsNotExist(err) { + return err + } + if err := subvolRescanQuota(d.home); err != nil { + return err + } + return nil +} + +// Get the requested filesystem id. +func (d *Driver) Get(id, mountLabel string) (string, error) { + dir := d.subvolumesDirID(id) + st, err := os.Stat(dir) + if err != nil { + return "", err + } + + if !st.IsDir() { + return "", fmt.Errorf("%s: not a directory", dir) + } + + return dir, nil +} + +// Put is not implemented for BTRFS as there is no cleanup required for the id. +func (d *Driver) Put(id string) error { + // Get() creates no runtime resources (like e.g. mounts) + // so this doesn't need to do anything. + return nil +} + +// Exists checks if the id exists in the filesystem. +func (d *Driver) Exists(id string) bool { + dir := d.subvolumesDirID(id) + _, err := os.Stat(dir) + return err == nil +} diff --git a/vendor/github.com/containers/storage/drivers/btrfs/dummy_unsupported.go b/vendor/github.com/containers/storage/drivers/btrfs/dummy_unsupported.go new file mode 100644 index 00000000..f0708888 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/btrfs/dummy_unsupported.go @@ -0,0 +1,3 @@ +// +build !linux !cgo + +package btrfs diff --git a/vendor/github.com/containers/storage/drivers/btrfs/version.go b/vendor/github.com/containers/storage/drivers/btrfs/version.go new file mode 100644 index 00000000..73d90cdd --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/btrfs/version.go @@ -0,0 +1,26 @@ +// +build linux,!btrfs_noversion + +package btrfs + +/* +#include + +// around version 3.16, they did not define lib version yet +#ifndef BTRFS_LIB_VERSION +#define BTRFS_LIB_VERSION -1 +#endif + +// upstream had removed it, but now it will be coming back +#ifndef BTRFS_BUILD_VERSION +#define BTRFS_BUILD_VERSION "-" +#endif +*/ +import "C" + +func btrfsBuildVersion() string { + return string(C.BTRFS_BUILD_VERSION) +} + +func btrfsLibVersion() int { + return int(C.BTRFS_LIB_VERSION) +} diff --git a/vendor/github.com/containers/storage/drivers/btrfs/version_none.go b/vendor/github.com/containers/storage/drivers/btrfs/version_none.go new file mode 100644 index 00000000..f802fbc6 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/btrfs/version_none.go @@ -0,0 +1,14 @@ +// +build linux,btrfs_noversion + +package btrfs + +// TODO(vbatts) remove this work-around once supported linux distros are on +// btrfs utilities of >= 3.16.1 + +func btrfsBuildVersion() string { + return "-" +} + +func btrfsLibVersion() int { + return -1 +} diff --git a/vendor/github.com/containers/storage/drivers/counter.go b/vendor/github.com/containers/storage/drivers/counter.go new file mode 100644 index 00000000..5ea604f5 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/counter.go @@ -0,0 +1,67 @@ +package graphdriver + +import "sync" + +type minfo struct { + check bool + count int +} + +// RefCounter is a generic counter for use by graphdriver Get/Put calls +type RefCounter struct { + counts map[string]*minfo + mu sync.Mutex + checker Checker +} + +// NewRefCounter returns a new RefCounter +func NewRefCounter(c Checker) *RefCounter { + return &RefCounter{ + checker: c, + counts: make(map[string]*minfo), + } +} + +// Increment increaes the ref count for the given id and returns the current count +func (c *RefCounter) Increment(path string) int { + c.mu.Lock() + m := c.counts[path] + if m == nil { + m = &minfo{} + c.counts[path] = m + } + // if we are checking this path for the first time check to make sure + // if it was already mounted on the system and make sure we have a correct ref + // count if it is mounted as it is in use. + if !m.check { + m.check = true + if c.checker.IsMounted(path) { + m.count++ + } + } + m.count++ + c.mu.Unlock() + return m.count +} + +// Decrement decreases the ref count for the given id and returns the current count +func (c *RefCounter) Decrement(path string) int { + c.mu.Lock() + m := c.counts[path] + if m == nil { + m = &minfo{} + c.counts[path] = m + } + // if we are checking this path for the first time check to make sure + // if it was already mounted on the system and make sure we have a correct ref + // count if it is mounted as it is in use. + if !m.check { + m.check = true + if c.checker.IsMounted(path) { + m.count++ + } + } + m.count-- + c.mu.Unlock() + return m.count +} diff --git a/vendor/github.com/containers/storage/drivers/devmapper/deviceset.go b/vendor/github.com/containers/storage/drivers/devmapper/deviceset.go new file mode 100644 index 00000000..e7d05006 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/devmapper/deviceset.go @@ -0,0 +1,2658 @@ +// +build linux + +package devmapper + +import ( + "bufio" + "encoding/json" + "errors" + "fmt" + "io" + "io/ioutil" + "os" + "os/exec" + "path" + "path/filepath" + "strconv" + "strings" + "sync" + "syscall" + "time" + + "github.com/Sirupsen/logrus" + + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/devicemapper" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/ioutils" + "github.com/containers/storage/pkg/loopback" + "github.com/containers/storage/pkg/mount" + "github.com/containers/storage/pkg/parsers" + "github.com/containers/storage/storageversion" + "github.com/docker/go-units" + + "github.com/opencontainers/runc/libcontainer/label" +) + +var ( + defaultDataLoopbackSize int64 = 100 * 1024 * 1024 * 1024 + defaultMetaDataLoopbackSize int64 = 2 * 1024 * 1024 * 1024 + defaultBaseFsSize uint64 = 10 * 1024 * 1024 * 1024 + defaultThinpBlockSize uint32 = 128 // 64K = 128 512b sectors + defaultUdevSyncOverride = false + maxDeviceID = 0xffffff // 24 bit, pool limit + deviceIDMapSz = (maxDeviceID + 1) / 8 + // We retry device removal so many a times that even error messages + // will fill up console during normal operation. So only log Fatal + // messages by default. + logLevel = devicemapper.LogLevelFatal + driverDeferredRemovalSupport = false + enableDeferredRemoval = false + enableDeferredDeletion = false + userBaseSize = false + defaultMinFreeSpacePercent uint32 = 10 +) + +const deviceSetMetaFile string = "deviceset-metadata" +const transactionMetaFile string = "transaction-metadata" + +type transaction struct { + OpenTransactionID uint64 `json:"open_transaction_id"` + DeviceIDHash string `json:"device_hash"` + DeviceID int `json:"device_id"` +} + +type devInfo struct { + Hash string `json:"-"` + DeviceID int `json:"device_id"` + Size uint64 `json:"size"` + TransactionID uint64 `json:"transaction_id"` + Initialized bool `json:"initialized"` + Deleted bool `json:"deleted"` + devices *DeviceSet + + // The global DeviceSet lock guarantees that we serialize all + // the calls to libdevmapper (which is not threadsafe), but we + // sometimes release that lock while sleeping. In that case + // this per-device lock is still held, protecting against + // other accesses to the device that we're doing the wait on. + // + // WARNING: In order to avoid AB-BA deadlocks when releasing + // the global lock while holding the per-device locks all + // device locks must be acquired *before* the device lock, and + // multiple device locks should be acquired parent before child. + lock sync.Mutex +} + +type metaData struct { + Devices map[string]*devInfo `json:"Devices"` +} + +// DeviceSet holds information about list of devices +type DeviceSet struct { + metaData `json:"-"` + sync.Mutex `json:"-"` // Protects all fields of DeviceSet and serializes calls into libdevmapper + root string + devicePrefix string + TransactionID uint64 `json:"-"` + NextDeviceID int `json:"next_device_id"` + deviceIDMap []byte + + // Options + dataLoopbackSize int64 + metaDataLoopbackSize int64 + baseFsSize uint64 + filesystem string + mountOptions string + mkfsArgs []string + dataDevice string // block or loop dev + dataLoopFile string // loopback file, if used + metadataDevice string // block or loop dev + metadataLoopFile string // loopback file, if used + doBlkDiscard bool + thinpBlockSize uint32 + thinPoolDevice string + transaction `json:"-"` + overrideUdevSyncCheck bool + deferredRemove bool // use deferred removal + deferredDelete bool // use deferred deletion + BaseDeviceUUID string // save UUID of base device + BaseDeviceFilesystem string // save filesystem of base device + nrDeletedDevices uint // number of deleted devices + deletionWorkerTicker *time.Ticker + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap + minFreeSpacePercent uint32 //min free space percentage in thinpool +} + +// DiskUsage contains information about disk usage and is used when reporting Status of a device. +type DiskUsage struct { + // Used bytes on the disk. + Used uint64 + // Total bytes on the disk. + Total uint64 + // Available bytes on the disk. + Available uint64 +} + +// Status returns the information about the device. +type Status struct { + // PoolName is the name of the data pool. + PoolName string + // DataFile is the actual block device for data. + DataFile string + // DataLoopback loopback file, if used. + DataLoopback string + // MetadataFile is the actual block device for metadata. + MetadataFile string + // MetadataLoopback is the loopback file, if used. + MetadataLoopback string + // Data is the disk used for data. + Data DiskUsage + // Metadata is the disk used for meta data. + Metadata DiskUsage + // BaseDeviceSize is base size of container and image + BaseDeviceSize uint64 + // BaseDeviceFS is backing filesystem. + BaseDeviceFS string + // SectorSize size of the vector. + SectorSize uint64 + // UdevSyncSupported is true if sync is supported. + UdevSyncSupported bool + // DeferredRemoveEnabled is true then the device is not unmounted. + DeferredRemoveEnabled bool + // True if deferred deletion is enabled. This is different from + // deferred removal. "removal" means that device mapper device is + // deactivated. Thin device is still in thin pool and can be activated + // again. But "deletion" means that thin device will be deleted from + // thin pool and it can't be activated again. + DeferredDeleteEnabled bool + DeferredDeletedDeviceCount uint + MinFreeSpace uint64 +} + +// Structure used to export image/container metadata in docker inspect. +type deviceMetadata struct { + deviceID int + deviceSize uint64 // size in bytes + deviceName string // Device name as used during activation +} + +// DevStatus returns information about device mounted containing its id, size and sector information. +type DevStatus struct { + // DeviceID is the id of the device. + DeviceID int + // Size is the size of the filesystem. + Size uint64 + // TransactionID is a unique integer per device set used to identify an operation on the file system, this number is incremental. + TransactionID uint64 + // SizeInSectors indicates the size of the sectors allocated. + SizeInSectors uint64 + // MappedSectors indicates number of mapped sectors. + MappedSectors uint64 + // HighestMappedSector is the pointer to the highest mapped sector. + HighestMappedSector uint64 +} + +func getDevName(name string) string { + return "/dev/mapper/" + name +} + +func (info *devInfo) Name() string { + hash := info.Hash + if hash == "" { + hash = "base" + } + return fmt.Sprintf("%s-%s", info.devices.devicePrefix, hash) +} + +func (info *devInfo) DevName() string { + return getDevName(info.Name()) +} + +func (devices *DeviceSet) loopbackDir() string { + return path.Join(devices.root, "devicemapper") +} + +func (devices *DeviceSet) metadataDir() string { + return path.Join(devices.root, "metadata") +} + +func (devices *DeviceSet) metadataFile(info *devInfo) string { + file := info.Hash + if file == "" { + file = "base" + } + return path.Join(devices.metadataDir(), file) +} + +func (devices *DeviceSet) transactionMetaFile() string { + return path.Join(devices.metadataDir(), transactionMetaFile) +} + +func (devices *DeviceSet) deviceSetMetaFile() string { + return path.Join(devices.metadataDir(), deviceSetMetaFile) +} + +func (devices *DeviceSet) oldMetadataFile() string { + return path.Join(devices.loopbackDir(), "json") +} + +func (devices *DeviceSet) getPoolName() string { + if devices.thinPoolDevice == "" { + return devices.devicePrefix + "-pool" + } + return devices.thinPoolDevice +} + +func (devices *DeviceSet) getPoolDevName() string { + return getDevName(devices.getPoolName()) +} + +func (devices *DeviceSet) hasImage(name string) bool { + dirname := devices.loopbackDir() + filename := path.Join(dirname, name) + + _, err := os.Stat(filename) + return err == nil +} + +// ensureImage creates a sparse file of bytes at the path +// /devicemapper/. +// If the file already exists and new size is larger than its current size, it grows to the new size. +// Either way it returns the full path. +func (devices *DeviceSet) ensureImage(name string, size int64) (string, error) { + dirname := devices.loopbackDir() + filename := path.Join(dirname, name) + + uid, gid, err := idtools.GetRootUIDGID(devices.uidMaps, devices.gidMaps) + if err != nil { + return "", err + } + if err := idtools.MkdirAllAs(dirname, 0700, uid, gid); err != nil && !os.IsExist(err) { + return "", err + } + + if fi, err := os.Stat(filename); err != nil { + if !os.IsNotExist(err) { + return "", err + } + logrus.Debugf("devmapper: Creating loopback file %s for device-manage use", filename) + file, err := os.OpenFile(filename, os.O_RDWR|os.O_CREATE, 0600) + if err != nil { + return "", err + } + defer file.Close() + + if err := file.Truncate(size); err != nil { + return "", err + } + } else { + if fi.Size() < size { + file, err := os.OpenFile(filename, os.O_RDWR|os.O_CREATE, 0600) + if err != nil { + return "", err + } + defer file.Close() + if err := file.Truncate(size); err != nil { + return "", fmt.Errorf("devmapper: Unable to grow loopback file %s: %v", filename, err) + } + } else if fi.Size() > size { + logrus.Warnf("devmapper: Can't shrink loopback file %s", filename) + } + } + return filename, nil +} + +func (devices *DeviceSet) allocateTransactionID() uint64 { + devices.OpenTransactionID = devices.TransactionID + 1 + return devices.OpenTransactionID +} + +func (devices *DeviceSet) updatePoolTransactionID() error { + if err := devicemapper.SetTransactionID(devices.getPoolDevName(), devices.TransactionID, devices.OpenTransactionID); err != nil { + return fmt.Errorf("devmapper: Error setting devmapper transaction ID: %s", err) + } + devices.TransactionID = devices.OpenTransactionID + return nil +} + +func (devices *DeviceSet) removeMetadata(info *devInfo) error { + if err := os.RemoveAll(devices.metadataFile(info)); err != nil { + return fmt.Errorf("devmapper: Error removing metadata file %s: %s", devices.metadataFile(info), err) + } + return nil +} + +// Given json data and file path, write it to disk +func (devices *DeviceSet) writeMetaFile(jsonData []byte, filePath string) error { + tmpFile, err := ioutil.TempFile(devices.metadataDir(), ".tmp") + if err != nil { + return fmt.Errorf("devmapper: Error creating metadata file: %s", err) + } + + n, err := tmpFile.Write(jsonData) + if err != nil { + return fmt.Errorf("devmapper: Error writing metadata to %s: %s", tmpFile.Name(), err) + } + if n < len(jsonData) { + return io.ErrShortWrite + } + if err := tmpFile.Sync(); err != nil { + return fmt.Errorf("devmapper: Error syncing metadata file %s: %s", tmpFile.Name(), err) + } + if err := tmpFile.Close(); err != nil { + return fmt.Errorf("devmapper: Error closing metadata file %s: %s", tmpFile.Name(), err) + } + if err := os.Rename(tmpFile.Name(), filePath); err != nil { + return fmt.Errorf("devmapper: Error committing metadata file %s: %s", tmpFile.Name(), err) + } + + return nil +} + +func (devices *DeviceSet) saveMetadata(info *devInfo) error { + jsonData, err := json.Marshal(info) + if err != nil { + return fmt.Errorf("devmapper: Error encoding metadata to json: %s", err) + } + if err := devices.writeMetaFile(jsonData, devices.metadataFile(info)); err != nil { + return err + } + return nil +} + +func (devices *DeviceSet) markDeviceIDUsed(deviceID int) { + var mask byte + i := deviceID % 8 + mask = 1 << uint(i) + devices.deviceIDMap[deviceID/8] = devices.deviceIDMap[deviceID/8] | mask +} + +func (devices *DeviceSet) markDeviceIDFree(deviceID int) { + var mask byte + i := deviceID % 8 + mask = ^(1 << uint(i)) + devices.deviceIDMap[deviceID/8] = devices.deviceIDMap[deviceID/8] & mask +} + +func (devices *DeviceSet) isDeviceIDFree(deviceID int) bool { + var mask byte + i := deviceID % 8 + mask = (1 << uint(i)) + if (devices.deviceIDMap[deviceID/8] & mask) != 0 { + return false + } + return true +} + +// Should be called with devices.Lock() held. +func (devices *DeviceSet) lookupDevice(hash string) (*devInfo, error) { + info := devices.Devices[hash] + if info == nil { + info = devices.loadMetadata(hash) + if info == nil { + return nil, fmt.Errorf("devmapper: Unknown device %s", hash) + } + + devices.Devices[hash] = info + } + return info, nil +} + +func (devices *DeviceSet) lookupDeviceWithLock(hash string) (*devInfo, error) { + devices.Lock() + defer devices.Unlock() + info, err := devices.lookupDevice(hash) + return info, err +} + +// This function relies on that device hash map has been loaded in advance. +// Should be called with devices.Lock() held. +func (devices *DeviceSet) constructDeviceIDMap() { + logrus.Debugf("devmapper: constructDeviceIDMap()") + defer logrus.Debugf("devmapper: constructDeviceIDMap() END") + + for _, info := range devices.Devices { + devices.markDeviceIDUsed(info.DeviceID) + logrus.Debugf("devmapper: Added deviceId=%d to DeviceIdMap", info.DeviceID) + } +} + +func (devices *DeviceSet) deviceFileWalkFunction(path string, finfo os.FileInfo) error { + + // Skip some of the meta files which are not device files. + if strings.HasSuffix(finfo.Name(), ".migrated") { + logrus.Debugf("devmapper: Skipping file %s", path) + return nil + } + + if strings.HasPrefix(finfo.Name(), ".") { + logrus.Debugf("devmapper: Skipping file %s", path) + return nil + } + + if finfo.Name() == deviceSetMetaFile { + logrus.Debugf("devmapper: Skipping file %s", path) + return nil + } + + if finfo.Name() == transactionMetaFile { + logrus.Debugf("devmapper: Skipping file %s", path) + return nil + } + + logrus.Debugf("devmapper: Loading data for file %s", path) + + hash := finfo.Name() + if hash == "base" { + hash = "" + } + + // Include deleted devices also as cleanup delete device logic + // will go through it and see if there are any deleted devices. + if _, err := devices.lookupDevice(hash); err != nil { + return fmt.Errorf("devmapper: Error looking up device %s:%v", hash, err) + } + + return nil +} + +func (devices *DeviceSet) loadDeviceFilesOnStart() error { + logrus.Debugf("devmapper: loadDeviceFilesOnStart()") + defer logrus.Debugf("devmapper: loadDeviceFilesOnStart() END") + + var scan = func(path string, info os.FileInfo, err error) error { + if err != nil { + logrus.Debugf("devmapper: Can't walk the file %s", path) + return nil + } + + // Skip any directories + if info.IsDir() { + return nil + } + + return devices.deviceFileWalkFunction(path, info) + } + + return filepath.Walk(devices.metadataDir(), scan) +} + +// Should be called with devices.Lock() held. +func (devices *DeviceSet) unregisterDevice(id int, hash string) error { + logrus.Debugf("devmapper: unregisterDevice(%v, %v)", id, hash) + info := &devInfo{ + Hash: hash, + DeviceID: id, + } + + delete(devices.Devices, hash) + + if err := devices.removeMetadata(info); err != nil { + logrus.Debugf("devmapper: Error removing metadata: %s", err) + return err + } + + return nil +} + +// Should be called with devices.Lock() held. +func (devices *DeviceSet) registerDevice(id int, hash string, size uint64, transactionID uint64) (*devInfo, error) { + logrus.Debugf("devmapper: registerDevice(%v, %v)", id, hash) + info := &devInfo{ + Hash: hash, + DeviceID: id, + Size: size, + TransactionID: transactionID, + Initialized: false, + devices: devices, + } + + devices.Devices[hash] = info + + if err := devices.saveMetadata(info); err != nil { + // Try to remove unused device + delete(devices.Devices, hash) + return nil, err + } + + return info, nil +} + +func (devices *DeviceSet) activateDeviceIfNeeded(info *devInfo, ignoreDeleted bool) error { + logrus.Debugf("devmapper: activateDeviceIfNeeded(%v)", info.Hash) + + if info.Deleted && !ignoreDeleted { + return fmt.Errorf("devmapper: Can't activate device %v as it is marked for deletion", info.Hash) + } + + // Make sure deferred removal on device is canceled, if one was + // scheduled. + if err := devices.cancelDeferredRemoval(info); err != nil { + return fmt.Errorf("devmapper: Device Deferred Removal Cancellation Failed: %s", err) + } + + if devinfo, _ := devicemapper.GetInfo(info.Name()); devinfo != nil && devinfo.Exists != 0 { + return nil + } + + return devicemapper.ActivateDevice(devices.getPoolDevName(), info.Name(), info.DeviceID, info.Size) +} + +// Return true only if kernel supports xfs and mkfs.xfs is available +func xfsSupported() bool { + // Make sure mkfs.xfs is available + if _, err := exec.LookPath("mkfs.xfs"); err != nil { + return false + } + + // Check if kernel supports xfs filesystem or not. + exec.Command("modprobe", "xfs").Run() + + f, err := os.Open("/proc/filesystems") + if err != nil { + logrus.Warnf("devmapper: Could not check if xfs is supported: %v", err) + return false + } + defer f.Close() + + s := bufio.NewScanner(f) + for s.Scan() { + if strings.HasSuffix(s.Text(), "\txfs") { + return true + } + } + + if err := s.Err(); err != nil { + logrus.Warnf("devmapper: Could not check if xfs is supported: %v", err) + } + return false +} + +func determineDefaultFS() string { + if xfsSupported() { + return "xfs" + } + + logrus.Warn("devmapper: XFS is not supported in your system. Either the kernel doesn't support it or mkfs.xfs is not in your PATH. Defaulting to ext4 filesystem") + return "ext4" +} + +func (devices *DeviceSet) createFilesystem(info *devInfo) (err error) { + devname := info.DevName() + + args := []string{} + for _, arg := range devices.mkfsArgs { + args = append(args, arg) + } + + args = append(args, devname) + + if devices.filesystem == "" { + devices.filesystem = determineDefaultFS() + } + if err := devices.saveBaseDeviceFilesystem(devices.filesystem); err != nil { + return err + } + + logrus.Infof("devmapper: Creating filesystem %s on device %s", devices.filesystem, info.Name()) + defer func() { + if err != nil { + logrus.Infof("devmapper: Error while creating filesystem %s on device %s: %v", devices.filesystem, info.Name(), err) + } else { + logrus.Infof("devmapper: Successfully created filesystem %s on device %s", devices.filesystem, info.Name()) + } + }() + + switch devices.filesystem { + case "xfs": + err = exec.Command("mkfs.xfs", args...).Run() + case "ext4": + err = exec.Command("mkfs.ext4", append([]string{"-E", "nodiscard,lazy_itable_init=0,lazy_journal_init=0"}, args...)...).Run() + if err != nil { + err = exec.Command("mkfs.ext4", append([]string{"-E", "nodiscard,lazy_itable_init=0"}, args...)...).Run() + } + if err != nil { + return err + } + err = exec.Command("tune2fs", append([]string{"-c", "-1", "-i", "0"}, devname)...).Run() + default: + err = fmt.Errorf("devmapper: Unsupported filesystem type %s", devices.filesystem) + } + return +} + +func (devices *DeviceSet) migrateOldMetaData() error { + // Migrate old metadata file + jsonData, err := ioutil.ReadFile(devices.oldMetadataFile()) + if err != nil && !os.IsNotExist(err) { + return err + } + + if jsonData != nil { + m := metaData{Devices: make(map[string]*devInfo)} + + if err := json.Unmarshal(jsonData, &m); err != nil { + return err + } + + for hash, info := range m.Devices { + info.Hash = hash + devices.saveMetadata(info) + } + if err := os.Rename(devices.oldMetadataFile(), devices.oldMetadataFile()+".migrated"); err != nil { + return err + } + + } + + return nil +} + +// Cleanup deleted devices. It assumes that all the devices have been +// loaded in the hash table. +func (devices *DeviceSet) cleanupDeletedDevices() error { + devices.Lock() + + // If there are no deleted devices, there is nothing to do. + if devices.nrDeletedDevices == 0 { + devices.Unlock() + return nil + } + + var deletedDevices []*devInfo + + for _, info := range devices.Devices { + if !info.Deleted { + continue + } + logrus.Debugf("devmapper: Found deleted device %s.", info.Hash) + deletedDevices = append(deletedDevices, info) + } + + // Delete the deleted devices. DeleteDevice() first takes the info lock + // and then devices.Lock(). So drop it to avoid deadlock. + devices.Unlock() + + for _, info := range deletedDevices { + // This will again try deferred deletion. + if err := devices.DeleteDevice(info.Hash, false); err != nil { + logrus.Warnf("devmapper: Deletion of device %s, device_id=%v failed:%v", info.Hash, info.DeviceID, err) + } + } + + return nil +} + +func (devices *DeviceSet) countDeletedDevices() { + for _, info := range devices.Devices { + if !info.Deleted { + continue + } + devices.nrDeletedDevices++ + } +} + +func (devices *DeviceSet) startDeviceDeletionWorker() { + // Deferred deletion is not enabled. Don't do anything. + if !devices.deferredDelete { + return + } + + logrus.Debug("devmapper: Worker to cleanup deleted devices started") + for range devices.deletionWorkerTicker.C { + devices.cleanupDeletedDevices() + } +} + +func (devices *DeviceSet) initMetaData() error { + devices.Lock() + defer devices.Unlock() + + if err := devices.migrateOldMetaData(); err != nil { + return err + } + + _, transactionID, _, _, _, _, err := devices.poolStatus() + if err != nil { + return err + } + + devices.TransactionID = transactionID + + if err := devices.loadDeviceFilesOnStart(); err != nil { + return fmt.Errorf("devmapper: Failed to load device files:%v", err) + } + + devices.constructDeviceIDMap() + devices.countDeletedDevices() + + if err := devices.processPendingTransaction(); err != nil { + return err + } + + // Start a goroutine to cleanup Deleted Devices + go devices.startDeviceDeletionWorker() + return nil +} + +func (devices *DeviceSet) incNextDeviceID() { + // IDs are 24bit, so wrap around + devices.NextDeviceID = (devices.NextDeviceID + 1) & maxDeviceID +} + +func (devices *DeviceSet) getNextFreeDeviceID() (int, error) { + devices.incNextDeviceID() + for i := 0; i <= maxDeviceID; i++ { + if devices.isDeviceIDFree(devices.NextDeviceID) { + devices.markDeviceIDUsed(devices.NextDeviceID) + return devices.NextDeviceID, nil + } + devices.incNextDeviceID() + } + + return 0, fmt.Errorf("devmapper: Unable to find a free device ID") +} + +func (devices *DeviceSet) poolHasFreeSpace() error { + if devices.minFreeSpacePercent == 0 { + return nil + } + + _, _, dataUsed, dataTotal, metadataUsed, metadataTotal, err := devices.poolStatus() + if err != nil { + return err + } + + minFreeData := (dataTotal * uint64(devices.minFreeSpacePercent)) / 100 + if minFreeData < 1 { + minFreeData = 1 + } + dataFree := dataTotal - dataUsed + if dataFree < minFreeData { + return fmt.Errorf("devmapper: Thin Pool has %v free data blocks which is less than minimum required %v free data blocks. Create more free space in thin pool or use dm.min_free_space option to change behavior", (dataTotal - dataUsed), minFreeData) + } + + minFreeMetadata := (metadataTotal * uint64(devices.minFreeSpacePercent)) / 100 + if minFreeMetadata < 1 { + minFreeMetadata = 1 + } + + metadataFree := metadataTotal - metadataUsed + if metadataFree < minFreeMetadata { + return fmt.Errorf("devmapper: Thin Pool has %v free metadata blocks which is less than minimum required %v free metadata blocks. Create more free metadata space in thin pool or use dm.min_free_space option to change behavior", (metadataTotal - metadataUsed), minFreeMetadata) + } + + return nil +} + +func (devices *DeviceSet) createRegisterDevice(hash string) (*devInfo, error) { + devices.Lock() + defer devices.Unlock() + + deviceID, err := devices.getNextFreeDeviceID() + if err != nil { + return nil, err + } + + if err := devices.openTransaction(hash, deviceID); err != nil { + logrus.Debugf("devmapper: Error opening transaction hash = %s deviceID = %d", hash, deviceID) + devices.markDeviceIDFree(deviceID) + return nil, err + } + + for { + if err := devicemapper.CreateDevice(devices.getPoolDevName(), deviceID); err != nil { + if devicemapper.DeviceIDExists(err) { + // Device ID already exists. This should not + // happen. Now we have a mechanism to find + // a free device ID. So something is not right. + // Give a warning and continue. + logrus.Errorf("devmapper: Device ID %d exists in pool but it is supposed to be unused", deviceID) + deviceID, err = devices.getNextFreeDeviceID() + if err != nil { + return nil, err + } + // Save new device id into transaction + devices.refreshTransaction(deviceID) + continue + } + logrus.Debugf("devmapper: Error creating device: %s", err) + devices.markDeviceIDFree(deviceID) + return nil, err + } + break + } + + logrus.Debugf("devmapper: Registering device (id %v) with FS size %v", deviceID, devices.baseFsSize) + info, err := devices.registerDevice(deviceID, hash, devices.baseFsSize, devices.OpenTransactionID) + if err != nil { + _ = devicemapper.DeleteDevice(devices.getPoolDevName(), deviceID) + devices.markDeviceIDFree(deviceID) + return nil, err + } + + if err := devices.closeTransaction(); err != nil { + devices.unregisterDevice(deviceID, hash) + devicemapper.DeleteDevice(devices.getPoolDevName(), deviceID) + devices.markDeviceIDFree(deviceID) + return nil, err + } + return info, nil +} + +func (devices *DeviceSet) createRegisterSnapDevice(hash string, baseInfo *devInfo, size uint64) error { + if err := devices.poolHasFreeSpace(); err != nil { + return err + } + + deviceID, err := devices.getNextFreeDeviceID() + if err != nil { + return err + } + + if err := devices.openTransaction(hash, deviceID); err != nil { + logrus.Debugf("devmapper: Error opening transaction hash = %s deviceID = %d", hash, deviceID) + devices.markDeviceIDFree(deviceID) + return err + } + + for { + if err := devicemapper.CreateSnapDevice(devices.getPoolDevName(), deviceID, baseInfo.Name(), baseInfo.DeviceID); err != nil { + if devicemapper.DeviceIDExists(err) { + // Device ID already exists. This should not + // happen. Now we have a mechanism to find + // a free device ID. So something is not right. + // Give a warning and continue. + logrus.Errorf("devmapper: Device ID %d exists in pool but it is supposed to be unused", deviceID) + deviceID, err = devices.getNextFreeDeviceID() + if err != nil { + return err + } + // Save new device id into transaction + devices.refreshTransaction(deviceID) + continue + } + logrus.Debugf("devmapper: Error creating snap device: %s", err) + devices.markDeviceIDFree(deviceID) + return err + } + break + } + + if _, err := devices.registerDevice(deviceID, hash, size, devices.OpenTransactionID); err != nil { + devicemapper.DeleteDevice(devices.getPoolDevName(), deviceID) + devices.markDeviceIDFree(deviceID) + logrus.Debugf("devmapper: Error registering device: %s", err) + return err + } + + if err := devices.closeTransaction(); err != nil { + devices.unregisterDevice(deviceID, hash) + devicemapper.DeleteDevice(devices.getPoolDevName(), deviceID) + devices.markDeviceIDFree(deviceID) + return err + } + return nil +} + +func (devices *DeviceSet) loadMetadata(hash string) *devInfo { + info := &devInfo{Hash: hash, devices: devices} + + jsonData, err := ioutil.ReadFile(devices.metadataFile(info)) + if err != nil { + logrus.Debugf("devmapper: Failed to read %s with err: %v", devices.metadataFile(info), err) + return nil + } + + if err := json.Unmarshal(jsonData, &info); err != nil { + logrus.Debugf("devmapper: Failed to unmarshal devInfo from %s with err: %v", devices.metadataFile(info), err) + return nil + } + + if info.DeviceID > maxDeviceID { + logrus.Errorf("devmapper: Ignoring Invalid DeviceId=%d", info.DeviceID) + return nil + } + + return info +} + +func getDeviceUUID(device string) (string, error) { + out, err := exec.Command("blkid", "-s", "UUID", "-o", "value", device).Output() + if err != nil { + return "", fmt.Errorf("devmapper: Failed to find uuid for device %s:%v", device, err) + } + + uuid := strings.TrimSuffix(string(out), "\n") + uuid = strings.TrimSpace(uuid) + logrus.Debugf("devmapper: UUID for device: %s is:%s", device, uuid) + return uuid, nil +} + +func (devices *DeviceSet) getBaseDeviceSize() uint64 { + info, _ := devices.lookupDevice("") + if info == nil { + return 0 + } + return info.Size +} + +func (devices *DeviceSet) getBaseDeviceFS() string { + return devices.BaseDeviceFilesystem +} + +func (devices *DeviceSet) verifyBaseDeviceUUIDFS(baseInfo *devInfo) error { + devices.Lock() + defer devices.Unlock() + + if err := devices.activateDeviceIfNeeded(baseInfo, false); err != nil { + return err + } + defer devices.deactivateDevice(baseInfo) + + uuid, err := getDeviceUUID(baseInfo.DevName()) + if err != nil { + return err + } + + if devices.BaseDeviceUUID != uuid { + return fmt.Errorf("devmapper: Current Base Device UUID:%s does not match with stored UUID:%s. Possibly using a different thin pool than last invocation", uuid, devices.BaseDeviceUUID) + } + + if devices.BaseDeviceFilesystem == "" { + fsType, err := ProbeFsType(baseInfo.DevName()) + if err != nil { + return err + } + if err := devices.saveBaseDeviceFilesystem(fsType); err != nil { + return err + } + } + + // If user specified a filesystem using dm.fs option and current + // file system of base image is not same, warn user that dm.fs + // will be ignored. + if devices.BaseDeviceFilesystem != devices.filesystem { + logrus.Warnf("devmapper: Base device already exists and has filesystem %s on it. User specified filesystem %s will be ignored.", devices.BaseDeviceFilesystem, devices.filesystem) + devices.filesystem = devices.BaseDeviceFilesystem + } + return nil +} + +func (devices *DeviceSet) saveBaseDeviceFilesystem(fs string) error { + devices.BaseDeviceFilesystem = fs + return devices.saveDeviceSetMetaData() +} + +func (devices *DeviceSet) saveBaseDeviceUUID(baseInfo *devInfo) error { + devices.Lock() + defer devices.Unlock() + + if err := devices.activateDeviceIfNeeded(baseInfo, false); err != nil { + return err + } + defer devices.deactivateDevice(baseInfo) + + uuid, err := getDeviceUUID(baseInfo.DevName()) + if err != nil { + return err + } + + devices.BaseDeviceUUID = uuid + return devices.saveDeviceSetMetaData() +} + +func (devices *DeviceSet) createBaseImage() error { + logrus.Debug("devmapper: Initializing base device-mapper thin volume") + + // Create initial device + info, err := devices.createRegisterDevice("") + if err != nil { + return err + } + + logrus.Debug("devmapper: Creating filesystem on base device-mapper thin volume") + + if err := devices.activateDeviceIfNeeded(info, false); err != nil { + return err + } + + if err := devices.createFilesystem(info); err != nil { + return err + } + + info.Initialized = true + if err := devices.saveMetadata(info); err != nil { + info.Initialized = false + return err + } + + if err := devices.saveBaseDeviceUUID(info); err != nil { + return fmt.Errorf("devmapper: Could not query and save base device UUID:%v", err) + } + + return nil +} + +// Returns if thin pool device exists or not. If device exists, also makes +// sure it is a thin pool device and not some other type of device. +func (devices *DeviceSet) thinPoolExists(thinPoolDevice string) (bool, error) { + logrus.Debugf("devmapper: Checking for existence of the pool %s", thinPoolDevice) + + info, err := devicemapper.GetInfo(thinPoolDevice) + if err != nil { + return false, fmt.Errorf("devmapper: GetInfo() on device %s failed: %v", thinPoolDevice, err) + } + + // Device does not exist. + if info.Exists == 0 { + return false, nil + } + + _, _, deviceType, _, err := devicemapper.GetStatus(thinPoolDevice) + if err != nil { + return false, fmt.Errorf("devmapper: GetStatus() on device %s failed: %v", thinPoolDevice, err) + } + + if deviceType != "thin-pool" { + return false, fmt.Errorf("devmapper: Device %s is not a thin pool", thinPoolDevice) + } + + return true, nil +} + +func (devices *DeviceSet) checkThinPool() error { + _, transactionID, dataUsed, _, _, _, err := devices.poolStatus() + if err != nil { + return err + } + if dataUsed != 0 { + return fmt.Errorf("devmapper: Unable to take ownership of thin-pool (%s) that already has used data blocks", + devices.thinPoolDevice) + } + if transactionID != 0 { + return fmt.Errorf("devmapper: Unable to take ownership of thin-pool (%s) with non-zero transaction ID", + devices.thinPoolDevice) + } + return nil +} + +// Base image is initialized properly. Either save UUID for first time (for +// upgrade case or verify UUID. +func (devices *DeviceSet) setupVerifyBaseImageUUIDFS(baseInfo *devInfo) error { + // If BaseDeviceUUID is nil (upgrade case), save it and return success. + if devices.BaseDeviceUUID == "" { + if err := devices.saveBaseDeviceUUID(baseInfo); err != nil { + return fmt.Errorf("devmapper: Could not query and save base device UUID:%v", err) + } + return nil + } + + if err := devices.verifyBaseDeviceUUIDFS(baseInfo); err != nil { + return fmt.Errorf("devmapper: Base Device UUID and Filesystem verification failed: %v", err) + } + + return nil +} + +func (devices *DeviceSet) checkGrowBaseDeviceFS(info *devInfo) error { + + if !userBaseSize { + return nil + } + + if devices.baseFsSize < devices.getBaseDeviceSize() { + return fmt.Errorf("devmapper: Base device size cannot be smaller than %s", units.HumanSize(float64(devices.getBaseDeviceSize()))) + } + + if devices.baseFsSize == devices.getBaseDeviceSize() { + return nil + } + + info.lock.Lock() + defer info.lock.Unlock() + + devices.Lock() + defer devices.Unlock() + + info.Size = devices.baseFsSize + + if err := devices.saveMetadata(info); err != nil { + // Try to remove unused device + delete(devices.Devices, info.Hash) + return err + } + + return devices.growFS(info) +} + +func (devices *DeviceSet) growFS(info *devInfo) error { + if err := devices.activateDeviceIfNeeded(info, false); err != nil { + return fmt.Errorf("Error activating devmapper device: %s", err) + } + + defer devices.deactivateDevice(info) + + fsMountPoint := "/run/docker/mnt" + if _, err := os.Stat(fsMountPoint); os.IsNotExist(err) { + if err := os.MkdirAll(fsMountPoint, 0700); err != nil { + return err + } + defer os.RemoveAll(fsMountPoint) + } + + options := "" + if devices.BaseDeviceFilesystem == "xfs" { + // XFS needs nouuid or it can't mount filesystems with the same fs + options = joinMountOptions(options, "nouuid") + } + options = joinMountOptions(options, devices.mountOptions) + + if err := mount.Mount(info.DevName(), fsMountPoint, devices.BaseDeviceFilesystem, options); err != nil { + return fmt.Errorf("Error mounting '%s' on '%s': %s", info.DevName(), fsMountPoint, err) + } + + defer syscall.Unmount(fsMountPoint, syscall.MNT_DETACH) + + switch devices.BaseDeviceFilesystem { + case "ext4": + if out, err := exec.Command("resize2fs", info.DevName()).CombinedOutput(); err != nil { + return fmt.Errorf("Failed to grow rootfs:%v:%s", err, string(out)) + } + case "xfs": + if out, err := exec.Command("xfs_growfs", info.DevName()).CombinedOutput(); err != nil { + return fmt.Errorf("Failed to grow rootfs:%v:%s", err, string(out)) + } + default: + return fmt.Errorf("Unsupported filesystem type %s", devices.BaseDeviceFilesystem) + } + return nil +} + +func (devices *DeviceSet) setupBaseImage() error { + oldInfo, _ := devices.lookupDeviceWithLock("") + + // base image already exists. If it is initialized properly, do UUID + // verification and return. Otherwise remove image and set it up + // fresh. + + if oldInfo != nil { + if oldInfo.Initialized && !oldInfo.Deleted { + if err := devices.setupVerifyBaseImageUUIDFS(oldInfo); err != nil { + return err + } + + if err := devices.checkGrowBaseDeviceFS(oldInfo); err != nil { + return err + } + + return nil + } + + logrus.Debug("devmapper: Removing uninitialized base image") + // If previous base device is in deferred delete state, + // that needs to be cleaned up first. So don't try + // deferred deletion. + if err := devices.DeleteDevice("", true); err != nil { + return err + } + } + + // If we are setting up base image for the first time, make sure + // thin pool is empty. + if devices.thinPoolDevice != "" && oldInfo == nil { + if err := devices.checkThinPool(); err != nil { + return err + } + } + + // Create new base image device + if err := devices.createBaseImage(); err != nil { + return err + } + + return nil +} + +func setCloseOnExec(name string) { + if fileInfos, _ := ioutil.ReadDir("/proc/self/fd"); fileInfos != nil { + for _, i := range fileInfos { + link, _ := os.Readlink(filepath.Join("/proc/self/fd", i.Name())) + if link == name { + fd, err := strconv.Atoi(i.Name()) + if err == nil { + syscall.CloseOnExec(fd) + } + } + } + } +} + +// DMLog implements logging using DevMapperLogger interface. +func (devices *DeviceSet) DMLog(level int, file string, line int, dmError int, message string) { + // By default libdm sends us all the messages including debug ones. + // We need to filter out messages here and figure out which one + // should be printed. + if level > logLevel { + return + } + + // FIXME(vbatts) push this back into ./pkg/devicemapper/ + if level <= devicemapper.LogLevelErr { + logrus.Errorf("libdevmapper(%d): %s:%d (%d) %s", level, file, line, dmError, message) + } else if level <= devicemapper.LogLevelInfo { + logrus.Infof("libdevmapper(%d): %s:%d (%d) %s", level, file, line, dmError, message) + } else { + // FIXME(vbatts) push this back into ./pkg/devicemapper/ + logrus.Debugf("libdevmapper(%d): %s:%d (%d) %s", level, file, line, dmError, message) + } +} + +func major(device uint64) uint64 { + return (device >> 8) & 0xfff +} + +func minor(device uint64) uint64 { + return (device & 0xff) | ((device >> 12) & 0xfff00) +} + +// ResizePool increases the size of the pool. +func (devices *DeviceSet) ResizePool(size int64) error { + dirname := devices.loopbackDir() + datafilename := path.Join(dirname, "data") + if len(devices.dataDevice) > 0 { + datafilename = devices.dataDevice + } + metadatafilename := path.Join(dirname, "metadata") + if len(devices.metadataDevice) > 0 { + metadatafilename = devices.metadataDevice + } + + datafile, err := os.OpenFile(datafilename, os.O_RDWR, 0) + if datafile == nil { + return err + } + defer datafile.Close() + + fi, err := datafile.Stat() + if fi == nil { + return err + } + + if fi.Size() > size { + return fmt.Errorf("devmapper: Can't shrink file") + } + + dataloopback := loopback.FindLoopDeviceFor(datafile) + if dataloopback == nil { + return fmt.Errorf("devmapper: Unable to find loopback mount for: %s", datafilename) + } + defer dataloopback.Close() + + metadatafile, err := os.OpenFile(metadatafilename, os.O_RDWR, 0) + if metadatafile == nil { + return err + } + defer metadatafile.Close() + + metadataloopback := loopback.FindLoopDeviceFor(metadatafile) + if metadataloopback == nil { + return fmt.Errorf("devmapper: Unable to find loopback mount for: %s", metadatafilename) + } + defer metadataloopback.Close() + + // Grow loopback file + if err := datafile.Truncate(size); err != nil { + return fmt.Errorf("devmapper: Unable to grow loopback file: %s", err) + } + + // Reload size for loopback device + if err := loopback.SetCapacity(dataloopback); err != nil { + return fmt.Errorf("Unable to update loopback capacity: %s", err) + } + + // Suspend the pool + if err := devicemapper.SuspendDevice(devices.getPoolName()); err != nil { + return fmt.Errorf("devmapper: Unable to suspend pool: %s", err) + } + + // Reload with the new block sizes + if err := devicemapper.ReloadPool(devices.getPoolName(), dataloopback, metadataloopback, devices.thinpBlockSize); err != nil { + return fmt.Errorf("devmapper: Unable to reload pool: %s", err) + } + + // Resume the pool + if err := devicemapper.ResumeDevice(devices.getPoolName()); err != nil { + return fmt.Errorf("devmapper: Unable to resume pool: %s", err) + } + + return nil +} + +func (devices *DeviceSet) loadTransactionMetaData() error { + jsonData, err := ioutil.ReadFile(devices.transactionMetaFile()) + if err != nil { + // There is no active transaction. This will be the case + // during upgrade. + if os.IsNotExist(err) { + devices.OpenTransactionID = devices.TransactionID + return nil + } + return err + } + + json.Unmarshal(jsonData, &devices.transaction) + return nil +} + +func (devices *DeviceSet) saveTransactionMetaData() error { + jsonData, err := json.Marshal(&devices.transaction) + if err != nil { + return fmt.Errorf("devmapper: Error encoding metadata to json: %s", err) + } + + return devices.writeMetaFile(jsonData, devices.transactionMetaFile()) +} + +func (devices *DeviceSet) removeTransactionMetaData() error { + if err := os.RemoveAll(devices.transactionMetaFile()); err != nil { + return err + } + return nil +} + +func (devices *DeviceSet) rollbackTransaction() error { + logrus.Debugf("devmapper: Rolling back open transaction: TransactionID=%d hash=%s device_id=%d", devices.OpenTransactionID, devices.DeviceIDHash, devices.DeviceID) + + // A device id might have already been deleted before transaction + // closed. In that case this call will fail. Just leave a message + // in case of failure. + if err := devicemapper.DeleteDevice(devices.getPoolDevName(), devices.DeviceID); err != nil { + logrus.Errorf("devmapper: Unable to delete device: %s", err) + } + + dinfo := &devInfo{Hash: devices.DeviceIDHash} + if err := devices.removeMetadata(dinfo); err != nil { + logrus.Errorf("devmapper: Unable to remove metadata: %s", err) + } else { + devices.markDeviceIDFree(devices.DeviceID) + } + + if err := devices.removeTransactionMetaData(); err != nil { + logrus.Errorf("devmapper: Unable to remove transaction meta file %s: %s", devices.transactionMetaFile(), err) + } + + return nil +} + +func (devices *DeviceSet) processPendingTransaction() error { + if err := devices.loadTransactionMetaData(); err != nil { + return err + } + + // If there was open transaction but pool transaction ID is same + // as open transaction ID, nothing to roll back. + if devices.TransactionID == devices.OpenTransactionID { + return nil + } + + // If open transaction ID is less than pool transaction ID, something + // is wrong. Bail out. + if devices.OpenTransactionID < devices.TransactionID { + logrus.Errorf("devmapper: Open Transaction id %d is less than pool transaction id %d", devices.OpenTransactionID, devices.TransactionID) + return nil + } + + // Pool transaction ID is not same as open transaction. There is + // a transaction which was not completed. + if err := devices.rollbackTransaction(); err != nil { + return fmt.Errorf("devmapper: Rolling back open transaction failed: %s", err) + } + + devices.OpenTransactionID = devices.TransactionID + return nil +} + +func (devices *DeviceSet) loadDeviceSetMetaData() error { + jsonData, err := ioutil.ReadFile(devices.deviceSetMetaFile()) + if err != nil { + // For backward compatibility return success if file does + // not exist. + if os.IsNotExist(err) { + return nil + } + return err + } + + return json.Unmarshal(jsonData, devices) +} + +func (devices *DeviceSet) saveDeviceSetMetaData() error { + jsonData, err := json.Marshal(devices) + if err != nil { + return fmt.Errorf("devmapper: Error encoding metadata to json: %s", err) + } + + return devices.writeMetaFile(jsonData, devices.deviceSetMetaFile()) +} + +func (devices *DeviceSet) openTransaction(hash string, DeviceID int) error { + devices.allocateTransactionID() + devices.DeviceIDHash = hash + devices.DeviceID = DeviceID + if err := devices.saveTransactionMetaData(); err != nil { + return fmt.Errorf("devmapper: Error saving transaction metadata: %s", err) + } + return nil +} + +func (devices *DeviceSet) refreshTransaction(DeviceID int) error { + devices.DeviceID = DeviceID + if err := devices.saveTransactionMetaData(); err != nil { + return fmt.Errorf("devmapper: Error saving transaction metadata: %s", err) + } + return nil +} + +func (devices *DeviceSet) closeTransaction() error { + if err := devices.updatePoolTransactionID(); err != nil { + logrus.Debug("devmapper: Failed to close Transaction") + return err + } + return nil +} + +func determineDriverCapabilities(version string) error { + /* + * Driver version 4.27.0 and greater support deferred activation + * feature. + */ + + logrus.Debugf("devicemapper: driver version is %s", version) + + versionSplit := strings.Split(version, ".") + major, err := strconv.Atoi(versionSplit[0]) + if err != nil { + return graphdriver.ErrNotSupported + } + + if major > 4 { + driverDeferredRemovalSupport = true + return nil + } + + if major < 4 { + return nil + } + + minor, err := strconv.Atoi(versionSplit[1]) + if err != nil { + return graphdriver.ErrNotSupported + } + + /* + * If major is 4 and minor is 27, then there is no need to + * check for patch level as it can not be less than 0. + */ + if minor >= 27 { + driverDeferredRemovalSupport = true + return nil + } + + return nil +} + +// Determine the major and minor number of loopback device +func getDeviceMajorMinor(file *os.File) (uint64, uint64, error) { + stat, err := file.Stat() + if err != nil { + return 0, 0, err + } + + dev := stat.Sys().(*syscall.Stat_t).Rdev + majorNum := major(dev) + minorNum := minor(dev) + + logrus.Debugf("devmapper: Major:Minor for device: %s is:%v:%v", file.Name(), majorNum, minorNum) + return majorNum, minorNum, nil +} + +// Given a file which is backing file of a loop back device, find the +// loopback device name and its major/minor number. +func getLoopFileDeviceMajMin(filename string) (string, uint64, uint64, error) { + file, err := os.Open(filename) + if err != nil { + logrus.Debugf("devmapper: Failed to open file %s", filename) + return "", 0, 0, err + } + + defer file.Close() + loopbackDevice := loopback.FindLoopDeviceFor(file) + if loopbackDevice == nil { + return "", 0, 0, fmt.Errorf("devmapper: Unable to find loopback mount for: %s", filename) + } + defer loopbackDevice.Close() + + Major, Minor, err := getDeviceMajorMinor(loopbackDevice) + if err != nil { + return "", 0, 0, err + } + return loopbackDevice.Name(), Major, Minor, nil +} + +// Get the major/minor numbers of thin pool data and metadata devices +func (devices *DeviceSet) getThinPoolDataMetaMajMin() (uint64, uint64, uint64, uint64, error) { + var params, poolDataMajMin, poolMetadataMajMin string + + _, _, _, params, err := devicemapper.GetTable(devices.getPoolName()) + if err != nil { + return 0, 0, 0, 0, err + } + + if _, err = fmt.Sscanf(params, "%s %s", &poolMetadataMajMin, &poolDataMajMin); err != nil { + return 0, 0, 0, 0, err + } + + logrus.Debugf("devmapper: poolDataMajMin=%s poolMetaMajMin=%s\n", poolDataMajMin, poolMetadataMajMin) + + poolDataMajMinorSplit := strings.Split(poolDataMajMin, ":") + poolDataMajor, err := strconv.ParseUint(poolDataMajMinorSplit[0], 10, 32) + if err != nil { + return 0, 0, 0, 0, err + } + + poolDataMinor, err := strconv.ParseUint(poolDataMajMinorSplit[1], 10, 32) + if err != nil { + return 0, 0, 0, 0, err + } + + poolMetadataMajMinorSplit := strings.Split(poolMetadataMajMin, ":") + poolMetadataMajor, err := strconv.ParseUint(poolMetadataMajMinorSplit[0], 10, 32) + if err != nil { + return 0, 0, 0, 0, err + } + + poolMetadataMinor, err := strconv.ParseUint(poolMetadataMajMinorSplit[1], 10, 32) + if err != nil { + return 0, 0, 0, 0, err + } + + return poolDataMajor, poolDataMinor, poolMetadataMajor, poolMetadataMinor, nil +} + +func (devices *DeviceSet) loadThinPoolLoopBackInfo() error { + poolDataMajor, poolDataMinor, poolMetadataMajor, poolMetadataMinor, err := devices.getThinPoolDataMetaMajMin() + if err != nil { + return err + } + + dirname := devices.loopbackDir() + + // data device has not been passed in. So there should be a data file + // which is being mounted as loop device. + if devices.dataDevice == "" { + datafilename := path.Join(dirname, "data") + dataLoopDevice, dataMajor, dataMinor, err := getLoopFileDeviceMajMin(datafilename) + if err != nil { + return err + } + + // Compare the two + if poolDataMajor == dataMajor && poolDataMinor == dataMinor { + devices.dataDevice = dataLoopDevice + devices.dataLoopFile = datafilename + } + + } + + // metadata device has not been passed in. So there should be a + // metadata file which is being mounted as loop device. + if devices.metadataDevice == "" { + metadatafilename := path.Join(dirname, "metadata") + metadataLoopDevice, metadataMajor, metadataMinor, err := getLoopFileDeviceMajMin(metadatafilename) + if err != nil { + return err + } + if poolMetadataMajor == metadataMajor && poolMetadataMinor == metadataMinor { + devices.metadataDevice = metadataLoopDevice + devices.metadataLoopFile = metadatafilename + } + } + + return nil +} + +func (devices *DeviceSet) enableDeferredRemovalDeletion() error { + + // If user asked for deferred removal then check both libdm library + // and kernel driver support deferred removal otherwise error out. + if enableDeferredRemoval { + if !driverDeferredRemovalSupport { + return fmt.Errorf("devmapper: Deferred removal can not be enabled as kernel does not support it") + } + if !devicemapper.LibraryDeferredRemovalSupport { + return fmt.Errorf("devmapper: Deferred removal can not be enabled as libdm does not support it") + } + logrus.Debug("devmapper: Deferred removal support enabled.") + devices.deferredRemove = true + } + + if enableDeferredDeletion { + if !devices.deferredRemove { + return fmt.Errorf("devmapper: Deferred deletion can not be enabled as deferred removal is not enabled. Enable deferred removal using --storage-opt dm.use_deferred_removal=true parameter") + } + logrus.Debug("devmapper: Deferred deletion support enabled.") + devices.deferredDelete = true + } + return nil +} + +func (devices *DeviceSet) initDevmapper(doInit bool) error { + // give ourselves to libdm as a log handler + devicemapper.LogInit(devices) + + version, err := devicemapper.GetDriverVersion() + if err != nil { + // Can't even get driver version, assume not supported + return graphdriver.ErrNotSupported + } + + if err := determineDriverCapabilities(version); err != nil { + return graphdriver.ErrNotSupported + } + + if err := devices.enableDeferredRemovalDeletion(); err != nil { + return err + } + + // https://github.com/docker/docker/issues/4036 + if supported := devicemapper.UdevSetSyncSupport(true); !supported { + if storageversion.IAmStatic == "true" { + logrus.Errorf("devmapper: Udev sync is not supported. This will lead to data loss and unexpected behavior. Install a dynamic binary to use devicemapper or select a different storage driver. For more information, see https://docs.docker.com/engine/reference/commandline/daemon/#daemon-storage-driver-option") + } else { + logrus.Errorf("devmapper: Udev sync is not supported. This will lead to data loss and unexpected behavior. Install a more recent version of libdevmapper or select a different storage driver. For more information, see https://docs.docker.com/engine/reference/commandline/daemon/#daemon-storage-driver-option") + } + + if !devices.overrideUdevSyncCheck { + return graphdriver.ErrNotSupported + } + } + + //create the root dir of the devmapper driver ownership to match this + //daemon's remapped root uid/gid so containers can start properly + uid, gid, err := idtools.GetRootUIDGID(devices.uidMaps, devices.gidMaps) + if err != nil { + return err + } + if err := idtools.MkdirAs(devices.root, 0700, uid, gid); err != nil && !os.IsExist(err) { + return err + } + if err := os.MkdirAll(devices.metadataDir(), 0700); err != nil && !os.IsExist(err) { + return err + } + + // Set the device prefix from the device id and inode of the docker root dir + + st, err := os.Stat(devices.root) + if err != nil { + return fmt.Errorf("devmapper: Error looking up dir %s: %s", devices.root, err) + } + sysSt := st.Sys().(*syscall.Stat_t) + // "reg-" stands for "regular file". + // In the future we might use "dev-" for "device file", etc. + // docker-maj,min[-inode] stands for: + // - Managed by docker + // - The target of this device is at major and minor + // - If is defined, use that file inside the device as a loopback image. Otherwise use the device itself. + devices.devicePrefix = fmt.Sprintf("docker-%d:%d-%d", major(sysSt.Dev), minor(sysSt.Dev), sysSt.Ino) + logrus.Debugf("devmapper: Generated prefix: %s", devices.devicePrefix) + + // Check for the existence of the thin-pool device + poolExists, err := devices.thinPoolExists(devices.getPoolName()) + if err != nil { + return err + } + + // It seems libdevmapper opens this without O_CLOEXEC, and go exec will not close files + // that are not Close-on-exec, + // so we add this badhack to make sure it closes itself + setCloseOnExec("/dev/mapper/control") + + // Make sure the sparse images exist in /devicemapper/data and + // /devicemapper/metadata + + createdLoopback := false + + // If the pool doesn't exist, create it + if !poolExists && devices.thinPoolDevice == "" { + logrus.Debug("devmapper: Pool doesn't exist. Creating it.") + + var ( + dataFile *os.File + metadataFile *os.File + ) + + if devices.dataDevice == "" { + // Make sure the sparse images exist in /devicemapper/data + + hasData := devices.hasImage("data") + + if !doInit && !hasData { + return errors.New("Loopback data file not found") + } + + if !hasData { + createdLoopback = true + } + + data, err := devices.ensureImage("data", devices.dataLoopbackSize) + if err != nil { + logrus.Debugf("devmapper: Error device ensureImage (data): %s", err) + return err + } + + dataFile, err = loopback.AttachLoopDevice(data) + if err != nil { + return err + } + devices.dataLoopFile = data + devices.dataDevice = dataFile.Name() + } else { + dataFile, err = os.OpenFile(devices.dataDevice, os.O_RDWR, 0600) + if err != nil { + return err + } + } + defer dataFile.Close() + + if devices.metadataDevice == "" { + // Make sure the sparse images exist in /devicemapper/metadata + + hasMetadata := devices.hasImage("metadata") + + if !doInit && !hasMetadata { + return errors.New("Loopback metadata file not found") + } + + if !hasMetadata { + createdLoopback = true + } + + metadata, err := devices.ensureImage("metadata", devices.metaDataLoopbackSize) + if err != nil { + logrus.Debugf("devmapper: Error device ensureImage (metadata): %s", err) + return err + } + + metadataFile, err = loopback.AttachLoopDevice(metadata) + if err != nil { + return err + } + devices.metadataLoopFile = metadata + devices.metadataDevice = metadataFile.Name() + } else { + metadataFile, err = os.OpenFile(devices.metadataDevice, os.O_RDWR, 0600) + if err != nil { + return err + } + } + defer metadataFile.Close() + + if err := devicemapper.CreatePool(devices.getPoolName(), dataFile, metadataFile, devices.thinpBlockSize); err != nil { + return err + } + } + + // Pool already exists and caller did not pass us a pool. That means + // we probably created pool earlier and could not remove it as some + // containers were still using it. Detect some of the properties of + // pool, like is it using loop devices. + if poolExists && devices.thinPoolDevice == "" { + if err := devices.loadThinPoolLoopBackInfo(); err != nil { + logrus.Debugf("devmapper: Failed to load thin pool loopback device information:%v", err) + return err + } + } + + // If we didn't just create the data or metadata image, we need to + // load the transaction id and migrate old metadata + if !createdLoopback { + if err := devices.initMetaData(); err != nil { + return err + } + } + + if devices.thinPoolDevice == "" { + if devices.metadataLoopFile != "" || devices.dataLoopFile != "" { + logrus.Warn("devmapper: Usage of loopback devices is strongly discouraged for production use. Please use `--storage-opt dm.thinpooldev` or use `man docker` to refer to dm.thinpooldev section.") + } + } + + // Right now this loads only NextDeviceID. If there is more metadata + // down the line, we might have to move it earlier. + if err := devices.loadDeviceSetMetaData(); err != nil { + return err + } + + // Setup the base image + if doInit { + if err := devices.setupBaseImage(); err != nil { + logrus.Debugf("devmapper: Error device setupBaseImage: %s", err) + return err + } + } + + return nil +} + +// AddDevice adds a device and registers in the hash. +func (devices *DeviceSet) AddDevice(hash, baseHash string, storageOpt map[string]string) error { + logrus.Debugf("devmapper: AddDevice(hash=%s basehash=%s)", hash, baseHash) + defer logrus.Debugf("devmapper: AddDevice(hash=%s basehash=%s) END", hash, baseHash) + + // If a deleted device exists, return error. + baseInfo, err := devices.lookupDeviceWithLock(baseHash) + if err != nil { + return err + } + + if baseInfo.Deleted { + return fmt.Errorf("devmapper: Base device %v has been marked for deferred deletion", baseInfo.Hash) + } + + baseInfo.lock.Lock() + defer baseInfo.lock.Unlock() + + devices.Lock() + defer devices.Unlock() + + // Also include deleted devices in case hash of new device is + // same as one of the deleted devices. + if info, _ := devices.lookupDevice(hash); info != nil { + return fmt.Errorf("devmapper: device %s already exists. Deleted=%v", hash, info.Deleted) + } + + size, err := devices.parseStorageOpt(storageOpt) + if err != nil { + return err + } + + if size == 0 { + size = baseInfo.Size + } + + if size < baseInfo.Size { + return fmt.Errorf("devmapper: Container size cannot be smaller than %s", units.HumanSize(float64(baseInfo.Size))) + } + + if err := devices.createRegisterSnapDevice(hash, baseInfo, size); err != nil { + return err + } + + // Grow the container rootfs. + if size > baseInfo.Size { + info, err := devices.lookupDevice(hash) + if err != nil { + return err + } + + if err := devices.growFS(info); err != nil { + return err + } + } + + return nil +} + +func (devices *DeviceSet) parseStorageOpt(storageOpt map[string]string) (uint64, error) { + + // Read size to change the block device size per container. + for key, val := range storageOpt { + key := strings.ToLower(key) + switch key { + case "size": + size, err := units.RAMInBytes(val) + if err != nil { + return 0, err + } + return uint64(size), nil + default: + return 0, fmt.Errorf("Unknown option %s", key) + } + } + + return 0, nil +} + +func (devices *DeviceSet) markForDeferredDeletion(info *devInfo) error { + // If device is already in deleted state, there is nothing to be done. + if info.Deleted { + return nil + } + + logrus.Debugf("devmapper: Marking device %s for deferred deletion.", info.Hash) + + info.Deleted = true + + // save device metadata to reflect deleted state. + if err := devices.saveMetadata(info); err != nil { + info.Deleted = false + return err + } + + devices.nrDeletedDevices++ + return nil +} + +// Should be called with devices.Lock() held. +func (devices *DeviceSet) deleteTransaction(info *devInfo, syncDelete bool) error { + if err := devices.openTransaction(info.Hash, info.DeviceID); err != nil { + logrus.Debugf("devmapper: Error opening transaction hash = %s deviceId = %d", "", info.DeviceID) + return err + } + + defer devices.closeTransaction() + + err := devicemapper.DeleteDevice(devices.getPoolDevName(), info.DeviceID) + if err != nil { + // If syncDelete is true, we want to return error. If deferred + // deletion is not enabled, we return an error. If error is + // something other then EBUSY, return an error. + if syncDelete || !devices.deferredDelete || err != devicemapper.ErrBusy { + logrus.Debugf("devmapper: Error deleting device: %s", err) + return err + } + } + + if err == nil { + if err := devices.unregisterDevice(info.DeviceID, info.Hash); err != nil { + return err + } + // If device was already in deferred delete state that means + // deletion was being tried again later. Reduce the deleted + // device count. + if info.Deleted { + devices.nrDeletedDevices-- + } + devices.markDeviceIDFree(info.DeviceID) + } else { + if err := devices.markForDeferredDeletion(info); err != nil { + return err + } + } + + return nil +} + +// Issue discard only if device open count is zero. +func (devices *DeviceSet) issueDiscard(info *devInfo) error { + logrus.Debugf("devmapper: issueDiscard(device: %s). START", info.Hash) + defer logrus.Debugf("devmapper: issueDiscard(device: %s). END", info.Hash) + // This is a workaround for the kernel not discarding block so + // on the thin pool when we remove a thinp device, so we do it + // manually. + // Even if device is deferred deleted, activate it and issue + // discards. + if err := devices.activateDeviceIfNeeded(info, true); err != nil { + return err + } + + devinfo, err := devicemapper.GetInfo(info.Name()) + if err != nil { + return err + } + + if devinfo.OpenCount != 0 { + logrus.Debugf("devmapper: Device: %s is in use. OpenCount=%d. Not issuing discards.", info.Hash, devinfo.OpenCount) + return nil + } + + if err := devicemapper.BlockDeviceDiscard(info.DevName()); err != nil { + logrus.Debugf("devmapper: Error discarding block on device: %s (ignoring)", err) + } + return nil +} + +// Should be called with devices.Lock() held. +func (devices *DeviceSet) deleteDevice(info *devInfo, syncDelete bool) error { + if devices.doBlkDiscard { + devices.issueDiscard(info) + } + + // Try to deactivate device in case it is active. + if err := devices.deactivateDevice(info); err != nil { + logrus.Debugf("devmapper: Error deactivating device: %s", err) + return err + } + + if err := devices.deleteTransaction(info, syncDelete); err != nil { + return err + } + + return nil +} + +// DeleteDevice will return success if device has been marked for deferred +// removal. If one wants to override that and want DeleteDevice() to fail if +// device was busy and could not be deleted, set syncDelete=true. +func (devices *DeviceSet) DeleteDevice(hash string, syncDelete bool) error { + logrus.Debugf("devmapper: DeleteDevice(hash=%v syncDelete=%v) START", hash, syncDelete) + defer logrus.Debugf("devmapper: DeleteDevice(hash=%v syncDelete=%v) END", hash, syncDelete) + info, err := devices.lookupDeviceWithLock(hash) + if err != nil { + return err + } + + info.lock.Lock() + defer info.lock.Unlock() + + devices.Lock() + defer devices.Unlock() + + return devices.deleteDevice(info, syncDelete) +} + +func (devices *DeviceSet) deactivatePool() error { + logrus.Debug("devmapper: deactivatePool()") + defer logrus.Debug("devmapper: deactivatePool END") + devname := devices.getPoolDevName() + + devinfo, err := devicemapper.GetInfo(devname) + if err != nil { + return err + } + + if devinfo.Exists == 0 { + return nil + } + if err := devicemapper.RemoveDevice(devname); err != nil { + return err + } + + if d, err := devicemapper.GetDeps(devname); err == nil { + logrus.Warnf("devmapper: device %s still has %d active dependents", devname, d.Count) + } + + return nil +} + +func (devices *DeviceSet) deactivateDevice(info *devInfo) error { + logrus.Debugf("devmapper: deactivateDevice(%s)", info.Hash) + defer logrus.Debugf("devmapper: deactivateDevice END(%s)", info.Hash) + + devinfo, err := devicemapper.GetInfo(info.Name()) + if err != nil { + return err + } + + if devinfo.Exists == 0 { + return nil + } + + if devices.deferredRemove { + if err := devicemapper.RemoveDeviceDeferred(info.Name()); err != nil { + return err + } + } else { + if err := devices.removeDevice(info.Name()); err != nil { + return err + } + } + return nil +} + +// Issues the underlying dm remove operation. +func (devices *DeviceSet) removeDevice(devname string) error { + var err error + + logrus.Debugf("devmapper: removeDevice START(%s)", devname) + defer logrus.Debugf("devmapper: removeDevice END(%s)", devname) + + for i := 0; i < 200; i++ { + err = devicemapper.RemoveDevice(devname) + if err == nil { + break + } + if err != devicemapper.ErrBusy { + return err + } + + // If we see EBUSY it may be a transient error, + // sleep a bit a retry a few times. + devices.Unlock() + time.Sleep(100 * time.Millisecond) + devices.Lock() + } + + return err +} + +func (devices *DeviceSet) cancelDeferredRemoval(info *devInfo) error { + if !devices.deferredRemove { + return nil + } + + logrus.Debugf("devmapper: cancelDeferredRemoval START(%s)", info.Name()) + defer logrus.Debugf("devmapper: cancelDeferredRemoval END(%s)", info.Name()) + + devinfo, err := devicemapper.GetInfoWithDeferred(info.Name()) + + if devinfo != nil && devinfo.DeferredRemove == 0 { + return nil + } + + // Cancel deferred remove + for i := 0; i < 100; i++ { + err = devicemapper.CancelDeferredRemove(info.Name()) + if err == nil { + break + } + + if err == devicemapper.ErrEnxio { + // Device is probably already gone. Return success. + return nil + } + + if err != devicemapper.ErrBusy { + return err + } + + // If we see EBUSY it may be a transient error, + // sleep a bit a retry a few times. + devices.Unlock() + time.Sleep(100 * time.Millisecond) + devices.Lock() + } + return err +} + +// Shutdown shuts down the device by unmounting the root. +func (devices *DeviceSet) Shutdown(home string) error { + logrus.Debugf("devmapper: [deviceset %s] Shutdown()", devices.devicePrefix) + logrus.Debugf("devmapper: Shutting down DeviceSet: %s", devices.root) + defer logrus.Debugf("devmapper: [deviceset %s] Shutdown() END", devices.devicePrefix) + + // Stop deletion worker. This should start delivering new events to + // ticker channel. That means no new instance of cleanupDeletedDevice() + // will run after this call. If one instance is already running at + // the time of the call, it must be holding devices.Lock() and + // we will block on this lock till cleanup function exits. + devices.deletionWorkerTicker.Stop() + + devices.Lock() + // Save DeviceSet Metadata first. Docker kills all threads if they + // don't finish in certain time. It is possible that Shutdown() + // routine does not finish in time as we loop trying to deactivate + // some devices while these are busy. In that case shutdown() routine + // will be killed and we will not get a chance to save deviceset + // metadata. Hence save this early before trying to deactivate devices. + devices.saveDeviceSetMetaData() + + // ignore the error since it's just a best effort to not try to unmount something that's mounted + mounts, _ := mount.GetMounts() + mounted := make(map[string]bool, len(mounts)) + for _, mnt := range mounts { + mounted[mnt.Mountpoint] = true + } + + if err := filepath.Walk(path.Join(home, "mnt"), func(p string, info os.FileInfo, err error) error { + if err != nil { + return err + } + if !info.IsDir() { + return nil + } + + if mounted[p] { + // We use MNT_DETACH here in case it is still busy in some running + // container. This means it'll go away from the global scope directly, + // and the device will be released when that container dies. + if err := syscall.Unmount(p, syscall.MNT_DETACH); err != nil { + logrus.Debugf("devmapper: Shutdown unmounting %s, error: %s", p, err) + } + } + + if devInfo, err := devices.lookupDevice(path.Base(p)); err != nil { + logrus.Debugf("devmapper: Shutdown lookup device %s, error: %s", path.Base(p), err) + } else { + if err := devices.deactivateDevice(devInfo); err != nil { + logrus.Debugf("devmapper: Shutdown deactivate %s , error: %s", devInfo.Hash, err) + } + } + + return nil + }); err != nil && !os.IsNotExist(err) { + devices.Unlock() + return err + } + + devices.Unlock() + + info, _ := devices.lookupDeviceWithLock("") + if info != nil { + info.lock.Lock() + devices.Lock() + if err := devices.deactivateDevice(info); err != nil { + logrus.Debugf("devmapper: Shutdown deactivate base , error: %s", err) + } + devices.Unlock() + info.lock.Unlock() + } + + devices.Lock() + if devices.thinPoolDevice == "" { + if err := devices.deactivatePool(); err != nil { + logrus.Debugf("devmapper: Shutdown deactivate pool , error: %s", err) + } + } + devices.Unlock() + + return nil +} + +// MountDevice mounts the device if not already mounted. +func (devices *DeviceSet) MountDevice(hash, path, mountLabel string) error { + info, err := devices.lookupDeviceWithLock(hash) + if err != nil { + return err + } + + if info.Deleted { + return fmt.Errorf("devmapper: Can't mount device %v as it has been marked for deferred deletion", info.Hash) + } + + info.lock.Lock() + defer info.lock.Unlock() + + devices.Lock() + defer devices.Unlock() + + if err := devices.activateDeviceIfNeeded(info, false); err != nil { + return fmt.Errorf("devmapper: Error activating devmapper device for '%s': %s", hash, err) + } + + fstype, err := ProbeFsType(info.DevName()) + if err != nil { + return err + } + + options := "" + + if fstype == "xfs" { + // XFS needs nouuid or it can't mount filesystems with the same fs + options = joinMountOptions(options, "nouuid") + } + + options = joinMountOptions(options, devices.mountOptions) + options = joinMountOptions(options, label.FormatMountLabel("", mountLabel)) + + if err := mount.Mount(info.DevName(), path, fstype, options); err != nil { + return fmt.Errorf("devmapper: Error mounting '%s' on '%s': %s", info.DevName(), path, err) + } + + return nil +} + +// UnmountDevice unmounts the device and removes it from hash. +func (devices *DeviceSet) UnmountDevice(hash, mountPath string) error { + logrus.Debugf("devmapper: UnmountDevice(hash=%s)", hash) + defer logrus.Debugf("devmapper: UnmountDevice(hash=%s) END", hash) + + info, err := devices.lookupDeviceWithLock(hash) + if err != nil { + return err + } + + info.lock.Lock() + defer info.lock.Unlock() + + devices.Lock() + defer devices.Unlock() + + logrus.Debugf("devmapper: Unmount(%s)", mountPath) + if err := syscall.Unmount(mountPath, syscall.MNT_DETACH); err != nil { + return err + } + logrus.Debug("devmapper: Unmount done") + + if err := devices.deactivateDevice(info); err != nil { + return err + } + + return nil +} + +// HasDevice returns true if the device metadata exists. +func (devices *DeviceSet) HasDevice(hash string) bool { + info, _ := devices.lookupDeviceWithLock(hash) + return info != nil +} + +// List returns a list of device ids. +func (devices *DeviceSet) List() []string { + devices.Lock() + defer devices.Unlock() + + ids := make([]string, len(devices.Devices)) + i := 0 + for k := range devices.Devices { + ids[i] = k + i++ + } + return ids +} + +func (devices *DeviceSet) deviceStatus(devName string) (sizeInSectors, mappedSectors, highestMappedSector uint64, err error) { + var params string + _, sizeInSectors, _, params, err = devicemapper.GetStatus(devName) + if err != nil { + return + } + if _, err = fmt.Sscanf(params, "%d %d", &mappedSectors, &highestMappedSector); err == nil { + return + } + return +} + +// GetDeviceStatus provides size, mapped sectors +func (devices *DeviceSet) GetDeviceStatus(hash string) (*DevStatus, error) { + info, err := devices.lookupDeviceWithLock(hash) + if err != nil { + return nil, err + } + + info.lock.Lock() + defer info.lock.Unlock() + + devices.Lock() + defer devices.Unlock() + + status := &DevStatus{ + DeviceID: info.DeviceID, + Size: info.Size, + TransactionID: info.TransactionID, + } + + if err := devices.activateDeviceIfNeeded(info, false); err != nil { + return nil, fmt.Errorf("devmapper: Error activating devmapper device for '%s': %s", hash, err) + } + + sizeInSectors, mappedSectors, highestMappedSector, err := devices.deviceStatus(info.DevName()) + + if err != nil { + return nil, err + } + + status.SizeInSectors = sizeInSectors + status.MappedSectors = mappedSectors + status.HighestMappedSector = highestMappedSector + + return status, nil +} + +func (devices *DeviceSet) poolStatus() (totalSizeInSectors, transactionID, dataUsed, dataTotal, metadataUsed, metadataTotal uint64, err error) { + var params string + if _, totalSizeInSectors, _, params, err = devicemapper.GetStatus(devices.getPoolName()); err == nil { + _, err = fmt.Sscanf(params, "%d %d/%d %d/%d", &transactionID, &metadataUsed, &metadataTotal, &dataUsed, &dataTotal) + } + return +} + +// DataDevicePath returns the path to the data storage for this deviceset, +// regardless of loopback or block device +func (devices *DeviceSet) DataDevicePath() string { + return devices.dataDevice +} + +// MetadataDevicePath returns the path to the metadata storage for this deviceset, +// regardless of loopback or block device +func (devices *DeviceSet) MetadataDevicePath() string { + return devices.metadataDevice +} + +func (devices *DeviceSet) getUnderlyingAvailableSpace(loopFile string) (uint64, error) { + buf := new(syscall.Statfs_t) + if err := syscall.Statfs(loopFile, buf); err != nil { + logrus.Warnf("devmapper: Couldn't stat loopfile filesystem %v: %v", loopFile, err) + return 0, err + } + return buf.Bfree * uint64(buf.Bsize), nil +} + +func (devices *DeviceSet) isRealFile(loopFile string) (bool, error) { + if loopFile != "" { + fi, err := os.Stat(loopFile) + if err != nil { + logrus.Warnf("devmapper: Couldn't stat loopfile %v: %v", loopFile, err) + return false, err + } + return fi.Mode().IsRegular(), nil + } + return false, nil +} + +// Status returns the current status of this deviceset +func (devices *DeviceSet) Status() *Status { + devices.Lock() + defer devices.Unlock() + + status := &Status{} + + status.PoolName = devices.getPoolName() + status.DataFile = devices.DataDevicePath() + status.DataLoopback = devices.dataLoopFile + status.MetadataFile = devices.MetadataDevicePath() + status.MetadataLoopback = devices.metadataLoopFile + status.UdevSyncSupported = devicemapper.UdevSyncSupported() + status.DeferredRemoveEnabled = devices.deferredRemove + status.DeferredDeleteEnabled = devices.deferredDelete + status.DeferredDeletedDeviceCount = devices.nrDeletedDevices + status.BaseDeviceSize = devices.getBaseDeviceSize() + status.BaseDeviceFS = devices.getBaseDeviceFS() + + totalSizeInSectors, _, dataUsed, dataTotal, metadataUsed, metadataTotal, err := devices.poolStatus() + if err == nil { + // Convert from blocks to bytes + blockSizeInSectors := totalSizeInSectors / dataTotal + + status.Data.Used = dataUsed * blockSizeInSectors * 512 + status.Data.Total = dataTotal * blockSizeInSectors * 512 + status.Data.Available = status.Data.Total - status.Data.Used + + // metadata blocks are always 4k + status.Metadata.Used = metadataUsed * 4096 + status.Metadata.Total = metadataTotal * 4096 + status.Metadata.Available = status.Metadata.Total - status.Metadata.Used + + status.SectorSize = blockSizeInSectors * 512 + + if check, _ := devices.isRealFile(devices.dataLoopFile); check { + actualSpace, err := devices.getUnderlyingAvailableSpace(devices.dataLoopFile) + if err == nil && actualSpace < status.Data.Available { + status.Data.Available = actualSpace + } + } + + if check, _ := devices.isRealFile(devices.metadataLoopFile); check { + actualSpace, err := devices.getUnderlyingAvailableSpace(devices.metadataLoopFile) + if err == nil && actualSpace < status.Metadata.Available { + status.Metadata.Available = actualSpace + } + } + + minFreeData := (dataTotal * uint64(devices.minFreeSpacePercent)) / 100 + status.MinFreeSpace = minFreeData * blockSizeInSectors * 512 + } + + return status +} + +// Status returns the current status of this deviceset +func (devices *DeviceSet) exportDeviceMetadata(hash string) (*deviceMetadata, error) { + info, err := devices.lookupDeviceWithLock(hash) + if err != nil { + return nil, err + } + + info.lock.Lock() + defer info.lock.Unlock() + + metadata := &deviceMetadata{info.DeviceID, info.Size, info.Name()} + return metadata, nil +} + +// NewDeviceSet creates the device set based on the options provided. +func NewDeviceSet(root string, doInit bool, options []string, uidMaps, gidMaps []idtools.IDMap) (*DeviceSet, error) { + devicemapper.SetDevDir("/dev") + + devices := &DeviceSet{ + root: root, + metaData: metaData{Devices: make(map[string]*devInfo)}, + dataLoopbackSize: defaultDataLoopbackSize, + metaDataLoopbackSize: defaultMetaDataLoopbackSize, + baseFsSize: defaultBaseFsSize, + overrideUdevSyncCheck: defaultUdevSyncOverride, + doBlkDiscard: true, + thinpBlockSize: defaultThinpBlockSize, + deviceIDMap: make([]byte, deviceIDMapSz), + deletionWorkerTicker: time.NewTicker(time.Second * 30), + uidMaps: uidMaps, + gidMaps: gidMaps, + minFreeSpacePercent: defaultMinFreeSpacePercent, + } + + // Pick up initialization settings, if any were saved before + defaultsFile := path.Join(root, "defaults") + defaultsBytes, err := ioutil.ReadFile(defaultsFile) + defaults := []string{} + settings := map[string]string{} + if err == nil && len(defaultsBytes) > 0 { + defaults = strings.Split(string(defaultsBytes), "\n") + } + + foundBlkDiscard := false + nthOption := 0 + for _, option := range append(defaults, options...) { + nthOption = nthOption + 1 + if len(option) == 0 { + continue + } + key, val, err := parsers.ParseKeyValueOpt(option) + if err != nil { + return nil, err + } + key = strings.ToLower(key) + switch key { + case "dm.basesize": + size, err := units.RAMInBytes(val) + if err != nil { + return nil, err + } + userBaseSize = true + devices.baseFsSize = uint64(size) + case "dm.loopdatasize": + size, err := units.RAMInBytes(val) + if err != nil { + return nil, err + } + devices.dataLoopbackSize = size + case "dm.loopmetadatasize": + size, err := units.RAMInBytes(val) + if err != nil { + return nil, err + } + devices.metaDataLoopbackSize = size + case "dm.fs": + if val != "ext4" && val != "xfs" { + return nil, fmt.Errorf("devmapper: Unsupported filesystem %s\n", val) + } + devices.filesystem = val + case "dm.mkfsarg": + devices.mkfsArgs = append(devices.mkfsArgs, val) + case "dm.mountopt": + devices.mountOptions = joinMountOptions(devices.mountOptions, val) + case "dm.metadatadev": + devices.metadataDevice = val + case "dm.datadev": + devices.dataDevice = val + case "dm.thinpooldev": + devices.thinPoolDevice = strings.TrimPrefix(val, "/dev/mapper/") + case "dm.blkdiscard": + foundBlkDiscard = true + devices.doBlkDiscard, err = strconv.ParseBool(val) + if err != nil { + return nil, err + } + case "dm.blocksize": + size, err := units.RAMInBytes(val) + if err != nil { + return nil, err + } + // convert to 512b sectors + devices.thinpBlockSize = uint32(size) >> 9 + case "dm.override_udev_sync_check": + devices.overrideUdevSyncCheck, err = strconv.ParseBool(val) + if err != nil { + return nil, err + } + + case "dm.use_deferred_removal": + enableDeferredRemoval, err = strconv.ParseBool(val) + if err != nil { + return nil, err + } + + case "dm.use_deferred_deletion": + enableDeferredDeletion, err = strconv.ParseBool(val) + if err != nil { + return nil, err + } + + case "dm.min_free_space": + if !strings.HasSuffix(val, "%") { + return nil, fmt.Errorf("devmapper: Option dm.min_free_space requires %% suffix") + } + + valstring := strings.TrimSuffix(val, "%") + minFreeSpacePercent, err := strconv.ParseUint(valstring, 10, 32) + if err != nil { + return nil, err + } + + if minFreeSpacePercent >= 100 { + return nil, fmt.Errorf("devmapper: Invalid value %v for option dm.min_free_space", val) + } + + devices.minFreeSpacePercent = uint32(minFreeSpacePercent) + default: + if nthOption > len(defaults) { + return nil, fmt.Errorf("devmapper: Unknown option %s\n", key) + } + logrus.Errorf("devmapper: Unknown option %s, ignoring\n", key) + } + settings[key] = val + } + + // By default, don't do blk discard hack on raw devices, its rarely useful and is expensive + if !foundBlkDiscard && (devices.dataDevice != "" || devices.thinPoolDevice != "") { + devices.doBlkDiscard = false + } + + if err := devices.initDevmapper(doInit); err != nil { + return nil, err + } + + // Save these settings along with the other metadata + defaults = []string{} + for key, val := range settings { + defaults = append(defaults, key+"="+val) + } + defaultsBytes = []byte(strings.Join(defaults, "\n") + "\n") + if err := ioutils.AtomicWriteFile(defaultsFile, defaultsBytes, 0600); err != nil { + return nil, err + } + + return devices, nil +} diff --git a/vendor/github.com/containers/storage/drivers/devmapper/devmapper_doc.go b/vendor/github.com/containers/storage/drivers/devmapper/devmapper_doc.go new file mode 100644 index 00000000..9ab3e4f8 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/devmapper/devmapper_doc.go @@ -0,0 +1,106 @@ +package devmapper + +// Definition of struct dm_task and sub structures (from lvm2) +// +// struct dm_ioctl { +// /* +// * The version number is made up of three parts: +// * major - no backward or forward compatibility, +// * minor - only backwards compatible, +// * patch - both backwards and forwards compatible. +// * +// * All clients of the ioctl interface should fill in the +// * version number of the interface that they were +// * compiled with. +// * +// * All recognized ioctl commands (ie. those that don't +// * return -ENOTTY) fill out this field, even if the +// * command failed. +// */ +// uint32_t version[3]; /* in/out */ +// uint32_t data_size; /* total size of data passed in +// * including this struct */ + +// uint32_t data_start; /* offset to start of data +// * relative to start of this struct */ + +// uint32_t target_count; /* in/out */ +// int32_t open_count; /* out */ +// uint32_t flags; /* in/out */ + +// /* +// * event_nr holds either the event number (input and output) or the +// * udev cookie value (input only). +// * The DM_DEV_WAIT ioctl takes an event number as input. +// * The DM_SUSPEND, DM_DEV_REMOVE and DM_DEV_RENAME ioctls +// * use the field as a cookie to return in the DM_COOKIE +// * variable with the uevents they issue. +// * For output, the ioctls return the event number, not the cookie. +// */ +// uint32_t event_nr; /* in/out */ +// uint32_t padding; + +// uint64_t dev; /* in/out */ + +// char name[DM_NAME_LEN]; /* device name */ +// char uuid[DM_UUID_LEN]; /* unique identifier for +// * the block device */ +// char data[7]; /* padding or data */ +// }; + +// struct target { +// uint64_t start; +// uint64_t length; +// char *type; +// char *params; + +// struct target *next; +// }; + +// typedef enum { +// DM_ADD_NODE_ON_RESUME, /* add /dev/mapper node with dmsetup resume */ +// DM_ADD_NODE_ON_CREATE /* add /dev/mapper node with dmsetup create */ +// } dm_add_node_t; + +// struct dm_task { +// int type; +// char *dev_name; +// char *mangled_dev_name; + +// struct target *head, *tail; + +// int read_only; +// uint32_t event_nr; +// int major; +// int minor; +// int allow_default_major_fallback; +// uid_t uid; +// gid_t gid; +// mode_t mode; +// uint32_t read_ahead; +// uint32_t read_ahead_flags; +// union { +// struct dm_ioctl *v4; +// } dmi; +// char *newname; +// char *message; +// char *geometry; +// uint64_t sector; +// int no_flush; +// int no_open_count; +// int skip_lockfs; +// int query_inactive_table; +// int suppress_identical_reload; +// dm_add_node_t add_node; +// uint64_t existing_table_size; +// int cookie_set; +// int new_uuid; +// int secure_data; +// int retry_remove; +// int enable_checks; +// int expected_errno; + +// char *uuid; +// char *mangled_uuid; +// }; +// diff --git a/vendor/github.com/containers/storage/drivers/devmapper/driver.go b/vendor/github.com/containers/storage/drivers/devmapper/driver.go new file mode 100644 index 00000000..1fc3a7b3 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/devmapper/driver.go @@ -0,0 +1,226 @@ +// +build linux + +package devmapper + +import ( + "fmt" + "io/ioutil" + "os" + "path" + "strconv" + + "github.com/Sirupsen/logrus" + + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/devicemapper" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/mount" + "github.com/docker/go-units" +) + +func init() { + graphdriver.Register("devicemapper", Init) +} + +// Driver contains the device set mounted and the home directory +type Driver struct { + *DeviceSet + home string + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap + ctr *graphdriver.RefCounter +} + +// Init creates a driver with the given home and the set of options. +func Init(home string, options []string, uidMaps, gidMaps []idtools.IDMap) (graphdriver.Driver, error) { + deviceSet, err := NewDeviceSet(home, true, options, uidMaps, gidMaps) + if err != nil { + return nil, err + } + + if err := mount.MakePrivate(home); err != nil { + return nil, err + } + + d := &Driver{ + DeviceSet: deviceSet, + home: home, + uidMaps: uidMaps, + gidMaps: gidMaps, + ctr: graphdriver.NewRefCounter(graphdriver.NewDefaultChecker()), + } + + return graphdriver.NewNaiveDiffDriver(d, uidMaps, gidMaps), nil +} + +func (d *Driver) String() string { + return "devicemapper" +} + +// Status returns the status about the driver in a printable format. +// Information returned contains Pool Name, Data File, Metadata file, disk usage by +// the data and metadata, etc. +func (d *Driver) Status() [][2]string { + s := d.DeviceSet.Status() + + status := [][2]string{ + {"Pool Name", s.PoolName}, + {"Pool Blocksize", fmt.Sprintf("%s", units.HumanSize(float64(s.SectorSize)))}, + {"Base Device Size", fmt.Sprintf("%s", units.HumanSize(float64(s.BaseDeviceSize)))}, + {"Backing Filesystem", s.BaseDeviceFS}, + {"Data file", s.DataFile}, + {"Metadata file", s.MetadataFile}, + {"Data Space Used", fmt.Sprintf("%s", units.HumanSize(float64(s.Data.Used)))}, + {"Data Space Total", fmt.Sprintf("%s", units.HumanSize(float64(s.Data.Total)))}, + {"Data Space Available", fmt.Sprintf("%s", units.HumanSize(float64(s.Data.Available)))}, + {"Metadata Space Used", fmt.Sprintf("%s", units.HumanSize(float64(s.Metadata.Used)))}, + {"Metadata Space Total", fmt.Sprintf("%s", units.HumanSize(float64(s.Metadata.Total)))}, + {"Metadata Space Available", fmt.Sprintf("%s", units.HumanSize(float64(s.Metadata.Available)))}, + {"Thin Pool Minimum Free Space", fmt.Sprintf("%s", units.HumanSize(float64(s.MinFreeSpace)))}, + {"Udev Sync Supported", fmt.Sprintf("%v", s.UdevSyncSupported)}, + {"Deferred Removal Enabled", fmt.Sprintf("%v", s.DeferredRemoveEnabled)}, + {"Deferred Deletion Enabled", fmt.Sprintf("%v", s.DeferredDeleteEnabled)}, + {"Deferred Deleted Device Count", fmt.Sprintf("%v", s.DeferredDeletedDeviceCount)}, + } + if len(s.DataLoopback) > 0 { + status = append(status, [2]string{"Data loop file", s.DataLoopback}) + } + if len(s.MetadataLoopback) > 0 { + status = append(status, [2]string{"Metadata loop file", s.MetadataLoopback}) + } + if vStr, err := devicemapper.GetLibraryVersion(); err == nil { + status = append(status, [2]string{"Library Version", vStr}) + } + return status +} + +// GetMetadata returns a map of information about the device. +func (d *Driver) GetMetadata(id string) (map[string]string, error) { + m, err := d.DeviceSet.exportDeviceMetadata(id) + + if err != nil { + return nil, err + } + + metadata := make(map[string]string) + metadata["DeviceId"] = strconv.Itoa(m.deviceID) + metadata["DeviceSize"] = strconv.FormatUint(m.deviceSize, 10) + metadata["DeviceName"] = m.deviceName + return metadata, nil +} + +// Cleanup unmounts a device. +func (d *Driver) Cleanup() error { + err := d.DeviceSet.Shutdown(d.home) + + if err2 := mount.Unmount(d.home); err == nil { + err = err2 + } + + return err +} + +// CreateReadWrite creates a layer that is writable for use as a container +// file system. +func (d *Driver) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + return d.Create(id, parent, mountLabel, storageOpt) +} + +// Create adds a device with a given id and the parent. +func (d *Driver) Create(id, parent, mountLabel string, storageOpt map[string]string) error { + if err := d.DeviceSet.AddDevice(id, parent, storageOpt); err != nil { + return err + } + + return nil +} + +// Remove removes a device with a given id, unmounts the filesystem. +func (d *Driver) Remove(id string) error { + if !d.DeviceSet.HasDevice(id) { + // Consider removing a non-existing device a no-op + // This is useful to be able to progress on container removal + // if the underlying device has gone away due to earlier errors + return nil + } + + // This assumes the device has been properly Get/Put:ed and thus is unmounted + if err := d.DeviceSet.DeleteDevice(id, false); err != nil { + return err + } + + mp := path.Join(d.home, "mnt", id) + if err := os.RemoveAll(mp); err != nil && !os.IsNotExist(err) { + return err + } + + return nil +} + +// Get mounts a device with given id into the root filesystem +func (d *Driver) Get(id, mountLabel string) (string, error) { + mp := path.Join(d.home, "mnt", id) + rootFs := path.Join(mp, "rootfs") + if count := d.ctr.Increment(mp); count > 1 { + return rootFs, nil + } + + uid, gid, err := idtools.GetRootUIDGID(d.uidMaps, d.gidMaps) + if err != nil { + d.ctr.Decrement(mp) + return "", err + } + + // Create the target directories if they don't exist + if err := idtools.MkdirAllAs(path.Join(d.home, "mnt"), 0755, uid, gid); err != nil && !os.IsExist(err) { + d.ctr.Decrement(mp) + return "", err + } + if err := idtools.MkdirAs(mp, 0755, uid, gid); err != nil && !os.IsExist(err) { + d.ctr.Decrement(mp) + return "", err + } + + // Mount the device + if err := d.DeviceSet.MountDevice(id, mp, mountLabel); err != nil { + d.ctr.Decrement(mp) + return "", err + } + + if err := idtools.MkdirAllAs(rootFs, 0755, uid, gid); err != nil && !os.IsExist(err) { + d.ctr.Decrement(mp) + d.DeviceSet.UnmountDevice(id, mp) + return "", err + } + + idFile := path.Join(mp, "id") + if _, err := os.Stat(idFile); err != nil && os.IsNotExist(err) { + // Create an "id" file with the container/image id in it to help reconstruct this in case + // of later problems + if err := ioutil.WriteFile(idFile, []byte(id), 0600); err != nil { + d.ctr.Decrement(mp) + d.DeviceSet.UnmountDevice(id, mp) + return "", err + } + } + + return rootFs, nil +} + +// Put unmounts a device and removes it. +func (d *Driver) Put(id string) error { + mp := path.Join(d.home, "mnt", id) + if count := d.ctr.Decrement(mp); count > 0 { + return nil + } + err := d.DeviceSet.UnmountDevice(id, mp) + if err != nil { + logrus.Errorf("devmapper: Error unmounting device %s: %s", id, err) + } + return err +} + +// Exists checks to see if the device exists. +func (d *Driver) Exists(id string) bool { + return d.DeviceSet.HasDevice(id) +} diff --git a/vendor/github.com/containers/storage/drivers/devmapper/mount.go b/vendor/github.com/containers/storage/drivers/devmapper/mount.go new file mode 100644 index 00000000..cca1fe1b --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/devmapper/mount.go @@ -0,0 +1,89 @@ +// +build linux + +package devmapper + +import ( + "bytes" + "fmt" + "os" + "path/filepath" + "syscall" +) + +// FIXME: this is copy-pasted from the aufs driver. +// It should be moved into the core. + +// Mounted returns true if a mount point exists. +func Mounted(mountpoint string) (bool, error) { + mntpoint, err := os.Stat(mountpoint) + if err != nil { + if os.IsNotExist(err) { + return false, nil + } + return false, err + } + parent, err := os.Stat(filepath.Join(mountpoint, "..")) + if err != nil { + return false, err + } + mntpointSt := mntpoint.Sys().(*syscall.Stat_t) + parentSt := parent.Sys().(*syscall.Stat_t) + return mntpointSt.Dev != parentSt.Dev, nil +} + +type probeData struct { + fsName string + magic string + offset uint64 +} + +// ProbeFsType returns the filesystem name for the given device id. +func ProbeFsType(device string) (string, error) { + probes := []probeData{ + {"btrfs", "_BHRfS_M", 0x10040}, + {"ext4", "\123\357", 0x438}, + {"xfs", "XFSB", 0}, + } + + maxLen := uint64(0) + for _, p := range probes { + l := p.offset + uint64(len(p.magic)) + if l > maxLen { + maxLen = l + } + } + + file, err := os.Open(device) + if err != nil { + return "", err + } + defer file.Close() + + buffer := make([]byte, maxLen) + l, err := file.Read(buffer) + if err != nil { + return "", err + } + + if uint64(l) != maxLen { + return "", fmt.Errorf("devmapper: unable to detect filesystem type of %s, short read", device) + } + + for _, p := range probes { + if bytes.Equal([]byte(p.magic), buffer[p.offset:p.offset+uint64(len(p.magic))]) { + return p.fsName, nil + } + } + + return "", fmt.Errorf("devmapper: Unknown filesystem type on %s", device) +} + +func joinMountOptions(a, b string) string { + if a == "" { + return b + } + if b == "" { + return a + } + return a + "," + b +} diff --git a/vendor/github.com/containers/storage/drivers/driver.go b/vendor/github.com/containers/storage/drivers/driver.go new file mode 100644 index 00000000..e267f618 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/driver.go @@ -0,0 +1,243 @@ +package graphdriver + +import ( + "errors" + "fmt" + "os" + "path/filepath" + "strings" + + "github.com/Sirupsen/logrus" + "github.com/vbatts/tar-split/tar/storage" + + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/idtools" +) + +// FsMagic unsigned id of the filesystem in use. +type FsMagic uint32 + +const ( + // FsMagicUnsupported is a predefined constant value other than a valid filesystem id. + FsMagicUnsupported = FsMagic(0x00000000) +) + +var ( + // All registered drivers + drivers map[string]InitFunc + + // ErrNotSupported returned when driver is not supported. + ErrNotSupported = errors.New("driver not supported") + // ErrPrerequisites retuned when driver does not meet prerequisites. + ErrPrerequisites = errors.New("prerequisites for driver not satisfied (wrong filesystem?)") + // ErrIncompatibleFS returned when file system is not supported. + ErrIncompatibleFS = fmt.Errorf("backing file system is unsupported for this graph driver") +) + +// InitFunc initializes the storage driver. +type InitFunc func(root string, options []string, uidMaps, gidMaps []idtools.IDMap) (Driver, error) + +// ProtoDriver defines the basic capabilities of a driver. +// This interface exists solely to be a minimum set of methods +// for client code which choose not to implement the entire Driver +// interface and use the NaiveDiffDriver wrapper constructor. +// +// Use of ProtoDriver directly by client code is not recommended. +type ProtoDriver interface { + // String returns a string representation of this driver. + String() string + // CreateReadWrite creates a new, empty filesystem layer that is ready + // to be used as the storage for a container. + CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error + // Create creates a new, empty, filesystem layer with the + // specified id and parent and mountLabel. Parent and mountLabel may be "". + Create(id, parent, mountLabel string, storageOpt map[string]string) error + // Remove attempts to remove the filesystem layer with this id. + Remove(id string) error + // Get returns the mountpoint for the layered filesystem referred + // to by this id. You can optionally specify a mountLabel or "". + // Returns the absolute path to the mounted layered filesystem. + Get(id, mountLabel string) (dir string, err error) + // Put releases the system resources for the specified id, + // e.g, unmounting layered filesystem. + Put(id string) error + // Exists returns whether a filesystem layer with the specified + // ID exists on this driver. + Exists(id string) bool + // Status returns a set of key-value pairs which give low + // level diagnostic status about this driver. + Status() [][2]string + // Returns a set of key-value pairs which give low level information + // about the image/container driver is managing. + GetMetadata(id string) (map[string]string, error) + // Cleanup performs necessary tasks to release resources + // held by the driver, e.g., unmounting all layered filesystems + // known to this driver. + Cleanup() error +} + +// Driver is the interface for layered/snapshot file system drivers. +type Driver interface { + ProtoDriver + // Diff produces an archive of the changes between the specified + // layer and its parent layer which may be "". + Diff(id, parent string) (archive.Archive, error) + // Changes produces a list of changes between the specified layer + // and its parent layer. If parent is "", then all changes will be ADD changes. + Changes(id, parent string) ([]archive.Change, error) + // ApplyDiff extracts the changeset from the given diff into the + // layer with the specified id and parent, returning the size of the + // new layer in bytes. + // The archive.Reader must be an uncompressed stream. + ApplyDiff(id, parent string, diff archive.Reader) (size int64, err error) + // DiffSize calculates the changes between the specified id + // and its parent and returns the size in bytes of the changes + // relative to its base filesystem directory. + DiffSize(id, parent string) (size int64, err error) +} + +// DiffGetterDriver is the interface for layered file system drivers that +// provide a specialized function for getting file contents for tar-split. +type DiffGetterDriver interface { + Driver + // DiffGetter returns an interface to efficiently retrieve the contents + // of files in a layer. + DiffGetter(id string) (FileGetCloser, error) +} + +// FileGetCloser extends the storage.FileGetter interface with a Close method +// for cleaning up. +type FileGetCloser interface { + storage.FileGetter + // Close cleans up any resources associated with the FileGetCloser. + Close() error +} + +// Checker makes checks on specified filesystems. +type Checker interface { + // IsMounted returns true if the provided path is mounted for the specific checker + IsMounted(path string) bool +} + +func init() { + drivers = make(map[string]InitFunc) +} + +// Register registers an InitFunc for the driver. +func Register(name string, initFunc InitFunc) error { + if _, exists := drivers[name]; exists { + return fmt.Errorf("Name already registered %s", name) + } + drivers[name] = initFunc + + return nil +} + +// GetDriver initializes and returns the registered driver +func GetDriver(name, home string, options []string, uidMaps, gidMaps []idtools.IDMap) (Driver, error) { + if initFunc, exists := drivers[name]; exists { + return initFunc(filepath.Join(home, name), options, uidMaps, gidMaps) + } + if pluginDriver, err := lookupPlugin(name, home, options); err == nil { + return pluginDriver, nil + } + logrus.Errorf("Failed to GetDriver graph %s %s", name, home) + return nil, ErrNotSupported +} + +// getBuiltinDriver initializes and returns the registered driver, but does not try to load from plugins +func getBuiltinDriver(name, home string, options []string, uidMaps, gidMaps []idtools.IDMap) (Driver, error) { + if initFunc, exists := drivers[name]; exists { + return initFunc(filepath.Join(home, name), options, uidMaps, gidMaps) + } + logrus.Errorf("Failed to built-in GetDriver graph %s %s", name, home) + return nil, ErrNotSupported +} + +// New creates the driver and initializes it at the specified root. +func New(root string, name string, options []string, uidMaps, gidMaps []idtools.IDMap) (Driver, error) { + if name != "" { + logrus.Debugf("[graphdriver] trying provided driver %q", name) // so the logs show specified driver + return GetDriver(name, root, options, uidMaps, gidMaps) + } + + // Guess for prior driver + driversMap := scanPriorDrivers(root) + for _, name := range priority { + if name == "vfs" { + // don't use vfs even if there is state present. + continue + } + if _, prior := driversMap[name]; prior { + // of the state found from prior drivers, check in order of our priority + // which we would prefer + driver, err := getBuiltinDriver(name, root, options, uidMaps, gidMaps) + if err != nil { + // unlike below, we will return error here, because there is prior + // state, and now it is no longer supported/prereq/compatible, so + // something changed and needs attention. Otherwise the daemon's + // images would just "disappear". + logrus.Errorf("[graphdriver] prior storage driver %q failed: %s", name, err) + return nil, err + } + + // abort starting when there are other prior configured drivers + // to ensure the user explicitly selects the driver to load + if len(driversMap)-1 > 0 { + var driversSlice []string + for name := range driversMap { + driversSlice = append(driversSlice, name) + } + + return nil, fmt.Errorf("%q contains several valid graphdrivers: %s; Please cleanup or explicitly choose storage driver (-s )", root, strings.Join(driversSlice, ", ")) + } + + logrus.Infof("[graphdriver] using prior storage driver %q", name) + return driver, nil + } + } + + // Check for priority drivers first + for _, name := range priority { + driver, err := getBuiltinDriver(name, root, options, uidMaps, gidMaps) + if err != nil { + if isDriverNotSupported(err) { + continue + } + return nil, err + } + return driver, nil + } + + // Check all registered drivers if no priority driver is found + for name, initFunc := range drivers { + driver, err := initFunc(filepath.Join(root, name), options, uidMaps, gidMaps) + if err != nil { + if isDriverNotSupported(err) { + continue + } + return nil, err + } + return driver, nil + } + return nil, fmt.Errorf("No supported storage backend found") +} + +// isDriverNotSupported returns true if the error initializing +// the graph driver is a non-supported error. +func isDriverNotSupported(err error) bool { + return err == ErrNotSupported || err == ErrPrerequisites || err == ErrIncompatibleFS +} + +// scanPriorDrivers returns an un-ordered scan of directories of prior storage drivers +func scanPriorDrivers(root string) map[string]bool { + driversMap := make(map[string]bool) + + for driver := range drivers { + p := filepath.Join(root, driver) + if _, err := os.Stat(p); err == nil && driver != "vfs" { + driversMap[driver] = true + } + } + return driversMap +} diff --git a/vendor/github.com/containers/storage/drivers/driver_freebsd.go b/vendor/github.com/containers/storage/drivers/driver_freebsd.go new file mode 100644 index 00000000..2891a84f --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/driver_freebsd.go @@ -0,0 +1,19 @@ +package graphdriver + +import "syscall" + +var ( + // Slice of drivers that should be used in an order + priority = []string{ + "zfs", + } +) + +// Mounted checks if the given path is mounted as the fs type +func Mounted(fsType FsMagic, mountPath string) (bool, error) { + var buf syscall.Statfs_t + if err := syscall.Statfs(mountPath, &buf); err != nil { + return false, err + } + return FsMagic(buf.Type) == fsType, nil +} diff --git a/vendor/github.com/containers/storage/drivers/driver_linux.go b/vendor/github.com/containers/storage/drivers/driver_linux.go new file mode 100644 index 00000000..2b421e32 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/driver_linux.go @@ -0,0 +1,133 @@ +// +build linux + +package graphdriver + +import ( + "path/filepath" + "syscall" + + "github.com/containers/storage/pkg/mount" +) + +const ( + // FsMagicAufs filesystem id for Aufs + FsMagicAufs = FsMagic(0x61756673) + // FsMagicBtrfs filesystem id for Btrfs + FsMagicBtrfs = FsMagic(0x9123683E) + // FsMagicCramfs filesystem id for Cramfs + FsMagicCramfs = FsMagic(0x28cd3d45) + // FsMagicEcryptfs filesystem id for eCryptfs + FsMagicEcryptfs = FsMagic(0xf15f) + // FsMagicExtfs filesystem id for Extfs + FsMagicExtfs = FsMagic(0x0000EF53) + // FsMagicF2fs filesystem id for F2fs + FsMagicF2fs = FsMagic(0xF2F52010) + // FsMagicGPFS filesystem id for GPFS + FsMagicGPFS = FsMagic(0x47504653) + // FsMagicJffs2Fs filesystem if for Jffs2Fs + FsMagicJffs2Fs = FsMagic(0x000072b6) + // FsMagicJfs filesystem id for Jfs + FsMagicJfs = FsMagic(0x3153464a) + // FsMagicNfsFs filesystem id for NfsFs + FsMagicNfsFs = FsMagic(0x00006969) + // FsMagicRAMFs filesystem id for RamFs + FsMagicRAMFs = FsMagic(0x858458f6) + // FsMagicReiserFs filesystem id for ReiserFs + FsMagicReiserFs = FsMagic(0x52654973) + // FsMagicSmbFs filesystem id for SmbFs + FsMagicSmbFs = FsMagic(0x0000517B) + // FsMagicSquashFs filesystem id for SquashFs + FsMagicSquashFs = FsMagic(0x73717368) + // FsMagicTmpFs filesystem id for TmpFs + FsMagicTmpFs = FsMagic(0x01021994) + // FsMagicVxFS filesystem id for VxFs + FsMagicVxFS = FsMagic(0xa501fcf5) + // FsMagicXfs filesystem id for Xfs + FsMagicXfs = FsMagic(0x58465342) + // FsMagicZfs filesystem id for Zfs + FsMagicZfs = FsMagic(0x2fc12fc1) + // FsMagicOverlay filesystem id for overlay + FsMagicOverlay = FsMagic(0x794C7630) +) + +var ( + // Slice of drivers that should be used in an order + priority = []string{ + "aufs", + "btrfs", + "zfs", + "devicemapper", + "overlay", + "vfs", + } + + // FsNames maps filesystem id to name of the filesystem. + FsNames = map[FsMagic]string{ + FsMagicAufs: "aufs", + FsMagicBtrfs: "btrfs", + FsMagicCramfs: "cramfs", + FsMagicExtfs: "extfs", + FsMagicF2fs: "f2fs", + FsMagicGPFS: "gpfs", + FsMagicJffs2Fs: "jffs2", + FsMagicJfs: "jfs", + FsMagicNfsFs: "nfs", + FsMagicRAMFs: "ramfs", + FsMagicReiserFs: "reiserfs", + FsMagicSmbFs: "smb", + FsMagicSquashFs: "squashfs", + FsMagicTmpFs: "tmpfs", + FsMagicUnsupported: "unsupported", + FsMagicVxFS: "vxfs", + FsMagicXfs: "xfs", + FsMagicZfs: "zfs", + } +) + +// GetFSMagic returns the filesystem id given the path. +func GetFSMagic(rootpath string) (FsMagic, error) { + var buf syscall.Statfs_t + if err := syscall.Statfs(filepath.Dir(rootpath), &buf); err != nil { + return 0, err + } + return FsMagic(buf.Type), nil +} + +// NewFsChecker returns a checker configured for the provied FsMagic +func NewFsChecker(t FsMagic) Checker { + return &fsChecker{ + t: t, + } +} + +type fsChecker struct { + t FsMagic +} + +func (c *fsChecker) IsMounted(path string) bool { + m, _ := Mounted(c.t, path) + return m +} + +// NewDefaultChecker returns a check that parses /proc/mountinfo to check +// if the specified path is mounted. +func NewDefaultChecker() Checker { + return &defaultChecker{} +} + +type defaultChecker struct { +} + +func (c *defaultChecker) IsMounted(path string) bool { + m, _ := mount.Mounted(path) + return m +} + +// Mounted checks if the given path is mounted as the fs type +func Mounted(fsType FsMagic, mountPath string) (bool, error) { + var buf syscall.Statfs_t + if err := syscall.Statfs(mountPath, &buf); err != nil { + return false, err + } + return FsMagic(buf.Type) == fsType, nil +} diff --git a/vendor/github.com/containers/storage/drivers/driver_solaris.go b/vendor/github.com/containers/storage/drivers/driver_solaris.go new file mode 100644 index 00000000..29719ffa --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/driver_solaris.go @@ -0,0 +1,65 @@ +// +build solaris,cgo + +package graphdriver + +/* +#include +#include + +static inline struct statvfs *getstatfs(char *s) { + struct statvfs *buf; + int err; + buf = (struct statvfs *)malloc(sizeof(struct statvfs)); + err = statvfs(s, buf); + return buf; +} +*/ +import "C" +import ( + "path/filepath" + "unsafe" + + log "github.com/Sirupsen/logrus" +) + +const ( + // FsMagicZfs filesystem id for Zfs + FsMagicZfs = FsMagic(0x2fc12fc1) +) + +var ( + // Slice of drivers that should be used in an order + priority = []string{ + "zfs", + } + + // FsNames maps filesystem id to name of the filesystem. + FsNames = map[FsMagic]string{ + FsMagicZfs: "zfs", + } +) + +// GetFSMagic returns the filesystem id given the path. +func GetFSMagic(rootpath string) (FsMagic, error) { + return 0, nil +} + +// Mounted checks if the given path is mounted as the fs type +//Solaris supports only ZFS for now +func Mounted(fsType FsMagic, mountPath string) (bool, error) { + + cs := C.CString(filepath.Dir(mountPath)) + buf := C.getstatfs(cs) + + // on Solaris buf.f_basetype contains ['z', 'f', 's', 0 ... ] + if (buf.f_basetype[0] != 122) || (buf.f_basetype[1] != 102) || (buf.f_basetype[2] != 115) || + (buf.f_basetype[3] != 0) { + log.Debugf("[zfs] no zfs dataset found for rootdir '%s'", mountPath) + C.free(unsafe.Pointer(buf)) + return false, ErrPrerequisites + } + + C.free(unsafe.Pointer(buf)) + C.free(unsafe.Pointer(cs)) + return true, nil +} diff --git a/vendor/github.com/containers/storage/drivers/driver_unsupported.go b/vendor/github.com/containers/storage/drivers/driver_unsupported.go new file mode 100644 index 00000000..4a875608 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/driver_unsupported.go @@ -0,0 +1,15 @@ +// +build !linux,!windows,!freebsd,!solaris + +package graphdriver + +var ( + // Slice of drivers that should be used in an order + priority = []string{ + "unsupported", + } +) + +// GetFSMagic returns the filesystem id given the path. +func GetFSMagic(rootpath string) (FsMagic, error) { + return FsMagicUnsupported, nil +} diff --git a/vendor/github.com/containers/storage/drivers/driver_windows.go b/vendor/github.com/containers/storage/drivers/driver_windows.go new file mode 100644 index 00000000..ffd30c29 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/driver_windows.go @@ -0,0 +1,14 @@ +package graphdriver + +var ( + // Slice of drivers that should be used in order + priority = []string{ + "windowsfilter", + } +) + +// GetFSMagic returns the filesystem id given the path. +func GetFSMagic(rootpath string) (FsMagic, error) { + // Note it is OK to return FsMagicUnsupported on Windows. + return FsMagicUnsupported, nil +} diff --git a/vendor/github.com/containers/storage/drivers/fsdiff.go b/vendor/github.com/containers/storage/drivers/fsdiff.go new file mode 100644 index 00000000..0f5b4fe4 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/fsdiff.go @@ -0,0 +1,157 @@ +package graphdriver + +import ( + "time" + + "github.com/Sirupsen/logrus" + + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/chrootarchive" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/ioutils" +) + +var ( + // ApplyUncompressedLayer defines the unpack method used by the graph + // driver. + ApplyUncompressedLayer = chrootarchive.ApplyUncompressedLayer +) + +// NaiveDiffDriver takes a ProtoDriver and adds the +// capability of the Diffing methods which it may or may not +// support on its own. See the comment on the exported +// NewNaiveDiffDriver function below. +// Notably, the AUFS driver doesn't need to be wrapped like this. +type NaiveDiffDriver struct { + ProtoDriver + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap +} + +// NewNaiveDiffDriver returns a fully functional driver that wraps the +// given ProtoDriver and adds the capability of the following methods which +// it may or may not support on its own: +// Diff(id, parent string) (archive.Archive, error) +// Changes(id, parent string) ([]archive.Change, error) +// ApplyDiff(id, parent string, diff archive.Reader) (size int64, err error) +// DiffSize(id, parent string) (size int64, err error) +func NewNaiveDiffDriver(driver ProtoDriver, uidMaps, gidMaps []idtools.IDMap) Driver { + gdw := &NaiveDiffDriver{ + ProtoDriver: driver, + uidMaps: uidMaps, + gidMaps: gidMaps, + } + return gdw +} + +// Diff produces an archive of the changes between the specified +// layer and its parent layer which may be "". +func (gdw *NaiveDiffDriver) Diff(id, parent string) (arch archive.Archive, err error) { + layerFs, err := gdw.Get(id, "") + if err != nil { + return nil, err + } + + defer func() { + if err != nil { + gdw.Put(id) + } + }() + + if parent == "" { + archive, err := archive.Tar(layerFs, archive.Uncompressed) + if err != nil { + return nil, err + } + return ioutils.NewReadCloserWrapper(archive, func() error { + err := archive.Close() + gdw.Put(id) + return err + }), nil + } + + parentFs, err := gdw.Get(parent, "") + if err != nil { + return nil, err + } + defer gdw.Put(parent) + + changes, err := archive.ChangesDirs(layerFs, parentFs) + if err != nil { + return nil, err + } + + archive, err := archive.ExportChanges(layerFs, changes, gdw.uidMaps, gdw.gidMaps) + if err != nil { + return nil, err + } + + return ioutils.NewReadCloserWrapper(archive, func() error { + err := archive.Close() + gdw.Put(id) + return err + }), nil +} + +// Changes produces a list of changes between the specified layer +// and its parent layer. If parent is "", then all changes will be ADD changes. +func (gdw *NaiveDiffDriver) Changes(id, parent string) ([]archive.Change, error) { + layerFs, err := gdw.Get(id, "") + if err != nil { + return nil, err + } + defer gdw.Put(id) + + parentFs := "" + + if parent != "" { + parentFs, err = gdw.Get(parent, "") + if err != nil { + return nil, err + } + defer gdw.Put(parent) + } + + return archive.ChangesDirs(layerFs, parentFs) +} + +// ApplyDiff extracts the changeset from the given diff into the +// layer with the specified id and parent, returning the size of the +// new layer in bytes. +func (gdw *NaiveDiffDriver) ApplyDiff(id, parent string, diff archive.Reader) (size int64, err error) { + // Mount the root filesystem so we can apply the diff/layer. + layerFs, err := gdw.Get(id, "") + if err != nil { + return + } + defer gdw.Put(id) + + options := &archive.TarOptions{UIDMaps: gdw.uidMaps, + GIDMaps: gdw.gidMaps} + start := time.Now().UTC() + logrus.Debug("Start untar layer") + if size, err = ApplyUncompressedLayer(layerFs, diff, options); err != nil { + return + } + logrus.Debugf("Untar time: %vs", time.Now().UTC().Sub(start).Seconds()) + + return +} + +// DiffSize calculates the changes between the specified layer +// and its parent and returns the size in bytes of the changes +// relative to its base filesystem directory. +func (gdw *NaiveDiffDriver) DiffSize(id, parent string) (size int64, err error) { + changes, err := gdw.Changes(id, parent) + if err != nil { + return + } + + layerFs, err := gdw.Get(id, "") + if err != nil { + return + } + defer gdw.Put(id) + + return archive.ChangesSize(layerFs, changes), nil +} diff --git a/vendor/github.com/containers/storage/drivers/overlay/copy.go b/vendor/github.com/containers/storage/drivers/overlay/copy.go new file mode 100644 index 00000000..703d51a8 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/overlay/copy.go @@ -0,0 +1,169 @@ +// +build linux + +package overlay + +import ( + "fmt" + "os" + "path/filepath" + "syscall" + "time" + + "github.com/containers/storage/pkg/pools" + "github.com/containers/storage/pkg/system" +) + +type copyFlags int + +const ( + copyHardlink copyFlags = 1 << iota +) + +func copyRegular(srcPath, dstPath string, mode os.FileMode) error { + srcFile, err := os.Open(srcPath) + if err != nil { + return err + } + defer srcFile.Close() + + dstFile, err := os.OpenFile(dstPath, os.O_WRONLY|os.O_CREATE, mode) + if err != nil { + return err + } + defer dstFile.Close() + + _, err = pools.Copy(dstFile, srcFile) + + return err +} + +func copyXattr(srcPath, dstPath, attr string) error { + data, err := system.Lgetxattr(srcPath, attr) + if err != nil { + return err + } + if data != nil { + if err := system.Lsetxattr(dstPath, attr, data, 0); err != nil { + return err + } + } + return nil +} + +func copyDir(srcDir, dstDir string, flags copyFlags) error { + err := filepath.Walk(srcDir, func(srcPath string, f os.FileInfo, err error) error { + if err != nil { + return err + } + + // Rebase path + relPath, err := filepath.Rel(srcDir, srcPath) + if err != nil { + return err + } + + dstPath := filepath.Join(dstDir, relPath) + if err != nil { + return err + } + + stat, ok := f.Sys().(*syscall.Stat_t) + if !ok { + return fmt.Errorf("Unable to get raw syscall.Stat_t data for %s", srcPath) + } + + isHardlink := false + + switch f.Mode() & os.ModeType { + case 0: // Regular file + if flags©Hardlink != 0 { + isHardlink = true + if err := os.Link(srcPath, dstPath); err != nil { + return err + } + } else { + if err := copyRegular(srcPath, dstPath, f.Mode()); err != nil { + return err + } + } + + case os.ModeDir: + if err := os.Mkdir(dstPath, f.Mode()); err != nil && !os.IsExist(err) { + return err + } + + case os.ModeSymlink: + link, err := os.Readlink(srcPath) + if err != nil { + return err + } + + if err := os.Symlink(link, dstPath); err != nil { + return err + } + + case os.ModeNamedPipe: + fallthrough + case os.ModeSocket: + if err := syscall.Mkfifo(dstPath, stat.Mode); err != nil { + return err + } + + case os.ModeDevice: + if err := syscall.Mknod(dstPath, stat.Mode, int(stat.Rdev)); err != nil { + return err + } + + default: + return fmt.Errorf("Unknown file type for %s\n", srcPath) + } + + // Everything below is copying metadata from src to dst. All this metadata + // already shares an inode for hardlinks. + if isHardlink { + return nil + } + + if err := os.Lchown(dstPath, int(stat.Uid), int(stat.Gid)); err != nil { + return err + } + + if err := copyXattr(srcPath, dstPath, "security.capability"); err != nil { + return err + } + + // We need to copy this attribute if it appears in an overlay upper layer, as + // this function is used to copy those. It is set by overlay if a directory + // is removed and then re-created and should not inherit anything from the + // same dir in the lower dir. + if err := copyXattr(srcPath, dstPath, "trusted.overlay.opaque"); err != nil { + return err + } + + isSymlink := f.Mode()&os.ModeSymlink != 0 + + // There is no LChmod, so ignore mode for symlink. Also, this + // must happen after chown, as that can modify the file mode + if !isSymlink { + if err := os.Chmod(dstPath, f.Mode()); err != nil { + return err + } + } + + // system.Chtimes doesn't support a NOFOLLOW flag atm + if !isSymlink { + aTime := time.Unix(int64(stat.Atim.Sec), int64(stat.Atim.Nsec)) + mTime := time.Unix(int64(stat.Mtim.Sec), int64(stat.Mtim.Nsec)) + if err := system.Chtimes(dstPath, aTime, mTime); err != nil { + return err + } + } else { + ts := []syscall.Timespec{stat.Atim, stat.Mtim} + if err := system.LUtimesNano(dstPath, ts); err != nil { + return err + } + } + return nil + }) + return err +} diff --git a/vendor/github.com/containers/storage/drivers/overlay/overlay.go b/vendor/github.com/containers/storage/drivers/overlay/overlay.go new file mode 100644 index 00000000..ec4aed46 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/overlay/overlay.go @@ -0,0 +1,450 @@ +// +build linux + +package overlay + +import ( + "bufio" + "fmt" + "io/ioutil" + "os" + "os/exec" + "path" + "syscall" + + "github.com/Sirupsen/logrus" + + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/idtools" + + "github.com/containers/storage/pkg/mount" + "github.com/opencontainers/runc/libcontainer/label" +) + +// This is a small wrapper over the NaiveDiffWriter that lets us have a custom +// implementation of ApplyDiff() + +var ( + // ErrApplyDiffFallback is returned to indicate that a normal ApplyDiff is applied as a fallback from Naive diff writer. + ErrApplyDiffFallback = fmt.Errorf("Fall back to normal ApplyDiff") + backingFs = "" +) + +// ApplyDiffProtoDriver wraps the ProtoDriver by extending the interface with ApplyDiff method. +type ApplyDiffProtoDriver interface { + graphdriver.ProtoDriver + // ApplyDiff writes the diff to the archive for the given id and parent id. + // It returns the size in bytes written if successful, an error ErrApplyDiffFallback is returned otherwise. + ApplyDiff(id, parent string, diff archive.Reader) (size int64, err error) +} + +type naiveDiffDriverWithApply struct { + graphdriver.Driver + applyDiff ApplyDiffProtoDriver +} + +// NaiveDiffDriverWithApply returns a NaiveDiff driver with custom ApplyDiff. +func NaiveDiffDriverWithApply(driver ApplyDiffProtoDriver, uidMaps, gidMaps []idtools.IDMap) graphdriver.Driver { + return &naiveDiffDriverWithApply{ + Driver: graphdriver.NewNaiveDiffDriver(driver, uidMaps, gidMaps), + applyDiff: driver, + } +} + +// ApplyDiff creates a diff layer with either the NaiveDiffDriver or with a fallback. +func (d *naiveDiffDriverWithApply) ApplyDiff(id, parent string, diff archive.Reader) (int64, error) { + b, err := d.applyDiff.ApplyDiff(id, parent, diff) + if err == ErrApplyDiffFallback { + return d.Driver.ApplyDiff(id, parent, diff) + } + return b, err +} + +// This backend uses the overlay union filesystem for containers +// plus hard link file sharing for images. + +// Each container/image can have a "root" subdirectory which is a plain +// filesystem hierarchy, or they can use overlay. + +// If they use overlay there is a "upper" directory and a "lower-id" +// file, as well as "merged" and "work" directories. The "upper" +// directory has the upper layer of the overlay, and "lower-id" contains +// the id of the parent whose "root" directory shall be used as the lower +// layer in the overlay. The overlay itself is mounted in the "merged" +// directory, and the "work" dir is needed for overlay to work. + +// When an overlay layer is created there are two cases, either the +// parent has a "root" dir, then we start out with an empty "upper" +// directory overlaid on the parents root. This is typically the +// case with the init layer of a container which is based on an image. +// If there is no "root" in the parent, we inherit the lower-id from +// the parent and start by making a copy in the parent's "upper" dir. +// This is typically the case for a container layer which copies +// its parent -init upper layer. + +// Additionally we also have a custom implementation of ApplyLayer +// which makes a recursive copy of the parent "root" layer using +// hardlinks to share file data, and then applies the layer on top +// of that. This means all child images share file (but not directory) +// data with the parent. + +// Driver contains information about the home directory and the list of active mounts that are created using this driver. +type Driver struct { + home string + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap + ctr *graphdriver.RefCounter +} + +func init() { + graphdriver.Register("overlay", Init) +} + +// Init returns the NaiveDiffDriver, a native diff driver for overlay filesystem. +// If overlay filesystem is not supported on the host, graphdriver.ErrNotSupported is returned as error. +// If an overlay filesystem is not supported over an existing filesystem then error graphdriver.ErrIncompatibleFS is returned. +func Init(home string, options []string, uidMaps, gidMaps []idtools.IDMap) (graphdriver.Driver, error) { + + if err := supportsOverlay(); err != nil { + return nil, graphdriver.ErrNotSupported + } + + fsMagic, err := graphdriver.GetFSMagic(home) + if err != nil { + return nil, err + } + if fsName, ok := graphdriver.FsNames[fsMagic]; ok { + backingFs = fsName + } + + switch fsMagic { + case graphdriver.FsMagicAufs, graphdriver.FsMagicBtrfs, graphdriver.FsMagicOverlay, graphdriver.FsMagicZfs, graphdriver.FsMagicEcryptfs: + logrus.Errorf("'overlay' is not supported over %s", backingFs) + return nil, graphdriver.ErrIncompatibleFS + } + + rootUID, rootGID, err := idtools.GetRootUIDGID(uidMaps, gidMaps) + if err != nil { + return nil, err + } + // Create the driver home dir + if err := idtools.MkdirAllAs(home, 0700, rootUID, rootGID); err != nil && !os.IsExist(err) { + return nil, err + } + + if err := mount.MakePrivate(home); err != nil { + return nil, err + } + + d := &Driver{ + home: home, + uidMaps: uidMaps, + gidMaps: gidMaps, + ctr: graphdriver.NewRefCounter(graphdriver.NewFsChecker(graphdriver.FsMagicOverlay)), + } + + return NaiveDiffDriverWithApply(d, uidMaps, gidMaps), nil +} + +func supportsOverlay() error { + // We can try to modprobe overlay first before looking at + // proc/filesystems for when overlay is supported + exec.Command("modprobe", "overlay").Run() + + f, err := os.Open("/proc/filesystems") + if err != nil { + return err + } + defer f.Close() + + s := bufio.NewScanner(f) + for s.Scan() { + if s.Text() == "nodev\toverlay" { + return nil + } + } + logrus.Error("'overlay' not found as a supported filesystem on this host. Please ensure kernel is new enough and has overlay support loaded.") + return graphdriver.ErrNotSupported +} + +func (d *Driver) String() string { + return "overlay" +} + +// Status returns current driver information in a two dimensional string array. +// Output contains "Backing Filesystem" used in this implementation. +func (d *Driver) Status() [][2]string { + return [][2]string{ + {"Backing Filesystem", backingFs}, + } +} + +// GetMetadata returns meta data about the overlay driver such as root, LowerDir, UpperDir, WorkDir and MergeDir used to store data. +func (d *Driver) GetMetadata(id string) (map[string]string, error) { + dir := d.dir(id) + if _, err := os.Stat(dir); err != nil { + return nil, err + } + + metadata := make(map[string]string) + + // If id has a root, it is an image + rootDir := path.Join(dir, "root") + if _, err := os.Stat(rootDir); err == nil { + metadata["RootDir"] = rootDir + return metadata, nil + } + + lowerID, err := ioutil.ReadFile(path.Join(dir, "lower-id")) + if err != nil { + return nil, err + } + + metadata["LowerDir"] = path.Join(d.dir(string(lowerID)), "root") + metadata["UpperDir"] = path.Join(dir, "upper") + metadata["WorkDir"] = path.Join(dir, "work") + metadata["MergedDir"] = path.Join(dir, "merged") + + return metadata, nil +} + +// Cleanup any state created by overlay which should be cleaned when daemon +// is being shutdown. For now, we just have to unmount the bind mounted +// we had created. +func (d *Driver) Cleanup() error { + return mount.Unmount(d.home) +} + +// CreateReadWrite creates a layer that is writable for use as a container +// file system. +func (d *Driver) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + return d.Create(id, parent, mountLabel, storageOpt) +} + +// Create is used to create the upper, lower, and merge directories required for overlay fs for a given id. +// The parent filesystem is used to configure these directories for the overlay. +func (d *Driver) Create(id, parent, mountLabel string, storageOpt map[string]string) (retErr error) { + + if len(storageOpt) != 0 { + return fmt.Errorf("--storage-opt is not supported for overlay") + } + + dir := d.dir(id) + + rootUID, rootGID, err := idtools.GetRootUIDGID(d.uidMaps, d.gidMaps) + if err != nil { + return err + } + if err := idtools.MkdirAllAs(path.Dir(dir), 0700, rootUID, rootGID); err != nil { + return err + } + if err := idtools.MkdirAs(dir, 0700, rootUID, rootGID); err != nil { + return err + } + + defer func() { + // Clean up on failure + if retErr != nil { + os.RemoveAll(dir) + } + }() + + // Toplevel images are just a "root" dir + if parent == "" { + if err := idtools.MkdirAs(path.Join(dir, "root"), 0755, rootUID, rootGID); err != nil { + return err + } + return nil + } + + parentDir := d.dir(parent) + + // Ensure parent exists + if _, err := os.Lstat(parentDir); err != nil { + return err + } + + // If parent has a root, just do an overlay to it + parentRoot := path.Join(parentDir, "root") + + if s, err := os.Lstat(parentRoot); err == nil { + if err := idtools.MkdirAs(path.Join(dir, "upper"), s.Mode(), rootUID, rootGID); err != nil { + return err + } + if err := idtools.MkdirAs(path.Join(dir, "work"), 0700, rootUID, rootGID); err != nil { + return err + } + if err := idtools.MkdirAs(path.Join(dir, "merged"), 0700, rootUID, rootGID); err != nil { + return err + } + if err := ioutil.WriteFile(path.Join(dir, "lower-id"), []byte(parent), 0666); err != nil { + return err + } + return nil + } + + // Otherwise, copy the upper and the lower-id from the parent + + lowerID, err := ioutil.ReadFile(path.Join(parentDir, "lower-id")) + if err != nil { + return err + } + + if err := ioutil.WriteFile(path.Join(dir, "lower-id"), lowerID, 0666); err != nil { + return err + } + + parentUpperDir := path.Join(parentDir, "upper") + s, err := os.Lstat(parentUpperDir) + if err != nil { + return err + } + + upperDir := path.Join(dir, "upper") + if err := idtools.MkdirAs(upperDir, s.Mode(), rootUID, rootGID); err != nil { + return err + } + if err := idtools.MkdirAs(path.Join(dir, "work"), 0700, rootUID, rootGID); err != nil { + return err + } + if err := idtools.MkdirAs(path.Join(dir, "merged"), 0700, rootUID, rootGID); err != nil { + return err + } + + return copyDir(parentUpperDir, upperDir, 0) +} + +func (d *Driver) dir(id string) string { + return path.Join(d.home, id) +} + +// Remove cleans the directories that are created for this id. +func (d *Driver) Remove(id string) error { + if err := os.RemoveAll(d.dir(id)); err != nil && !os.IsNotExist(err) { + return err + } + return nil +} + +// Get creates and mounts the required file system for the given id and returns the mount path. +func (d *Driver) Get(id string, mountLabel string) (s string, err error) { + dir := d.dir(id) + if _, err := os.Stat(dir); err != nil { + return "", err + } + // If id has a root, just return it + rootDir := path.Join(dir, "root") + if _, err := os.Stat(rootDir); err == nil { + return rootDir, nil + } + mergedDir := path.Join(dir, "merged") + if count := d.ctr.Increment(mergedDir); count > 1 { + return mergedDir, nil + } + defer func() { + if err != nil { + if c := d.ctr.Decrement(mergedDir); c <= 0 { + syscall.Unmount(mergedDir, 0) + } + } + }() + lowerID, err := ioutil.ReadFile(path.Join(dir, "lower-id")) + if err != nil { + return "", err + } + var ( + lowerDir = path.Join(d.dir(string(lowerID)), "root") + upperDir = path.Join(dir, "upper") + workDir = path.Join(dir, "work") + opts = fmt.Sprintf("lowerdir=%s,upperdir=%s,workdir=%s", lowerDir, upperDir, workDir) + ) + if err := syscall.Mount("overlay", mergedDir, "overlay", 0, label.FormatMountLabel(opts, mountLabel)); err != nil { + return "", fmt.Errorf("error creating overlay mount to %s: %v", mergedDir, err) + } + // chown "workdir/work" to the remapped root UID/GID. Overlay fs inside a + // user namespace requires this to move a directory from lower to upper. + rootUID, rootGID, err := idtools.GetRootUIDGID(d.uidMaps, d.gidMaps) + if err != nil { + return "", err + } + if err := os.Chown(path.Join(workDir, "work"), rootUID, rootGID); err != nil { + return "", err + } + return mergedDir, nil +} + +// Put unmounts the mount path created for the give id. +func (d *Driver) Put(id string) error { + mountpoint := path.Join(d.dir(id), "merged") + if count := d.ctr.Decrement(mountpoint); count > 0 { + return nil + } + err := syscall.Unmount(mountpoint, 0) + if err != nil { + rootDir := path.Join(d.dir(id), "root") + if _, err := os.Stat(rootDir); err == nil { + // We weren't mounting a "merged" directory anyway + return nil + } + logrus.Debugf("Failed to unmount %s overlay: %v", id, err) + } + return err +} + +// ApplyDiff applies the new layer on top of the root, if parent does not exist with will return an ErrApplyDiffFallback error. +func (d *Driver) ApplyDiff(id string, parent string, diff archive.Reader) (size int64, err error) { + dir := d.dir(id) + + if parent == "" { + return 0, ErrApplyDiffFallback + } + + parentRootDir := path.Join(d.dir(parent), "root") + if _, err := os.Stat(parentRootDir); err != nil { + return 0, ErrApplyDiffFallback + } + + // We now know there is a parent, and it has a "root" directory containing + // the full root filesystem. We can just hardlink it and apply the + // layer. This relies on two things: + // 1) ApplyDiff is only run once on a clean (no writes to upper layer) container + // 2) ApplyDiff doesn't do any in-place writes to files (would break hardlinks) + // These are all currently true and are not expected to break + + tmpRootDir, err := ioutil.TempDir(dir, "tmproot") + if err != nil { + return 0, err + } + defer func() { + if err != nil { + os.RemoveAll(tmpRootDir) + } else { + os.RemoveAll(path.Join(dir, "upper")) + os.RemoveAll(path.Join(dir, "work")) + os.RemoveAll(path.Join(dir, "merged")) + os.RemoveAll(path.Join(dir, "lower-id")) + } + }() + + if err = copyDir(parentRootDir, tmpRootDir, copyHardlink); err != nil { + return 0, err + } + + options := &archive.TarOptions{UIDMaps: d.uidMaps, GIDMaps: d.gidMaps} + if size, err = graphdriver.ApplyUncompressedLayer(tmpRootDir, diff, options); err != nil { + return 0, err + } + + rootDir := path.Join(dir, "root") + if err := os.Rename(tmpRootDir, rootDir); err != nil { + return 0, err + } + + return +} + +// Exists checks to see if the id is already mounted. +func (d *Driver) Exists(id string) bool { + _, err := os.Stat(d.dir(id)) + return err == nil +} diff --git a/vendor/github.com/containers/storage/drivers/overlay/overlay_unsupported.go b/vendor/github.com/containers/storage/drivers/overlay/overlay_unsupported.go new file mode 100644 index 00000000..3dbb4de4 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/overlay/overlay_unsupported.go @@ -0,0 +1,3 @@ +// +build !linux + +package overlay diff --git a/vendor/github.com/containers/storage/drivers/overlay2/mount.go b/vendor/github.com/containers/storage/drivers/overlay2/mount.go new file mode 100644 index 00000000..73bf9264 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/overlay2/mount.go @@ -0,0 +1,88 @@ +// +build linux + +package overlay2 + +import ( + "bytes" + "encoding/json" + "flag" + "fmt" + "os" + "runtime" + "syscall" + + "github.com/containers/storage/pkg/reexec" +) + +func init() { + reexec.Register("docker-mountfrom", mountFromMain) +} + +func fatal(err error) { + fmt.Fprint(os.Stderr, err) + os.Exit(1) +} + +type mountOptions struct { + Device string + Target string + Type string + Label string + Flag uint32 +} + +func mountFrom(dir, device, target, mType, label string) error { + options := &mountOptions{ + Device: device, + Target: target, + Type: mType, + Flag: 0, + Label: label, + } + + cmd := reexec.Command("docker-mountfrom", dir) + w, err := cmd.StdinPipe() + if err != nil { + return fmt.Errorf("mountfrom error on pipe creation: %v", err) + } + + output := bytes.NewBuffer(nil) + cmd.Stdout = output + cmd.Stderr = output + + if err := cmd.Start(); err != nil { + return fmt.Errorf("mountfrom error on re-exec cmd: %v", err) + } + //write the options to the pipe for the untar exec to read + if err := json.NewEncoder(w).Encode(options); err != nil { + return fmt.Errorf("mountfrom json encode to pipe failed: %v", err) + } + w.Close() + + if err := cmd.Wait(); err != nil { + return fmt.Errorf("mountfrom re-exec error: %v: output: %s", err, output) + } + return nil +} + +// mountfromMain is the entry-point for docker-mountfrom on re-exec. +func mountFromMain() { + runtime.LockOSThread() + flag.Parse() + + var options *mountOptions + + if err := json.NewDecoder(os.Stdin).Decode(&options); err != nil { + fatal(err) + } + + if err := os.Chdir(flag.Arg(0)); err != nil { + fatal(err) + } + + if err := syscall.Mount(options.Device, options.Target, options.Type, uintptr(options.Flag), options.Label); err != nil { + fatal(err) + } + + os.Exit(0) +} diff --git a/vendor/github.com/containers/storage/drivers/overlay2/overlay.go b/vendor/github.com/containers/storage/drivers/overlay2/overlay.go new file mode 100644 index 00000000..b9a1fa85 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/overlay2/overlay.go @@ -0,0 +1,514 @@ +// +build linux + +package overlay2 + +import ( + "bufio" + "errors" + "fmt" + "io/ioutil" + "os" + "os/exec" + "path" + "strconv" + "strings" + "syscall" + + "github.com/Sirupsen/logrus" + + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/chrootarchive" + "github.com/containers/storage/pkg/directory" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/mount" + "github.com/containers/storage/pkg/parsers" + "github.com/containers/storage/pkg/parsers/kernel" + + "github.com/opencontainers/runc/libcontainer/label" +) + +var ( + // untar defines the untar method + untar = chrootarchive.UntarUncompressed +) + +// This backend uses the overlay union filesystem for containers +// with diff directories for each layer. + +// This version of the overlay driver requires at least kernel +// 4.0.0 in order to support mounting multiple diff directories. + +// Each container/image has at least a "diff" directory and "link" file. +// If there is also a "lower" file when there are diff layers +// below as well as "merged" and "work" directories. The "diff" directory +// has the upper layer of the overlay and is used to capture any +// changes to the layer. The "lower" file contains all the lower layer +// mounts separated by ":" and ordered from uppermost to lowermost +// layers. The overlay itself is mounted in the "merged" directory, +// and the "work" dir is needed for overlay to work. + +// The "link" file for each layer contains a unique string for the layer. +// Under the "l" directory at the root there will be a symbolic link +// with that unique string pointing the "diff" directory for the layer. +// The symbolic links are used to reference lower layers in the "lower" +// file and on mount. The links are used to shorten the total length +// of a layer reference without requiring changes to the layer identifier +// or root directory. Mounts are always done relative to root and +// referencing the symbolic links in order to ensure the number of +// lower directories can fit in a single page for making the mount +// syscall. A hard upper limit of 128 lower layers is enforced to ensure +// that mounts do not fail due to length. + +const ( + driverName = "overlay2" + linkDir = "l" + lowerFile = "lower" + maxDepth = 128 + + // idLength represents the number of random characters + // which can be used to create the unique link identifer + // for every layer. If this value is too long then the + // page size limit for the mount command may be exceeded. + // The idLength should be selected such that following equation + // is true (512 is a buffer for label metadata). + // ((idLength + len(linkDir) + 1) * maxDepth) <= (pageSize - 512) + idLength = 26 +) + +// Driver contains information about the home directory and the list of active mounts that are created using this driver. +type Driver struct { + home string + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap + ctr *graphdriver.RefCounter +} + +var backingFs = "" + +func init() { + graphdriver.Register(driverName, Init) +} + +// Init returns the a native diff driver for overlay filesystem. +// If overlay filesystem is not supported on the host, graphdriver.ErrNotSupported is returned as error. +// If a overlay filesystem is not supported over a existing filesystem then error graphdriver.ErrIncompatibleFS is returned. +func Init(home string, options []string, uidMaps, gidMaps []idtools.IDMap) (graphdriver.Driver, error) { + opts, err := parseOptions(options) + if err != nil { + return nil, err + } + + if err := supportsOverlay(); err != nil { + return nil, graphdriver.ErrNotSupported + } + + // require kernel 4.0.0 to ensure multiple lower dirs are supported + v, err := kernel.GetKernelVersion() + if err != nil { + return nil, err + } + if kernel.CompareKernelVersion(*v, kernel.VersionInfo{Kernel: 4, Major: 0, Minor: 0}) < 0 { + if !opts.overrideKernelCheck { + return nil, graphdriver.ErrNotSupported + } + logrus.Warnf("Using pre-4.0.0 kernel for overlay2, mount failures may require kernel update") + } + + fsMagic, err := graphdriver.GetFSMagic(home) + if err != nil { + return nil, err + } + if fsName, ok := graphdriver.FsNames[fsMagic]; ok { + backingFs = fsName + } + + // check if they are running over btrfs, aufs, zfs, overlay, or ecryptfs + switch fsMagic { + case graphdriver.FsMagicBtrfs, graphdriver.FsMagicAufs, graphdriver.FsMagicZfs, graphdriver.FsMagicOverlay, graphdriver.FsMagicEcryptfs: + logrus.Errorf("'overlay2' is not supported over %s", backingFs) + return nil, graphdriver.ErrIncompatibleFS + } + + rootUID, rootGID, err := idtools.GetRootUIDGID(uidMaps, gidMaps) + if err != nil { + return nil, err + } + // Create the driver home dir + if err := idtools.MkdirAllAs(path.Join(home, linkDir), 0700, rootUID, rootGID); err != nil && !os.IsExist(err) { + return nil, err + } + + if err := mount.MakePrivate(home); err != nil { + return nil, err + } + + d := &Driver{ + home: home, + uidMaps: uidMaps, + gidMaps: gidMaps, + ctr: graphdriver.NewRefCounter(graphdriver.NewFsChecker(graphdriver.FsMagicOverlay)), + } + + return d, nil +} + +type overlayOptions struct { + overrideKernelCheck bool +} + +func parseOptions(options []string) (*overlayOptions, error) { + o := &overlayOptions{} + for _, option := range options { + key, val, err := parsers.ParseKeyValueOpt(option) + if err != nil { + return nil, err + } + key = strings.ToLower(key) + switch key { + case "overlay2.override_kernel_check": + o.overrideKernelCheck, err = strconv.ParseBool(val) + if err != nil { + return nil, err + } + default: + return nil, fmt.Errorf("overlay2: Unknown option %s\n", key) + } + } + return o, nil +} + +func supportsOverlay() error { + // We can try to modprobe overlay first before looking at + // proc/filesystems for when overlay is supported + exec.Command("modprobe", "overlay").Run() + + f, err := os.Open("/proc/filesystems") + if err != nil { + return err + } + defer f.Close() + + s := bufio.NewScanner(f) + for s.Scan() { + if s.Text() == "nodev\toverlay" { + return nil + } + } + logrus.Error("'overlay' not found as a supported filesystem on this host. Please ensure kernel is new enough and has overlay support loaded.") + return graphdriver.ErrNotSupported +} + +func (d *Driver) String() string { + return driverName +} + +// Status returns current driver information in a two dimensional string array. +// Output contains "Backing Filesystem" used in this implementation. +func (d *Driver) Status() [][2]string { + return [][2]string{ + {"Backing Filesystem", backingFs}, + } +} + +// GetMetadata returns meta data about the overlay driver such as +// LowerDir, UpperDir, WorkDir and MergeDir used to store data. +func (d *Driver) GetMetadata(id string) (map[string]string, error) { + dir := d.dir(id) + if _, err := os.Stat(dir); err != nil { + return nil, err + } + + metadata := map[string]string{ + "WorkDir": path.Join(dir, "work"), + "MergedDir": path.Join(dir, "merged"), + "UpperDir": path.Join(dir, "diff"), + } + + lowerDirs, err := d.getLowerDirs(id) + if err != nil { + return nil, err + } + if len(lowerDirs) > 0 { + metadata["LowerDir"] = strings.Join(lowerDirs, ":") + } + + return metadata, nil +} + +// Cleanup any state created by overlay which should be cleaned when daemon +// is being shutdown. For now, we just have to unmount the bind mounted +// we had created. +func (d *Driver) Cleanup() error { + return mount.Unmount(d.home) +} + +// CreateReadWrite creates a layer that is writable for use as a container +// file system. +func (d *Driver) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + return d.Create(id, parent, mountLabel, storageOpt) +} + +// Create is used to create the upper, lower, and merge directories required for overlay fs for a given id. +// The parent filesystem is used to configure these directories for the overlay. +func (d *Driver) Create(id, parent, mountLabel string, storageOpt map[string]string) (retErr error) { + + if len(storageOpt) != 0 { + return fmt.Errorf("--storage-opt is not supported for overlay") + } + + dir := d.dir(id) + + rootUID, rootGID, err := idtools.GetRootUIDGID(d.uidMaps, d.gidMaps) + if err != nil { + return err + } + if err := idtools.MkdirAllAs(path.Dir(dir), 0700, rootUID, rootGID); err != nil { + return err + } + if err := idtools.MkdirAs(dir, 0700, rootUID, rootGID); err != nil { + return err + } + + defer func() { + // Clean up on failure + if retErr != nil { + os.RemoveAll(dir) + } + }() + + if err := idtools.MkdirAs(path.Join(dir, "diff"), 0755, rootUID, rootGID); err != nil { + return err + } + + lid := generateID(idLength) + if err := os.Symlink(path.Join("..", id, "diff"), path.Join(d.home, linkDir, lid)); err != nil { + return err + } + + // Write link id to link file + if err := ioutil.WriteFile(path.Join(dir, "link"), []byte(lid), 0644); err != nil { + return err + } + + // if no parent directory, done + if parent == "" { + return nil + } + + if err := idtools.MkdirAs(path.Join(dir, "work"), 0700, rootUID, rootGID); err != nil { + return err + } + if err := idtools.MkdirAs(path.Join(dir, "merged"), 0700, rootUID, rootGID); err != nil { + return err + } + + lower, err := d.getLower(parent) + if err != nil { + return err + } + if lower != "" { + if err := ioutil.WriteFile(path.Join(dir, lowerFile), []byte(lower), 0666); err != nil { + return err + } + } + + return nil +} + +func (d *Driver) getLower(parent string) (string, error) { + parentDir := d.dir(parent) + + // Ensure parent exists + if _, err := os.Lstat(parentDir); err != nil { + return "", err + } + + // Read Parent link fileA + parentLink, err := ioutil.ReadFile(path.Join(parentDir, "link")) + if err != nil { + return "", err + } + lowers := []string{path.Join(linkDir, string(parentLink))} + + parentLower, err := ioutil.ReadFile(path.Join(parentDir, lowerFile)) + if err == nil { + parentLowers := strings.Split(string(parentLower), ":") + lowers = append(lowers, parentLowers...) + } + if len(lowers) > maxDepth { + return "", errors.New("max depth exceeded") + } + return strings.Join(lowers, ":"), nil +} + +func (d *Driver) dir(id string) string { + return path.Join(d.home, id) +} + +func (d *Driver) getLowerDirs(id string) ([]string, error) { + var lowersArray []string + lowers, err := ioutil.ReadFile(path.Join(d.dir(id), lowerFile)) + if err == nil { + for _, s := range strings.Split(string(lowers), ":") { + lp, err := os.Readlink(path.Join(d.home, s)) + if err != nil { + return nil, err + } + lowersArray = append(lowersArray, path.Clean(path.Join(d.home, "link", lp))) + } + } else if !os.IsNotExist(err) { + return nil, err + } + return lowersArray, nil +} + +// Remove cleans the directories that are created for this id. +func (d *Driver) Remove(id string) error { + dir := d.dir(id) + lid, err := ioutil.ReadFile(path.Join(dir, "link")) + if err == nil { + if err := os.RemoveAll(path.Join(d.home, linkDir, string(lid))); err != nil { + logrus.Debugf("Failed to remove link: %v", err) + } + } + + if err := os.RemoveAll(dir); err != nil && !os.IsNotExist(err) { + return err + } + return nil +} + +// Get creates and mounts the required file system for the given id and returns the mount path. +func (d *Driver) Get(id string, mountLabel string) (s string, err error) { + dir := d.dir(id) + if _, err := os.Stat(dir); err != nil { + return "", err + } + + diffDir := path.Join(dir, "diff") + lowers, err := ioutil.ReadFile(path.Join(dir, lowerFile)) + if err != nil { + // If no lower, just return diff directory + if os.IsNotExist(err) { + return diffDir, nil + } + return "", err + } + + mergedDir := path.Join(dir, "merged") + if count := d.ctr.Increment(mergedDir); count > 1 { + return mergedDir, nil + } + defer func() { + if err != nil { + if c := d.ctr.Decrement(mergedDir); c <= 0 { + syscall.Unmount(mergedDir, 0) + } + } + }() + + workDir := path.Join(dir, "work") + opts := fmt.Sprintf("lowerdir=%s,upperdir=%s,workdir=%s", string(lowers), path.Join(id, "diff"), path.Join(id, "work")) + mountLabel = label.FormatMountLabel(opts, mountLabel) + if len(mountLabel) > syscall.Getpagesize() { + return "", fmt.Errorf("cannot mount layer, mount label too large %d", len(mountLabel)) + } + + if err := mountFrom(d.home, "overlay", path.Join(id, "merged"), "overlay", mountLabel); err != nil { + return "", fmt.Errorf("error creating overlay mount to %s: %v", mergedDir, err) + } + + // chown "workdir/work" to the remapped root UID/GID. Overlay fs inside a + // user namespace requires this to move a directory from lower to upper. + rootUID, rootGID, err := idtools.GetRootUIDGID(d.uidMaps, d.gidMaps) + if err != nil { + return "", err + } + + if err := os.Chown(path.Join(workDir, "work"), rootUID, rootGID); err != nil { + return "", err + } + + return mergedDir, nil +} + +// Put unmounts the mount path created for the give id. +func (d *Driver) Put(id string) error { + mountpoint := path.Join(d.dir(id), "merged") + if count := d.ctr.Decrement(mountpoint); count > 0 { + return nil + } + err := syscall.Unmount(mountpoint, 0) + if err != nil { + if _, err := ioutil.ReadFile(path.Join(d.dir(id), lowerFile)); err != nil { + // We didn't have a "lower" directory, so we weren't mounting a "merged" directory anyway + return nil + } + logrus.Debugf("Failed to unmount %s overlay: %v", id, err) + } + return err +} + +// Exists checks to see if the id is already mounted. +func (d *Driver) Exists(id string) bool { + _, err := os.Stat(d.dir(id)) + return err == nil +} + +// ApplyDiff applies the new layer into a root +func (d *Driver) ApplyDiff(id string, parent string, diff archive.Reader) (size int64, err error) { + applyDir := d.getDiffPath(id) + + logrus.Debugf("Applying tar in %s", applyDir) + // Overlay doesn't need the parent id to apply the diff + if err := untar(diff, applyDir, &archive.TarOptions{ + UIDMaps: d.uidMaps, + GIDMaps: d.gidMaps, + WhiteoutFormat: archive.OverlayWhiteoutFormat, + }); err != nil { + return 0, err + } + + return d.DiffSize(id, parent) +} + +func (d *Driver) getDiffPath(id string) string { + dir := d.dir(id) + + return path.Join(dir, "diff") +} + +// DiffSize calculates the changes between the specified id +// and its parent and returns the size in bytes of the changes +// relative to its base filesystem directory. +func (d *Driver) DiffSize(id, parent string) (size int64, err error) { + return directory.Size(d.getDiffPath(id)) +} + +// Diff produces an archive of the changes between the specified +// layer and its parent layer which may be "". +func (d *Driver) Diff(id, parent string) (archive.Archive, error) { + diffPath := d.getDiffPath(id) + logrus.Debugf("Tar with options on %s", diffPath) + return archive.TarWithOptions(diffPath, &archive.TarOptions{ + Compression: archive.Uncompressed, + UIDMaps: d.uidMaps, + GIDMaps: d.gidMaps, + WhiteoutFormat: archive.OverlayWhiteoutFormat, + }) +} + +// Changes produces a list of changes between the specified layer +// and its parent layer. If parent is "", then all changes will be ADD changes. +func (d *Driver) Changes(id, parent string) ([]archive.Change, error) { + // Overlay doesn't have snapshots, so we need to get changes from all parent + // layers. + diffPath := d.getDiffPath(id) + layers, err := d.getLowerDirs(id) + if err != nil { + return nil, err + } + + return archive.OverlayChanges(layers, diffPath) +} diff --git a/vendor/github.com/containers/storage/drivers/overlay2/overlay_unsupported.go b/vendor/github.com/containers/storage/drivers/overlay2/overlay_unsupported.go new file mode 100644 index 00000000..e5ac4ca8 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/overlay2/overlay_unsupported.go @@ -0,0 +1,3 @@ +// +build !linux + +package overlay2 diff --git a/vendor/github.com/containers/storage/drivers/overlay2/randomid.go b/vendor/github.com/containers/storage/drivers/overlay2/randomid.go new file mode 100644 index 00000000..af5cb659 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/overlay2/randomid.go @@ -0,0 +1,80 @@ +// +build linux + +package overlay2 + +import ( + "crypto/rand" + "encoding/base32" + "fmt" + "io" + "os" + "syscall" + "time" + + "github.com/Sirupsen/logrus" +) + +// generateID creates a new random string identifier with the given length +func generateID(l int) string { + const ( + // ensures we backoff for less than 450ms total. Use the following to + // select new value, in units of 10ms: + // n*(n+1)/2 = d -> n^2 + n - 2d -> n = (sqrt(8d + 1) - 1)/2 + maxretries = 9 + backoff = time.Millisecond * 10 + ) + + var ( + totalBackoff time.Duration + count int + retries int + size = (l*5 + 7) / 8 + u = make([]byte, size) + ) + // TODO: Include time component, counter component, random component + + for { + // This should never block but the read may fail. Because of this, + // we just try to read the random number generator until we get + // something. This is a very rare condition but may happen. + b := time.Duration(retries) * backoff + time.Sleep(b) + totalBackoff += b + + n, err := io.ReadFull(rand.Reader, u[count:]) + if err != nil { + if retryOnError(err) && retries < maxretries { + count += n + retries++ + logrus.Errorf("error generating version 4 uuid, retrying: %v", err) + continue + } + + // Any other errors represent a system problem. What did someone + // do to /dev/urandom? + panic(fmt.Errorf("error reading random number generator, retried for %v: %v", totalBackoff.String(), err)) + } + + break + } + + s := base32.StdEncoding.EncodeToString(u) + + return s[:l] +} + +// retryOnError tries to detect whether or not retrying would be fruitful. +func retryOnError(err error) bool { + switch err := err.(type) { + case *os.PathError: + return retryOnError(err.Err) // unpack the target error + case syscall.Errno: + if err == syscall.EPERM { + // EPERM represents an entropy pool exhaustion, a condition under + // which we backoff and retry. + return true + } + } + + return false +} diff --git a/vendor/github.com/containers/storage/drivers/plugin.go b/vendor/github.com/containers/storage/drivers/plugin.go new file mode 100644 index 00000000..a76aae6e --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/plugin.go @@ -0,0 +1,32 @@ +// +build experimental + +package graphdriver + +import ( + "fmt" + "io" + + "github.com/containers/storage/pkg/plugins" +) + +type pluginClient interface { + // Call calls the specified method with the specified arguments for the plugin. + Call(string, interface{}, interface{}) error + // Stream calls the specified method with the specified arguments for the plugin and returns the response IO stream + Stream(string, interface{}) (io.ReadCloser, error) + // SendFile calls the specified method, and passes through the IO stream + SendFile(string, io.Reader, interface{}) error +} + +func lookupPlugin(name, home string, opts []string) (Driver, error) { + pl, err := plugins.Get(name, "GraphDriver") + if err != nil { + return nil, fmt.Errorf("Error looking up graphdriver plugin %s: %v", name, err) + } + return newPluginDriver(name, home, opts, pl.Client()) +} + +func newPluginDriver(name, home string, opts []string, c pluginClient) (Driver, error) { + proxy := &graphDriverProxy{name, c} + return proxy, proxy.Init(home, opts) +} diff --git a/vendor/github.com/containers/storage/drivers/plugin_unsupported.go b/vendor/github.com/containers/storage/drivers/plugin_unsupported.go new file mode 100644 index 00000000..daa7a170 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/plugin_unsupported.go @@ -0,0 +1,7 @@ +// +build !experimental + +package graphdriver + +func lookupPlugin(name, home string, opts []string) (Driver, error) { + return nil, ErrNotSupported +} diff --git a/vendor/github.com/containers/storage/drivers/proxy.go b/vendor/github.com/containers/storage/drivers/proxy.go new file mode 100644 index 00000000..1bab2ef3 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/proxy.go @@ -0,0 +1,225 @@ +// +build experimental + +package graphdriver + +import ( + "errors" + "fmt" + + "github.com/containers/storage/pkg/archive" +) + +type graphDriverProxy struct { + name string + client pluginClient +} + +type graphDriverRequest struct { + ID string `json:",omitempty"` + Parent string `json:",omitempty"` + MountLabel string `json:",omitempty"` +} + +type graphDriverResponse struct { + Err string `json:",omitempty"` + Dir string `json:",omitempty"` + Exists bool `json:",omitempty"` + Status [][2]string `json:",omitempty"` + Changes []archive.Change `json:",omitempty"` + Size int64 `json:",omitempty"` + Metadata map[string]string `json:",omitempty"` +} + +type graphDriverInitRequest struct { + Home string + Opts []string +} + +func (d *graphDriverProxy) Init(home string, opts []string) error { + args := &graphDriverInitRequest{ + Home: home, + Opts: opts, + } + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Init", args, &ret); err != nil { + return err + } + if ret.Err != "" { + return errors.New(ret.Err) + } + return nil +} + +func (d *graphDriverProxy) String() string { + return d.name +} + +func (d *graphDriverProxy) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + args := &graphDriverRequest{ + ID: id, + Parent: parent, + MountLabel: mountLabel, + } + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.CreateReadWrite", args, &ret); err != nil { + return err + } + if ret.Err != "" { + return errors.New(ret.Err) + } + return nil +} + +func (d *graphDriverProxy) Create(id, parent, mountLabel string, storageOpt map[string]string) error { + args := &graphDriverRequest{ + ID: id, + Parent: parent, + MountLabel: mountLabel, + } + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Create", args, &ret); err != nil { + return err + } + if ret.Err != "" { + return errors.New(ret.Err) + } + return nil +} + +func (d *graphDriverProxy) Remove(id string) error { + args := &graphDriverRequest{ID: id} + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Remove", args, &ret); err != nil { + return err + } + if ret.Err != "" { + return errors.New(ret.Err) + } + return nil +} + +func (d *graphDriverProxy) Get(id, mountLabel string) (string, error) { + args := &graphDriverRequest{ + ID: id, + MountLabel: mountLabel, + } + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Get", args, &ret); err != nil { + return "", err + } + var err error + if ret.Err != "" { + err = errors.New(ret.Err) + } + return ret.Dir, err +} + +func (d *graphDriverProxy) Put(id string) error { + args := &graphDriverRequest{ID: id} + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Put", args, &ret); err != nil { + return err + } + if ret.Err != "" { + return errors.New(ret.Err) + } + return nil +} + +func (d *graphDriverProxy) Exists(id string) bool { + args := &graphDriverRequest{ID: id} + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Exists", args, &ret); err != nil { + return false + } + return ret.Exists +} + +func (d *graphDriverProxy) Status() [][2]string { + args := &graphDriverRequest{} + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Status", args, &ret); err != nil { + return nil + } + return ret.Status +} + +func (d *graphDriverProxy) GetMetadata(id string) (map[string]string, error) { + args := &graphDriverRequest{ + ID: id, + } + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.GetMetadata", args, &ret); err != nil { + return nil, err + } + if ret.Err != "" { + return nil, errors.New(ret.Err) + } + return ret.Metadata, nil +} + +func (d *graphDriverProxy) Cleanup() error { + args := &graphDriverRequest{} + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Cleanup", args, &ret); err != nil { + return nil + } + if ret.Err != "" { + return errors.New(ret.Err) + } + return nil +} + +func (d *graphDriverProxy) Diff(id, parent string) (archive.Archive, error) { + args := &graphDriverRequest{ + ID: id, + Parent: parent, + } + body, err := d.client.Stream("GraphDriver.Diff", args) + if err != nil { + return nil, err + } + return archive.Archive(body), nil +} + +func (d *graphDriverProxy) Changes(id, parent string) ([]archive.Change, error) { + args := &graphDriverRequest{ + ID: id, + Parent: parent, + } + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.Changes", args, &ret); err != nil { + return nil, err + } + if ret.Err != "" { + return nil, errors.New(ret.Err) + } + + return ret.Changes, nil +} + +func (d *graphDriverProxy) ApplyDiff(id, parent string, diff archive.Reader) (int64, error) { + var ret graphDriverResponse + if err := d.client.SendFile(fmt.Sprintf("GraphDriver.ApplyDiff?id=%s&parent=%s", id, parent), diff, &ret); err != nil { + return -1, err + } + if ret.Err != "" { + return -1, errors.New(ret.Err) + } + return ret.Size, nil +} + +func (d *graphDriverProxy) DiffSize(id, parent string) (int64, error) { + args := &graphDriverRequest{ + ID: id, + Parent: parent, + } + var ret graphDriverResponse + if err := d.client.Call("GraphDriver.DiffSize", args, &ret); err != nil { + return -1, err + } + if ret.Err != "" { + return -1, errors.New(ret.Err) + } + return ret.Size, nil +} diff --git a/vendor/github.com/containers/storage/drivers/register/register_aufs.go b/vendor/github.com/containers/storage/drivers/register/register_aufs.go new file mode 100644 index 00000000..7743dced --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/register/register_aufs.go @@ -0,0 +1,8 @@ +// +build !exclude_graphdriver_aufs,linux + +package register + +import ( + // register the aufs graphdriver + _ "github.com/containers/storage/drivers/aufs" +) diff --git a/vendor/github.com/containers/storage/drivers/register/register_btrfs.go b/vendor/github.com/containers/storage/drivers/register/register_btrfs.go new file mode 100644 index 00000000..40ff1cdd --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/register/register_btrfs.go @@ -0,0 +1,8 @@ +// +build !exclude_graphdriver_btrfs,linux + +package register + +import ( + // register the btrfs graphdriver + _ "github.com/containers/storage/drivers/btrfs" +) diff --git a/vendor/github.com/containers/storage/drivers/register/register_devicemapper.go b/vendor/github.com/containers/storage/drivers/register/register_devicemapper.go new file mode 100644 index 00000000..08ac984b --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/register/register_devicemapper.go @@ -0,0 +1,8 @@ +// +build !exclude_graphdriver_devicemapper,linux + +package register + +import ( + // register the devmapper graphdriver + _ "github.com/containers/storage/drivers/devmapper" +) diff --git a/vendor/github.com/containers/storage/drivers/register/register_overlay.go b/vendor/github.com/containers/storage/drivers/register/register_overlay.go new file mode 100644 index 00000000..3b6c5f85 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/register/register_overlay.go @@ -0,0 +1,9 @@ +// +build !exclude_graphdriver_overlay,linux + +package register + +import ( + // register the overlay graphdriver + _ "github.com/containers/storage/drivers/overlay" + _ "github.com/containers/storage/drivers/overlay2" +) diff --git a/vendor/github.com/containers/storage/drivers/register/register_vfs.go b/vendor/github.com/containers/storage/drivers/register/register_vfs.go new file mode 100644 index 00000000..691ce859 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/register/register_vfs.go @@ -0,0 +1,6 @@ +package register + +import ( + // register vfs + _ "github.com/containers/storage/drivers/vfs" +) diff --git a/vendor/github.com/containers/storage/drivers/register/register_windows.go b/vendor/github.com/containers/storage/drivers/register/register_windows.go new file mode 100644 index 00000000..048b2709 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/register/register_windows.go @@ -0,0 +1,6 @@ +package register + +import ( + // register the windows graph driver + _ "github.com/containers/storage/drivers/windows" +) diff --git a/vendor/github.com/containers/storage/drivers/register/register_zfs.go b/vendor/github.com/containers/storage/drivers/register/register_zfs.go new file mode 100644 index 00000000..c748468e --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/register/register_zfs.go @@ -0,0 +1,8 @@ +// +build !exclude_graphdriver_zfs,linux !exclude_graphdriver_zfs,freebsd, solaris + +package register + +import ( + // register the zfs driver + _ "github.com/containers/storage/drivers/zfs" +) diff --git a/vendor/github.com/containers/storage/drivers/vfs/driver.go b/vendor/github.com/containers/storage/drivers/vfs/driver.go new file mode 100644 index 00000000..36a975e3 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/vfs/driver.go @@ -0,0 +1,145 @@ +package vfs + +import ( + "fmt" + "os" + "path/filepath" + + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/chrootarchive" + "github.com/containers/storage/pkg/idtools" + + "github.com/opencontainers/runc/libcontainer/label" +) + +var ( + // CopyWithTar defines the copy method to use. + CopyWithTar = chrootarchive.CopyWithTar +) + +func init() { + graphdriver.Register("vfs", Init) +} + +// Init returns a new VFS driver. +// This sets the home directory for the driver and returns NaiveDiffDriver. +func Init(home string, options []string, uidMaps, gidMaps []idtools.IDMap) (graphdriver.Driver, error) { + d := &Driver{ + home: home, + uidMaps: uidMaps, + gidMaps: gidMaps, + } + rootUID, rootGID, err := idtools.GetRootUIDGID(uidMaps, gidMaps) + if err != nil { + return nil, err + } + if err := idtools.MkdirAllAs(home, 0700, rootUID, rootGID); err != nil { + return nil, err + } + return graphdriver.NewNaiveDiffDriver(d, uidMaps, gidMaps), nil +} + +// Driver holds information about the driver, home directory of the driver. +// Driver implements graphdriver.ProtoDriver. It uses only basic vfs operations. +// In order to support layering, files are copied from the parent layer into the new layer. There is no copy-on-write support. +// Driver must be wrapped in NaiveDiffDriver to be used as a graphdriver.Driver +type Driver struct { + home string + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap +} + +func (d *Driver) String() string { + return "vfs" +} + +// Status is used for implementing the graphdriver.ProtoDriver interface. VFS does not currently have any status information. +func (d *Driver) Status() [][2]string { + return nil +} + +// GetMetadata is used for implementing the graphdriver.ProtoDriver interface. VFS does not currently have any meta data. +func (d *Driver) GetMetadata(id string) (map[string]string, error) { + return nil, nil +} + +// Cleanup is used to implement graphdriver.ProtoDriver. There is no cleanup required for this driver. +func (d *Driver) Cleanup() error { + return nil +} + +// CreateReadWrite creates a layer that is writable for use as a container +// file system. +func (d *Driver) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + return d.Create(id, parent, mountLabel, storageOpt) +} + +// Create prepares the filesystem for the VFS driver and copies the directory for the given id under the parent. +func (d *Driver) Create(id, parent, mountLabel string, storageOpt map[string]string) error { + if len(storageOpt) != 0 { + return fmt.Errorf("--storage-opt is not supported for vfs") + } + + dir := d.dir(id) + rootUID, rootGID, err := idtools.GetRootUIDGID(d.uidMaps, d.gidMaps) + if err != nil { + return err + } + if err := idtools.MkdirAllAs(filepath.Dir(dir), 0700, rootUID, rootGID); err != nil { + return err + } + if err := idtools.MkdirAs(dir, 0755, rootUID, rootGID); err != nil { + return err + } + opts := []string{"level:s0"} + if _, mountLabel, err := label.InitLabels(opts); err == nil { + label.SetFileLabel(dir, mountLabel) + } + if parent == "" { + return nil + } + parentDir, err := d.Get(parent, "") + if err != nil { + return fmt.Errorf("%s: %s", parent, err) + } + if err := CopyWithTar(parentDir, dir); err != nil { + return err + } + return nil +} + +func (d *Driver) dir(id string) string { + return filepath.Join(d.home, "dir", filepath.Base(id)) +} + +// Remove deletes the content from the directory for a given id. +func (d *Driver) Remove(id string) error { + if err := os.RemoveAll(d.dir(id)); err != nil && !os.IsNotExist(err) { + return err + } + return nil +} + +// Get returns the directory for the given id. +func (d *Driver) Get(id, mountLabel string) (string, error) { + dir := d.dir(id) + if st, err := os.Stat(dir); err != nil { + return "", err + } else if !st.IsDir() { + return "", fmt.Errorf("%s: not a directory", dir) + } + return dir, nil +} + +// Put is a noop for vfs that return nil for the error, since this driver has no runtime resources to clean up. +func (d *Driver) Put(id string) error { + // The vfs driver has no runtime resources (e.g. mounts) + // to clean up, so we don't need anything here + return nil +} + +// Exists checks to see if the directory exists for the given id. +func (d *Driver) Exists(id string) bool { + _, err := os.Stat(d.dir(id)) + return err == nil +} diff --git a/vendor/github.com/containers/storage/drivers/windows/windows.go b/vendor/github.com/containers/storage/drivers/windows/windows.go new file mode 100644 index 00000000..018437fc --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/windows/windows.go @@ -0,0 +1,779 @@ +//+build windows + +package windows + +import ( + "bufio" + "bytes" + "encoding/json" + "fmt" + "io" + "io/ioutil" + "os" + "path" + "path/filepath" + "strconv" + "strings" + "sync" + "syscall" + "unsafe" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/go-winio/archive/tar" + "github.com/Microsoft/go-winio/backuptar" + "github.com/Microsoft/hcsshim" + "github.com/Sirupsen/logrus" + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/ioutils" + "github.com/containers/storage/pkg/longpath" + "github.com/containers/storage/pkg/reexec" + "github.com/containers/storage/pkg/system" + "github.com/vbatts/tar-split/tar/storage" +) + +// filterDriver is an HCSShim driver type for the Windows Filter driver. +const filterDriver = 1 + +// init registers the windows graph drivers to the register. +func init() { + graphdriver.Register("windowsfilter", InitFilter) + reexec.Register("docker-windows-write-layer", writeLayer) +} + +type checker struct { +} + +func (c *checker) IsMounted(path string) bool { + return false +} + +// Driver represents a windows graph driver. +type Driver struct { + // info stores the shim driver information + info hcsshim.DriverInfo + ctr *graphdriver.RefCounter + // it is safe for windows to use a cache here because it does not support + // restoring containers when the daemon dies. + cacheMu sync.Mutex + cache map[string]string +} + +func isTP5OrOlder() bool { + return system.GetOSVersion().Build <= 14300 +} + +// InitFilter returns a new Windows storage filter driver. +func InitFilter(home string, options []string, uidMaps, gidMaps []idtools.IDMap) (graphdriver.Driver, error) { + logrus.Debugf("WindowsGraphDriver InitFilter at %s", home) + d := &Driver{ + info: hcsshim.DriverInfo{ + HomeDir: home, + Flavour: filterDriver, + }, + cache: make(map[string]string), + ctr: graphdriver.NewRefCounter(&checker{}), + } + return d, nil +} + +// String returns the string representation of a driver. This should match +// the name the graph driver has been registered with. +func (d *Driver) String() string { + return "windowsfilter" +} + +// Status returns the status of the driver. +func (d *Driver) Status() [][2]string { + return [][2]string{ + {"Windows", ""}, + } +} + +// Exists returns true if the given id is registered with this driver. +func (d *Driver) Exists(id string) bool { + rID, err := d.resolveID(id) + if err != nil { + return false + } + result, err := hcsshim.LayerExists(d.info, rID) + if err != nil { + return false + } + return result +} + +// CreateReadWrite creates a layer that is writable for use as a container +// file system. +func (d *Driver) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + return d.create(id, parent, mountLabel, false, storageOpt) +} + +// Create creates a new read-only layer with the given id. +func (d *Driver) Create(id, parent, mountLabel string, storageOpt map[string]string) error { + return d.create(id, parent, mountLabel, true, storageOpt) +} + +func (d *Driver) create(id, parent, mountLabel string, readOnly bool, storageOpt map[string]string) error { + if len(storageOpt) != 0 { + return fmt.Errorf("--storage-opt is not supported for windows") + } + + rPId, err := d.resolveID(parent) + if err != nil { + return err + } + + parentChain, err := d.getLayerChain(rPId) + if err != nil { + return err + } + + var layerChain []string + + if rPId != "" { + parentPath, err := hcsshim.GetLayerMountPath(d.info, rPId) + if err != nil { + return err + } + if _, err := os.Stat(filepath.Join(parentPath, "Files")); err == nil { + // This is a legitimate parent layer (not the empty "-init" layer), + // so include it in the layer chain. + layerChain = []string{parentPath} + } + } + + layerChain = append(layerChain, parentChain...) + + if readOnly { + if err := hcsshim.CreateLayer(d.info, id, rPId); err != nil { + return err + } + } else { + var parentPath string + if len(layerChain) != 0 { + parentPath = layerChain[0] + } + + if isTP5OrOlder() { + // Pre-create the layer directory, providing an ACL to give the Hyper-V Virtual Machines + // group access. This is necessary to ensure that Hyper-V containers can access the + // virtual machine data. This is not necessary post-TP5. + path, err := syscall.UTF16FromString(filepath.Join(d.info.HomeDir, id)) + if err != nil { + return err + } + // Give system and administrators full control, and VMs read, write, and execute. + // Mark these ACEs as inherited. + sd, err := winio.SddlToSecurityDescriptor("D:(A;OICI;FA;;;SY)(A;OICI;FA;;;BA)(A;OICI;FRFWFX;;;S-1-5-83-0)") + if err != nil { + return err + } + err = syscall.CreateDirectory(&path[0], &syscall.SecurityAttributes{ + Length: uint32(unsafe.Sizeof(syscall.SecurityAttributes{})), + SecurityDescriptor: uintptr(unsafe.Pointer(&sd[0])), + }) + if err != nil { + return err + } + } + + if err := hcsshim.CreateSandboxLayer(d.info, id, parentPath, layerChain); err != nil { + return err + } + } + + if _, err := os.Lstat(d.dir(parent)); err != nil { + if err2 := hcsshim.DestroyLayer(d.info, id); err2 != nil { + logrus.Warnf("Failed to DestroyLayer %s: %s", id, err2) + } + return fmt.Errorf("Cannot create layer with missing parent %s: %s", parent, err) + } + + if err := d.setLayerChain(id, layerChain); err != nil { + if err2 := hcsshim.DestroyLayer(d.info, id); err2 != nil { + logrus.Warnf("Failed to DestroyLayer %s: %s", id, err2) + } + return err + } + + return nil +} + +// dir returns the absolute path to the layer. +func (d *Driver) dir(id string) string { + return filepath.Join(d.info.HomeDir, filepath.Base(id)) +} + +// Remove unmounts and removes the dir information. +func (d *Driver) Remove(id string) error { + rID, err := d.resolveID(id) + if err != nil { + return err + } + os.RemoveAll(filepath.Join(d.info.HomeDir, "sysfile-backups", rID)) // ok to fail + return hcsshim.DestroyLayer(d.info, rID) +} + +// Get returns the rootfs path for the id. This will mount the dir at it's given path. +func (d *Driver) Get(id, mountLabel string) (string, error) { + logrus.Debugf("WindowsGraphDriver Get() id %s mountLabel %s", id, mountLabel) + var dir string + + rID, err := d.resolveID(id) + if err != nil { + return "", err + } + if count := d.ctr.Increment(rID); count > 1 { + return d.cache[rID], nil + } + + // Getting the layer paths must be done outside of the lock. + layerChain, err := d.getLayerChain(rID) + if err != nil { + d.ctr.Decrement(rID) + return "", err + } + + if err := hcsshim.ActivateLayer(d.info, rID); err != nil { + d.ctr.Decrement(rID) + return "", err + } + if err := hcsshim.PrepareLayer(d.info, rID, layerChain); err != nil { + d.ctr.Decrement(rID) + if err2 := hcsshim.DeactivateLayer(d.info, rID); err2 != nil { + logrus.Warnf("Failed to Deactivate %s: %s", id, err) + } + return "", err + } + + mountPath, err := hcsshim.GetLayerMountPath(d.info, rID) + if err != nil { + d.ctr.Decrement(rID) + if err2 := hcsshim.DeactivateLayer(d.info, rID); err2 != nil { + logrus.Warnf("Failed to Deactivate %s: %s", id, err) + } + return "", err + } + d.cacheMu.Lock() + d.cache[rID] = mountPath + d.cacheMu.Unlock() + + // If the layer has a mount path, use that. Otherwise, use the + // folder path. + if mountPath != "" { + dir = mountPath + } else { + dir = d.dir(id) + } + + return dir, nil +} + +// Put adds a new layer to the driver. +func (d *Driver) Put(id string) error { + logrus.Debugf("WindowsGraphDriver Put() id %s", id) + + rID, err := d.resolveID(id) + if err != nil { + return err + } + if count := d.ctr.Decrement(rID); count > 0 { + return nil + } + d.cacheMu.Lock() + delete(d.cache, rID) + d.cacheMu.Unlock() + + if err := hcsshim.UnprepareLayer(d.info, rID); err != nil { + return err + } + return hcsshim.DeactivateLayer(d.info, rID) +} + +// Cleanup ensures the information the driver stores is properly removed. +func (d *Driver) Cleanup() error { + return nil +} + +// Diff produces an archive of the changes between the specified +// layer and its parent layer which may be "". +// The layer should be mounted when calling this function +func (d *Driver) Diff(id, parent string) (_ archive.Archive, err error) { + rID, err := d.resolveID(id) + if err != nil { + return + } + + layerChain, err := d.getLayerChain(rID) + if err != nil { + return + } + + // this is assuming that the layer is unmounted + if err := hcsshim.UnprepareLayer(d.info, rID); err != nil { + return nil, err + } + prepare := func() { + if err := hcsshim.PrepareLayer(d.info, rID, layerChain); err != nil { + logrus.Warnf("Failed to Deactivate %s: %s", rID, err) + } + } + + arch, err := d.exportLayer(rID, layerChain) + if err != nil { + prepare() + return + } + return ioutils.NewReadCloserWrapper(arch, func() error { + err := arch.Close() + prepare() + return err + }), nil +} + +// Changes produces a list of changes between the specified layer +// and its parent layer. If parent is "", then all changes will be ADD changes. +// The layer should be mounted when calling this function +func (d *Driver) Changes(id, parent string) ([]archive.Change, error) { + rID, err := d.resolveID(id) + if err != nil { + return nil, err + } + parentChain, err := d.getLayerChain(rID) + if err != nil { + return nil, err + } + + // this is assuming that the layer is unmounted + if err := hcsshim.UnprepareLayer(d.info, rID); err != nil { + return nil, err + } + defer func() { + if err := hcsshim.PrepareLayer(d.info, rID, parentChain); err != nil { + logrus.Warnf("Failed to Deactivate %s: %s", rID, err) + } + }() + + var changes []archive.Change + err = winio.RunWithPrivilege(winio.SeBackupPrivilege, func() error { + r, err := hcsshim.NewLayerReader(d.info, id, parentChain) + if err != nil { + return err + } + defer r.Close() + + for { + name, _, fileInfo, err := r.Next() + if err == io.EOF { + return nil + } + if err != nil { + return err + } + name = filepath.ToSlash(name) + if fileInfo == nil { + changes = append(changes, archive.Change{Path: name, Kind: archive.ChangeDelete}) + } else { + // Currently there is no way to tell between an add and a modify. + changes = append(changes, archive.Change{Path: name, Kind: archive.ChangeModify}) + } + } + }) + if err != nil { + return nil, err + } + + return changes, nil +} + +// ApplyDiff extracts the changeset from the given diff into the +// layer with the specified id and parent, returning the size of the +// new layer in bytes. +// The layer should not be mounted when calling this function +func (d *Driver) ApplyDiff(id, parent string, diff archive.Reader) (int64, error) { + var layerChain []string + if parent != "" { + rPId, err := d.resolveID(parent) + if err != nil { + return 0, err + } + parentChain, err := d.getLayerChain(rPId) + if err != nil { + return 0, err + } + parentPath, err := hcsshim.GetLayerMountPath(d.info, rPId) + if err != nil { + return 0, err + } + layerChain = append(layerChain, parentPath) + layerChain = append(layerChain, parentChain...) + } + + size, err := d.importLayer(id, diff, layerChain) + if err != nil { + return 0, err + } + + if err = d.setLayerChain(id, layerChain); err != nil { + return 0, err + } + + return size, nil +} + +// DiffSize calculates the changes between the specified layer +// and its parent and returns the size in bytes of the changes +// relative to its base filesystem directory. +func (d *Driver) DiffSize(id, parent string) (size int64, err error) { + rPId, err := d.resolveID(parent) + if err != nil { + return + } + + changes, err := d.Changes(id, rPId) + if err != nil { + return + } + + layerFs, err := d.Get(id, "") + if err != nil { + return + } + defer d.Put(id) + + return archive.ChangesSize(layerFs, changes), nil +} + +// GetMetadata returns custom driver information. +func (d *Driver) GetMetadata(id string) (map[string]string, error) { + m := make(map[string]string) + m["dir"] = d.dir(id) + return m, nil +} + +func writeTarFromLayer(r hcsshim.LayerReader, w io.Writer) error { + t := tar.NewWriter(w) + for { + name, size, fileInfo, err := r.Next() + if err == io.EOF { + break + } + if err != nil { + return err + } + if fileInfo == nil { + // Write a whiteout file. + hdr := &tar.Header{ + Name: filepath.ToSlash(filepath.Join(filepath.Dir(name), archive.WhiteoutPrefix+filepath.Base(name))), + } + err := t.WriteHeader(hdr) + if err != nil { + return err + } + } else { + err = backuptar.WriteTarFileFromBackupStream(t, r, name, size, fileInfo) + if err != nil { + return err + } + } + } + return t.Close() +} + +// exportLayer generates an archive from a layer based on the given ID. +func (d *Driver) exportLayer(id string, parentLayerPaths []string) (archive.Archive, error) { + archive, w := io.Pipe() + go func() { + err := winio.RunWithPrivilege(winio.SeBackupPrivilege, func() error { + r, err := hcsshim.NewLayerReader(d.info, id, parentLayerPaths) + if err != nil { + return err + } + + err = writeTarFromLayer(r, w) + cerr := r.Close() + if err == nil { + err = cerr + } + return err + }) + w.CloseWithError(err) + }() + + return archive, nil +} + +func writeLayerFromTar(r archive.Reader, w hcsshim.LayerWriter) (int64, error) { + t := tar.NewReader(r) + hdr, err := t.Next() + totalSize := int64(0) + buf := bufio.NewWriter(nil) + for err == nil { + base := path.Base(hdr.Name) + if strings.HasPrefix(base, archive.WhiteoutPrefix) { + name := path.Join(path.Dir(hdr.Name), base[len(archive.WhiteoutPrefix):]) + err = w.Remove(filepath.FromSlash(name)) + if err != nil { + return 0, err + } + hdr, err = t.Next() + } else if hdr.Typeflag == tar.TypeLink { + err = w.AddLink(filepath.FromSlash(hdr.Name), filepath.FromSlash(hdr.Linkname)) + if err != nil { + return 0, err + } + hdr, err = t.Next() + } else { + var ( + name string + size int64 + fileInfo *winio.FileBasicInfo + ) + name, size, fileInfo, err = backuptar.FileInfoFromHeader(hdr) + if err != nil { + return 0, err + } + err = w.Add(filepath.FromSlash(name), fileInfo) + if err != nil { + return 0, err + } + buf.Reset(w) + + // Add the Hyper-V Virtual Machine group ACE to the security descriptor + // for TP5 so that Xenons can access all files. This is not necessary + // for post-TP5 builds. + if isTP5OrOlder() { + if sddl, ok := hdr.Winheaders["sd"]; ok { + var ace string + if hdr.Typeflag == tar.TypeDir { + ace = "(A;OICI;0x1200a9;;;S-1-5-83-0)" + } else { + ace = "(A;;0x1200a9;;;S-1-5-83-0)" + } + if hdr.Winheaders["sd"], ok = addAceToSddlDacl(sddl, ace); !ok { + logrus.Debugf("failed to add VM ACE to %s", sddl) + } + } + } + + hdr, err = backuptar.WriteBackupStreamFromTarFile(buf, t, hdr) + ferr := buf.Flush() + if ferr != nil { + err = ferr + } + totalSize += size + } + } + if err != io.EOF { + return 0, err + } + return totalSize, nil +} + +func addAceToSddlDacl(sddl, ace string) (string, bool) { + daclStart := strings.Index(sddl, "D:") + if daclStart < 0 { + return sddl, false + } + + dacl := sddl[daclStart:] + daclEnd := strings.Index(dacl, "S:") + if daclEnd < 0 { + daclEnd = len(dacl) + } + dacl = dacl[:daclEnd] + + if strings.Contains(dacl, ace) { + return sddl, true + } + + i := 2 + for i+1 < len(dacl) { + if dacl[i] != '(' { + return sddl, false + } + + if dacl[i+1] == 'A' { + break + } + + i += 2 + for p := 1; i < len(dacl) && p > 0; i++ { + if dacl[i] == '(' { + p++ + } else if dacl[i] == ')' { + p-- + } + } + } + + return sddl[:daclStart+i] + ace + sddl[daclStart+i:], true +} + +// importLayer adds a new layer to the tag and graph store based on the given data. +func (d *Driver) importLayer(id string, layerData archive.Reader, parentLayerPaths []string) (size int64, err error) { + cmd := reexec.Command(append([]string{"docker-windows-write-layer", d.info.HomeDir, id}, parentLayerPaths...)...) + output := bytes.NewBuffer(nil) + cmd.Stdin = layerData + cmd.Stdout = output + cmd.Stderr = output + + if err = cmd.Start(); err != nil { + return + } + + if err = cmd.Wait(); err != nil { + return 0, fmt.Errorf("re-exec error: %v: output: %s", err, output) + } + + return strconv.ParseInt(output.String(), 10, 64) +} + +// writeLayer is the re-exec entry point for writing a layer from a tar file +func writeLayer() { + home := os.Args[1] + id := os.Args[2] + parentLayerPaths := os.Args[3:] + + err := func() error { + err := winio.EnableProcessPrivileges([]string{winio.SeBackupPrivilege, winio.SeRestorePrivilege}) + if err != nil { + return err + } + + info := hcsshim.DriverInfo{ + Flavour: filterDriver, + HomeDir: home, + } + + w, err := hcsshim.NewLayerWriter(info, id, parentLayerPaths) + if err != nil { + return err + } + + size, err := writeLayerFromTar(os.Stdin, w) + if err != nil { + return err + } + + err = w.Close() + if err != nil { + return err + } + + fmt.Fprint(os.Stdout, size) + return nil + }() + + if err != nil { + fmt.Fprint(os.Stderr, err) + os.Exit(1) + } +} + +// resolveID computes the layerID information based on the given id. +func (d *Driver) resolveID(id string) (string, error) { + content, err := ioutil.ReadFile(filepath.Join(d.dir(id), "layerID")) + if os.IsNotExist(err) { + return id, nil + } else if err != nil { + return "", err + } + return string(content), nil +} + +// setID stores the layerId in disk. +func (d *Driver) setID(id, altID string) error { + err := ioutil.WriteFile(filepath.Join(d.dir(id), "layerId"), []byte(altID), 0600) + if err != nil { + return err + } + return nil +} + +// getLayerChain returns the layer chain information. +func (d *Driver) getLayerChain(id string) ([]string, error) { + jPath := filepath.Join(d.dir(id), "layerchain.json") + content, err := ioutil.ReadFile(jPath) + if os.IsNotExist(err) { + return nil, nil + } else if err != nil { + return nil, fmt.Errorf("Unable to read layerchain file - %s", err) + } + + var layerChain []string + err = json.Unmarshal(content, &layerChain) + if err != nil { + return nil, fmt.Errorf("Failed to unmarshall layerchain json - %s", err) + } + + return layerChain, nil +} + +// setLayerChain stores the layer chain information in disk. +func (d *Driver) setLayerChain(id string, chain []string) error { + content, err := json.Marshal(&chain) + if err != nil { + return fmt.Errorf("Failed to marshall layerchain json - %s", err) + } + + jPath := filepath.Join(d.dir(id), "layerchain.json") + err = ioutil.WriteFile(jPath, content, 0600) + if err != nil { + return fmt.Errorf("Unable to write layerchain file - %s", err) + } + + return nil +} + +type fileGetCloserWithBackupPrivileges struct { + path string +} + +func (fg *fileGetCloserWithBackupPrivileges) Get(filename string) (io.ReadCloser, error) { + var f *os.File + // Open the file while holding the Windows backup privilege. This ensures that the + // file can be opened even if the caller does not actually have access to it according + // to the security descriptor. + err := winio.RunWithPrivilege(winio.SeBackupPrivilege, func() error { + path := longpath.AddPrefix(filepath.Join(fg.path, filename)) + p, err := syscall.UTF16FromString(path) + if err != nil { + return err + } + h, err := syscall.CreateFile(&p[0], syscall.GENERIC_READ, syscall.FILE_SHARE_READ, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_BACKUP_SEMANTICS, 0) + if err != nil { + return &os.PathError{Op: "open", Path: path, Err: err} + } + f = os.NewFile(uintptr(h), path) + return nil + }) + return f, err +} + +func (fg *fileGetCloserWithBackupPrivileges) Close() error { + return nil +} + +type fileGetDestroyCloser struct { + storage.FileGetter + path string +} + +func (f *fileGetDestroyCloser) Close() error { + // TODO: activate layers and release here? + return os.RemoveAll(f.path) +} + +// DiffGetter returns a FileGetCloser that can read files from the directory that +// contains files for the layer differences. Used for direct access for tar-split. +func (d *Driver) DiffGetter(id string) (graphdriver.FileGetCloser, error) { + id, err := d.resolveID(id) + if err != nil { + return nil, err + } + + return &fileGetCloserWithBackupPrivileges{d.dir(id)}, nil +} diff --git a/vendor/github.com/containers/storage/drivers/zfs/zfs.go b/vendor/github.com/containers/storage/drivers/zfs/zfs.go new file mode 100644 index 00000000..16426337 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/zfs/zfs.go @@ -0,0 +1,405 @@ +// +build linux freebsd solaris + +package zfs + +import ( + "fmt" + "os" + "os/exec" + "path" + "strconv" + "strings" + "sync" + "syscall" + "time" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/mount" + "github.com/containers/storage/pkg/parsers" + zfs "github.com/mistifyio/go-zfs" + "github.com/opencontainers/runc/libcontainer/label" +) + +type zfsOptions struct { + fsName string + mountPath string +} + +func init() { + graphdriver.Register("zfs", Init) +} + +// Logger returns a zfs logger implementation. +type Logger struct{} + +// Log wraps log message from ZFS driver with a prefix '[zfs]'. +func (*Logger) Log(cmd []string) { + logrus.Debugf("[zfs] %s", strings.Join(cmd, " ")) +} + +// Init returns a new ZFS driver. +// It takes base mount path and an array of options which are represented as key value pairs. +// Each option is in the for key=value. 'zfs.fsname' is expected to be a valid key in the options. +func Init(base string, opt []string, uidMaps, gidMaps []idtools.IDMap) (graphdriver.Driver, error) { + var err error + + if _, err := exec.LookPath("zfs"); err != nil { + logrus.Debugf("[zfs] zfs command is not available: %v", err) + return nil, graphdriver.ErrPrerequisites + } + + file, err := os.OpenFile("/dev/zfs", os.O_RDWR, 600) + if err != nil { + logrus.Debugf("[zfs] cannot open /dev/zfs: %v", err) + return nil, graphdriver.ErrPrerequisites + } + defer file.Close() + + options, err := parseOptions(opt) + if err != nil { + return nil, err + } + options.mountPath = base + + rootdir := path.Dir(base) + + if options.fsName == "" { + err = checkRootdirFs(rootdir) + if err != nil { + return nil, err + } + } + + if options.fsName == "" { + options.fsName, err = lookupZfsDataset(rootdir) + if err != nil { + return nil, err + } + } + + zfs.SetLogger(new(Logger)) + + filesystems, err := zfs.Filesystems(options.fsName) + if err != nil { + return nil, fmt.Errorf("Cannot find root filesystem %s: %v", options.fsName, err) + } + + filesystemsCache := make(map[string]bool, len(filesystems)) + var rootDataset *zfs.Dataset + for _, fs := range filesystems { + if fs.Name == options.fsName { + rootDataset = fs + } + filesystemsCache[fs.Name] = true + } + + if rootDataset == nil { + return nil, fmt.Errorf("BUG: zfs get all -t filesystem -rHp '%s' should contain '%s'", options.fsName, options.fsName) + } + + if err := mount.MakePrivate(base); err != nil { + return nil, err + } + d := &Driver{ + dataset: rootDataset, + options: options, + filesystemsCache: filesystemsCache, + uidMaps: uidMaps, + gidMaps: gidMaps, + ctr: graphdriver.NewRefCounter(graphdriver.NewDefaultChecker()), + } + return graphdriver.NewNaiveDiffDriver(d, uidMaps, gidMaps), nil +} + +func parseOptions(opt []string) (zfsOptions, error) { + var options zfsOptions + options.fsName = "" + for _, option := range opt { + key, val, err := parsers.ParseKeyValueOpt(option) + if err != nil { + return options, err + } + key = strings.ToLower(key) + switch key { + case "zfs.fsname": + options.fsName = val + default: + return options, fmt.Errorf("Unknown option %s", key) + } + } + return options, nil +} + +func lookupZfsDataset(rootdir string) (string, error) { + var stat syscall.Stat_t + if err := syscall.Stat(rootdir, &stat); err != nil { + return "", fmt.Errorf("Failed to access '%s': %s", rootdir, err) + } + wantedDev := stat.Dev + + mounts, err := mount.GetMounts() + if err != nil { + return "", err + } + for _, m := range mounts { + if err := syscall.Stat(m.Mountpoint, &stat); err != nil { + logrus.Debugf("[zfs] failed to stat '%s' while scanning for zfs mount: %v", m.Mountpoint, err) + continue // may fail on fuse file systems + } + + if stat.Dev == wantedDev && m.Fstype == "zfs" { + return m.Source, nil + } + } + + return "", fmt.Errorf("Failed to find zfs dataset mounted on '%s' in /proc/mounts", rootdir) +} + +// Driver holds information about the driver, such as zfs dataset, options and cache. +type Driver struct { + dataset *zfs.Dataset + options zfsOptions + sync.Mutex // protects filesystem cache against concurrent access + filesystemsCache map[string]bool + uidMaps []idtools.IDMap + gidMaps []idtools.IDMap + ctr *graphdriver.RefCounter +} + +func (d *Driver) String() string { + return "zfs" +} + +// Cleanup is used to implement graphdriver.ProtoDriver. There is no cleanup required for this driver. +func (d *Driver) Cleanup() error { + return nil +} + +// Status returns information about the ZFS filesystem. It returns a two dimensional array of information +// such as pool name, dataset name, disk usage, parent quota and compression used. +// Currently it return 'Zpool', 'Zpool Health', 'Parent Dataset', 'Space Used By Parent', +// 'Space Available', 'Parent Quota' and 'Compression'. +func (d *Driver) Status() [][2]string { + parts := strings.Split(d.dataset.Name, "/") + pool, err := zfs.GetZpool(parts[0]) + + var poolName, poolHealth string + if err == nil { + poolName = pool.Name + poolHealth = pool.Health + } else { + poolName = fmt.Sprintf("error while getting pool information %v", err) + poolHealth = "not available" + } + + quota := "no" + if d.dataset.Quota != 0 { + quota = strconv.FormatUint(d.dataset.Quota, 10) + } + + return [][2]string{ + {"Zpool", poolName}, + {"Zpool Health", poolHealth}, + {"Parent Dataset", d.dataset.Name}, + {"Space Used By Parent", strconv.FormatUint(d.dataset.Used, 10)}, + {"Space Available", strconv.FormatUint(d.dataset.Avail, 10)}, + {"Parent Quota", quota}, + {"Compression", d.dataset.Compression}, + } +} + +// GetMetadata returns image/container metadata related to graph driver +func (d *Driver) GetMetadata(id string) (map[string]string, error) { + return nil, nil +} + +func (d *Driver) cloneFilesystem(name, parentName string) error { + snapshotName := fmt.Sprintf("%d", time.Now().Nanosecond()) + parentDataset := zfs.Dataset{Name: parentName} + snapshot, err := parentDataset.Snapshot(snapshotName /*recursive */, false) + if err != nil { + return err + } + + _, err = snapshot.Clone(name, map[string]string{"mountpoint": "legacy"}) + if err == nil { + d.Lock() + d.filesystemsCache[name] = true + d.Unlock() + } + + if err != nil { + snapshot.Destroy(zfs.DestroyDeferDeletion) + return err + } + return snapshot.Destroy(zfs.DestroyDeferDeletion) +} + +func (d *Driver) zfsPath(id string) string { + return d.options.fsName + "/" + id +} + +func (d *Driver) mountPath(id string) string { + return path.Join(d.options.mountPath, "graph", getMountpoint(id)) +} + +// CreateReadWrite creates a layer that is writable for use as a container +// file system. +func (d *Driver) CreateReadWrite(id, parent, mountLabel string, storageOpt map[string]string) error { + return d.Create(id, parent, mountLabel, storageOpt) +} + +// Create prepares the dataset and filesystem for the ZFS driver for the given id under the parent. +func (d *Driver) Create(id string, parent string, mountLabel string, storageOpt map[string]string) error { + err := d.create(id, parent, storageOpt) + if err == nil { + return nil + } + if zfsError, ok := err.(*zfs.Error); ok { + if !strings.HasSuffix(zfsError.Stderr, "dataset already exists\n") { + return err + } + // aborted build -> cleanup + } else { + return err + } + + dataset := zfs.Dataset{Name: d.zfsPath(id)} + if err := dataset.Destroy(zfs.DestroyRecursiveClones); err != nil { + return err + } + + // retry + return d.create(id, parent, storageOpt) +} + +func (d *Driver) create(id, parent string, storageOpt map[string]string) error { + name := d.zfsPath(id) + quota, err := parseStorageOpt(storageOpt) + if err != nil { + return err + } + if parent == "" { + mountoptions := map[string]string{"mountpoint": "legacy"} + fs, err := zfs.CreateFilesystem(name, mountoptions) + if err == nil { + err = setQuota(name, quota) + if err == nil { + d.Lock() + d.filesystemsCache[fs.Name] = true + d.Unlock() + } + } + return err + } + err = d.cloneFilesystem(name, d.zfsPath(parent)) + if err == nil { + err = setQuota(name, quota) + } + return err +} + +func parseStorageOpt(storageOpt map[string]string) (string, error) { + // Read size to change the disk quota per container + for k, v := range storageOpt { + key := strings.ToLower(k) + switch key { + case "size": + return v, nil + default: + return "0", fmt.Errorf("Unknown option %s", key) + } + } + return "0", nil +} + +func setQuota(name string, quota string) error { + if quota == "0" { + return nil + } + fs, err := zfs.GetDataset(name) + if err != nil { + return err + } + return fs.SetProperty("quota", quota) +} + +// Remove deletes the dataset, filesystem and the cache for the given id. +func (d *Driver) Remove(id string) error { + name := d.zfsPath(id) + dataset := zfs.Dataset{Name: name} + err := dataset.Destroy(zfs.DestroyRecursive) + if err == nil { + d.Lock() + delete(d.filesystemsCache, name) + d.Unlock() + } + return err +} + +// Get returns the mountpoint for the given id after creating the target directories if necessary. +func (d *Driver) Get(id, mountLabel string) (string, error) { + mountpoint := d.mountPath(id) + if count := d.ctr.Increment(mountpoint); count > 1 { + return mountpoint, nil + } + + filesystem := d.zfsPath(id) + options := label.FormatMountLabel("", mountLabel) + logrus.Debugf(`[zfs] mount("%s", "%s", "%s")`, filesystem, mountpoint, options) + + rootUID, rootGID, err := idtools.GetRootUIDGID(d.uidMaps, d.gidMaps) + if err != nil { + d.ctr.Decrement(mountpoint) + return "", err + } + // Create the target directories if they don't exist + if err := idtools.MkdirAllAs(mountpoint, 0755, rootUID, rootGID); err != nil { + d.ctr.Decrement(mountpoint) + return "", err + } + + if err := mount.Mount(filesystem, mountpoint, "zfs", options); err != nil { + d.ctr.Decrement(mountpoint) + return "", fmt.Errorf("error creating zfs mount of %s to %s: %v", filesystem, mountpoint, err) + } + + // this could be our first mount after creation of the filesystem, and the root dir may still have root + // permissions instead of the remapped root uid:gid (if user namespaces are enabled): + if err := os.Chown(mountpoint, rootUID, rootGID); err != nil { + mount.Unmount(mountpoint) + d.ctr.Decrement(mountpoint) + return "", fmt.Errorf("error modifying zfs mountpoint (%s) directory ownership: %v", mountpoint, err) + } + + return mountpoint, nil +} + +// Put removes the existing mountpoint for the given id if it exists. +func (d *Driver) Put(id string) error { + mountpoint := d.mountPath(id) + if count := d.ctr.Decrement(mountpoint); count > 0 { + return nil + } + mounted, err := graphdriver.Mounted(graphdriver.FsMagicZfs, mountpoint) + if err != nil || !mounted { + return err + } + + logrus.Debugf(`[zfs] unmount("%s")`, mountpoint) + + err = mount.Unmount(mountpoint) + if err != nil { + return fmt.Errorf("error unmounting to %s: %v", mountpoint, err) + } + return err +} + +// Exists checks to see if the cache entry exists for the given id. +func (d *Driver) Exists(id string) bool { + d.Lock() + defer d.Unlock() + return d.filesystemsCache[d.zfsPath(id)] == true +} diff --git a/vendor/github.com/containers/storage/drivers/zfs/zfs_freebsd.go b/vendor/github.com/containers/storage/drivers/zfs/zfs_freebsd.go new file mode 100644 index 00000000..a25e2a45 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/zfs/zfs_freebsd.go @@ -0,0 +1,38 @@ +package zfs + +import ( + "fmt" + "strings" + "syscall" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/drivers" +) + +func checkRootdirFs(rootdir string) error { + var buf syscall.Statfs_t + if err := syscall.Statfs(rootdir, &buf); err != nil { + return fmt.Errorf("Failed to access '%s': %s", rootdir, err) + } + + // on FreeBSD buf.Fstypename contains ['z', 'f', 's', 0 ... ] + if (buf.Fstypename[0] != 122) || (buf.Fstypename[1] != 102) || (buf.Fstypename[2] != 115) || (buf.Fstypename[3] != 0) { + logrus.Debugf("[zfs] no zfs dataset found for rootdir '%s'", rootdir) + return graphdriver.ErrPrerequisites + } + + return nil +} + +func getMountpoint(id string) string { + maxlen := 12 + + // we need to preserve filesystem suffix + suffix := strings.SplitN(id, "-", 2) + + if len(suffix) > 1 { + return id[:maxlen] + "-" + suffix[1] + } + + return id[:maxlen] +} diff --git a/vendor/github.com/containers/storage/drivers/zfs/zfs_linux.go b/vendor/github.com/containers/storage/drivers/zfs/zfs_linux.go new file mode 100644 index 00000000..6aa41d90 --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/zfs/zfs_linux.go @@ -0,0 +1,27 @@ +package zfs + +import ( + "fmt" + "syscall" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/drivers" +) + +func checkRootdirFs(rootdir string) error { + var buf syscall.Statfs_t + if err := syscall.Statfs(rootdir, &buf); err != nil { + return fmt.Errorf("Failed to access '%s': %s", rootdir, err) + } + + if graphdriver.FsMagic(buf.Type) != graphdriver.FsMagicZfs { + logrus.Debugf("[zfs] no zfs dataset found for rootdir '%s'", rootdir) + return graphdriver.ErrPrerequisites + } + + return nil +} + +func getMountpoint(id string) string { + return id +} diff --git a/vendor/github.com/containers/storage/drivers/zfs/zfs_solaris.go b/vendor/github.com/containers/storage/drivers/zfs/zfs_solaris.go new file mode 100644 index 00000000..56d09cac --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/zfs/zfs_solaris.go @@ -0,0 +1,59 @@ +// +build solaris,cgo + +package zfs + +/* +#include +#include + +static inline struct statvfs *getstatfs(char *s) { + struct statvfs *buf; + int err; + buf = (struct statvfs *)malloc(sizeof(struct statvfs)); + err = statvfs(s, buf); + return buf; +} +*/ +import "C" +import ( + "path/filepath" + "strings" + "unsafe" + + log "github.com/Sirupsen/logrus" + "github.com/containers/storage/drivers" +) + +func checkRootdirFs(rootdir string) error { + + cs := C.CString(filepath.Dir(rootdir)) + buf := C.getstatfs(cs) + + // on Solaris buf.f_basetype contains ['z', 'f', 's', 0 ... ] + if (buf.f_basetype[0] != 122) || (buf.f_basetype[1] != 102) || (buf.f_basetype[2] != 115) || + (buf.f_basetype[3] != 0) { + log.Debugf("[zfs] no zfs dataset found for rootdir '%s'", rootdir) + C.free(unsafe.Pointer(buf)) + return graphdriver.ErrPrerequisites + } + + C.free(unsafe.Pointer(buf)) + C.free(unsafe.Pointer(cs)) + return nil +} + +/* rootfs is introduced to comply with the OCI spec +which states that root filesystem must be mounted at /rootfs/ instead of / +*/ +func getMountpoint(id string) string { + maxlen := 12 + + // we need to preserve filesystem suffix + suffix := strings.SplitN(id, "-", 2) + + if len(suffix) > 1 { + return filepath.Join(id[:maxlen]+"-"+suffix[1], "rootfs", "root") + } + + return filepath.Join(id[:maxlen], "rootfs", "root") +} diff --git a/vendor/github.com/containers/storage/drivers/zfs/zfs_unsupported.go b/vendor/github.com/containers/storage/drivers/zfs/zfs_unsupported.go new file mode 100644 index 00000000..ce8daada --- /dev/null +++ b/vendor/github.com/containers/storage/drivers/zfs/zfs_unsupported.go @@ -0,0 +1,11 @@ +// +build !linux,!freebsd,!solaris + +package zfs + +func checkRootdirFs(rootdir string) error { + return nil +} + +func getMountpoint(id string) string { + return id +} diff --git a/vendor/github.com/containers/storage/pkg/archive/archive.go b/vendor/github.com/containers/storage/pkg/archive/archive.go new file mode 100644 index 00000000..98197a02 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/archive.go @@ -0,0 +1,1147 @@ +package archive + +import ( + "archive/tar" + "bufio" + "bytes" + "compress/bzip2" + "compress/gzip" + "errors" + "fmt" + "io" + "io/ioutil" + "os" + "os/exec" + "path/filepath" + "runtime" + "strings" + "syscall" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/pkg/fileutils" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/ioutils" + "github.com/containers/storage/pkg/pools" + "github.com/containers/storage/pkg/promise" + "github.com/containers/storage/pkg/system" +) + +type ( + // Archive is a type of io.ReadCloser which has two interfaces Read and Closer. + Archive io.ReadCloser + // Reader is a type of io.Reader. + Reader io.Reader + // Compression is the state represents if compressed or not. + Compression int + // WhiteoutFormat is the format of whiteouts unpacked + WhiteoutFormat int + // TarChownOptions wraps the chown options UID and GID. + TarChownOptions struct { + UID, GID int + } + // TarOptions wraps the tar options. + TarOptions struct { + IncludeFiles []string + ExcludePatterns []string + Compression Compression + NoLchown bool + UIDMaps []idtools.IDMap + GIDMaps []idtools.IDMap + ChownOpts *TarChownOptions + IncludeSourceDir bool + // WhiteoutFormat is the expected on disk format for whiteout files. + // This format will be converted to the standard format on pack + // and from the standard format on unpack. + WhiteoutFormat WhiteoutFormat + // When unpacking, specifies whether overwriting a directory with a + // non-directory is allowed and vice versa. + NoOverwriteDirNonDir bool + // For each include when creating an archive, the included name will be + // replaced with the matching name from this map. + RebaseNames map[string]string + } + + // Archiver allows the reuse of most utility functions of this package + // with a pluggable Untar function. Also, to facilitate the passing of + // specific id mappings for untar, an archiver can be created with maps + // which will then be passed to Untar operations + Archiver struct { + Untar func(io.Reader, string, *TarOptions) error + UIDMaps []idtools.IDMap + GIDMaps []idtools.IDMap + } + + // breakoutError is used to differentiate errors related to breaking out + // When testing archive breakout in the unit tests, this error is expected + // in order for the test to pass. + breakoutError error +) + +var ( + // ErrNotImplemented is the error message of function not implemented. + ErrNotImplemented = errors.New("Function not implemented") + defaultArchiver = &Archiver{Untar: Untar, UIDMaps: nil, GIDMaps: nil} +) + +const ( + // HeaderSize is the size in bytes of a tar header + HeaderSize = 512 +) + +const ( + // Uncompressed represents the uncompressed. + Uncompressed Compression = iota + // Bzip2 is bzip2 compression algorithm. + Bzip2 + // Gzip is gzip compression algorithm. + Gzip + // Xz is xz compression algorithm. + Xz +) + +const ( + // AUFSWhiteoutFormat is the default format for whiteouts + AUFSWhiteoutFormat WhiteoutFormat = iota + // OverlayWhiteoutFormat formats whiteout according to the overlay + // standard. + OverlayWhiteoutFormat +) + +// IsArchive checks for the magic bytes of a tar or any supported compression +// algorithm. +func IsArchive(header []byte) bool { + compression := DetectCompression(header) + if compression != Uncompressed { + return true + } + r := tar.NewReader(bytes.NewBuffer(header)) + _, err := r.Next() + return err == nil +} + +// IsArchivePath checks if the (possibly compressed) file at the given path +// starts with a tar file header. +func IsArchivePath(path string) bool { + file, err := os.Open(path) + if err != nil { + return false + } + defer file.Close() + rdr, err := DecompressStream(file) + if err != nil { + return false + } + r := tar.NewReader(rdr) + _, err = r.Next() + return err == nil +} + +// DetectCompression detects the compression algorithm of the source. +func DetectCompression(source []byte) Compression { + for compression, m := range map[Compression][]byte{ + Bzip2: {0x42, 0x5A, 0x68}, + Gzip: {0x1F, 0x8B, 0x08}, + Xz: {0xFD, 0x37, 0x7A, 0x58, 0x5A, 0x00}, + } { + if len(source) < len(m) { + logrus.Debug("Len too short") + continue + } + if bytes.Compare(m, source[:len(m)]) == 0 { + return compression + } + } + return Uncompressed +} + +func xzDecompress(archive io.Reader) (io.ReadCloser, <-chan struct{}, error) { + args := []string{"xz", "-d", "-c", "-q"} + + return cmdStream(exec.Command(args[0], args[1:]...), archive) +} + +// DecompressStream decompresses the archive and returns a ReaderCloser with the decompressed archive. +func DecompressStream(archive io.Reader) (io.ReadCloser, error) { + p := pools.BufioReader32KPool + buf := p.Get(archive) + bs, err := buf.Peek(10) + if err != nil && err != io.EOF { + // Note: we'll ignore any io.EOF error because there are some odd + // cases where the layer.tar file will be empty (zero bytes) and + // that results in an io.EOF from the Peek() call. So, in those + // cases we'll just treat it as a non-compressed stream and + // that means just create an empty layer. + // See Issue 18170 + return nil, err + } + + compression := DetectCompression(bs) + switch compression { + case Uncompressed: + readBufWrapper := p.NewReadCloserWrapper(buf, buf) + return readBufWrapper, nil + case Gzip: + gzReader, err := gzip.NewReader(buf) + if err != nil { + return nil, err + } + readBufWrapper := p.NewReadCloserWrapper(buf, gzReader) + return readBufWrapper, nil + case Bzip2: + bz2Reader := bzip2.NewReader(buf) + readBufWrapper := p.NewReadCloserWrapper(buf, bz2Reader) + return readBufWrapper, nil + case Xz: + xzReader, chdone, err := xzDecompress(buf) + if err != nil { + return nil, err + } + readBufWrapper := p.NewReadCloserWrapper(buf, xzReader) + return ioutils.NewReadCloserWrapper(readBufWrapper, func() error { + <-chdone + return readBufWrapper.Close() + }), nil + default: + return nil, fmt.Errorf("Unsupported compression format %s", (&compression).Extension()) + } +} + +// CompressStream compresseses the dest with specified compression algorithm. +func CompressStream(dest io.Writer, compression Compression) (io.WriteCloser, error) { + p := pools.BufioWriter32KPool + buf := p.Get(dest) + switch compression { + case Uncompressed: + writeBufWrapper := p.NewWriteCloserWrapper(buf, buf) + return writeBufWrapper, nil + case Gzip: + gzWriter := gzip.NewWriter(dest) + writeBufWrapper := p.NewWriteCloserWrapper(buf, gzWriter) + return writeBufWrapper, nil + case Bzip2, Xz: + // archive/bzip2 does not support writing, and there is no xz support at all + // However, this is not a problem as docker only currently generates gzipped tars + return nil, fmt.Errorf("Unsupported compression format %s", (&compression).Extension()) + default: + return nil, fmt.Errorf("Unsupported compression format %s", (&compression).Extension()) + } +} + +// Extension returns the extension of a file that uses the specified compression algorithm. +func (compression *Compression) Extension() string { + switch *compression { + case Uncompressed: + return "tar" + case Bzip2: + return "tar.bz2" + case Gzip: + return "tar.gz" + case Xz: + return "tar.xz" + } + return "" +} + +type tarWhiteoutConverter interface { + ConvertWrite(*tar.Header, string, os.FileInfo) error + ConvertRead(*tar.Header, string) (bool, error) +} + +type tarAppender struct { + TarWriter *tar.Writer + Buffer *bufio.Writer + + // for hardlink mapping + SeenFiles map[uint64]string + UIDMaps []idtools.IDMap + GIDMaps []idtools.IDMap + + // For packing and unpacking whiteout files in the + // non standard format. The whiteout files defined + // by the AUFS standard are used as the tar whiteout + // standard. + WhiteoutConverter tarWhiteoutConverter +} + +// canonicalTarName provides a platform-independent and consistent posix-style +//path for files and directories to be archived regardless of the platform. +func canonicalTarName(name string, isDir bool) (string, error) { + name, err := CanonicalTarNameForPath(name) + if err != nil { + return "", err + } + + // suffix with '/' for directories + if isDir && !strings.HasSuffix(name, "/") { + name += "/" + } + return name, nil +} + +// addTarFile adds to the tar archive a file from `path` as `name` +func (ta *tarAppender) addTarFile(path, name string) error { + fi, err := os.Lstat(path) + if err != nil { + return err + } + + link := "" + if fi.Mode()&os.ModeSymlink != 0 { + if link, err = os.Readlink(path); err != nil { + return err + } + } + + hdr, err := tar.FileInfoHeader(fi, link) + if err != nil { + return err + } + hdr.Mode = int64(chmodTarEntry(os.FileMode(hdr.Mode))) + + name, err = canonicalTarName(name, fi.IsDir()) + if err != nil { + return fmt.Errorf("tar: cannot canonicalize path: %v", err) + } + hdr.Name = name + + inode, err := setHeaderForSpecialDevice(hdr, ta, name, fi.Sys()) + if err != nil { + return err + } + + // if it's not a directory and has more than 1 link, + // it's hardlinked, so set the type flag accordingly + if !fi.IsDir() && hasHardlinks(fi) { + // a link should have a name that it links too + // and that linked name should be first in the tar archive + if oldpath, ok := ta.SeenFiles[inode]; ok { + hdr.Typeflag = tar.TypeLink + hdr.Linkname = oldpath + hdr.Size = 0 // This Must be here for the writer math to add up! + } else { + ta.SeenFiles[inode] = name + } + } + + capability, _ := system.Lgetxattr(path, "security.capability") + if capability != nil { + hdr.Xattrs = make(map[string]string) + hdr.Xattrs["security.capability"] = string(capability) + } + + //handle re-mapping container ID mappings back to host ID mappings before + //writing tar headers/files. We skip whiteout files because they were written + //by the kernel and already have proper ownership relative to the host + if !strings.HasPrefix(filepath.Base(hdr.Name), WhiteoutPrefix) && (ta.UIDMaps != nil || ta.GIDMaps != nil) { + uid, gid, err := getFileUIDGID(fi.Sys()) + if err != nil { + return err + } + xUID, err := idtools.ToContainer(uid, ta.UIDMaps) + if err != nil { + return err + } + xGID, err := idtools.ToContainer(gid, ta.GIDMaps) + if err != nil { + return err + } + hdr.Uid = xUID + hdr.Gid = xGID + } + + if ta.WhiteoutConverter != nil { + if err := ta.WhiteoutConverter.ConvertWrite(hdr, path, fi); err != nil { + return err + } + } + + if err := ta.TarWriter.WriteHeader(hdr); err != nil { + return err + } + + if hdr.Typeflag == tar.TypeReg && hdr.Size > 0 { + file, err := os.Open(path) + if err != nil { + return err + } + + ta.Buffer.Reset(ta.TarWriter) + defer ta.Buffer.Reset(nil) + _, err = io.Copy(ta.Buffer, file) + file.Close() + if err != nil { + return err + } + err = ta.Buffer.Flush() + if err != nil { + return err + } + } + + return nil +} + +func createTarFile(path, extractDir string, hdr *tar.Header, reader io.Reader, Lchown bool, chownOpts *TarChownOptions) error { + // hdr.Mode is in linux format, which we can use for sycalls, + // but for os.Foo() calls we need the mode converted to os.FileMode, + // so use hdrInfo.Mode() (they differ for e.g. setuid bits) + hdrInfo := hdr.FileInfo() + + switch hdr.Typeflag { + case tar.TypeDir: + // Create directory unless it exists as a directory already. + // In that case we just want to merge the two + if fi, err := os.Lstat(path); !(err == nil && fi.IsDir()) { + if err := os.Mkdir(path, hdrInfo.Mode()); err != nil { + return err + } + } + + case tar.TypeReg, tar.TypeRegA: + // Source is regular file + file, err := os.OpenFile(path, os.O_CREATE|os.O_WRONLY, hdrInfo.Mode()) + if err != nil { + return err + } + if _, err := io.Copy(file, reader); err != nil { + file.Close() + return err + } + file.Close() + + case tar.TypeBlock, tar.TypeChar, tar.TypeFifo: + // Handle this is an OS-specific way + if err := handleTarTypeBlockCharFifo(hdr, path); err != nil { + return err + } + + case tar.TypeLink: + targetPath := filepath.Join(extractDir, hdr.Linkname) + // check for hardlink breakout + if !strings.HasPrefix(targetPath, extractDir) { + return breakoutError(fmt.Errorf("invalid hardlink %q -> %q", targetPath, hdr.Linkname)) + } + if err := os.Link(targetPath, path); err != nil { + return err + } + + case tar.TypeSymlink: + // path -> hdr.Linkname = targetPath + // e.g. /extractDir/path/to/symlink -> ../2/file = /extractDir/path/2/file + targetPath := filepath.Join(filepath.Dir(path), hdr.Linkname) + + // the reason we don't need to check symlinks in the path (with FollowSymlinkInScope) is because + // that symlink would first have to be created, which would be caught earlier, at this very check: + if !strings.HasPrefix(targetPath, extractDir) { + return breakoutError(fmt.Errorf("invalid symlink %q -> %q", path, hdr.Linkname)) + } + if err := os.Symlink(hdr.Linkname, path); err != nil { + return err + } + + case tar.TypeXGlobalHeader: + logrus.Debug("PAX Global Extended Headers found and ignored") + return nil + + default: + return fmt.Errorf("Unhandled tar header type %d\n", hdr.Typeflag) + } + + // Lchown is not supported on Windows. + if Lchown && runtime.GOOS != "windows" { + if chownOpts == nil { + chownOpts = &TarChownOptions{UID: hdr.Uid, GID: hdr.Gid} + } + if err := os.Lchown(path, chownOpts.UID, chownOpts.GID); err != nil { + return err + } + } + + var errors []string + for key, value := range hdr.Xattrs { + if err := system.Lsetxattr(path, key, []byte(value), 0); err != nil { + if err == syscall.ENOTSUP { + // We ignore errors here because not all graphdrivers support + // xattrs *cough* old versions of AUFS *cough*. However only + // ENOTSUP should be emitted in that case, otherwise we still + // bail. + errors = append(errors, err.Error()) + continue + } + return err + } + + } + + if len(errors) > 0 { + logrus.WithFields(logrus.Fields{ + "errors": errors, + }).Warn("ignored xattrs in archive: underlying filesystem doesn't support them") + } + + // There is no LChmod, so ignore mode for symlink. Also, this + // must happen after chown, as that can modify the file mode + if err := handleLChmod(hdr, path, hdrInfo); err != nil { + return err + } + + aTime := hdr.AccessTime + if aTime.Before(hdr.ModTime) { + // Last access time should never be before last modified time. + aTime = hdr.ModTime + } + + // system.Chtimes doesn't support a NOFOLLOW flag atm + if hdr.Typeflag == tar.TypeLink { + if fi, err := os.Lstat(hdr.Linkname); err == nil && (fi.Mode()&os.ModeSymlink == 0) { + if err := system.Chtimes(path, aTime, hdr.ModTime); err != nil { + return err + } + } + } else if hdr.Typeflag != tar.TypeSymlink { + if err := system.Chtimes(path, aTime, hdr.ModTime); err != nil { + return err + } + } else { + ts := []syscall.Timespec{timeToTimespec(aTime), timeToTimespec(hdr.ModTime)} + if err := system.LUtimesNano(path, ts); err != nil && err != system.ErrNotSupportedPlatform { + return err + } + } + return nil +} + +// Tar creates an archive from the directory at `path`, and returns it as a +// stream of bytes. +func Tar(path string, compression Compression) (io.ReadCloser, error) { + return TarWithOptions(path, &TarOptions{Compression: compression}) +} + +// TarWithOptions creates an archive from the directory at `path`, only including files whose relative +// paths are included in `options.IncludeFiles` (if non-nil) or not in `options.ExcludePatterns`. +func TarWithOptions(srcPath string, options *TarOptions) (io.ReadCloser, error) { + + // Fix the source path to work with long path names. This is a no-op + // on platforms other than Windows. + srcPath = fixVolumePathPrefix(srcPath) + + patterns, patDirs, exceptions, err := fileutils.CleanPatterns(options.ExcludePatterns) + + if err != nil { + return nil, err + } + + pipeReader, pipeWriter := io.Pipe() + + compressWriter, err := CompressStream(pipeWriter, options.Compression) + if err != nil { + return nil, err + } + + go func() { + ta := &tarAppender{ + TarWriter: tar.NewWriter(compressWriter), + Buffer: pools.BufioWriter32KPool.Get(nil), + SeenFiles: make(map[uint64]string), + UIDMaps: options.UIDMaps, + GIDMaps: options.GIDMaps, + WhiteoutConverter: getWhiteoutConverter(options.WhiteoutFormat), + } + + defer func() { + // Make sure to check the error on Close. + if err := ta.TarWriter.Close(); err != nil { + logrus.Errorf("Can't close tar writer: %s", err) + } + if err := compressWriter.Close(); err != nil { + logrus.Errorf("Can't close compress writer: %s", err) + } + if err := pipeWriter.Close(); err != nil { + logrus.Errorf("Can't close pipe writer: %s", err) + } + }() + + // this buffer is needed for the duration of this piped stream + defer pools.BufioWriter32KPool.Put(ta.Buffer) + + // In general we log errors here but ignore them because + // during e.g. a diff operation the container can continue + // mutating the filesystem and we can see transient errors + // from this + + stat, err := os.Lstat(srcPath) + if err != nil { + return + } + + if !stat.IsDir() { + // We can't later join a non-dir with any includes because the + // 'walk' will error if "file/." is stat-ed and "file" is not a + // directory. So, we must split the source path and use the + // basename as the include. + if len(options.IncludeFiles) > 0 { + logrus.Warn("Tar: Can't archive a file with includes") + } + + dir, base := SplitPathDirEntry(srcPath) + srcPath = dir + options.IncludeFiles = []string{base} + } + + if len(options.IncludeFiles) == 0 { + options.IncludeFiles = []string{"."} + } + + seen := make(map[string]bool) + + for _, include := range options.IncludeFiles { + rebaseName := options.RebaseNames[include] + + walkRoot := getWalkRoot(srcPath, include) + filepath.Walk(walkRoot, func(filePath string, f os.FileInfo, err error) error { + if err != nil { + logrus.Errorf("Tar: Can't stat file %s to tar: %s", srcPath, err) + return nil + } + + relFilePath, err := filepath.Rel(srcPath, filePath) + if err != nil || (!options.IncludeSourceDir && relFilePath == "." && f.IsDir()) { + // Error getting relative path OR we are looking + // at the source directory path. Skip in both situations. + return nil + } + + if options.IncludeSourceDir && include == "." && relFilePath != "." { + relFilePath = strings.Join([]string{".", relFilePath}, string(filepath.Separator)) + } + + skip := false + + // If "include" is an exact match for the current file + // then even if there's an "excludePatterns" pattern that + // matches it, don't skip it. IOW, assume an explicit 'include' + // is asking for that file no matter what - which is true + // for some files, like .dockerignore and Dockerfile (sometimes) + if include != relFilePath { + skip, err = fileutils.OptimizedMatches(relFilePath, patterns, patDirs) + if err != nil { + logrus.Errorf("Error matching %s: %v", relFilePath, err) + return err + } + } + + if skip { + // If we want to skip this file and its a directory + // then we should first check to see if there's an + // excludes pattern (eg !dir/file) that starts with this + // dir. If so then we can't skip this dir. + + // Its not a dir then so we can just return/skip. + if !f.IsDir() { + return nil + } + + // No exceptions (!...) in patterns so just skip dir + if !exceptions { + return filepath.SkipDir + } + + dirSlash := relFilePath + string(filepath.Separator) + + for _, pat := range patterns { + if pat[0] != '!' { + continue + } + pat = pat[1:] + string(filepath.Separator) + if strings.HasPrefix(pat, dirSlash) { + // found a match - so can't skip this dir + return nil + } + } + + // No matching exclusion dir so just skip dir + return filepath.SkipDir + } + + if seen[relFilePath] { + return nil + } + seen[relFilePath] = true + + // Rename the base resource. + if rebaseName != "" { + var replacement string + if rebaseName != string(filepath.Separator) { + // Special case the root directory to replace with an + // empty string instead so that we don't end up with + // double slashes in the paths. + replacement = rebaseName + } + + relFilePath = strings.Replace(relFilePath, include, replacement, 1) + } + + if err := ta.addTarFile(filePath, relFilePath); err != nil { + logrus.Errorf("Can't add file %s to tar: %s", filePath, err) + // if pipe is broken, stop writing tar stream to it + if err == io.ErrClosedPipe { + return err + } + } + return nil + }) + } + }() + + return pipeReader, nil +} + +// Unpack unpacks the decompressedArchive to dest with options. +func Unpack(decompressedArchive io.Reader, dest string, options *TarOptions) error { + tr := tar.NewReader(decompressedArchive) + trBuf := pools.BufioReader32KPool.Get(nil) + defer pools.BufioReader32KPool.Put(trBuf) + + var dirs []*tar.Header + remappedRootUID, remappedRootGID, err := idtools.GetRootUIDGID(options.UIDMaps, options.GIDMaps) + if err != nil { + return err + } + whiteoutConverter := getWhiteoutConverter(options.WhiteoutFormat) + + // Iterate through the files in the archive. +loop: + for { + hdr, err := tr.Next() + if err == io.EOF { + // end of tar archive + break + } + if err != nil { + return err + } + + // Normalize name, for safety and for a simple is-root check + // This keeps "../" as-is, but normalizes "/../" to "/". Or Windows: + // This keeps "..\" as-is, but normalizes "\..\" to "\". + hdr.Name = filepath.Clean(hdr.Name) + + for _, exclude := range options.ExcludePatterns { + if strings.HasPrefix(hdr.Name, exclude) { + continue loop + } + } + + // After calling filepath.Clean(hdr.Name) above, hdr.Name will now be in + // the filepath format for the OS on which the daemon is running. Hence + // the check for a slash-suffix MUST be done in an OS-agnostic way. + if !strings.HasSuffix(hdr.Name, string(os.PathSeparator)) { + // Not the root directory, ensure that the parent directory exists + parent := filepath.Dir(hdr.Name) + parentPath := filepath.Join(dest, parent) + if _, err := os.Lstat(parentPath); err != nil && os.IsNotExist(err) { + err = idtools.MkdirAllNewAs(parentPath, 0777, remappedRootUID, remappedRootGID) + if err != nil { + return err + } + } + } + + path := filepath.Join(dest, hdr.Name) + rel, err := filepath.Rel(dest, path) + if err != nil { + return err + } + if strings.HasPrefix(rel, ".."+string(os.PathSeparator)) { + return breakoutError(fmt.Errorf("%q is outside of %q", hdr.Name, dest)) + } + + // If path exits we almost always just want to remove and replace it + // The only exception is when it is a directory *and* the file from + // the layer is also a directory. Then we want to merge them (i.e. + // just apply the metadata from the layer). + if fi, err := os.Lstat(path); err == nil { + if options.NoOverwriteDirNonDir && fi.IsDir() && hdr.Typeflag != tar.TypeDir { + // If NoOverwriteDirNonDir is true then we cannot replace + // an existing directory with a non-directory from the archive. + return fmt.Errorf("cannot overwrite directory %q with non-directory %q", path, dest) + } + + if options.NoOverwriteDirNonDir && !fi.IsDir() && hdr.Typeflag == tar.TypeDir { + // If NoOverwriteDirNonDir is true then we cannot replace + // an existing non-directory with a directory from the archive. + return fmt.Errorf("cannot overwrite non-directory %q with directory %q", path, dest) + } + + if fi.IsDir() && hdr.Name == "." { + continue + } + + if !(fi.IsDir() && hdr.Typeflag == tar.TypeDir) { + if err := os.RemoveAll(path); err != nil { + return err + } + } + } + trBuf.Reset(tr) + + // if the options contain a uid & gid maps, convert header uid/gid + // entries using the maps such that lchown sets the proper mapped + // uid/gid after writing the file. We only perform this mapping if + // the file isn't already owned by the remapped root UID or GID, as + // that specific uid/gid has no mapping from container -> host, and + // those files already have the proper ownership for inside the + // container. + if hdr.Uid != remappedRootUID { + xUID, err := idtools.ToHost(hdr.Uid, options.UIDMaps) + if err != nil { + return err + } + hdr.Uid = xUID + } + if hdr.Gid != remappedRootGID { + xGID, err := idtools.ToHost(hdr.Gid, options.GIDMaps) + if err != nil { + return err + } + hdr.Gid = xGID + } + + if whiteoutConverter != nil { + writeFile, err := whiteoutConverter.ConvertRead(hdr, path) + if err != nil { + return err + } + if !writeFile { + continue + } + } + + if err := createTarFile(path, dest, hdr, trBuf, !options.NoLchown, options.ChownOpts); err != nil { + return err + } + + // Directory mtimes must be handled at the end to avoid further + // file creation in them to modify the directory mtime + if hdr.Typeflag == tar.TypeDir { + dirs = append(dirs, hdr) + } + } + + for _, hdr := range dirs { + path := filepath.Join(dest, hdr.Name) + + if err := system.Chtimes(path, hdr.AccessTime, hdr.ModTime); err != nil { + return err + } + } + return nil +} + +// Untar reads a stream of bytes from `archive`, parses it as a tar archive, +// and unpacks it into the directory at `dest`. +// The archive may be compressed with one of the following algorithms: +// identity (uncompressed), gzip, bzip2, xz. +// FIXME: specify behavior when target path exists vs. doesn't exist. +func Untar(tarArchive io.Reader, dest string, options *TarOptions) error { + return untarHandler(tarArchive, dest, options, true) +} + +// UntarUncompressed reads a stream of bytes from `archive`, parses it as a tar archive, +// and unpacks it into the directory at `dest`. +// The archive must be an uncompressed stream. +func UntarUncompressed(tarArchive io.Reader, dest string, options *TarOptions) error { + return untarHandler(tarArchive, dest, options, false) +} + +// Handler for teasing out the automatic decompression +func untarHandler(tarArchive io.Reader, dest string, options *TarOptions, decompress bool) error { + if tarArchive == nil { + return fmt.Errorf("Empty archive") + } + dest = filepath.Clean(dest) + if options == nil { + options = &TarOptions{} + } + if options.ExcludePatterns == nil { + options.ExcludePatterns = []string{} + } + + r := tarArchive + if decompress { + decompressedArchive, err := DecompressStream(tarArchive) + if err != nil { + return err + } + defer decompressedArchive.Close() + r = decompressedArchive + } + + return Unpack(r, dest, options) +} + +// TarUntar is a convenience function which calls Tar and Untar, with the output of one piped into the other. +// If either Tar or Untar fails, TarUntar aborts and returns the error. +func (archiver *Archiver) TarUntar(src, dst string) error { + logrus.Debugf("TarUntar(%s %s)", src, dst) + archive, err := TarWithOptions(src, &TarOptions{Compression: Uncompressed}) + if err != nil { + return err + } + defer archive.Close() + + var options *TarOptions + if archiver.UIDMaps != nil || archiver.GIDMaps != nil { + options = &TarOptions{ + UIDMaps: archiver.UIDMaps, + GIDMaps: archiver.GIDMaps, + } + } + return archiver.Untar(archive, dst, options) +} + +// TarUntar is a convenience function which calls Tar and Untar, with the output of one piped into the other. +// If either Tar or Untar fails, TarUntar aborts and returns the error. +func TarUntar(src, dst string) error { + return defaultArchiver.TarUntar(src, dst) +} + +// UntarPath untar a file from path to a destination, src is the source tar file path. +func (archiver *Archiver) UntarPath(src, dst string) error { + archive, err := os.Open(src) + if err != nil { + return err + } + defer archive.Close() + var options *TarOptions + if archiver.UIDMaps != nil || archiver.GIDMaps != nil { + options = &TarOptions{ + UIDMaps: archiver.UIDMaps, + GIDMaps: archiver.GIDMaps, + } + } + return archiver.Untar(archive, dst, options) +} + +// UntarPath is a convenience function which looks for an archive +// at filesystem path `src`, and unpacks it at `dst`. +func UntarPath(src, dst string) error { + return defaultArchiver.UntarPath(src, dst) +} + +// CopyWithTar creates a tar archive of filesystem path `src`, and +// unpacks it at filesystem path `dst`. +// The archive is streamed directly with fixed buffering and no +// intermediary disk IO. +func (archiver *Archiver) CopyWithTar(src, dst string) error { + srcSt, err := os.Stat(src) + if err != nil { + return err + } + if !srcSt.IsDir() { + return archiver.CopyFileWithTar(src, dst) + } + + // if this archiver is set up with ID mapping we need to create + // the new destination directory with the remapped root UID/GID pair + // as owner + rootUID, rootGID, err := idtools.GetRootUIDGID(archiver.UIDMaps, archiver.GIDMaps) + if err != nil { + return err + } + // Create dst, copy src's content into it + logrus.Debugf("Creating dest directory: %s", dst) + if err := idtools.MkdirAllNewAs(dst, 0755, rootUID, rootGID); err != nil { + return err + } + logrus.Debugf("Calling TarUntar(%s, %s)", src, dst) + return archiver.TarUntar(src, dst) +} + +// CopyWithTar creates a tar archive of filesystem path `src`, and +// unpacks it at filesystem path `dst`. +// The archive is streamed directly with fixed buffering and no +// intermediary disk IO. +func CopyWithTar(src, dst string) error { + return defaultArchiver.CopyWithTar(src, dst) +} + +// CopyFileWithTar emulates the behavior of the 'cp' command-line +// for a single file. It copies a regular file from path `src` to +// path `dst`, and preserves all its metadata. +func (archiver *Archiver) CopyFileWithTar(src, dst string) (err error) { + logrus.Debugf("CopyFileWithTar(%s, %s)", src, dst) + srcSt, err := os.Stat(src) + if err != nil { + return err + } + + if srcSt.IsDir() { + return fmt.Errorf("Can't copy a directory") + } + + // Clean up the trailing slash. This must be done in an operating + // system specific manner. + if dst[len(dst)-1] == os.PathSeparator { + dst = filepath.Join(dst, filepath.Base(src)) + } + // Create the holding directory if necessary + if err := system.MkdirAll(filepath.Dir(dst), 0700); err != nil { + return err + } + + r, w := io.Pipe() + errC := promise.Go(func() error { + defer w.Close() + + srcF, err := os.Open(src) + if err != nil { + return err + } + defer srcF.Close() + + hdr, err := tar.FileInfoHeader(srcSt, "") + if err != nil { + return err + } + hdr.Name = filepath.Base(dst) + hdr.Mode = int64(chmodTarEntry(os.FileMode(hdr.Mode))) + + remappedRootUID, remappedRootGID, err := idtools.GetRootUIDGID(archiver.UIDMaps, archiver.GIDMaps) + if err != nil { + return err + } + + // only perform mapping if the file being copied isn't already owned by the + // uid or gid of the remapped root in the container + if remappedRootUID != hdr.Uid { + xUID, err := idtools.ToHost(hdr.Uid, archiver.UIDMaps) + if err != nil { + return err + } + hdr.Uid = xUID + } + if remappedRootGID != hdr.Gid { + xGID, err := idtools.ToHost(hdr.Gid, archiver.GIDMaps) + if err != nil { + return err + } + hdr.Gid = xGID + } + + tw := tar.NewWriter(w) + defer tw.Close() + if err := tw.WriteHeader(hdr); err != nil { + return err + } + if _, err := io.Copy(tw, srcF); err != nil { + return err + } + return nil + }) + defer func() { + if er := <-errC; err != nil { + err = er + } + }() + + err = archiver.Untar(r, filepath.Dir(dst), nil) + if err != nil { + r.CloseWithError(err) + } + return err +} + +// CopyFileWithTar emulates the behavior of the 'cp' command-line +// for a single file. It copies a regular file from path `src` to +// path `dst`, and preserves all its metadata. +// +// Destination handling is in an operating specific manner depending +// where the daemon is running. If `dst` ends with a trailing slash +// the final destination path will be `dst/base(src)` (Linux) or +// `dst\base(src)` (Windows). +func CopyFileWithTar(src, dst string) (err error) { + return defaultArchiver.CopyFileWithTar(src, dst) +} + +// cmdStream executes a command, and returns its stdout as a stream. +// If the command fails to run or doesn't complete successfully, an error +// will be returned, including anything written on stderr. +func cmdStream(cmd *exec.Cmd, input io.Reader) (io.ReadCloser, <-chan struct{}, error) { + chdone := make(chan struct{}) + cmd.Stdin = input + pipeR, pipeW := io.Pipe() + cmd.Stdout = pipeW + var errBuf bytes.Buffer + cmd.Stderr = &errBuf + + // Run the command and return the pipe + if err := cmd.Start(); err != nil { + return nil, nil, err + } + + // Copy stdout to the returned pipe + go func() { + if err := cmd.Wait(); err != nil { + pipeW.CloseWithError(fmt.Errorf("%s: %s", err, errBuf.String())) + } else { + pipeW.Close() + } + close(chdone) + }() + + return pipeR, chdone, nil +} + +// NewTempArchive reads the content of src into a temporary file, and returns the contents +// of that file as an archive. The archive can only be read once - as soon as reading completes, +// the file will be deleted. +func NewTempArchive(src Archive, dir string) (*TempArchive, error) { + f, err := ioutil.TempFile(dir, "") + if err != nil { + return nil, err + } + if _, err := io.Copy(f, src); err != nil { + return nil, err + } + if _, err := f.Seek(0, 0); err != nil { + return nil, err + } + st, err := f.Stat() + if err != nil { + return nil, err + } + size := st.Size() + return &TempArchive{File: f, Size: size}, nil +} + +// TempArchive is a temporary archive. The archive can only be read once - as soon as reading completes, +// the file will be deleted. +type TempArchive struct { + *os.File + Size int64 // Pre-computed from Stat().Size() as a convenience + read int64 + closed bool +} + +// Close closes the underlying file if it's still open, or does a no-op +// to allow callers to try to close the TempArchive multiple times safely. +func (archive *TempArchive) Close() error { + if archive.closed { + return nil + } + + archive.closed = true + + return archive.File.Close() +} + +func (archive *TempArchive) Read(data []byte) (int, error) { + n, err := archive.File.Read(data) + archive.read += int64(n) + if err != nil || archive.read == archive.Size { + archive.Close() + os.Remove(archive.File.Name()) + } + return n, err +} diff --git a/vendor/github.com/containers/storage/pkg/archive/archive_linux.go b/vendor/github.com/containers/storage/pkg/archive/archive_linux.go new file mode 100644 index 00000000..e944ca2a --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/archive_linux.go @@ -0,0 +1,91 @@ +package archive + +import ( + "archive/tar" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/containers/storage/pkg/system" +) + +func getWhiteoutConverter(format WhiteoutFormat) tarWhiteoutConverter { + if format == OverlayWhiteoutFormat { + return overlayWhiteoutConverter{} + } + return nil +} + +type overlayWhiteoutConverter struct{} + +func (overlayWhiteoutConverter) ConvertWrite(hdr *tar.Header, path string, fi os.FileInfo) error { + // convert whiteouts to AUFS format + if fi.Mode()&os.ModeCharDevice != 0 && hdr.Devmajor == 0 && hdr.Devminor == 0 { + // we just rename the file and make it normal + dir, filename := filepath.Split(hdr.Name) + hdr.Name = filepath.Join(dir, WhiteoutPrefix+filename) + hdr.Mode = 0600 + hdr.Typeflag = tar.TypeReg + hdr.Size = 0 + } + + if fi.Mode()&os.ModeDir != 0 { + // convert opaque dirs to AUFS format by writing an empty file with the prefix + opaque, err := system.Lgetxattr(path, "trusted.overlay.opaque") + if err != nil { + return err + } + if opaque != nil && len(opaque) == 1 && opaque[0] == 'y' { + // create a header for the whiteout file + // it should inherit some properties from the parent, but be a regular file + *hdr = tar.Header{ + Typeflag: tar.TypeReg, + Mode: hdr.Mode & int64(os.ModePerm), + Name: filepath.Join(hdr.Name, WhiteoutOpaqueDir), + Size: 0, + Uid: hdr.Uid, + Uname: hdr.Uname, + Gid: hdr.Gid, + Gname: hdr.Gname, + AccessTime: hdr.AccessTime, + ChangeTime: hdr.ChangeTime, + } + } + } + + return nil +} + +func (overlayWhiteoutConverter) ConvertRead(hdr *tar.Header, path string) (bool, error) { + base := filepath.Base(path) + dir := filepath.Dir(path) + + // if a directory is marked as opaque by the AUFS special file, we need to translate that to overlay + if base == WhiteoutOpaqueDir { + if err := syscall.Setxattr(dir, "trusted.overlay.opaque", []byte{'y'}, 0); err != nil { + return false, err + } + + // don't write the file itself + return false, nil + } + + // if a file was deleted and we are using overlay, we need to create a character device + if strings.HasPrefix(base, WhiteoutPrefix) { + originalBase := base[len(WhiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + if err := syscall.Mknod(originalPath, syscall.S_IFCHR, 0); err != nil { + return false, err + } + if err := os.Chown(originalPath, hdr.Uid, hdr.Gid); err != nil { + return false, err + } + + // don't write the file itself + return false, nil + } + + return true, nil +} diff --git a/vendor/github.com/containers/storage/pkg/archive/archive_other.go b/vendor/github.com/containers/storage/pkg/archive/archive_other.go new file mode 100644 index 00000000..54acbf28 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/archive_other.go @@ -0,0 +1,7 @@ +// +build !linux + +package archive + +func getWhiteoutConverter(format WhiteoutFormat) tarWhiteoutConverter { + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/archive/archive_unix.go b/vendor/github.com/containers/storage/pkg/archive/archive_unix.go new file mode 100644 index 00000000..19d731fd --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/archive_unix.go @@ -0,0 +1,112 @@ +// +build !windows + +package archive + +import ( + "archive/tar" + "errors" + "os" + "path/filepath" + "syscall" + + "github.com/containers/storage/pkg/system" +) + +// fixVolumePathPrefix does platform specific processing to ensure that if +// the path being passed in is not in a volume path format, convert it to one. +func fixVolumePathPrefix(srcPath string) string { + return srcPath +} + +// getWalkRoot calculates the root path when performing a TarWithOptions. +// We use a separate function as this is platform specific. On Linux, we +// can't use filepath.Join(srcPath,include) because this will clean away +// a trailing "." or "/" which may be important. +func getWalkRoot(srcPath string, include string) string { + return srcPath + string(filepath.Separator) + include +} + +// CanonicalTarNameForPath returns platform-specific filepath +// to canonical posix-style path for tar archival. p is relative +// path. +func CanonicalTarNameForPath(p string) (string, error) { + return p, nil // already unix-style +} + +// chmodTarEntry is used to adjust the file permissions used in tar header based +// on the platform the archival is done. + +func chmodTarEntry(perm os.FileMode) os.FileMode { + return perm // noop for unix as golang APIs provide perm bits correctly +} + +func setHeaderForSpecialDevice(hdr *tar.Header, ta *tarAppender, name string, stat interface{}) (inode uint64, err error) { + s, ok := stat.(*syscall.Stat_t) + + if !ok { + err = errors.New("cannot convert stat value to syscall.Stat_t") + return + } + + inode = uint64(s.Ino) + + // Currently go does not fill in the major/minors + if s.Mode&syscall.S_IFBLK != 0 || + s.Mode&syscall.S_IFCHR != 0 { + hdr.Devmajor = int64(major(uint64(s.Rdev))) + hdr.Devminor = int64(minor(uint64(s.Rdev))) + } + + return +} + +func getFileUIDGID(stat interface{}) (int, int, error) { + s, ok := stat.(*syscall.Stat_t) + + if !ok { + return -1, -1, errors.New("cannot convert stat value to syscall.Stat_t") + } + return int(s.Uid), int(s.Gid), nil +} + +func major(device uint64) uint64 { + return (device >> 8) & 0xfff +} + +func minor(device uint64) uint64 { + return (device & 0xff) | ((device >> 12) & 0xfff00) +} + +// handleTarTypeBlockCharFifo is an OS-specific helper function used by +// createTarFile to handle the following types of header: Block; Char; Fifo +func handleTarTypeBlockCharFifo(hdr *tar.Header, path string) error { + mode := uint32(hdr.Mode & 07777) + switch hdr.Typeflag { + case tar.TypeBlock: + mode |= syscall.S_IFBLK + case tar.TypeChar: + mode |= syscall.S_IFCHR + case tar.TypeFifo: + mode |= syscall.S_IFIFO + } + + if err := system.Mknod(path, mode, int(system.Mkdev(hdr.Devmajor, hdr.Devminor))); err != nil { + return err + } + return nil +} + +func handleLChmod(hdr *tar.Header, path string, hdrInfo os.FileInfo) error { + if hdr.Typeflag == tar.TypeLink { + if fi, err := os.Lstat(hdr.Linkname); err == nil && (fi.Mode()&os.ModeSymlink == 0) { + if err := os.Chmod(path, hdrInfo.Mode()); err != nil { + return err + } + } + } else if hdr.Typeflag != tar.TypeSymlink { + if err := os.Chmod(path, hdrInfo.Mode()); err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/archive/archive_windows.go b/vendor/github.com/containers/storage/pkg/archive/archive_windows.go new file mode 100644 index 00000000..828d3b9d --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/archive_windows.go @@ -0,0 +1,70 @@ +// +build windows + +package archive + +import ( + "archive/tar" + "fmt" + "os" + "path/filepath" + "strings" + + "github.com/containers/storage/pkg/longpath" +) + +// fixVolumePathPrefix does platform specific processing to ensure that if +// the path being passed in is not in a volume path format, convert it to one. +func fixVolumePathPrefix(srcPath string) string { + return longpath.AddPrefix(srcPath) +} + +// getWalkRoot calculates the root path when performing a TarWithOptions. +// We use a separate function as this is platform specific. +func getWalkRoot(srcPath string, include string) string { + return filepath.Join(srcPath, include) +} + +// CanonicalTarNameForPath returns platform-specific filepath +// to canonical posix-style path for tar archival. p is relative +// path. +func CanonicalTarNameForPath(p string) (string, error) { + // windows: convert windows style relative path with backslashes + // into forward slashes. Since windows does not allow '/' or '\' + // in file names, it is mostly safe to replace however we must + // check just in case + if strings.Contains(p, "/") { + return "", fmt.Errorf("Windows path contains forward slash: %s", p) + } + return strings.Replace(p, string(os.PathSeparator), "/", -1), nil + +} + +// chmodTarEntry is used to adjust the file permissions used in tar header based +// on the platform the archival is done. +func chmodTarEntry(perm os.FileMode) os.FileMode { + perm &= 0755 + // Add the x bit: make everything +x from windows + perm |= 0111 + + return perm +} + +func setHeaderForSpecialDevice(hdr *tar.Header, ta *tarAppender, name string, stat interface{}) (inode uint64, err error) { + // do nothing. no notion of Rdev, Inode, Nlink in stat on Windows + return +} + +// handleTarTypeBlockCharFifo is an OS-specific helper function used by +// createTarFile to handle the following types of header: Block; Char; Fifo +func handleTarTypeBlockCharFifo(hdr *tar.Header, path string) error { + return nil +} + +func handleLChmod(hdr *tar.Header, path string, hdrInfo os.FileInfo) error { + return nil +} + +func getFileUIDGID(stat interface{}) (int, int, error) { + // no notion of file ownership mapping yet on Windows + return 0, 0, nil +} diff --git a/vendor/github.com/containers/storage/pkg/archive/changes.go b/vendor/github.com/containers/storage/pkg/archive/changes.go new file mode 100644 index 00000000..234b0a68 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/changes.go @@ -0,0 +1,446 @@ +package archive + +import ( + "archive/tar" + "bytes" + "fmt" + "io" + "io/ioutil" + "os" + "path/filepath" + "sort" + "strings" + "syscall" + "time" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/pools" + "github.com/containers/storage/pkg/system" +) + +// ChangeType represents the change type. +type ChangeType int + +const ( + // ChangeModify represents the modify operation. + ChangeModify = iota + // ChangeAdd represents the add operation. + ChangeAdd + // ChangeDelete represents the delete operation. + ChangeDelete +) + +func (c ChangeType) String() string { + switch c { + case ChangeModify: + return "C" + case ChangeAdd: + return "A" + case ChangeDelete: + return "D" + } + return "" +} + +// Change represents a change, it wraps the change type and path. +// It describes changes of the files in the path respect to the +// parent layers. The change could be modify, add, delete. +// This is used for layer diff. +type Change struct { + Path string + Kind ChangeType +} + +func (change *Change) String() string { + return fmt.Sprintf("%s %s", change.Kind, change.Path) +} + +// for sort.Sort +type changesByPath []Change + +func (c changesByPath) Less(i, j int) bool { return c[i].Path < c[j].Path } +func (c changesByPath) Len() int { return len(c) } +func (c changesByPath) Swap(i, j int) { c[j], c[i] = c[i], c[j] } + +// Gnu tar and the go tar writer don't have sub-second mtime +// precision, which is problematic when we apply changes via tar +// files, we handle this by comparing for exact times, *or* same +// second count and either a or b having exactly 0 nanoseconds +func sameFsTime(a, b time.Time) bool { + return a == b || + (a.Unix() == b.Unix() && + (a.Nanosecond() == 0 || b.Nanosecond() == 0)) +} + +func sameFsTimeSpec(a, b syscall.Timespec) bool { + return a.Sec == b.Sec && + (a.Nsec == b.Nsec || a.Nsec == 0 || b.Nsec == 0) +} + +// Changes walks the path rw and determines changes for the files in the path, +// with respect to the parent layers +func Changes(layers []string, rw string) ([]Change, error) { + return changes(layers, rw, aufsDeletedFile, aufsMetadataSkip) +} + +func aufsMetadataSkip(path string) (skip bool, err error) { + skip, err = filepath.Match(string(os.PathSeparator)+WhiteoutMetaPrefix+"*", path) + if err != nil { + skip = true + } + return +} + +func aufsDeletedFile(root, path string, fi os.FileInfo) (string, error) { + f := filepath.Base(path) + + // If there is a whiteout, then the file was removed + if strings.HasPrefix(f, WhiteoutPrefix) { + originalFile := f[len(WhiteoutPrefix):] + return filepath.Join(filepath.Dir(path), originalFile), nil + } + + return "", nil +} + +type skipChange func(string) (bool, error) +type deleteChange func(string, string, os.FileInfo) (string, error) + +func changes(layers []string, rw string, dc deleteChange, sc skipChange) ([]Change, error) { + var ( + changes []Change + changedDirs = make(map[string]struct{}) + ) + + err := filepath.Walk(rw, func(path string, f os.FileInfo, err error) error { + if err != nil { + return err + } + + // Rebase path + path, err = filepath.Rel(rw, path) + if err != nil { + return err + } + + // As this runs on the daemon side, file paths are OS specific. + path = filepath.Join(string(os.PathSeparator), path) + + // Skip root + if path == string(os.PathSeparator) { + return nil + } + + if sc != nil { + if skip, err := sc(path); skip { + return err + } + } + + change := Change{ + Path: path, + } + + deletedFile, err := dc(rw, path, f) + if err != nil { + return err + } + + // Find out what kind of modification happened + if deletedFile != "" { + change.Path = deletedFile + change.Kind = ChangeDelete + } else { + // Otherwise, the file was added + change.Kind = ChangeAdd + + // ...Unless it already existed in a top layer, in which case, it's a modification + for _, layer := range layers { + stat, err := os.Stat(filepath.Join(layer, path)) + if err != nil && !os.IsNotExist(err) { + return err + } + if err == nil { + // The file existed in the top layer, so that's a modification + + // However, if it's a directory, maybe it wasn't actually modified. + // If you modify /foo/bar/baz, then /foo will be part of the changed files only because it's the parent of bar + if stat.IsDir() && f.IsDir() { + if f.Size() == stat.Size() && f.Mode() == stat.Mode() && sameFsTime(f.ModTime(), stat.ModTime()) { + // Both directories are the same, don't record the change + return nil + } + } + change.Kind = ChangeModify + break + } + } + } + + // If /foo/bar/file.txt is modified, then /foo/bar must be part of the changed files. + // This block is here to ensure the change is recorded even if the + // modify time, mode and size of the parent directory in the rw and ro layers are all equal. + // Check https://github.com/docker/docker/pull/13590 for details. + if f.IsDir() { + changedDirs[path] = struct{}{} + } + if change.Kind == ChangeAdd || change.Kind == ChangeDelete { + parent := filepath.Dir(path) + if _, ok := changedDirs[parent]; !ok && parent != "/" { + changes = append(changes, Change{Path: parent, Kind: ChangeModify}) + changedDirs[parent] = struct{}{} + } + } + + // Record change + changes = append(changes, change) + return nil + }) + if err != nil && !os.IsNotExist(err) { + return nil, err + } + return changes, nil +} + +// FileInfo describes the information of a file. +type FileInfo struct { + parent *FileInfo + name string + stat *system.StatT + children map[string]*FileInfo + capability []byte + added bool +} + +// LookUp looks up the file information of a file. +func (info *FileInfo) LookUp(path string) *FileInfo { + // As this runs on the daemon side, file paths are OS specific. + parent := info + if path == string(os.PathSeparator) { + return info + } + + pathElements := strings.Split(path, string(os.PathSeparator)) + for _, elem := range pathElements { + if elem != "" { + child := parent.children[elem] + if child == nil { + return nil + } + parent = child + } + } + return parent +} + +func (info *FileInfo) path() string { + if info.parent == nil { + // As this runs on the daemon side, file paths are OS specific. + return string(os.PathSeparator) + } + return filepath.Join(info.parent.path(), info.name) +} + +func (info *FileInfo) addChanges(oldInfo *FileInfo, changes *[]Change) { + + sizeAtEntry := len(*changes) + + if oldInfo == nil { + // add + change := Change{ + Path: info.path(), + Kind: ChangeAdd, + } + *changes = append(*changes, change) + info.added = true + } + + // We make a copy so we can modify it to detect additions + // also, we only recurse on the old dir if the new info is a directory + // otherwise any previous delete/change is considered recursive + oldChildren := make(map[string]*FileInfo) + if oldInfo != nil && info.isDir() { + for k, v := range oldInfo.children { + oldChildren[k] = v + } + } + + for name, newChild := range info.children { + oldChild, _ := oldChildren[name] + if oldChild != nil { + // change? + oldStat := oldChild.stat + newStat := newChild.stat + // Note: We can't compare inode or ctime or blocksize here, because these change + // when copying a file into a container. However, that is not generally a problem + // because any content change will change mtime, and any status change should + // be visible when actually comparing the stat fields. The only time this + // breaks down is if some code intentionally hides a change by setting + // back mtime + if statDifferent(oldStat, newStat) || + bytes.Compare(oldChild.capability, newChild.capability) != 0 { + change := Change{ + Path: newChild.path(), + Kind: ChangeModify, + } + *changes = append(*changes, change) + newChild.added = true + } + + // Remove from copy so we can detect deletions + delete(oldChildren, name) + } + + newChild.addChanges(oldChild, changes) + } + for _, oldChild := range oldChildren { + // delete + change := Change{ + Path: oldChild.path(), + Kind: ChangeDelete, + } + *changes = append(*changes, change) + } + + // If there were changes inside this directory, we need to add it, even if the directory + // itself wasn't changed. This is needed to properly save and restore filesystem permissions. + // As this runs on the daemon side, file paths are OS specific. + if len(*changes) > sizeAtEntry && info.isDir() && !info.added && info.path() != string(os.PathSeparator) { + change := Change{ + Path: info.path(), + Kind: ChangeModify, + } + // Let's insert the directory entry before the recently added entries located inside this dir + *changes = append(*changes, change) // just to resize the slice, will be overwritten + copy((*changes)[sizeAtEntry+1:], (*changes)[sizeAtEntry:]) + (*changes)[sizeAtEntry] = change + } + +} + +// Changes add changes to file information. +func (info *FileInfo) Changes(oldInfo *FileInfo) []Change { + var changes []Change + + info.addChanges(oldInfo, &changes) + + return changes +} + +func newRootFileInfo() *FileInfo { + // As this runs on the daemon side, file paths are OS specific. + root := &FileInfo{ + name: string(os.PathSeparator), + children: make(map[string]*FileInfo), + } + return root +} + +// ChangesDirs compares two directories and generates an array of Change objects describing the changes. +// If oldDir is "", then all files in newDir will be Add-Changes. +func ChangesDirs(newDir, oldDir string) ([]Change, error) { + var ( + oldRoot, newRoot *FileInfo + ) + if oldDir == "" { + emptyDir, err := ioutil.TempDir("", "empty") + if err != nil { + return nil, err + } + defer os.Remove(emptyDir) + oldDir = emptyDir + } + oldRoot, newRoot, err := collectFileInfoForChanges(oldDir, newDir) + if err != nil { + return nil, err + } + + return newRoot.Changes(oldRoot), nil +} + +// ChangesSize calculates the size in bytes of the provided changes, based on newDir. +func ChangesSize(newDir string, changes []Change) int64 { + var ( + size int64 + sf = make(map[uint64]struct{}) + ) + for _, change := range changes { + if change.Kind == ChangeModify || change.Kind == ChangeAdd { + file := filepath.Join(newDir, change.Path) + fileInfo, err := os.Lstat(file) + if err != nil { + logrus.Errorf("Can not stat %q: %s", file, err) + continue + } + + if fileInfo != nil && !fileInfo.IsDir() { + if hasHardlinks(fileInfo) { + inode := getIno(fileInfo) + if _, ok := sf[inode]; !ok { + size += fileInfo.Size() + sf[inode] = struct{}{} + } + } else { + size += fileInfo.Size() + } + } + } + } + return size +} + +// ExportChanges produces an Archive from the provided changes, relative to dir. +func ExportChanges(dir string, changes []Change, uidMaps, gidMaps []idtools.IDMap) (Archive, error) { + reader, writer := io.Pipe() + go func() { + ta := &tarAppender{ + TarWriter: tar.NewWriter(writer), + Buffer: pools.BufioWriter32KPool.Get(nil), + SeenFiles: make(map[uint64]string), + UIDMaps: uidMaps, + GIDMaps: gidMaps, + } + // this buffer is needed for the duration of this piped stream + defer pools.BufioWriter32KPool.Put(ta.Buffer) + + sort.Sort(changesByPath(changes)) + + // In general we log errors here but ignore them because + // during e.g. a diff operation the container can continue + // mutating the filesystem and we can see transient errors + // from this + for _, change := range changes { + if change.Kind == ChangeDelete { + whiteOutDir := filepath.Dir(change.Path) + whiteOutBase := filepath.Base(change.Path) + whiteOut := filepath.Join(whiteOutDir, WhiteoutPrefix+whiteOutBase) + timestamp := time.Now() + hdr := &tar.Header{ + Name: whiteOut[1:], + Size: 0, + ModTime: timestamp, + AccessTime: timestamp, + ChangeTime: timestamp, + } + if err := ta.TarWriter.WriteHeader(hdr); err != nil { + logrus.Debugf("Can't write whiteout header: %s", err) + } + } else { + path := filepath.Join(dir, change.Path) + if err := ta.addTarFile(path, change.Path[1:]); err != nil { + logrus.Debugf("Can't add file %s to tar: %s", path, err) + } + } + } + + // Make sure to check the error on Close. + if err := ta.TarWriter.Close(); err != nil { + logrus.Debugf("Can't close layer: %s", err) + } + if err := writer.Close(); err != nil { + logrus.Debugf("failed close Changes writer: %s", err) + } + }() + return reader, nil +} diff --git a/vendor/github.com/containers/storage/pkg/archive/changes_linux.go b/vendor/github.com/containers/storage/pkg/archive/changes_linux.go new file mode 100644 index 00000000..798d7bfc --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/changes_linux.go @@ -0,0 +1,312 @@ +package archive + +import ( + "bytes" + "fmt" + "os" + "path/filepath" + "sort" + "syscall" + "unsafe" + + "github.com/containers/storage/pkg/system" +) + +// walker is used to implement collectFileInfoForChanges on linux. Where this +// method in general returns the entire contents of two directory trees, we +// optimize some FS calls out on linux. In particular, we take advantage of the +// fact that getdents(2) returns the inode of each file in the directory being +// walked, which, when walking two trees in parallel to generate a list of +// changes, can be used to prune subtrees without ever having to lstat(2) them +// directly. Eliminating stat calls in this way can save up to seconds on large +// images. +type walker struct { + dir1 string + dir2 string + root1 *FileInfo + root2 *FileInfo +} + +// collectFileInfoForChanges returns a complete representation of the trees +// rooted at dir1 and dir2, with one important exception: any subtree or +// leaf where the inode and device numbers are an exact match between dir1 +// and dir2 will be pruned from the results. This method is *only* to be used +// to generating a list of changes between the two directories, as it does not +// reflect the full contents. +func collectFileInfoForChanges(dir1, dir2 string) (*FileInfo, *FileInfo, error) { + w := &walker{ + dir1: dir1, + dir2: dir2, + root1: newRootFileInfo(), + root2: newRootFileInfo(), + } + + i1, err := os.Lstat(w.dir1) + if err != nil { + return nil, nil, err + } + i2, err := os.Lstat(w.dir2) + if err != nil { + return nil, nil, err + } + + if err := w.walk("/", i1, i2); err != nil { + return nil, nil, err + } + + return w.root1, w.root2, nil +} + +// Given a FileInfo, its path info, and a reference to the root of the tree +// being constructed, register this file with the tree. +func walkchunk(path string, fi os.FileInfo, dir string, root *FileInfo) error { + if fi == nil { + return nil + } + parent := root.LookUp(filepath.Dir(path)) + if parent == nil { + return fmt.Errorf("collectFileInfoForChanges: Unexpectedly no parent for %s", path) + } + info := &FileInfo{ + name: filepath.Base(path), + children: make(map[string]*FileInfo), + parent: parent, + } + cpath := filepath.Join(dir, path) + stat, err := system.FromStatT(fi.Sys().(*syscall.Stat_t)) + if err != nil { + return err + } + info.stat = stat + info.capability, _ = system.Lgetxattr(cpath, "security.capability") // lgetxattr(2): fs access + parent.children[info.name] = info + return nil +} + +// Walk a subtree rooted at the same path in both trees being iterated. For +// example, /docker/overlay/1234/a/b/c/d and /docker/overlay/8888/a/b/c/d +func (w *walker) walk(path string, i1, i2 os.FileInfo) (err error) { + // Register these nodes with the return trees, unless we're still at the + // (already-created) roots: + if path != "/" { + if err := walkchunk(path, i1, w.dir1, w.root1); err != nil { + return err + } + if err := walkchunk(path, i2, w.dir2, w.root2); err != nil { + return err + } + } + + is1Dir := i1 != nil && i1.IsDir() + is2Dir := i2 != nil && i2.IsDir() + + sameDevice := false + if i1 != nil && i2 != nil { + si1 := i1.Sys().(*syscall.Stat_t) + si2 := i2.Sys().(*syscall.Stat_t) + if si1.Dev == si2.Dev { + sameDevice = true + } + } + + // If these files are both non-existent, or leaves (non-dirs), we are done. + if !is1Dir && !is2Dir { + return nil + } + + // Fetch the names of all the files contained in both directories being walked: + var names1, names2 []nameIno + if is1Dir { + names1, err = readdirnames(filepath.Join(w.dir1, path)) // getdents(2): fs access + if err != nil { + return err + } + } + if is2Dir { + names2, err = readdirnames(filepath.Join(w.dir2, path)) // getdents(2): fs access + if err != nil { + return err + } + } + + // We have lists of the files contained in both parallel directories, sorted + // in the same order. Walk them in parallel, generating a unique merged list + // of all items present in either or both directories. + var names []string + ix1 := 0 + ix2 := 0 + + for { + if ix1 >= len(names1) { + break + } + if ix2 >= len(names2) { + break + } + + ni1 := names1[ix1] + ni2 := names2[ix2] + + switch bytes.Compare([]byte(ni1.name), []byte(ni2.name)) { + case -1: // ni1 < ni2 -- advance ni1 + // we will not encounter ni1 in names2 + names = append(names, ni1.name) + ix1++ + case 0: // ni1 == ni2 + if ni1.ino != ni2.ino || !sameDevice { + names = append(names, ni1.name) + } + ix1++ + ix2++ + case 1: // ni1 > ni2 -- advance ni2 + // we will not encounter ni2 in names1 + names = append(names, ni2.name) + ix2++ + } + } + for ix1 < len(names1) { + names = append(names, names1[ix1].name) + ix1++ + } + for ix2 < len(names2) { + names = append(names, names2[ix2].name) + ix2++ + } + + // For each of the names present in either or both of the directories being + // iterated, stat the name under each root, and recurse the pair of them: + for _, name := range names { + fname := filepath.Join(path, name) + var cInfo1, cInfo2 os.FileInfo + if is1Dir { + cInfo1, err = os.Lstat(filepath.Join(w.dir1, fname)) // lstat(2): fs access + if err != nil && !os.IsNotExist(err) { + return err + } + } + if is2Dir { + cInfo2, err = os.Lstat(filepath.Join(w.dir2, fname)) // lstat(2): fs access + if err != nil && !os.IsNotExist(err) { + return err + } + } + if err = w.walk(fname, cInfo1, cInfo2); err != nil { + return err + } + } + return nil +} + +// {name,inode} pairs used to support the early-pruning logic of the walker type +type nameIno struct { + name string + ino uint64 +} + +type nameInoSlice []nameIno + +func (s nameInoSlice) Len() int { return len(s) } +func (s nameInoSlice) Swap(i, j int) { s[i], s[j] = s[j], s[i] } +func (s nameInoSlice) Less(i, j int) bool { return s[i].name < s[j].name } + +// readdirnames is a hacked-apart version of the Go stdlib code, exposing inode +// numbers further up the stack when reading directory contents. Unlike +// os.Readdirnames, which returns a list of filenames, this function returns a +// list of {filename,inode} pairs. +func readdirnames(dirname string) (names []nameIno, err error) { + var ( + size = 100 + buf = make([]byte, 4096) + nbuf int + bufp int + nb int + ) + + f, err := os.Open(dirname) + if err != nil { + return nil, err + } + defer f.Close() + + names = make([]nameIno, 0, size) // Empty with room to grow. + for { + // Refill the buffer if necessary + if bufp >= nbuf { + bufp = 0 + nbuf, err = syscall.ReadDirent(int(f.Fd()), buf) // getdents on linux + if nbuf < 0 { + nbuf = 0 + } + if err != nil { + return nil, os.NewSyscallError("readdirent", err) + } + if nbuf <= 0 { + break // EOF + } + } + + // Drain the buffer + nb, names = parseDirent(buf[bufp:nbuf], names) + bufp += nb + } + + sl := nameInoSlice(names) + sort.Sort(sl) + return sl, nil +} + +// parseDirent is a minor modification of syscall.ParseDirent (linux version) +// which returns {name,inode} pairs instead of just names. +func parseDirent(buf []byte, names []nameIno) (consumed int, newnames []nameIno) { + origlen := len(buf) + for len(buf) > 0 { + dirent := (*syscall.Dirent)(unsafe.Pointer(&buf[0])) + buf = buf[dirent.Reclen:] + if dirent.Ino == 0 { // File absent in directory. + continue + } + bytes := (*[10000]byte)(unsafe.Pointer(&dirent.Name[0])) + var name = string(bytes[0:clen(bytes[:])]) + if name == "." || name == ".." { // Useless names + continue + } + names = append(names, nameIno{name, dirent.Ino}) + } + return origlen - len(buf), names +} + +func clen(n []byte) int { + for i := 0; i < len(n); i++ { + if n[i] == 0 { + return i + } + } + return len(n) +} + +// OverlayChanges walks the path rw and determines changes for the files in the path, +// with respect to the parent layers +func OverlayChanges(layers []string, rw string) ([]Change, error) { + return changes(layers, rw, overlayDeletedFile, nil) +} + +func overlayDeletedFile(root, path string, fi os.FileInfo) (string, error) { + if fi.Mode()&os.ModeCharDevice != 0 { + s := fi.Sys().(*syscall.Stat_t) + if major(uint64(s.Rdev)) == 0 && minor(uint64(s.Rdev)) == 0 { + return path, nil + } + } + if fi.Mode()&os.ModeDir != 0 { + opaque, err := system.Lgetxattr(filepath.Join(root, path), "trusted.overlay.opaque") + if err != nil { + return "", err + } + if opaque != nil && len(opaque) == 1 && opaque[0] == 'y' { + return path, nil + } + } + + return "", nil + +} diff --git a/vendor/github.com/containers/storage/pkg/archive/changes_other.go b/vendor/github.com/containers/storage/pkg/archive/changes_other.go new file mode 100644 index 00000000..e1d1e7a9 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/changes_other.go @@ -0,0 +1,97 @@ +// +build !linux + +package archive + +import ( + "fmt" + "os" + "path/filepath" + "runtime" + "strings" + + "github.com/containers/storage/pkg/system" +) + +func collectFileInfoForChanges(oldDir, newDir string) (*FileInfo, *FileInfo, error) { + var ( + oldRoot, newRoot *FileInfo + err1, err2 error + errs = make(chan error, 2) + ) + go func() { + oldRoot, err1 = collectFileInfo(oldDir) + errs <- err1 + }() + go func() { + newRoot, err2 = collectFileInfo(newDir) + errs <- err2 + }() + + // block until both routines have returned + for i := 0; i < 2; i++ { + if err := <-errs; err != nil { + return nil, nil, err + } + } + + return oldRoot, newRoot, nil +} + +func collectFileInfo(sourceDir string) (*FileInfo, error) { + root := newRootFileInfo() + + err := filepath.Walk(sourceDir, func(path string, f os.FileInfo, err error) error { + if err != nil { + return err + } + + // Rebase path + relPath, err := filepath.Rel(sourceDir, path) + if err != nil { + return err + } + + // As this runs on the daemon side, file paths are OS specific. + relPath = filepath.Join(string(os.PathSeparator), relPath) + + // See https://github.com/golang/go/issues/9168 - bug in filepath.Join. + // Temporary workaround. If the returned path starts with two backslashes, + // trim it down to a single backslash. Only relevant on Windows. + if runtime.GOOS == "windows" { + if strings.HasPrefix(relPath, `\\`) { + relPath = relPath[1:] + } + } + + if relPath == string(os.PathSeparator) { + return nil + } + + parent := root.LookUp(filepath.Dir(relPath)) + if parent == nil { + return fmt.Errorf("collectFileInfo: Unexpectedly no parent for %s", relPath) + } + + info := &FileInfo{ + name: filepath.Base(relPath), + children: make(map[string]*FileInfo), + parent: parent, + } + + s, err := system.Lstat(path) + if err != nil { + return err + } + info.stat = s + + info.capability, _ = system.Lgetxattr(path, "security.capability") + + parent.children[info.name] = info + + return nil + }) + if err != nil { + return nil, err + } + return root, nil +} diff --git a/vendor/github.com/containers/storage/pkg/archive/changes_unix.go b/vendor/github.com/containers/storage/pkg/archive/changes_unix.go new file mode 100644 index 00000000..43dd94e2 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/changes_unix.go @@ -0,0 +1,36 @@ +// +build !windows + +package archive + +import ( + "os" + "syscall" + + "github.com/containers/storage/pkg/system" +) + +func statDifferent(oldStat *system.StatT, newStat *system.StatT) bool { + // Don't look at size for dirs, its not a good measure of change + if oldStat.Mode() != newStat.Mode() || + oldStat.UID() != newStat.UID() || + oldStat.GID() != newStat.GID() || + oldStat.Rdev() != newStat.Rdev() || + // Don't look at size for dirs, its not a good measure of change + (oldStat.Mode()&syscall.S_IFDIR != syscall.S_IFDIR && + (!sameFsTimeSpec(oldStat.Mtim(), newStat.Mtim()) || (oldStat.Size() != newStat.Size()))) { + return true + } + return false +} + +func (info *FileInfo) isDir() bool { + return info.parent == nil || info.stat.Mode()&syscall.S_IFDIR != 0 +} + +func getIno(fi os.FileInfo) uint64 { + return uint64(fi.Sys().(*syscall.Stat_t).Ino) +} + +func hasHardlinks(fi os.FileInfo) bool { + return fi.Sys().(*syscall.Stat_t).Nlink > 1 +} diff --git a/vendor/github.com/containers/storage/pkg/archive/changes_windows.go b/vendor/github.com/containers/storage/pkg/archive/changes_windows.go new file mode 100644 index 00000000..06eadd66 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/changes_windows.go @@ -0,0 +1,30 @@ +package archive + +import ( + "os" + + "github.com/containers/storage/pkg/system" +) + +func statDifferent(oldStat *system.StatT, newStat *system.StatT) bool { + + // Don't look at size for dirs, its not a good measure of change + if oldStat.ModTime() != newStat.ModTime() || + oldStat.Mode() != newStat.Mode() || + oldStat.Size() != newStat.Size() && !oldStat.IsDir() { + return true + } + return false +} + +func (info *FileInfo) isDir() bool { + return info.parent == nil || info.stat.IsDir() +} + +func getIno(fi os.FileInfo) (inode uint64) { + return +} + +func hasHardlinks(fi os.FileInfo) bool { + return false +} diff --git a/vendor/github.com/containers/storage/pkg/archive/copy.go b/vendor/github.com/containers/storage/pkg/archive/copy.go new file mode 100644 index 00000000..05c243d3 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/copy.go @@ -0,0 +1,458 @@ +package archive + +import ( + "archive/tar" + "errors" + "io" + "io/ioutil" + "os" + "path/filepath" + "strings" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/pkg/system" +) + +// Errors used or returned by this file. +var ( + ErrNotDirectory = errors.New("not a directory") + ErrDirNotExists = errors.New("no such directory") + ErrCannotCopyDir = errors.New("cannot copy directory") + ErrInvalidCopySource = errors.New("invalid copy source content") +) + +// PreserveTrailingDotOrSeparator returns the given cleaned path (after +// processing using any utility functions from the path or filepath stdlib +// packages) and appends a trailing `/.` or `/` if its corresponding original +// path (from before being processed by utility functions from the path or +// filepath stdlib packages) ends with a trailing `/.` or `/`. If the cleaned +// path already ends in a `.` path segment, then another is not added. If the +// clean path already ends in a path separator, then another is not added. +func PreserveTrailingDotOrSeparator(cleanedPath, originalPath string) string { + // Ensure paths are in platform semantics + cleanedPath = normalizePath(cleanedPath) + originalPath = normalizePath(originalPath) + + if !specifiesCurrentDir(cleanedPath) && specifiesCurrentDir(originalPath) { + if !hasTrailingPathSeparator(cleanedPath) { + // Add a separator if it doesn't already end with one (a cleaned + // path would only end in a separator if it is the root). + cleanedPath += string(filepath.Separator) + } + cleanedPath += "." + } + + if !hasTrailingPathSeparator(cleanedPath) && hasTrailingPathSeparator(originalPath) { + cleanedPath += string(filepath.Separator) + } + + return cleanedPath +} + +// assertsDirectory returns whether the given path is +// asserted to be a directory, i.e., the path ends with +// a trailing '/' or `/.`, assuming a path separator of `/`. +func assertsDirectory(path string) bool { + return hasTrailingPathSeparator(path) || specifiesCurrentDir(path) +} + +// hasTrailingPathSeparator returns whether the given +// path ends with the system's path separator character. +func hasTrailingPathSeparator(path string) bool { + return len(path) > 0 && os.IsPathSeparator(path[len(path)-1]) +} + +// specifiesCurrentDir returns whether the given path specifies +// a "current directory", i.e., the last path segment is `.`. +func specifiesCurrentDir(path string) bool { + return filepath.Base(path) == "." +} + +// SplitPathDirEntry splits the given path between its directory name and its +// basename by first cleaning the path but preserves a trailing "." if the +// original path specified the current directory. +func SplitPathDirEntry(path string) (dir, base string) { + cleanedPath := filepath.Clean(normalizePath(path)) + + if specifiesCurrentDir(path) { + cleanedPath += string(filepath.Separator) + "." + } + + return filepath.Dir(cleanedPath), filepath.Base(cleanedPath) +} + +// TarResource archives the resource described by the given CopyInfo to a Tar +// archive. A non-nil error is returned if sourcePath does not exist or is +// asserted to be a directory but exists as another type of file. +// +// This function acts as a convenient wrapper around TarWithOptions, which +// requires a directory as the source path. TarResource accepts either a +// directory or a file path and correctly sets the Tar options. +func TarResource(sourceInfo CopyInfo) (content Archive, err error) { + return TarResourceRebase(sourceInfo.Path, sourceInfo.RebaseName) +} + +// TarResourceRebase is like TarResource but renames the first path element of +// items in the resulting tar archive to match the given rebaseName if not "". +func TarResourceRebase(sourcePath, rebaseName string) (content Archive, err error) { + sourcePath = normalizePath(sourcePath) + if _, err = os.Lstat(sourcePath); err != nil { + // Catches the case where the source does not exist or is not a + // directory if asserted to be a directory, as this also causes an + // error. + return + } + + // Separate the source path between it's directory and + // the entry in that directory which we are archiving. + sourceDir, sourceBase := SplitPathDirEntry(sourcePath) + + filter := []string{sourceBase} + + logrus.Debugf("copying %q from %q", sourceBase, sourceDir) + + return TarWithOptions(sourceDir, &TarOptions{ + Compression: Uncompressed, + IncludeFiles: filter, + IncludeSourceDir: true, + RebaseNames: map[string]string{ + sourceBase: rebaseName, + }, + }) +} + +// CopyInfo holds basic info about the source +// or destination path of a copy operation. +type CopyInfo struct { + Path string + Exists bool + IsDir bool + RebaseName string +} + +// CopyInfoSourcePath stats the given path to create a CopyInfo +// struct representing that resource for the source of an archive copy +// operation. The given path should be an absolute local path. A source path +// has all symlinks evaluated that appear before the last path separator ("/" +// on Unix). As it is to be a copy source, the path must exist. +func CopyInfoSourcePath(path string, followLink bool) (CopyInfo, error) { + // normalize the file path and then evaluate the symbol link + // we will use the target file instead of the symbol link if + // followLink is set + path = normalizePath(path) + + resolvedPath, rebaseName, err := ResolveHostSourcePath(path, followLink) + if err != nil { + return CopyInfo{}, err + } + + stat, err := os.Lstat(resolvedPath) + if err != nil { + return CopyInfo{}, err + } + + return CopyInfo{ + Path: resolvedPath, + Exists: true, + IsDir: stat.IsDir(), + RebaseName: rebaseName, + }, nil +} + +// CopyInfoDestinationPath stats the given path to create a CopyInfo +// struct representing that resource for the destination of an archive copy +// operation. The given path should be an absolute local path. +func CopyInfoDestinationPath(path string) (info CopyInfo, err error) { + maxSymlinkIter := 10 // filepath.EvalSymlinks uses 255, but 10 already seems like a lot. + path = normalizePath(path) + originalPath := path + + stat, err := os.Lstat(path) + + if err == nil && stat.Mode()&os.ModeSymlink == 0 { + // The path exists and is not a symlink. + return CopyInfo{ + Path: path, + Exists: true, + IsDir: stat.IsDir(), + }, nil + } + + // While the path is a symlink. + for n := 0; err == nil && stat.Mode()&os.ModeSymlink != 0; n++ { + if n > maxSymlinkIter { + // Don't follow symlinks more than this arbitrary number of times. + return CopyInfo{}, errors.New("too many symlinks in " + originalPath) + } + + // The path is a symbolic link. We need to evaluate it so that the + // destination of the copy operation is the link target and not the + // link itself. This is notably different than CopyInfoSourcePath which + // only evaluates symlinks before the last appearing path separator. + // Also note that it is okay if the last path element is a broken + // symlink as the copy operation should create the target. + var linkTarget string + + linkTarget, err = os.Readlink(path) + if err != nil { + return CopyInfo{}, err + } + + if !system.IsAbs(linkTarget) { + // Join with the parent directory. + dstParent, _ := SplitPathDirEntry(path) + linkTarget = filepath.Join(dstParent, linkTarget) + } + + path = linkTarget + stat, err = os.Lstat(path) + } + + if err != nil { + // It's okay if the destination path doesn't exist. We can still + // continue the copy operation if the parent directory exists. + if !os.IsNotExist(err) { + return CopyInfo{}, err + } + + // Ensure destination parent dir exists. + dstParent, _ := SplitPathDirEntry(path) + + parentDirStat, err := os.Lstat(dstParent) + if err != nil { + return CopyInfo{}, err + } + if !parentDirStat.IsDir() { + return CopyInfo{}, ErrNotDirectory + } + + return CopyInfo{Path: path}, nil + } + + // The path exists after resolving symlinks. + return CopyInfo{ + Path: path, + Exists: true, + IsDir: stat.IsDir(), + }, nil +} + +// PrepareArchiveCopy prepares the given srcContent archive, which should +// contain the archived resource described by srcInfo, to the destination +// described by dstInfo. Returns the possibly modified content archive along +// with the path to the destination directory which it should be extracted to. +func PrepareArchiveCopy(srcContent Reader, srcInfo, dstInfo CopyInfo) (dstDir string, content Archive, err error) { + // Ensure in platform semantics + srcInfo.Path = normalizePath(srcInfo.Path) + dstInfo.Path = normalizePath(dstInfo.Path) + + // Separate the destination path between its directory and base + // components in case the source archive contents need to be rebased. + dstDir, dstBase := SplitPathDirEntry(dstInfo.Path) + _, srcBase := SplitPathDirEntry(srcInfo.Path) + + switch { + case dstInfo.Exists && dstInfo.IsDir: + // The destination exists as a directory. No alteration + // to srcContent is needed as its contents can be + // simply extracted to the destination directory. + return dstInfo.Path, ioutil.NopCloser(srcContent), nil + case dstInfo.Exists && srcInfo.IsDir: + // The destination exists as some type of file and the source + // content is a directory. This is an error condition since + // you cannot copy a directory to an existing file location. + return "", nil, ErrCannotCopyDir + case dstInfo.Exists: + // The destination exists as some type of file and the source content + // is also a file. The source content entry will have to be renamed to + // have a basename which matches the destination path's basename. + if len(srcInfo.RebaseName) != 0 { + srcBase = srcInfo.RebaseName + } + return dstDir, RebaseArchiveEntries(srcContent, srcBase, dstBase), nil + case srcInfo.IsDir: + // The destination does not exist and the source content is an archive + // of a directory. The archive should be extracted to the parent of + // the destination path instead, and when it is, the directory that is + // created as a result should take the name of the destination path. + // The source content entries will have to be renamed to have a + // basename which matches the destination path's basename. + if len(srcInfo.RebaseName) != 0 { + srcBase = srcInfo.RebaseName + } + return dstDir, RebaseArchiveEntries(srcContent, srcBase, dstBase), nil + case assertsDirectory(dstInfo.Path): + // The destination does not exist and is asserted to be created as a + // directory, but the source content is not a directory. This is an + // error condition since you cannot create a directory from a file + // source. + return "", nil, ErrDirNotExists + default: + // The last remaining case is when the destination does not exist, is + // not asserted to be a directory, and the source content is not an + // archive of a directory. It this case, the destination file will need + // to be created when the archive is extracted and the source content + // entry will have to be renamed to have a basename which matches the + // destination path's basename. + if len(srcInfo.RebaseName) != 0 { + srcBase = srcInfo.RebaseName + } + return dstDir, RebaseArchiveEntries(srcContent, srcBase, dstBase), nil + } + +} + +// RebaseArchiveEntries rewrites the given srcContent archive replacing +// an occurrence of oldBase with newBase at the beginning of entry names. +func RebaseArchiveEntries(srcContent Reader, oldBase, newBase string) Archive { + if oldBase == string(os.PathSeparator) { + // If oldBase specifies the root directory, use an empty string as + // oldBase instead so that newBase doesn't replace the path separator + // that all paths will start with. + oldBase = "" + } + + rebased, w := io.Pipe() + + go func() { + srcTar := tar.NewReader(srcContent) + rebasedTar := tar.NewWriter(w) + + for { + hdr, err := srcTar.Next() + if err == io.EOF { + // Signals end of archive. + rebasedTar.Close() + w.Close() + return + } + if err != nil { + w.CloseWithError(err) + return + } + + hdr.Name = strings.Replace(hdr.Name, oldBase, newBase, 1) + + if err = rebasedTar.WriteHeader(hdr); err != nil { + w.CloseWithError(err) + return + } + + if _, err = io.Copy(rebasedTar, srcTar); err != nil { + w.CloseWithError(err) + return + } + } + }() + + return rebased +} + +// CopyResource performs an archive copy from the given source path to the +// given destination path. The source path MUST exist and the destination +// path's parent directory must exist. +func CopyResource(srcPath, dstPath string, followLink bool) error { + var ( + srcInfo CopyInfo + err error + ) + + // Ensure in platform semantics + srcPath = normalizePath(srcPath) + dstPath = normalizePath(dstPath) + + // Clean the source and destination paths. + srcPath = PreserveTrailingDotOrSeparator(filepath.Clean(srcPath), srcPath) + dstPath = PreserveTrailingDotOrSeparator(filepath.Clean(dstPath), dstPath) + + if srcInfo, err = CopyInfoSourcePath(srcPath, followLink); err != nil { + return err + } + + content, err := TarResource(srcInfo) + if err != nil { + return err + } + defer content.Close() + + return CopyTo(content, srcInfo, dstPath) +} + +// CopyTo handles extracting the given content whose +// entries should be sourced from srcInfo to dstPath. +func CopyTo(content Reader, srcInfo CopyInfo, dstPath string) error { + // The destination path need not exist, but CopyInfoDestinationPath will + // ensure that at least the parent directory exists. + dstInfo, err := CopyInfoDestinationPath(normalizePath(dstPath)) + if err != nil { + return err + } + + dstDir, copyArchive, err := PrepareArchiveCopy(content, srcInfo, dstInfo) + if err != nil { + return err + } + defer copyArchive.Close() + + options := &TarOptions{ + NoLchown: true, + NoOverwriteDirNonDir: true, + } + + return Untar(copyArchive, dstDir, options) +} + +// ResolveHostSourcePath decides real path need to be copied with parameters such as +// whether to follow symbol link or not, if followLink is true, resolvedPath will return +// link target of any symbol link file, else it will only resolve symlink of directory +// but return symbol link file itself without resolving. +func ResolveHostSourcePath(path string, followLink bool) (resolvedPath, rebaseName string, err error) { + if followLink { + resolvedPath, err = filepath.EvalSymlinks(path) + if err != nil { + return + } + + resolvedPath, rebaseName = GetRebaseName(path, resolvedPath) + } else { + dirPath, basePath := filepath.Split(path) + + // if not follow symbol link, then resolve symbol link of parent dir + var resolvedDirPath string + resolvedDirPath, err = filepath.EvalSymlinks(dirPath) + if err != nil { + return + } + // resolvedDirPath will have been cleaned (no trailing path separators) so + // we can manually join it with the base path element. + resolvedPath = resolvedDirPath + string(filepath.Separator) + basePath + if hasTrailingPathSeparator(path) && filepath.Base(path) != filepath.Base(resolvedPath) { + rebaseName = filepath.Base(path) + } + } + return resolvedPath, rebaseName, nil +} + +// GetRebaseName normalizes and compares path and resolvedPath, +// return completed resolved path and rebased file name +func GetRebaseName(path, resolvedPath string) (string, string) { + // linkTarget will have been cleaned (no trailing path separators and dot) so + // we can manually join it with them + var rebaseName string + if specifiesCurrentDir(path) && !specifiesCurrentDir(resolvedPath) { + resolvedPath += string(filepath.Separator) + "." + } + + if hasTrailingPathSeparator(path) && !hasTrailingPathSeparator(resolvedPath) { + resolvedPath += string(filepath.Separator) + } + + if filepath.Base(path) != filepath.Base(resolvedPath) { + // In the case where the path had a trailing separator and a symlink + // evaluation has changed the last path component, we will need to + // rebase the name in the archive that is being copied to match the + // originally requested name. + rebaseName = filepath.Base(path) + } + return resolvedPath, rebaseName +} diff --git a/vendor/github.com/containers/storage/pkg/archive/copy_unix.go b/vendor/github.com/containers/storage/pkg/archive/copy_unix.go new file mode 100644 index 00000000..e305b5e4 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/copy_unix.go @@ -0,0 +1,11 @@ +// +build !windows + +package archive + +import ( + "path/filepath" +) + +func normalizePath(path string) string { + return filepath.ToSlash(path) +} diff --git a/vendor/github.com/containers/storage/pkg/archive/copy_windows.go b/vendor/github.com/containers/storage/pkg/archive/copy_windows.go new file mode 100644 index 00000000..2b775b45 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/copy_windows.go @@ -0,0 +1,9 @@ +package archive + +import ( + "path/filepath" +) + +func normalizePath(path string) string { + return filepath.FromSlash(path) +} diff --git a/vendor/github.com/containers/storage/pkg/archive/diff.go b/vendor/github.com/containers/storage/pkg/archive/diff.go new file mode 100644 index 00000000..eba71738 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/diff.go @@ -0,0 +1,279 @@ +package archive + +import ( + "archive/tar" + "fmt" + "io" + "io/ioutil" + "os" + "path/filepath" + "runtime" + "strings" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/pools" + "github.com/containers/storage/pkg/system" +) + +// UnpackLayer unpack `layer` to a `dest`. The stream `layer` can be +// compressed or uncompressed. +// Returns the size in bytes of the contents of the layer. +func UnpackLayer(dest string, layer Reader, options *TarOptions) (size int64, err error) { + tr := tar.NewReader(layer) + trBuf := pools.BufioReader32KPool.Get(tr) + defer pools.BufioReader32KPool.Put(trBuf) + + var dirs []*tar.Header + unpackedPaths := make(map[string]struct{}) + + if options == nil { + options = &TarOptions{} + } + if options.ExcludePatterns == nil { + options.ExcludePatterns = []string{} + } + remappedRootUID, remappedRootGID, err := idtools.GetRootUIDGID(options.UIDMaps, options.GIDMaps) + if err != nil { + return 0, err + } + + aufsTempdir := "" + aufsHardlinks := make(map[string]*tar.Header) + + if options == nil { + options = &TarOptions{} + } + // Iterate through the files in the archive. + for { + hdr, err := tr.Next() + if err == io.EOF { + // end of tar archive + break + } + if err != nil { + return 0, err + } + + size += hdr.Size + + // Normalize name, for safety and for a simple is-root check + hdr.Name = filepath.Clean(hdr.Name) + + // Windows does not support filenames with colons in them. Ignore + // these files. This is not a problem though (although it might + // appear that it is). Let's suppose a client is running docker pull. + // The daemon it points to is Windows. Would it make sense for the + // client to be doing a docker pull Ubuntu for example (which has files + // with colons in the name under /usr/share/man/man3)? No, absolutely + // not as it would really only make sense that they were pulling a + // Windows image. However, for development, it is necessary to be able + // to pull Linux images which are in the repository. + // + // TODO Windows. Once the registry is aware of what images are Windows- + // specific or Linux-specific, this warning should be changed to an error + // to cater for the situation where someone does manage to upload a Linux + // image but have it tagged as Windows inadvertently. + if runtime.GOOS == "windows" { + if strings.Contains(hdr.Name, ":") { + logrus.Warnf("Windows: Ignoring %s (is this a Linux image?)", hdr.Name) + continue + } + } + + // Note as these operations are platform specific, so must the slash be. + if !strings.HasSuffix(hdr.Name, string(os.PathSeparator)) { + // Not the root directory, ensure that the parent directory exists. + // This happened in some tests where an image had a tarfile without any + // parent directories. + parent := filepath.Dir(hdr.Name) + parentPath := filepath.Join(dest, parent) + + if _, err := os.Lstat(parentPath); err != nil && os.IsNotExist(err) { + err = system.MkdirAll(parentPath, 0600) + if err != nil { + return 0, err + } + } + } + + // Skip AUFS metadata dirs + if strings.HasPrefix(hdr.Name, WhiteoutMetaPrefix) { + // Regular files inside /.wh..wh.plnk can be used as hardlink targets + // We don't want this directory, but we need the files in them so that + // such hardlinks can be resolved. + if strings.HasPrefix(hdr.Name, WhiteoutLinkDir) && hdr.Typeflag == tar.TypeReg { + basename := filepath.Base(hdr.Name) + aufsHardlinks[basename] = hdr + if aufsTempdir == "" { + if aufsTempdir, err = ioutil.TempDir("", "dockerplnk"); err != nil { + return 0, err + } + defer os.RemoveAll(aufsTempdir) + } + if err := createTarFile(filepath.Join(aufsTempdir, basename), dest, hdr, tr, true, nil); err != nil { + return 0, err + } + } + + if hdr.Name != WhiteoutOpaqueDir { + continue + } + } + path := filepath.Join(dest, hdr.Name) + rel, err := filepath.Rel(dest, path) + if err != nil { + return 0, err + } + + // Note as these operations are platform specific, so must the slash be. + if strings.HasPrefix(rel, ".."+string(os.PathSeparator)) { + return 0, breakoutError(fmt.Errorf("%q is outside of %q", hdr.Name, dest)) + } + base := filepath.Base(path) + + if strings.HasPrefix(base, WhiteoutPrefix) { + dir := filepath.Dir(path) + if base == WhiteoutOpaqueDir { + _, err := os.Lstat(dir) + if err != nil { + return 0, err + } + err = filepath.Walk(dir, func(path string, info os.FileInfo, err error) error { + if err != nil { + if os.IsNotExist(err) { + err = nil // parent was deleted + } + return err + } + if path == dir { + return nil + } + if _, exists := unpackedPaths[path]; !exists { + err := os.RemoveAll(path) + return err + } + return nil + }) + if err != nil { + return 0, err + } + } else { + originalBase := base[len(WhiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + if err := os.RemoveAll(originalPath); err != nil { + return 0, err + } + } + } else { + // If path exits we almost always just want to remove and replace it. + // The only exception is when it is a directory *and* the file from + // the layer is also a directory. Then we want to merge them (i.e. + // just apply the metadata from the layer). + if fi, err := os.Lstat(path); err == nil { + if !(fi.IsDir() && hdr.Typeflag == tar.TypeDir) { + if err := os.RemoveAll(path); err != nil { + return 0, err + } + } + } + + trBuf.Reset(tr) + srcData := io.Reader(trBuf) + srcHdr := hdr + + // Hard links into /.wh..wh.plnk don't work, as we don't extract that directory, so + // we manually retarget these into the temporary files we extracted them into + if hdr.Typeflag == tar.TypeLink && strings.HasPrefix(filepath.Clean(hdr.Linkname), WhiteoutLinkDir) { + linkBasename := filepath.Base(hdr.Linkname) + srcHdr = aufsHardlinks[linkBasename] + if srcHdr == nil { + return 0, fmt.Errorf("Invalid aufs hardlink") + } + tmpFile, err := os.Open(filepath.Join(aufsTempdir, linkBasename)) + if err != nil { + return 0, err + } + defer tmpFile.Close() + srcData = tmpFile + } + + // if the options contain a uid & gid maps, convert header uid/gid + // entries using the maps such that lchown sets the proper mapped + // uid/gid after writing the file. We only perform this mapping if + // the file isn't already owned by the remapped root UID or GID, as + // that specific uid/gid has no mapping from container -> host, and + // those files already have the proper ownership for inside the + // container. + if srcHdr.Uid != remappedRootUID { + xUID, err := idtools.ToHost(srcHdr.Uid, options.UIDMaps) + if err != nil { + return 0, err + } + srcHdr.Uid = xUID + } + if srcHdr.Gid != remappedRootGID { + xGID, err := idtools.ToHost(srcHdr.Gid, options.GIDMaps) + if err != nil { + return 0, err + } + srcHdr.Gid = xGID + } + if err := createTarFile(path, dest, srcHdr, srcData, true, nil); err != nil { + return 0, err + } + + // Directory mtimes must be handled at the end to avoid further + // file creation in them to modify the directory mtime + if hdr.Typeflag == tar.TypeDir { + dirs = append(dirs, hdr) + } + unpackedPaths[path] = struct{}{} + } + } + + for _, hdr := range dirs { + path := filepath.Join(dest, hdr.Name) + if err := system.Chtimes(path, hdr.AccessTime, hdr.ModTime); err != nil { + return 0, err + } + } + + return size, nil +} + +// ApplyLayer parses a diff in the standard layer format from `layer`, +// and applies it to the directory `dest`. The stream `layer` can be +// compressed or uncompressed. +// Returns the size in bytes of the contents of the layer. +func ApplyLayer(dest string, layer Reader) (int64, error) { + return applyLayerHandler(dest, layer, &TarOptions{}, true) +} + +// ApplyUncompressedLayer parses a diff in the standard layer format from +// `layer`, and applies it to the directory `dest`. The stream `layer` +// can only be uncompressed. +// Returns the size in bytes of the contents of the layer. +func ApplyUncompressedLayer(dest string, layer Reader, options *TarOptions) (int64, error) { + return applyLayerHandler(dest, layer, options, false) +} + +// do the bulk load of ApplyLayer, but allow for not calling DecompressStream +func applyLayerHandler(dest string, layer Reader, options *TarOptions, decompress bool) (int64, error) { + dest = filepath.Clean(dest) + + // We need to be able to set any perms + oldmask, err := system.Umask(0) + if err != nil { + return 0, err + } + defer system.Umask(oldmask) // ignore err, ErrNotSupportedPlatform + + if decompress { + layer, err = DecompressStream(layer) + if err != nil { + return 0, err + } + } + return UnpackLayer(dest, layer, options) +} diff --git a/vendor/github.com/containers/storage/pkg/archive/example_changes.go b/vendor/github.com/containers/storage/pkg/archive/example_changes.go new file mode 100644 index 00000000..ef339446 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/example_changes.go @@ -0,0 +1,97 @@ +// +build ignore + +// Simple tool to create an archive stream from an old and new directory +// +// By default it will stream the comparison of two temporary directories with junk files +package main + +import ( + "flag" + "fmt" + "io" + "io/ioutil" + "os" + "path" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/pkg/archive" +) + +var ( + flDebug = flag.Bool("D", false, "debugging output") + flNewDir = flag.String("newdir", "", "") + flOldDir = flag.String("olddir", "", "") + log = logrus.New() +) + +func main() { + flag.Usage = func() { + fmt.Println("Produce a tar from comparing two directory paths. By default a demo tar is created of around 200 files (including hardlinks)") + fmt.Printf("%s [OPTIONS]\n", os.Args[0]) + flag.PrintDefaults() + } + flag.Parse() + log.Out = os.Stderr + if (len(os.Getenv("DEBUG")) > 0) || *flDebug { + logrus.SetLevel(logrus.DebugLevel) + } + var newDir, oldDir string + + if len(*flNewDir) == 0 { + var err error + newDir, err = ioutil.TempDir("", "docker-test-newDir") + if err != nil { + log.Fatal(err) + } + defer os.RemoveAll(newDir) + if _, err := prepareUntarSourceDirectory(100, newDir, true); err != nil { + log.Fatal(err) + } + } else { + newDir = *flNewDir + } + + if len(*flOldDir) == 0 { + oldDir, err := ioutil.TempDir("", "docker-test-oldDir") + if err != nil { + log.Fatal(err) + } + defer os.RemoveAll(oldDir) + } else { + oldDir = *flOldDir + } + + changes, err := archive.ChangesDirs(newDir, oldDir) + if err != nil { + log.Fatal(err) + } + + a, err := archive.ExportChanges(newDir, changes) + if err != nil { + log.Fatal(err) + } + defer a.Close() + + i, err := io.Copy(os.Stdout, a) + if err != nil && err != io.EOF { + log.Fatal(err) + } + fmt.Fprintf(os.Stderr, "wrote archive of %d bytes", i) +} + +func prepareUntarSourceDirectory(numberOfFiles int, targetPath string, makeLinks bool) (int, error) { + fileData := []byte("fooo") + for n := 0; n < numberOfFiles; n++ { + fileName := fmt.Sprintf("file-%d", n) + if err := ioutil.WriteFile(path.Join(targetPath, fileName), fileData, 0700); err != nil { + return 0, err + } + if makeLinks { + if err := os.Link(path.Join(targetPath, fileName), path.Join(targetPath, fileName+"-link")); err != nil { + return 0, err + } + } + } + totalSize := numberOfFiles * len(fileData) + return totalSize, nil +} diff --git a/vendor/github.com/containers/storage/pkg/archive/time_linux.go b/vendor/github.com/containers/storage/pkg/archive/time_linux.go new file mode 100644 index 00000000..3448569b --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/time_linux.go @@ -0,0 +1,16 @@ +package archive + +import ( + "syscall" + "time" +) + +func timeToTimespec(time time.Time) (ts syscall.Timespec) { + if time.IsZero() { + // Return UTIME_OMIT special value + ts.Sec = 0 + ts.Nsec = ((1 << 30) - 2) + return + } + return syscall.NsecToTimespec(time.UnixNano()) +} diff --git a/vendor/github.com/containers/storage/pkg/archive/time_unsupported.go b/vendor/github.com/containers/storage/pkg/archive/time_unsupported.go new file mode 100644 index 00000000..e85aac05 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/time_unsupported.go @@ -0,0 +1,16 @@ +// +build !linux + +package archive + +import ( + "syscall" + "time" +) + +func timeToTimespec(time time.Time) (ts syscall.Timespec) { + nsec := int64(0) + if !time.IsZero() { + nsec = time.UnixNano() + } + return syscall.NsecToTimespec(nsec) +} diff --git a/vendor/github.com/containers/storage/pkg/archive/whiteouts.go b/vendor/github.com/containers/storage/pkg/archive/whiteouts.go new file mode 100644 index 00000000..d20478a1 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/whiteouts.go @@ -0,0 +1,23 @@ +package archive + +// Whiteouts are files with a special meaning for the layered filesystem. +// Docker uses AUFS whiteout files inside exported archives. In other +// filesystems these files are generated/handled on tar creation/extraction. + +// WhiteoutPrefix prefix means file is a whiteout. If this is followed by a +// filename this means that file has been removed from the base layer. +const WhiteoutPrefix = ".wh." + +// WhiteoutMetaPrefix prefix means whiteout has a special meaning and is not +// for removing an actual file. Normally these files are excluded from exported +// archives. +const WhiteoutMetaPrefix = WhiteoutPrefix + WhiteoutPrefix + +// WhiteoutLinkDir is a directory AUFS uses for storing hardlink links to other +// layers. Normally these should not go into exported archives and all changed +// hardlinks should be copied to the top layer. +const WhiteoutLinkDir = WhiteoutMetaPrefix + "plnk" + +// WhiteoutOpaqueDir file means directory has been made opaque - meaning +// readdir calls to this directory do not follow to lower layers. +const WhiteoutOpaqueDir = WhiteoutMetaPrefix + ".opq" diff --git a/vendor/github.com/containers/storage/pkg/archive/wrap.go b/vendor/github.com/containers/storage/pkg/archive/wrap.go new file mode 100644 index 00000000..dfb335c0 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/archive/wrap.go @@ -0,0 +1,59 @@ +package archive + +import ( + "archive/tar" + "bytes" + "io/ioutil" +) + +// Generate generates a new archive from the content provided +// as input. +// +// `files` is a sequence of path/content pairs. A new file is +// added to the archive for each pair. +// If the last pair is incomplete, the file is created with an +// empty content. For example: +// +// Generate("foo.txt", "hello world", "emptyfile") +// +// The above call will return an archive with 2 files: +// * ./foo.txt with content "hello world" +// * ./empty with empty content +// +// FIXME: stream content instead of buffering +// FIXME: specify permissions and other archive metadata +func Generate(input ...string) (Archive, error) { + files := parseStringPairs(input...) + buf := new(bytes.Buffer) + tw := tar.NewWriter(buf) + for _, file := range files { + name, content := file[0], file[1] + hdr := &tar.Header{ + Name: name, + Size: int64(len(content)), + } + if err := tw.WriteHeader(hdr); err != nil { + return nil, err + } + if _, err := tw.Write([]byte(content)); err != nil { + return nil, err + } + } + if err := tw.Close(); err != nil { + return nil, err + } + return ioutil.NopCloser(buf), nil +} + +func parseStringPairs(input ...string) (output [][2]string) { + output = make([][2]string, 0, len(input)/2+1) + for i := 0; i < len(input); i += 2 { + var pair [2]string + pair[0] = input[i] + if i+1 < len(input) { + pair[1] = input[i+1] + } + output = append(output, pair) + } + return +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/archive.go b/vendor/github.com/containers/storage/pkg/chrootarchive/archive.go new file mode 100644 index 00000000..649575c0 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/archive.go @@ -0,0 +1,97 @@ +package chrootarchive + +import ( + "fmt" + "io" + "io/ioutil" + "os" + "path/filepath" + + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/idtools" +) + +var chrootArchiver = &archive.Archiver{Untar: Untar} + +// Untar reads a stream of bytes from `archive`, parses it as a tar archive, +// and unpacks it into the directory at `dest`. +// The archive may be compressed with one of the following algorithms: +// identity (uncompressed), gzip, bzip2, xz. +func Untar(tarArchive io.Reader, dest string, options *archive.TarOptions) error { + return untarHandler(tarArchive, dest, options, true) +} + +// UntarUncompressed reads a stream of bytes from `archive`, parses it as a tar archive, +// and unpacks it into the directory at `dest`. +// The archive must be an uncompressed stream. +func UntarUncompressed(tarArchive io.Reader, dest string, options *archive.TarOptions) error { + return untarHandler(tarArchive, dest, options, false) +} + +// Handler for teasing out the automatic decompression +func untarHandler(tarArchive io.Reader, dest string, options *archive.TarOptions, decompress bool) error { + + if tarArchive == nil { + return fmt.Errorf("Empty archive") + } + if options == nil { + options = &archive.TarOptions{} + } + if options.ExcludePatterns == nil { + options.ExcludePatterns = []string{} + } + + rootUID, rootGID, err := idtools.GetRootUIDGID(options.UIDMaps, options.GIDMaps) + if err != nil { + return err + } + + dest = filepath.Clean(dest) + if _, err := os.Stat(dest); os.IsNotExist(err) { + if err := idtools.MkdirAllNewAs(dest, 0755, rootUID, rootGID); err != nil { + return err + } + } + + r := ioutil.NopCloser(tarArchive) + if decompress { + decompressedArchive, err := archive.DecompressStream(tarArchive) + if err != nil { + return err + } + defer decompressedArchive.Close() + r = decompressedArchive + } + + return invokeUnpack(r, dest, options) +} + +// TarUntar is a convenience function which calls Tar and Untar, with the output of one piped into the other. +// If either Tar or Untar fails, TarUntar aborts and returns the error. +func TarUntar(src, dst string) error { + return chrootArchiver.TarUntar(src, dst) +} + +// CopyWithTar creates a tar archive of filesystem path `src`, and +// unpacks it at filesystem path `dst`. +// The archive is streamed directly with fixed buffering and no +// intermediary disk IO. +func CopyWithTar(src, dst string) error { + return chrootArchiver.CopyWithTar(src, dst) +} + +// CopyFileWithTar emulates the behavior of the 'cp' command-line +// for a single file. It copies a regular file from path `src` to +// path `dst`, and preserves all its metadata. +// +// If `dst` ends with a trailing slash '/' ('\' on Windows), the final +// destination path will be `dst/base(src)` or `dst\base(src)` +func CopyFileWithTar(src, dst string) (err error) { + return chrootArchiver.CopyFileWithTar(src, dst) +} + +// UntarPath is a convenience function which looks for an archive +// at filesystem path `src`, and unpacks it at `dst`. +func UntarPath(src, dst string) error { + return chrootArchiver.UntarPath(src, dst) +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/archive_unix.go b/vendor/github.com/containers/storage/pkg/chrootarchive/archive_unix.go new file mode 100644 index 00000000..5b26a520 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/archive_unix.go @@ -0,0 +1,86 @@ +// +build !windows + +package chrootarchive + +import ( + "bytes" + "encoding/json" + "flag" + "fmt" + "io" + "io/ioutil" + "os" + "runtime" + + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/reexec" +) + +// untar is the entry-point for docker-untar on re-exec. This is not used on +// Windows as it does not support chroot, hence no point sandboxing through +// chroot and rexec. +func untar() { + runtime.LockOSThread() + flag.Parse() + + var options *archive.TarOptions + + //read the options from the pipe "ExtraFiles" + if err := json.NewDecoder(os.NewFile(3, "options")).Decode(&options); err != nil { + fatal(err) + } + + if err := chroot(flag.Arg(0)); err != nil { + fatal(err) + } + + if err := archive.Unpack(os.Stdin, "/", options); err != nil { + fatal(err) + } + // fully consume stdin in case it is zero padded + if _, err := flush(os.Stdin); err != nil { + fatal(err) + } + + os.Exit(0) +} + +func invokeUnpack(decompressedArchive io.Reader, dest string, options *archive.TarOptions) error { + + // We can't pass a potentially large exclude list directly via cmd line + // because we easily overrun the kernel's max argument/environment size + // when the full image list is passed (e.g. when this is used by + // `docker load`). We will marshall the options via a pipe to the + // child + r, w, err := os.Pipe() + if err != nil { + return fmt.Errorf("Untar pipe failure: %v", err) + } + + cmd := reexec.Command("docker-untar", dest) + cmd.Stdin = decompressedArchive + + cmd.ExtraFiles = append(cmd.ExtraFiles, r) + output := bytes.NewBuffer(nil) + cmd.Stdout = output + cmd.Stderr = output + + if err := cmd.Start(); err != nil { + return fmt.Errorf("Untar error on re-exec cmd: %v", err) + } + //write the options to the pipe for the untar exec to read + if err := json.NewEncoder(w).Encode(options); err != nil { + return fmt.Errorf("Untar json encode to pipe failed: %v", err) + } + w.Close() + + if err := cmd.Wait(); err != nil { + // when `xz -d -c -q | docker-untar ...` failed on docker-untar side, + // we need to exhaust `xz`'s output, otherwise the `xz` side will be + // pending on write pipe forever + io.Copy(ioutil.Discard, decompressedArchive) + + return fmt.Errorf("Error processing tar file(%v): %s", err, output) + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/archive_windows.go b/vendor/github.com/containers/storage/pkg/chrootarchive/archive_windows.go new file mode 100644 index 00000000..93fde422 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/archive_windows.go @@ -0,0 +1,22 @@ +package chrootarchive + +import ( + "io" + + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/longpath" +) + +// chroot is not supported by Windows +func chroot(path string) error { + return nil +} + +func invokeUnpack(decompressedArchive io.ReadCloser, + dest string, + options *archive.TarOptions) error { + // Windows is different to Linux here because Windows does not support + // chroot. Hence there is no point sandboxing a chrooted process to + // do the unpack. We call inline instead within the daemon process. + return archive.Unpack(decompressedArchive, longpath.AddPrefix(dest), options) +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/chroot_linux.go b/vendor/github.com/containers/storage/pkg/chrootarchive/chroot_linux.go new file mode 100644 index 00000000..54b5ff48 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/chroot_linux.go @@ -0,0 +1,103 @@ +package chrootarchive + +import ( + "fmt" + "io/ioutil" + "os" + "path/filepath" + "syscall" + + "github.com/containers/storage/pkg/mount" +) + +// chroot on linux uses pivot_root instead of chroot +// pivot_root takes a new root and an old root. +// Old root must be a sub-dir of new root, it is where the current rootfs will reside after the call to pivot_root. +// New root is where the new rootfs is set to. +// Old root is removed after the call to pivot_root so it is no longer available under the new root. +// This is similar to how libcontainer sets up a container's rootfs +func chroot(path string) (err error) { + if err := syscall.Unshare(syscall.CLONE_NEWNS); err != nil { + return fmt.Errorf("Error creating mount namespace before pivot: %v", err) + } + + if err := mount.MakeRPrivate(path); err != nil { + return err + } + + // setup oldRoot for pivot_root + pivotDir, err := ioutil.TempDir(path, ".pivot_root") + if err != nil { + return fmt.Errorf("Error setting up pivot dir: %v", err) + } + + var mounted bool + defer func() { + if mounted { + // make sure pivotDir is not mounted before we try to remove it + if errCleanup := syscall.Unmount(pivotDir, syscall.MNT_DETACH); errCleanup != nil { + if err == nil { + err = errCleanup + } + return + } + } + + errCleanup := os.Remove(pivotDir) + // pivotDir doesn't exist if pivot_root failed and chroot+chdir was successful + // because we already cleaned it up on failed pivot_root + if errCleanup != nil && !os.IsNotExist(errCleanup) { + errCleanup = fmt.Errorf("Error cleaning up after pivot: %v", errCleanup) + if err == nil { + err = errCleanup + } + } + + if errCleanup := syscall.Unmount("/", syscall.MNT_DETACH); errCleanup != nil { + if err == nil { + err = fmt.Errorf("error unmounting root: %v", errCleanup) + } + return + } + }() + + if err := syscall.PivotRoot(path, pivotDir); err != nil { + // If pivot fails, fall back to the normal chroot after cleaning up temp dir + if err := os.Remove(pivotDir); err != nil { + return fmt.Errorf("Error cleaning up after failed pivot: %v", err) + } + return realChroot(path) + } + mounted = true + + // This is the new path for where the old root (prior to the pivot) has been moved to + // This dir contains the rootfs of the caller, which we need to remove so it is not visible during extraction + pivotDir = filepath.Join("/", filepath.Base(pivotDir)) + + if err := syscall.Chdir("/"); err != nil { + return fmt.Errorf("Error changing to new root: %v", err) + } + + // Make the pivotDir (where the old root lives) private so it can be unmounted without propagating to the host + if err := syscall.Mount("", pivotDir, "", syscall.MS_PRIVATE|syscall.MS_REC, ""); err != nil { + return fmt.Errorf("Error making old root private after pivot: %v", err) + } + + // Now unmount the old root so it's no longer visible from the new root + if err := syscall.Unmount(pivotDir, syscall.MNT_DETACH); err != nil { + return fmt.Errorf("Error while unmounting old root after pivot: %v", err) + } + mounted = false + + return nil +} + +func realChroot(path string) error { + if err := syscall.Chroot(path); err != nil { + return fmt.Errorf("Error after fallback to chroot: %v", err) + } + if err := syscall.Chdir("/"); err != nil { + return fmt.Errorf("Error changing to new root after chroot: %v", err) + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/chroot_unix.go b/vendor/github.com/containers/storage/pkg/chrootarchive/chroot_unix.go new file mode 100644 index 00000000..16354bf6 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/chroot_unix.go @@ -0,0 +1,12 @@ +// +build !windows,!linux + +package chrootarchive + +import "syscall" + +func chroot(path string) error { + if err := syscall.Chroot(path); err != nil { + return err + } + return syscall.Chdir("/") +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/diff.go b/vendor/github.com/containers/storage/pkg/chrootarchive/diff.go new file mode 100644 index 00000000..377aeb9f --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/diff.go @@ -0,0 +1,19 @@ +package chrootarchive + +import "github.com/containers/storage/pkg/archive" + +// ApplyLayer parses a diff in the standard layer format from `layer`, +// and applies it to the directory `dest`. The stream `layer` can only be +// uncompressed. +// Returns the size in bytes of the contents of the layer. +func ApplyLayer(dest string, layer archive.Reader) (size int64, err error) { + return applyLayerHandler(dest, layer, &archive.TarOptions{}, true) +} + +// ApplyUncompressedLayer parses a diff in the standard layer format from +// `layer`, and applies it to the directory `dest`. The stream `layer` +// can only be uncompressed. +// Returns the size in bytes of the contents of the layer. +func ApplyUncompressedLayer(dest string, layer archive.Reader, options *archive.TarOptions) (int64, error) { + return applyLayerHandler(dest, layer, options, false) +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/diff_unix.go b/vendor/github.com/containers/storage/pkg/chrootarchive/diff_unix.go new file mode 100644 index 00000000..23daa721 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/diff_unix.go @@ -0,0 +1,120 @@ +//+build !windows + +package chrootarchive + +import ( + "bytes" + "encoding/json" + "flag" + "fmt" + "io/ioutil" + "os" + "path/filepath" + "runtime" + + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/reexec" + "github.com/containers/storage/pkg/system" +) + +type applyLayerResponse struct { + LayerSize int64 `json:"layerSize"` +} + +// applyLayer is the entry-point for docker-applylayer on re-exec. This is not +// used on Windows as it does not support chroot, hence no point sandboxing +// through chroot and rexec. +func applyLayer() { + + var ( + tmpDir = "" + err error + options *archive.TarOptions + ) + runtime.LockOSThread() + flag.Parse() + + if err := chroot(flag.Arg(0)); err != nil { + fatal(err) + } + + // We need to be able to set any perms + oldmask, err := system.Umask(0) + defer system.Umask(oldmask) + if err != nil { + fatal(err) + } + + if err := json.Unmarshal([]byte(os.Getenv("OPT")), &options); err != nil { + fatal(err) + } + + if tmpDir, err = ioutil.TempDir("/", "temp-docker-extract"); err != nil { + fatal(err) + } + + os.Setenv("TMPDIR", tmpDir) + size, err := archive.UnpackLayer("/", os.Stdin, options) + os.RemoveAll(tmpDir) + if err != nil { + fatal(err) + } + + encoder := json.NewEncoder(os.Stdout) + if err := encoder.Encode(applyLayerResponse{size}); err != nil { + fatal(fmt.Errorf("unable to encode layerSize JSON: %s", err)) + } + + if _, err := flush(os.Stdin); err != nil { + fatal(err) + } + + os.Exit(0) +} + +// applyLayerHandler parses a diff in the standard layer format from `layer`, and +// applies it to the directory `dest`. Returns the size in bytes of the +// contents of the layer. +func applyLayerHandler(dest string, layer archive.Reader, options *archive.TarOptions, decompress bool) (size int64, err error) { + dest = filepath.Clean(dest) + if decompress { + decompressed, err := archive.DecompressStream(layer) + if err != nil { + return 0, err + } + defer decompressed.Close() + + layer = decompressed + } + if options == nil { + options = &archive.TarOptions{} + } + if options.ExcludePatterns == nil { + options.ExcludePatterns = []string{} + } + + data, err := json.Marshal(options) + if err != nil { + return 0, fmt.Errorf("ApplyLayer json encode: %v", err) + } + + cmd := reexec.Command("docker-applyLayer", dest) + cmd.Stdin = layer + cmd.Env = append(cmd.Env, fmt.Sprintf("OPT=%s", data)) + + outBuf, errBuf := new(bytes.Buffer), new(bytes.Buffer) + cmd.Stdout, cmd.Stderr = outBuf, errBuf + + if err = cmd.Run(); err != nil { + return 0, fmt.Errorf("ApplyLayer %s stdout: %s stderr: %s", err, outBuf, errBuf) + } + + // Stdout should be a valid JSON struct representing an applyLayerResponse. + response := applyLayerResponse{} + decoder := json.NewDecoder(outBuf) + if err = decoder.Decode(&response); err != nil { + return 0, fmt.Errorf("unable to decode ApplyLayer JSON response: %s", err) + } + + return response.LayerSize, nil +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/diff_windows.go b/vendor/github.com/containers/storage/pkg/chrootarchive/diff_windows.go new file mode 100644 index 00000000..cfada9b1 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/diff_windows.go @@ -0,0 +1,44 @@ +package chrootarchive + +import ( + "fmt" + "io/ioutil" + "os" + "path/filepath" + + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/longpath" +) + +// applyLayerHandler parses a diff in the standard layer format from `layer`, and +// applies it to the directory `dest`. Returns the size in bytes of the +// contents of the layer. +func applyLayerHandler(dest string, layer archive.Reader, options *archive.TarOptions, decompress bool) (size int64, err error) { + dest = filepath.Clean(dest) + + // Ensure it is a Windows-style volume path + dest = longpath.AddPrefix(dest) + + if decompress { + decompressed, err := archive.DecompressStream(layer) + if err != nil { + return 0, err + } + defer decompressed.Close() + + layer = decompressed + } + + tmpDir, err := ioutil.TempDir(os.Getenv("temp"), "temp-docker-extract") + if err != nil { + return 0, fmt.Errorf("ApplyLayer failed to create temp-docker-extract under %s. %s", dest, err) + } + + s, err := archive.UnpackLayer(dest, layer, nil) + os.RemoveAll(tmpDir) + if err != nil { + return 0, fmt.Errorf("ApplyLayer %s failed UnpackLayer to %s", err, dest) + } + + return s, nil +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/init_unix.go b/vendor/github.com/containers/storage/pkg/chrootarchive/init_unix.go new file mode 100644 index 00000000..7b8a46f3 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/init_unix.go @@ -0,0 +1,28 @@ +// +build !windows + +package chrootarchive + +import ( + "fmt" + "io" + "io/ioutil" + "os" + + "github.com/containers/storage/pkg/reexec" +) + +func init() { + reexec.Register("docker-applyLayer", applyLayer) + reexec.Register("docker-untar", untar) +} + +func fatal(err error) { + fmt.Fprint(os.Stderr, err) + os.Exit(1) +} + +// flush consumes all the bytes from the reader discarding +// any errors +func flush(r io.Reader) (bytes int64, err error) { + return io.Copy(ioutil.Discard, r) +} diff --git a/vendor/github.com/containers/storage/pkg/chrootarchive/init_windows.go b/vendor/github.com/containers/storage/pkg/chrootarchive/init_windows.go new file mode 100644 index 00000000..fa17c9bf --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/chrootarchive/init_windows.go @@ -0,0 +1,4 @@ +package chrootarchive + +func init() { +} diff --git a/vendor/github.com/containers/storage/pkg/devicemapper/devmapper.go b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper.go new file mode 100644 index 00000000..838b06af --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper.go @@ -0,0 +1,807 @@ +// +build linux + +package devicemapper + +import ( + "errors" + "fmt" + "os" + "runtime" + "syscall" + "unsafe" + + "github.com/Sirupsen/logrus" +) + +// DevmapperLogger defines methods for logging with devicemapper. +type DevmapperLogger interface { + DMLog(level int, file string, line int, dmError int, message string) +} + +const ( + deviceCreate TaskType = iota + deviceReload + deviceRemove + deviceRemoveAll + deviceSuspend + deviceResume + deviceInfo + deviceDeps + deviceRename + deviceVersion + deviceStatus + deviceTable + deviceWaitevent + deviceList + deviceClear + deviceMknodes + deviceListVersions + deviceTargetMsg + deviceSetGeometry +) + +const ( + addNodeOnResume AddNodeType = iota + addNodeOnCreate +) + +// List of errors returned when using devicemapper. +var ( + ErrTaskRun = errors.New("dm_task_run failed") + ErrTaskSetName = errors.New("dm_task_set_name failed") + ErrTaskSetMessage = errors.New("dm_task_set_message failed") + ErrTaskSetAddNode = errors.New("dm_task_set_add_node failed") + ErrTaskSetRo = errors.New("dm_task_set_ro failed") + ErrTaskAddTarget = errors.New("dm_task_add_target failed") + ErrTaskSetSector = errors.New("dm_task_set_sector failed") + ErrTaskGetDeps = errors.New("dm_task_get_deps failed") + ErrTaskGetInfo = errors.New("dm_task_get_info failed") + ErrTaskGetDriverVersion = errors.New("dm_task_get_driver_version failed") + ErrTaskDeferredRemove = errors.New("dm_task_deferred_remove failed") + ErrTaskSetCookie = errors.New("dm_task_set_cookie failed") + ErrNilCookie = errors.New("cookie ptr can't be nil") + ErrGetBlockSize = errors.New("Can't get block size") + ErrUdevWait = errors.New("wait on udev cookie failed") + ErrSetDevDir = errors.New("dm_set_dev_dir failed") + ErrGetLibraryVersion = errors.New("dm_get_library_version failed") + ErrCreateRemoveTask = errors.New("Can't create task of type deviceRemove") + ErrRunRemoveDevice = errors.New("running RemoveDevice failed") + ErrInvalidAddNode = errors.New("Invalid AddNode type") + ErrBusy = errors.New("Device is Busy") + ErrDeviceIDExists = errors.New("Device Id Exists") + ErrEnxio = errors.New("No such device or address") +) + +var ( + dmSawBusy bool + dmSawExist bool + dmSawEnxio bool // No Such Device or Address +) + +type ( + // Task represents a devicemapper task (like lvcreate, etc.) ; a task is needed for each ioctl + // command to execute. + Task struct { + unmanaged *cdmTask + } + // Deps represents dependents (layer) of a device. + Deps struct { + Count uint32 + Filler uint32 + Device []uint64 + } + // Info represents information about a device. + Info struct { + Exists int + Suspended int + LiveTable int + InactiveTable int + OpenCount int32 + EventNr uint32 + Major uint32 + Minor uint32 + ReadOnly int + TargetCount int32 + DeferredRemove int + } + // TaskType represents a type of task + TaskType int + // AddNodeType represents a type of node to be added + AddNodeType int +) + +// DeviceIDExists returns whether error conveys the information about device Id already +// exist or not. This will be true if device creation or snap creation +// operation fails if device or snap device already exists in pool. +// Current implementation is little crude as it scans the error string +// for exact pattern match. Replacing it with more robust implementation +// is desirable. +func DeviceIDExists(err error) bool { + return fmt.Sprint(err) == fmt.Sprint(ErrDeviceIDExists) +} + +func (t *Task) destroy() { + if t != nil { + DmTaskDestroy(t.unmanaged) + runtime.SetFinalizer(t, nil) + } +} + +// TaskCreateNamed is a convenience function for TaskCreate when a name +// will be set on the task as well +func TaskCreateNamed(t TaskType, name string) (*Task, error) { + task := TaskCreate(t) + if task == nil { + return nil, fmt.Errorf("devicemapper: Can't create task of type %d", int(t)) + } + if err := task.setName(name); err != nil { + return nil, fmt.Errorf("devicemapper: Can't set task name %s", name) + } + return task, nil +} + +// TaskCreate initializes a devicemapper task of tasktype +func TaskCreate(tasktype TaskType) *Task { + Ctask := DmTaskCreate(int(tasktype)) + if Ctask == nil { + return nil + } + task := &Task{unmanaged: Ctask} + runtime.SetFinalizer(task, (*Task).destroy) + return task +} + +func (t *Task) run() error { + if res := DmTaskRun(t.unmanaged); res != 1 { + return ErrTaskRun + } + return nil +} + +func (t *Task) setName(name string) error { + if res := DmTaskSetName(t.unmanaged, name); res != 1 { + return ErrTaskSetName + } + return nil +} + +func (t *Task) setMessage(message string) error { + if res := DmTaskSetMessage(t.unmanaged, message); res != 1 { + return ErrTaskSetMessage + } + return nil +} + +func (t *Task) setSector(sector uint64) error { + if res := DmTaskSetSector(t.unmanaged, sector); res != 1 { + return ErrTaskSetSector + } + return nil +} + +func (t *Task) setCookie(cookie *uint, flags uint16) error { + if cookie == nil { + return ErrNilCookie + } + if res := DmTaskSetCookie(t.unmanaged, cookie, flags); res != 1 { + return ErrTaskSetCookie + } + return nil +} + +func (t *Task) setAddNode(addNode AddNodeType) error { + if addNode != addNodeOnResume && addNode != addNodeOnCreate { + return ErrInvalidAddNode + } + if res := DmTaskSetAddNode(t.unmanaged, addNode); res != 1 { + return ErrTaskSetAddNode + } + return nil +} + +func (t *Task) setRo() error { + if res := DmTaskSetRo(t.unmanaged); res != 1 { + return ErrTaskSetRo + } + return nil +} + +func (t *Task) addTarget(start, size uint64, ttype, params string) error { + if res := DmTaskAddTarget(t.unmanaged, start, size, + ttype, params); res != 1 { + return ErrTaskAddTarget + } + return nil +} + +func (t *Task) getDeps() (*Deps, error) { + var deps *Deps + if deps = DmTaskGetDeps(t.unmanaged); deps == nil { + return nil, ErrTaskGetDeps + } + return deps, nil +} + +func (t *Task) getInfo() (*Info, error) { + info := &Info{} + if res := DmTaskGetInfo(t.unmanaged, info); res != 1 { + return nil, ErrTaskGetInfo + } + return info, nil +} + +func (t *Task) getInfoWithDeferred() (*Info, error) { + info := &Info{} + if res := DmTaskGetInfoWithDeferred(t.unmanaged, info); res != 1 { + return nil, ErrTaskGetInfo + } + return info, nil +} + +func (t *Task) getDriverVersion() (string, error) { + res := DmTaskGetDriverVersion(t.unmanaged) + if res == "" { + return "", ErrTaskGetDriverVersion + } + return res, nil +} + +func (t *Task) getNextTarget(next unsafe.Pointer) (nextPtr unsafe.Pointer, start uint64, + length uint64, targetType string, params string) { + + return DmGetNextTarget(t.unmanaged, next, &start, &length, + &targetType, ¶ms), + start, length, targetType, params +} + +// UdevWait waits for any processes that are waiting for udev to complete the specified cookie. +func UdevWait(cookie *uint) error { + if res := DmUdevWait(*cookie); res != 1 { + logrus.Debugf("devicemapper: Failed to wait on udev cookie %d", *cookie) + return ErrUdevWait + } + return nil +} + +// LogInitVerbose is an interface to initialize the verbose logger for the device mapper library. +func LogInitVerbose(level int) { + DmLogInitVerbose(level) +} + +var dmLogger DevmapperLogger + +// LogInit initializes the logger for the device mapper library. +func LogInit(logger DevmapperLogger) { + dmLogger = logger + LogWithErrnoInit() +} + +// SetDevDir sets the dev folder for the device mapper library (usually /dev). +func SetDevDir(dir string) error { + if res := DmSetDevDir(dir); res != 1 { + logrus.Debug("devicemapper: Error dm_set_dev_dir") + return ErrSetDevDir + } + return nil +} + +// GetLibraryVersion returns the device mapper library version. +func GetLibraryVersion() (string, error) { + var version string + if res := DmGetLibraryVersion(&version); res != 1 { + return "", ErrGetLibraryVersion + } + return version, nil +} + +// UdevSyncSupported returns whether device-mapper is able to sync with udev +// +// This is essential otherwise race conditions can arise where both udev and +// device-mapper attempt to create and destroy devices. +func UdevSyncSupported() bool { + return DmUdevGetSyncSupport() != 0 +} + +// UdevSetSyncSupport allows setting whether the udev sync should be enabled. +// The return bool indicates the state of whether the sync is enabled. +func UdevSetSyncSupport(enable bool) bool { + if enable { + DmUdevSetSyncSupport(1) + } else { + DmUdevSetSyncSupport(0) + } + + return UdevSyncSupported() +} + +// CookieSupported returns whether the version of device-mapper supports the +// use of cookie's in the tasks. +// This is largely a lower level call that other functions use. +func CookieSupported() bool { + return DmCookieSupported() != 0 +} + +// RemoveDevice is a useful helper for cleaning up a device. +func RemoveDevice(name string) error { + task, err := TaskCreateNamed(deviceRemove, name) + if task == nil { + return err + } + + var cookie uint + if err := task.setCookie(&cookie, 0); err != nil { + return fmt.Errorf("devicemapper: Can not set cookie: %s", err) + } + defer UdevWait(&cookie) + + dmSawBusy = false // reset before the task is run + if err = task.run(); err != nil { + if dmSawBusy { + return ErrBusy + } + return fmt.Errorf("devicemapper: Error running RemoveDevice %s", err) + } + + return nil +} + +// RemoveDeviceDeferred is a useful helper for cleaning up a device, but deferred. +func RemoveDeviceDeferred(name string) error { + logrus.Debugf("devicemapper: RemoveDeviceDeferred START(%s)", name) + defer logrus.Debugf("devicemapper: RemoveDeviceDeferred END(%s)", name) + task, err := TaskCreateNamed(deviceRemove, name) + if task == nil { + return err + } + + if err := DmTaskDeferredRemove(task.unmanaged); err != 1 { + return ErrTaskDeferredRemove + } + + if err = task.run(); err != nil { + return fmt.Errorf("devicemapper: Error running RemoveDeviceDeferred %s", err) + } + + return nil +} + +// CancelDeferredRemove cancels a deferred remove for a device. +func CancelDeferredRemove(deviceName string) error { + task, err := TaskCreateNamed(deviceTargetMsg, deviceName) + if task == nil { + return err + } + + if err := task.setSector(0); err != nil { + return fmt.Errorf("devicemapper: Can't set sector %s", err) + } + + if err := task.setMessage(fmt.Sprintf("@cancel_deferred_remove")); err != nil { + return fmt.Errorf("devicemapper: Can't set message %s", err) + } + + dmSawBusy = false + dmSawEnxio = false + if err := task.run(); err != nil { + // A device might be being deleted already + if dmSawBusy { + return ErrBusy + } else if dmSawEnxio { + return ErrEnxio + } + return fmt.Errorf("devicemapper: Error running CancelDeferredRemove %s", err) + + } + return nil +} + +// GetBlockDeviceSize returns the size of a block device identified by the specified file. +func GetBlockDeviceSize(file *os.File) (uint64, error) { + size, err := ioctlBlkGetSize64(file.Fd()) + if err != nil { + logrus.Errorf("devicemapper: Error getblockdevicesize: %s", err) + return 0, ErrGetBlockSize + } + return uint64(size), nil +} + +// BlockDeviceDiscard runs discard for the given path. +// This is used as a workaround for the kernel not discarding block so +// on the thin pool when we remove a thinp device, so we do it +// manually +func BlockDeviceDiscard(path string) error { + file, err := os.OpenFile(path, os.O_RDWR, 0) + if err != nil { + return err + } + defer file.Close() + + size, err := GetBlockDeviceSize(file) + if err != nil { + return err + } + + if err := ioctlBlkDiscard(file.Fd(), 0, size); err != nil { + return err + } + + // Without this sometimes the remove of the device that happens after + // discard fails with EBUSY. + syscall.Sync() + + return nil +} + +// CreatePool is the programmatic example of "dmsetup create". +// It creates a device with the specified poolName, data and metadata file and block size. +func CreatePool(poolName string, dataFile, metadataFile *os.File, poolBlockSize uint32) error { + task, err := TaskCreateNamed(deviceCreate, poolName) + if task == nil { + return err + } + + size, err := GetBlockDeviceSize(dataFile) + if err != nil { + return fmt.Errorf("devicemapper: Can't get data size %s", err) + } + + params := fmt.Sprintf("%s %s %d 32768 1 skip_block_zeroing", metadataFile.Name(), dataFile.Name(), poolBlockSize) + if err := task.addTarget(0, size/512, "thin-pool", params); err != nil { + return fmt.Errorf("devicemapper: Can't add target %s", err) + } + + var cookie uint + var flags uint16 + flags = DmUdevDisableSubsystemRulesFlag | DmUdevDisableDiskRulesFlag | DmUdevDisableOtherRulesFlag + if err := task.setCookie(&cookie, flags); err != nil { + return fmt.Errorf("devicemapper: Can't set cookie %s", err) + } + defer UdevWait(&cookie) + + if err := task.run(); err != nil { + return fmt.Errorf("devicemapper: Error running deviceCreate (CreatePool) %s", err) + } + + return nil +} + +// ReloadPool is the programmatic example of "dmsetup reload". +// It reloads the table with the specified poolName, data and metadata file and block size. +func ReloadPool(poolName string, dataFile, metadataFile *os.File, poolBlockSize uint32) error { + task, err := TaskCreateNamed(deviceReload, poolName) + if task == nil { + return err + } + + size, err := GetBlockDeviceSize(dataFile) + if err != nil { + return fmt.Errorf("devicemapper: Can't get data size %s", err) + } + + params := fmt.Sprintf("%s %s %d 32768 1 skip_block_zeroing", metadataFile.Name(), dataFile.Name(), poolBlockSize) + if err := task.addTarget(0, size/512, "thin-pool", params); err != nil { + return fmt.Errorf("devicemapper: Can't add target %s", err) + } + + if err := task.run(); err != nil { + return fmt.Errorf("devicemapper: Error running deviceCreate %s", err) + } + + return nil +} + +// GetDeps is the programmatic example of "dmsetup deps". +// It outputs a list of devices referenced by the live table for the specified device. +func GetDeps(name string) (*Deps, error) { + task, err := TaskCreateNamed(deviceDeps, name) + if task == nil { + return nil, err + } + if err := task.run(); err != nil { + return nil, err + } + return task.getDeps() +} + +// GetInfo is the programmatic example of "dmsetup info". +// It outputs some brief information about the device. +func GetInfo(name string) (*Info, error) { + task, err := TaskCreateNamed(deviceInfo, name) + if task == nil { + return nil, err + } + if err := task.run(); err != nil { + return nil, err + } + return task.getInfo() +} + +// GetInfoWithDeferred is the programmatic example of "dmsetup info", but deferred. +// It outputs some brief information about the device. +func GetInfoWithDeferred(name string) (*Info, error) { + task, err := TaskCreateNamed(deviceInfo, name) + if task == nil { + return nil, err + } + if err := task.run(); err != nil { + return nil, err + } + return task.getInfoWithDeferred() +} + +// GetDriverVersion is the programmatic example of "dmsetup version". +// It outputs version information of the driver. +func GetDriverVersion() (string, error) { + task := TaskCreate(deviceVersion) + if task == nil { + return "", fmt.Errorf("devicemapper: Can't create deviceVersion task") + } + if err := task.run(); err != nil { + return "", err + } + return task.getDriverVersion() +} + +// GetStatus is the programmatic example of "dmsetup status". +// It outputs status information for the specified device name. +func GetStatus(name string) (uint64, uint64, string, string, error) { + task, err := TaskCreateNamed(deviceStatus, name) + if task == nil { + logrus.Debugf("devicemapper: GetStatus() Error TaskCreateNamed: %s", err) + return 0, 0, "", "", err + } + if err := task.run(); err != nil { + logrus.Debugf("devicemapper: GetStatus() Error Run: %s", err) + return 0, 0, "", "", err + } + + devinfo, err := task.getInfo() + if err != nil { + logrus.Debugf("devicemapper: GetStatus() Error GetInfo: %s", err) + return 0, 0, "", "", err + } + if devinfo.Exists == 0 { + logrus.Debugf("devicemapper: GetStatus() Non existing device %s", name) + return 0, 0, "", "", fmt.Errorf("devicemapper: Non existing device %s", name) + } + + _, start, length, targetType, params := task.getNextTarget(unsafe.Pointer(nil)) + return start, length, targetType, params, nil +} + +// GetTable is the programmatic example for "dmsetup table". +// It outputs the current table for the specified device name. +func GetTable(name string) (uint64, uint64, string, string, error) { + task, err := TaskCreateNamed(deviceTable, name) + if task == nil { + logrus.Debugf("devicemapper: GetTable() Error TaskCreateNamed: %s", err) + return 0, 0, "", "", err + } + if err := task.run(); err != nil { + logrus.Debugf("devicemapper: GetTable() Error Run: %s", err) + return 0, 0, "", "", err + } + + devinfo, err := task.getInfo() + if err != nil { + logrus.Debugf("devicemapper: GetTable() Error GetInfo: %s", err) + return 0, 0, "", "", err + } + if devinfo.Exists == 0 { + logrus.Debugf("devicemapper: GetTable() Non existing device %s", name) + return 0, 0, "", "", fmt.Errorf("devicemapper: Non existing device %s", name) + } + + _, start, length, targetType, params := task.getNextTarget(unsafe.Pointer(nil)) + return start, length, targetType, params, nil +} + +// SetTransactionID sets a transaction id for the specified device name. +func SetTransactionID(poolName string, oldID uint64, newID uint64) error { + task, err := TaskCreateNamed(deviceTargetMsg, poolName) + if task == nil { + return err + } + + if err := task.setSector(0); err != nil { + return fmt.Errorf("devicemapper: Can't set sector %s", err) + } + + if err := task.setMessage(fmt.Sprintf("set_transaction_id %d %d", oldID, newID)); err != nil { + return fmt.Errorf("devicemapper: Can't set message %s", err) + } + + if err := task.run(); err != nil { + return fmt.Errorf("devicemapper: Error running SetTransactionID %s", err) + } + return nil +} + +// SuspendDevice is the programmatic example of "dmsetup suspend". +// It suspends the specified device. +func SuspendDevice(name string) error { + task, err := TaskCreateNamed(deviceSuspend, name) + if task == nil { + return err + } + if err := task.run(); err != nil { + return fmt.Errorf("devicemapper: Error running deviceSuspend %s", err) + } + return nil +} + +// ResumeDevice is the programmatic example of "dmsetup resume". +// It un-suspends the specified device. +func ResumeDevice(name string) error { + task, err := TaskCreateNamed(deviceResume, name) + if task == nil { + return err + } + + var cookie uint + if err := task.setCookie(&cookie, 0); err != nil { + return fmt.Errorf("devicemapper: Can't set cookie %s", err) + } + defer UdevWait(&cookie) + + if err := task.run(); err != nil { + return fmt.Errorf("devicemapper: Error running deviceResume %s", err) + } + + return nil +} + +// CreateDevice creates a device with the specified poolName with the specified device id. +func CreateDevice(poolName string, deviceID int) error { + logrus.Debugf("devicemapper: CreateDevice(poolName=%v, deviceID=%v)", poolName, deviceID) + task, err := TaskCreateNamed(deviceTargetMsg, poolName) + if task == nil { + return err + } + + if err := task.setSector(0); err != nil { + return fmt.Errorf("devicemapper: Can't set sector %s", err) + } + + if err := task.setMessage(fmt.Sprintf("create_thin %d", deviceID)); err != nil { + return fmt.Errorf("devicemapper: Can't set message %s", err) + } + + dmSawExist = false // reset before the task is run + if err := task.run(); err != nil { + // Caller wants to know about ErrDeviceIDExists so that it can try with a different device id. + if dmSawExist { + return ErrDeviceIDExists + } + + return fmt.Errorf("devicemapper: Error running CreateDevice %s", err) + + } + return nil +} + +// DeleteDevice deletes a device with the specified poolName with the specified device id. +func DeleteDevice(poolName string, deviceID int) error { + task, err := TaskCreateNamed(deviceTargetMsg, poolName) + if task == nil { + return err + } + + if err := task.setSector(0); err != nil { + return fmt.Errorf("devicemapper: Can't set sector %s", err) + } + + if err := task.setMessage(fmt.Sprintf("delete %d", deviceID)); err != nil { + return fmt.Errorf("devicemapper: Can't set message %s", err) + } + + dmSawBusy = false + if err := task.run(); err != nil { + if dmSawBusy { + return ErrBusy + } + return fmt.Errorf("devicemapper: Error running DeleteDevice %s", err) + } + return nil +} + +// ActivateDevice activates the device identified by the specified +// poolName, name and deviceID with the specified size. +func ActivateDevice(poolName string, name string, deviceID int, size uint64) error { + return activateDevice(poolName, name, deviceID, size, "") +} + +// ActivateDeviceWithExternal activates the device identified by the specified +// poolName, name and deviceID with the specified size. +func ActivateDeviceWithExternal(poolName string, name string, deviceID int, size uint64, external string) error { + return activateDevice(poolName, name, deviceID, size, external) +} + +func activateDevice(poolName string, name string, deviceID int, size uint64, external string) error { + task, err := TaskCreateNamed(deviceCreate, name) + if task == nil { + return err + } + + var params string + if len(external) > 0 { + params = fmt.Sprintf("%s %d %s", poolName, deviceID, external) + } else { + params = fmt.Sprintf("%s %d", poolName, deviceID) + } + if err := task.addTarget(0, size/512, "thin", params); err != nil { + return fmt.Errorf("devicemapper: Can't add target %s", err) + } + if err := task.setAddNode(addNodeOnCreate); err != nil { + return fmt.Errorf("devicemapper: Can't add node %s", err) + } + + var cookie uint + if err := task.setCookie(&cookie, 0); err != nil { + return fmt.Errorf("devicemapper: Can't set cookie %s", err) + } + + defer UdevWait(&cookie) + + if err := task.run(); err != nil { + return fmt.Errorf("devicemapper: Error running deviceCreate (ActivateDevice) %s", err) + } + + return nil +} + +// CreateSnapDevice creates a snapshot based on the device identified by the baseName and baseDeviceId, +func CreateSnapDevice(poolName string, deviceID int, baseName string, baseDeviceID int) error { + devinfo, _ := GetInfo(baseName) + doSuspend := devinfo != nil && devinfo.Exists != 0 + + if doSuspend { + if err := SuspendDevice(baseName); err != nil { + return err + } + } + + task, err := TaskCreateNamed(deviceTargetMsg, poolName) + if task == nil { + if doSuspend { + ResumeDevice(baseName) + } + return err + } + + if err := task.setSector(0); err != nil { + if doSuspend { + ResumeDevice(baseName) + } + return fmt.Errorf("devicemapper: Can't set sector %s", err) + } + + if err := task.setMessage(fmt.Sprintf("create_snap %d %d", deviceID, baseDeviceID)); err != nil { + if doSuspend { + ResumeDevice(baseName) + } + return fmt.Errorf("devicemapper: Can't set message %s", err) + } + + dmSawExist = false // reset before the task is run + if err := task.run(); err != nil { + if doSuspend { + ResumeDevice(baseName) + } + // Caller wants to know about ErrDeviceIDExists so that it can try with a different device id. + if dmSawExist { + return ErrDeviceIDExists + } + + return fmt.Errorf("devicemapper: Error running deviceCreate (createSnapDevice) %s", err) + + } + + if doSuspend { + if err := ResumeDevice(baseName); err != nil { + return err + } + } + + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_log.go b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_log.go new file mode 100644 index 00000000..8477e36f --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_log.go @@ -0,0 +1,35 @@ +// +build linux + +package devicemapper + +import "C" + +import ( + "strings" +) + +// Due to the way cgo works this has to be in a separate file, as devmapper.go has +// definitions in the cgo block, which is incompatible with using "//export" + +// DevmapperLogCallback exports the devmapper log callback for cgo. +//export DevmapperLogCallback +func DevmapperLogCallback(level C.int, file *C.char, line C.int, dmErrnoOrClass C.int, message *C.char) { + msg := C.GoString(message) + if level < 7 { + if strings.Contains(msg, "busy") { + dmSawBusy = true + } + + if strings.Contains(msg, "File exists") { + dmSawExist = true + } + + if strings.Contains(msg, "No such device or address") { + dmSawEnxio = true + } + } + + if dmLogger != nil { + dmLogger.DMLog(int(level), C.GoString(file), int(line), int(dmErrnoOrClass), msg) + } +} diff --git a/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper.go b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper.go new file mode 100644 index 00000000..91fbc85b --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper.go @@ -0,0 +1,251 @@ +// +build linux + +package devicemapper + +/* +#cgo LDFLAGS: -L. -ldevmapper +#include +#include // FIXME: present only for BLKGETSIZE64, maybe we can remove it? + +// FIXME: Can't we find a way to do the logging in pure Go? +extern void DevmapperLogCallback(int level, char *file, int line, int dm_errno_or_class, char *str); + +static void log_cb(int level, const char *file, int line, int dm_errno_or_class, const char *f, ...) +{ + char buffer[256]; + va_list ap; + + va_start(ap, f); + vsnprintf(buffer, 256, f, ap); + va_end(ap); + + DevmapperLogCallback(level, (char *)file, line, dm_errno_or_class, buffer); +} + +static void log_with_errno_init() +{ + dm_log_with_errno_init(log_cb); +} +*/ +import "C" + +import ( + "reflect" + "unsafe" +) + +type ( + cdmTask C.struct_dm_task +) + +// IOCTL consts +const ( + BlkGetSize64 = C.BLKGETSIZE64 + BlkDiscard = C.BLKDISCARD +) + +// Devicemapper cookie flags. +const ( + DmUdevDisableSubsystemRulesFlag = C.DM_UDEV_DISABLE_SUBSYSTEM_RULES_FLAG + DmUdevDisableDiskRulesFlag = C.DM_UDEV_DISABLE_DISK_RULES_FLAG + DmUdevDisableOtherRulesFlag = C.DM_UDEV_DISABLE_OTHER_RULES_FLAG + DmUdevDisableLibraryFallback = C.DM_UDEV_DISABLE_LIBRARY_FALLBACK +) + +// DeviceMapper mapped functions. +var ( + DmGetLibraryVersion = dmGetLibraryVersionFct + DmGetNextTarget = dmGetNextTargetFct + DmLogInitVerbose = dmLogInitVerboseFct + DmSetDevDir = dmSetDevDirFct + DmTaskAddTarget = dmTaskAddTargetFct + DmTaskCreate = dmTaskCreateFct + DmTaskDestroy = dmTaskDestroyFct + DmTaskGetDeps = dmTaskGetDepsFct + DmTaskGetInfo = dmTaskGetInfoFct + DmTaskGetDriverVersion = dmTaskGetDriverVersionFct + DmTaskRun = dmTaskRunFct + DmTaskSetAddNode = dmTaskSetAddNodeFct + DmTaskSetCookie = dmTaskSetCookieFct + DmTaskSetMessage = dmTaskSetMessageFct + DmTaskSetName = dmTaskSetNameFct + DmTaskSetRo = dmTaskSetRoFct + DmTaskSetSector = dmTaskSetSectorFct + DmUdevWait = dmUdevWaitFct + DmUdevSetSyncSupport = dmUdevSetSyncSupportFct + DmUdevGetSyncSupport = dmUdevGetSyncSupportFct + DmCookieSupported = dmCookieSupportedFct + LogWithErrnoInit = logWithErrnoInitFct + DmTaskDeferredRemove = dmTaskDeferredRemoveFct + DmTaskGetInfoWithDeferred = dmTaskGetInfoWithDeferredFct +) + +func free(p *C.char) { + C.free(unsafe.Pointer(p)) +} + +func dmTaskDestroyFct(task *cdmTask) { + C.dm_task_destroy((*C.struct_dm_task)(task)) +} + +func dmTaskCreateFct(taskType int) *cdmTask { + return (*cdmTask)(C.dm_task_create(C.int(taskType))) +} + +func dmTaskRunFct(task *cdmTask) int { + ret, _ := C.dm_task_run((*C.struct_dm_task)(task)) + return int(ret) +} + +func dmTaskSetNameFct(task *cdmTask, name string) int { + Cname := C.CString(name) + defer free(Cname) + + return int(C.dm_task_set_name((*C.struct_dm_task)(task), Cname)) +} + +func dmTaskSetMessageFct(task *cdmTask, message string) int { + Cmessage := C.CString(message) + defer free(Cmessage) + + return int(C.dm_task_set_message((*C.struct_dm_task)(task), Cmessage)) +} + +func dmTaskSetSectorFct(task *cdmTask, sector uint64) int { + return int(C.dm_task_set_sector((*C.struct_dm_task)(task), C.uint64_t(sector))) +} + +func dmTaskSetCookieFct(task *cdmTask, cookie *uint, flags uint16) int { + cCookie := C.uint32_t(*cookie) + defer func() { + *cookie = uint(cCookie) + }() + return int(C.dm_task_set_cookie((*C.struct_dm_task)(task), &cCookie, C.uint16_t(flags))) +} + +func dmTaskSetAddNodeFct(task *cdmTask, addNode AddNodeType) int { + return int(C.dm_task_set_add_node((*C.struct_dm_task)(task), C.dm_add_node_t(addNode))) +} + +func dmTaskSetRoFct(task *cdmTask) int { + return int(C.dm_task_set_ro((*C.struct_dm_task)(task))) +} + +func dmTaskAddTargetFct(task *cdmTask, + start, size uint64, ttype, params string) int { + + Cttype := C.CString(ttype) + defer free(Cttype) + + Cparams := C.CString(params) + defer free(Cparams) + + return int(C.dm_task_add_target((*C.struct_dm_task)(task), C.uint64_t(start), C.uint64_t(size), Cttype, Cparams)) +} + +func dmTaskGetDepsFct(task *cdmTask) *Deps { + Cdeps := C.dm_task_get_deps((*C.struct_dm_task)(task)) + if Cdeps == nil { + return nil + } + + // golang issue: https://github.com/golang/go/issues/11925 + hdr := reflect.SliceHeader{ + Data: uintptr(unsafe.Pointer(uintptr(unsafe.Pointer(Cdeps)) + unsafe.Sizeof(*Cdeps))), + Len: int(Cdeps.count), + Cap: int(Cdeps.count), + } + devices := *(*[]C.uint64_t)(unsafe.Pointer(&hdr)) + + deps := &Deps{ + Count: uint32(Cdeps.count), + Filler: uint32(Cdeps.filler), + } + for _, device := range devices { + deps.Device = append(deps.Device, uint64(device)) + } + return deps +} + +func dmTaskGetInfoFct(task *cdmTask, info *Info) int { + Cinfo := C.struct_dm_info{} + defer func() { + info.Exists = int(Cinfo.exists) + info.Suspended = int(Cinfo.suspended) + info.LiveTable = int(Cinfo.live_table) + info.InactiveTable = int(Cinfo.inactive_table) + info.OpenCount = int32(Cinfo.open_count) + info.EventNr = uint32(Cinfo.event_nr) + info.Major = uint32(Cinfo.major) + info.Minor = uint32(Cinfo.minor) + info.ReadOnly = int(Cinfo.read_only) + info.TargetCount = int32(Cinfo.target_count) + }() + return int(C.dm_task_get_info((*C.struct_dm_task)(task), &Cinfo)) +} + +func dmTaskGetDriverVersionFct(task *cdmTask) string { + buffer := C.malloc(128) + defer C.free(buffer) + res := C.dm_task_get_driver_version((*C.struct_dm_task)(task), (*C.char)(buffer), 128) + if res == 0 { + return "" + } + return C.GoString((*C.char)(buffer)) +} + +func dmGetNextTargetFct(task *cdmTask, next unsafe.Pointer, start, length *uint64, target, params *string) unsafe.Pointer { + var ( + Cstart, Clength C.uint64_t + CtargetType, Cparams *C.char + ) + defer func() { + *start = uint64(Cstart) + *length = uint64(Clength) + *target = C.GoString(CtargetType) + *params = C.GoString(Cparams) + }() + + nextp := C.dm_get_next_target((*C.struct_dm_task)(task), next, &Cstart, &Clength, &CtargetType, &Cparams) + return nextp +} + +func dmUdevSetSyncSupportFct(syncWithUdev int) { + (C.dm_udev_set_sync_support(C.int(syncWithUdev))) +} + +func dmUdevGetSyncSupportFct() int { + return int(C.dm_udev_get_sync_support()) +} + +func dmUdevWaitFct(cookie uint) int { + return int(C.dm_udev_wait(C.uint32_t(cookie))) +} + +func dmCookieSupportedFct() int { + return int(C.dm_cookie_supported()) +} + +func dmLogInitVerboseFct(level int) { + C.dm_log_init_verbose(C.int(level)) +} + +func logWithErrnoInitFct() { + C.log_with_errno_init() +} + +func dmSetDevDirFct(dir string) int { + Cdir := C.CString(dir) + defer free(Cdir) + + return int(C.dm_set_dev_dir(Cdir)) +} + +func dmGetLibraryVersionFct(version *string) int { + buffer := C.CString(string(make([]byte, 128))) + defer free(buffer) + defer func() { + *version = C.GoString(buffer) + }() + return int(C.dm_get_library_version(buffer, 128)) +} diff --git a/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper_deferred_remove.go b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper_deferred_remove.go new file mode 100644 index 00000000..dc361eab --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper_deferred_remove.go @@ -0,0 +1,34 @@ +// +build linux,!libdm_no_deferred_remove + +package devicemapper + +/* +#cgo LDFLAGS: -L. -ldevmapper +#include +*/ +import "C" + +// LibraryDeferredRemovalSupport is supported when statically linked. +const LibraryDeferredRemovalSupport = true + +func dmTaskDeferredRemoveFct(task *cdmTask) int { + return int(C.dm_task_deferred_remove((*C.struct_dm_task)(task))) +} + +func dmTaskGetInfoWithDeferredFct(task *cdmTask, info *Info) int { + Cinfo := C.struct_dm_info{} + defer func() { + info.Exists = int(Cinfo.exists) + info.Suspended = int(Cinfo.suspended) + info.LiveTable = int(Cinfo.live_table) + info.InactiveTable = int(Cinfo.inactive_table) + info.OpenCount = int32(Cinfo.open_count) + info.EventNr = uint32(Cinfo.event_nr) + info.Major = uint32(Cinfo.major) + info.Minor = uint32(Cinfo.minor) + info.ReadOnly = int(Cinfo.read_only) + info.TargetCount = int32(Cinfo.target_count) + info.DeferredRemove = int(Cinfo.deferred_remove) + }() + return int(C.dm_task_get_info((*C.struct_dm_task)(task), &Cinfo)) +} diff --git a/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper_no_deferred_remove.go b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper_no_deferred_remove.go new file mode 100644 index 00000000..4a6665de --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/devicemapper/devmapper_wrapper_no_deferred_remove.go @@ -0,0 +1,15 @@ +// +build linux,libdm_no_deferred_remove + +package devicemapper + +// LibraryDeferredRemovalsupport is not supported when statically linked. +const LibraryDeferredRemovalSupport = false + +func dmTaskDeferredRemoveFct(task *cdmTask) int { + // Error. Nobody should be calling it. + return -1 +} + +func dmTaskGetInfoWithDeferredFct(task *cdmTask, info *Info) int { + return -1 +} diff --git a/vendor/github.com/containers/storage/pkg/devicemapper/ioctl.go b/vendor/github.com/containers/storage/pkg/devicemapper/ioctl.go new file mode 100644 index 00000000..581b57eb --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/devicemapper/ioctl.go @@ -0,0 +1,27 @@ +// +build linux + +package devicemapper + +import ( + "syscall" + "unsafe" +) + +func ioctlBlkGetSize64(fd uintptr) (int64, error) { + var size int64 + if _, _, err := syscall.Syscall(syscall.SYS_IOCTL, fd, BlkGetSize64, uintptr(unsafe.Pointer(&size))); err != 0 { + return 0, err + } + return size, nil +} + +func ioctlBlkDiscard(fd uintptr, offset, length uint64) error { + var r [2]uint64 + r[0] = offset + r[1] = length + + if _, _, err := syscall.Syscall(syscall.SYS_IOCTL, fd, BlkDiscard, uintptr(unsafe.Pointer(&r[0]))); err != 0 { + return err + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/devicemapper/log.go b/vendor/github.com/containers/storage/pkg/devicemapper/log.go new file mode 100644 index 00000000..cee5e545 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/devicemapper/log.go @@ -0,0 +1,11 @@ +package devicemapper + +// definitions from lvm2 lib/log/log.h +const ( + LogLevelFatal = 2 + iota // _LOG_FATAL + LogLevelErr // _LOG_ERR + LogLevelWarn // _LOG_WARN + LogLevelNotice // _LOG_NOTICE + LogLevelInfo // _LOG_INFO + LogLevelDebug // _LOG_DEBUG +) diff --git a/vendor/github.com/containers/storage/pkg/directory/directory.go b/vendor/github.com/containers/storage/pkg/directory/directory.go new file mode 100644 index 00000000..1715ef45 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/directory/directory.go @@ -0,0 +1,26 @@ +package directory + +import ( + "io/ioutil" + "os" + "path/filepath" +) + +// MoveToSubdir moves all contents of a directory to a subdirectory underneath the original path +func MoveToSubdir(oldpath, subdir string) error { + + infos, err := ioutil.ReadDir(oldpath) + if err != nil { + return err + } + for _, info := range infos { + if info.Name() != subdir { + oldName := filepath.Join(oldpath, info.Name()) + newName := filepath.Join(oldpath, subdir, info.Name()) + if err := os.Rename(oldName, newName); err != nil { + return err + } + } + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/directory/directory_unix.go b/vendor/github.com/containers/storage/pkg/directory/directory_unix.go new file mode 100644 index 00000000..397251bd --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/directory/directory_unix.go @@ -0,0 +1,48 @@ +// +build linux freebsd solaris + +package directory + +import ( + "os" + "path/filepath" + "syscall" +) + +// Size walks a directory tree and returns its total size in bytes. +func Size(dir string) (size int64, err error) { + data := make(map[uint64]struct{}) + err = filepath.Walk(dir, func(d string, fileInfo os.FileInfo, err error) error { + if err != nil { + // if dir does not exist, Size() returns the error. + // if dir/x disappeared while walking, Size() ignores dir/x. + if os.IsNotExist(err) && d != dir { + return nil + } + return err + } + + // Ignore directory sizes + if fileInfo == nil { + return nil + } + + s := fileInfo.Size() + if fileInfo.IsDir() || s == 0 { + return nil + } + + // Check inode to handle hard links correctly + inode := fileInfo.Sys().(*syscall.Stat_t).Ino + // inode is not a uint64 on all platforms. Cast it to avoid issues. + if _, exists := data[uint64(inode)]; exists { + return nil + } + // inode is not a uint64 on all platforms. Cast it to avoid issues. + data[uint64(inode)] = struct{}{} + + size += s + + return nil + }) + return +} diff --git a/vendor/github.com/containers/storage/pkg/directory/directory_windows.go b/vendor/github.com/containers/storage/pkg/directory/directory_windows.go new file mode 100644 index 00000000..6fb0917c --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/directory/directory_windows.go @@ -0,0 +1,37 @@ +// +build windows + +package directory + +import ( + "os" + "path/filepath" +) + +// Size walks a directory tree and returns its total size in bytes. +func Size(dir string) (size int64, err error) { + err = filepath.Walk(dir, func(d string, fileInfo os.FileInfo, err error) error { + if err != nil { + // if dir does not exist, Size() returns the error. + // if dir/x disappeared while walking, Size() ignores dir/x. + if os.IsNotExist(err) && d != dir { + return nil + } + return err + } + + // Ignore directory sizes + if fileInfo == nil { + return nil + } + + s := fileInfo.Size() + if fileInfo.IsDir() || s == 0 { + return nil + } + + size += s + + return nil + }) + return +} diff --git a/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go b/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go new file mode 100644 index 00000000..763d8d27 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/fileutils/fileutils.go @@ -0,0 +1,283 @@ +package fileutils + +import ( + "errors" + "fmt" + "io" + "os" + "path/filepath" + "regexp" + "strings" + "text/scanner" + + "github.com/Sirupsen/logrus" +) + +// exclusion returns true if the specified pattern is an exclusion +func exclusion(pattern string) bool { + return pattern[0] == '!' +} + +// empty returns true if the specified pattern is empty +func empty(pattern string) bool { + return pattern == "" +} + +// CleanPatterns takes a slice of patterns returns a new +// slice of patterns cleaned with filepath.Clean, stripped +// of any empty patterns and lets the caller know whether the +// slice contains any exception patterns (prefixed with !). +func CleanPatterns(patterns []string) ([]string, [][]string, bool, error) { + // Loop over exclusion patterns and: + // 1. Clean them up. + // 2. Indicate whether we are dealing with any exception rules. + // 3. Error if we see a single exclusion marker on it's own (!). + cleanedPatterns := []string{} + patternDirs := [][]string{} + exceptions := false + for _, pattern := range patterns { + // Eliminate leading and trailing whitespace. + pattern = strings.TrimSpace(pattern) + if empty(pattern) { + continue + } + if exclusion(pattern) { + if len(pattern) == 1 { + return nil, nil, false, errors.New("Illegal exclusion pattern: !") + } + exceptions = true + } + pattern = filepath.Clean(pattern) + cleanedPatterns = append(cleanedPatterns, pattern) + if exclusion(pattern) { + pattern = pattern[1:] + } + patternDirs = append(patternDirs, strings.Split(pattern, string(os.PathSeparator))) + } + + return cleanedPatterns, patternDirs, exceptions, nil +} + +// Matches returns true if file matches any of the patterns +// and isn't excluded by any of the subsequent patterns. +func Matches(file string, patterns []string) (bool, error) { + file = filepath.Clean(file) + + if file == "." { + // Don't let them exclude everything, kind of silly. + return false, nil + } + + patterns, patDirs, _, err := CleanPatterns(patterns) + if err != nil { + return false, err + } + + return OptimizedMatches(file, patterns, patDirs) +} + +// OptimizedMatches is basically the same as fileutils.Matches() but optimized for archive.go. +// It will assume that the inputs have been preprocessed and therefore the function +// doesn't need to do as much error checking and clean-up. This was done to avoid +// repeating these steps on each file being checked during the archive process. +// The more generic fileutils.Matches() can't make these assumptions. +func OptimizedMatches(file string, patterns []string, patDirs [][]string) (bool, error) { + matched := false + file = filepath.FromSlash(file) + parentPath := filepath.Dir(file) + parentPathDirs := strings.Split(parentPath, string(os.PathSeparator)) + + for i, pattern := range patterns { + negative := false + + if exclusion(pattern) { + negative = true + pattern = pattern[1:] + } + + match, err := regexpMatch(pattern, file) + if err != nil { + return false, fmt.Errorf("Error in pattern (%s): %s", pattern, err) + } + + if !match && parentPath != "." { + // Check to see if the pattern matches one of our parent dirs. + if len(patDirs[i]) <= len(parentPathDirs) { + match, _ = regexpMatch(strings.Join(patDirs[i], string(os.PathSeparator)), + strings.Join(parentPathDirs[:len(patDirs[i])], string(os.PathSeparator))) + } + } + + if match { + matched = !negative + } + } + + if matched { + logrus.Debugf("Skipping excluded path: %s", file) + } + + return matched, nil +} + +// regexpMatch tries to match the logic of filepath.Match but +// does so using regexp logic. We do this so that we can expand the +// wildcard set to include other things, like "**" to mean any number +// of directories. This means that we should be backwards compatible +// with filepath.Match(). We'll end up supporting more stuff, due to +// the fact that we're using regexp, but that's ok - it does no harm. +// +// As per the comment in golangs filepath.Match, on Windows, escaping +// is disabled. Instead, '\\' is treated as path separator. +func regexpMatch(pattern, path string) (bool, error) { + regStr := "^" + + // Do some syntax checking on the pattern. + // filepath's Match() has some really weird rules that are inconsistent + // so instead of trying to dup their logic, just call Match() for its + // error state and if there is an error in the pattern return it. + // If this becomes an issue we can remove this since its really only + // needed in the error (syntax) case - which isn't really critical. + if _, err := filepath.Match(pattern, path); err != nil { + return false, err + } + + // Go through the pattern and convert it to a regexp. + // We use a scanner so we can support utf-8 chars. + var scan scanner.Scanner + scan.Init(strings.NewReader(pattern)) + + sl := string(os.PathSeparator) + escSL := sl + if sl == `\` { + escSL += `\` + } + + for scan.Peek() != scanner.EOF { + ch := scan.Next() + + if ch == '*' { + if scan.Peek() == '*' { + // is some flavor of "**" + scan.Next() + + if scan.Peek() == scanner.EOF { + // is "**EOF" - to align with .gitignore just accept all + regStr += ".*" + } else { + // is "**" + regStr += "((.*" + escSL + ")|([^" + escSL + "]*))" + } + + // Treat **/ as ** so eat the "/" + if string(scan.Peek()) == sl { + scan.Next() + } + } else { + // is "*" so map it to anything but "/" + regStr += "[^" + escSL + "]*" + } + } else if ch == '?' { + // "?" is any char except "/" + regStr += "[^" + escSL + "]" + } else if strings.Index(".$", string(ch)) != -1 { + // Escape some regexp special chars that have no meaning + // in golang's filepath.Match + regStr += `\` + string(ch) + } else if ch == '\\' { + // escape next char. Note that a trailing \ in the pattern + // will be left alone (but need to escape it) + if sl == `\` { + // On windows map "\" to "\\", meaning an escaped backslash, + // and then just continue because filepath.Match on + // Windows doesn't allow escaping at all + regStr += escSL + continue + } + if scan.Peek() != scanner.EOF { + regStr += `\` + string(scan.Next()) + } else { + regStr += `\` + } + } else { + regStr += string(ch) + } + } + + regStr += "$" + + res, err := regexp.MatchString(regStr, path) + + // Map regexp's error to filepath's so no one knows we're not using filepath + if err != nil { + err = filepath.ErrBadPattern + } + + return res, err +} + +// CopyFile copies from src to dst until either EOF is reached +// on src or an error occurs. It verifies src exists and removes +// the dst if it exists. +func CopyFile(src, dst string) (int64, error) { + cleanSrc := filepath.Clean(src) + cleanDst := filepath.Clean(dst) + if cleanSrc == cleanDst { + return 0, nil + } + sf, err := os.Open(cleanSrc) + if err != nil { + return 0, err + } + defer sf.Close() + if err := os.Remove(cleanDst); err != nil && !os.IsNotExist(err) { + return 0, err + } + df, err := os.Create(cleanDst) + if err != nil { + return 0, err + } + defer df.Close() + return io.Copy(df, sf) +} + +// ReadSymlinkedDirectory returns the target directory of a symlink. +// The target of the symbolic link may not be a file. +func ReadSymlinkedDirectory(path string) (string, error) { + var realPath string + var err error + if realPath, err = filepath.Abs(path); err != nil { + return "", fmt.Errorf("unable to get absolute path for %s: %s", path, err) + } + if realPath, err = filepath.EvalSymlinks(realPath); err != nil { + return "", fmt.Errorf("failed to canonicalise path for %s: %s", path, err) + } + realPathInfo, err := os.Stat(realPath) + if err != nil { + return "", fmt.Errorf("failed to stat target '%s' of '%s': %s", realPath, path, err) + } + if !realPathInfo.Mode().IsDir() { + return "", fmt.Errorf("canonical path points to a file '%s'", realPath) + } + return realPath, nil +} + +// CreateIfNotExists creates a file or a directory only if it does not already exist. +func CreateIfNotExists(path string, isDir bool) error { + if _, err := os.Stat(path); err != nil { + if os.IsNotExist(err) { + if isDir { + return os.MkdirAll(path, 0755) + } + if err := os.MkdirAll(filepath.Dir(path), 0755); err != nil { + return err + } + f, err := os.OpenFile(path, os.O_CREATE, 0755) + if err != nil { + return err + } + f.Close() + } + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/fileutils/fileutils_darwin.go b/vendor/github.com/containers/storage/pkg/fileutils/fileutils_darwin.go new file mode 100644 index 00000000..ccd648fa --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/fileutils/fileutils_darwin.go @@ -0,0 +1,27 @@ +package fileutils + +import ( + "os" + "os/exec" + "strconv" + "strings" +) + +// GetTotalUsedFds returns the number of used File Descriptors by +// executing `lsof -p PID` +func GetTotalUsedFds() int { + pid := os.Getpid() + + cmd := exec.Command("lsof", "-p", strconv.Itoa(pid)) + + output, err := cmd.CombinedOutput() + if err != nil { + return -1 + } + + outputStr := strings.TrimSpace(string(output)) + + fds := strings.Split(outputStr, "\n") + + return len(fds) - 1 +} diff --git a/vendor/github.com/containers/storage/pkg/fileutils/fileutils_solaris.go b/vendor/github.com/containers/storage/pkg/fileutils/fileutils_solaris.go new file mode 100644 index 00000000..0f2cb7ab --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/fileutils/fileutils_solaris.go @@ -0,0 +1,7 @@ +package fileutils + +// GetTotalUsedFds Returns the number of used File Descriptors. +// On Solaris these limits are per process and not systemwide +func GetTotalUsedFds() int { + return -1 +} diff --git a/vendor/github.com/containers/storage/pkg/fileutils/fileutils_unix.go b/vendor/github.com/containers/storage/pkg/fileutils/fileutils_unix.go new file mode 100644 index 00000000..d5c3abf5 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/fileutils/fileutils_unix.go @@ -0,0 +1,22 @@ +// +build linux freebsd + +package fileutils + +import ( + "fmt" + "io/ioutil" + "os" + + "github.com/Sirupsen/logrus" +) + +// GetTotalUsedFds Returns the number of used File Descriptors by +// reading it via /proc filesystem. +func GetTotalUsedFds() int { + if fds, err := ioutil.ReadDir(fmt.Sprintf("/proc/%d/fd", os.Getpid())); err != nil { + logrus.Errorf("Error opening /proc/%d/fd: %s", os.Getpid(), err) + } else { + return len(fds) + } + return -1 +} diff --git a/vendor/github.com/containers/storage/pkg/fileutils/fileutils_windows.go b/vendor/github.com/containers/storage/pkg/fileutils/fileutils_windows.go new file mode 100644 index 00000000..5ec21cac --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/fileutils/fileutils_windows.go @@ -0,0 +1,7 @@ +package fileutils + +// GetTotalUsedFds Returns the number of used File Descriptors. Not supported +// on Windows. +func GetTotalUsedFds() int { + return -1 +} diff --git a/vendor/github.com/containers/storage/pkg/idtools/idtools.go b/vendor/github.com/containers/storage/pkg/idtools/idtools.go new file mode 100644 index 00000000..6bca4662 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/idtools/idtools.go @@ -0,0 +1,197 @@ +package idtools + +import ( + "bufio" + "fmt" + "os" + "sort" + "strconv" + "strings" +) + +// IDMap contains a single entry for user namespace range remapping. An array +// of IDMap entries represents the structure that will be provided to the Linux +// kernel for creating a user namespace. +type IDMap struct { + ContainerID int `json:"container_id"` + HostID int `json:"host_id"` + Size int `json:"size"` +} + +type subIDRange struct { + Start int + Length int +} + +type ranges []subIDRange + +func (e ranges) Len() int { return len(e) } +func (e ranges) Swap(i, j int) { e[i], e[j] = e[j], e[i] } +func (e ranges) Less(i, j int) bool { return e[i].Start < e[j].Start } + +const ( + subuidFileName string = "/etc/subuid" + subgidFileName string = "/etc/subgid" +) + +// MkdirAllAs creates a directory (include any along the path) and then modifies +// ownership to the requested uid/gid. If the directory already exists, this +// function will still change ownership to the requested uid/gid pair. +func MkdirAllAs(path string, mode os.FileMode, ownerUID, ownerGID int) error { + return mkdirAs(path, mode, ownerUID, ownerGID, true, true) +} + +// MkdirAllNewAs creates a directory (include any along the path) and then modifies +// ownership ONLY of newly created directories to the requested uid/gid. If the +// directories along the path exist, no change of ownership will be performed +func MkdirAllNewAs(path string, mode os.FileMode, ownerUID, ownerGID int) error { + return mkdirAs(path, mode, ownerUID, ownerGID, true, false) +} + +// MkdirAs creates a directory and then modifies ownership to the requested uid/gid. +// If the directory already exists, this function still changes ownership +func MkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int) error { + return mkdirAs(path, mode, ownerUID, ownerGID, false, true) +} + +// GetRootUIDGID retrieves the remapped root uid/gid pair from the set of maps. +// If the maps are empty, then the root uid/gid will default to "real" 0/0 +func GetRootUIDGID(uidMap, gidMap []IDMap) (int, int, error) { + var uid, gid int + + if uidMap != nil { + xUID, err := ToHost(0, uidMap) + if err != nil { + return -1, -1, err + } + uid = xUID + } + if gidMap != nil { + xGID, err := ToHost(0, gidMap) + if err != nil { + return -1, -1, err + } + gid = xGID + } + return uid, gid, nil +} + +// ToContainer takes an id mapping, and uses it to translate a +// host ID to the remapped ID. If no map is provided, then the translation +// assumes a 1-to-1 mapping and returns the passed in id +func ToContainer(hostID int, idMap []IDMap) (int, error) { + if idMap == nil { + return hostID, nil + } + for _, m := range idMap { + if (hostID >= m.HostID) && (hostID <= (m.HostID + m.Size - 1)) { + contID := m.ContainerID + (hostID - m.HostID) + return contID, nil + } + } + return -1, fmt.Errorf("Host ID %d cannot be mapped to a container ID", hostID) +} + +// ToHost takes an id mapping and a remapped ID, and translates the +// ID to the mapped host ID. If no map is provided, then the translation +// assumes a 1-to-1 mapping and returns the passed in id # +func ToHost(contID int, idMap []IDMap) (int, error) { + if idMap == nil { + return contID, nil + } + for _, m := range idMap { + if (contID >= m.ContainerID) && (contID <= (m.ContainerID + m.Size - 1)) { + hostID := m.HostID + (contID - m.ContainerID) + return hostID, nil + } + } + return -1, fmt.Errorf("Container ID %d cannot be mapped to a host ID", contID) +} + +// CreateIDMappings takes a requested user and group name and +// using the data from /etc/sub{uid,gid} ranges, creates the +// proper uid and gid remapping ranges for that user/group pair +func CreateIDMappings(username, groupname string) ([]IDMap, []IDMap, error) { + subuidRanges, err := parseSubuid(username) + if err != nil { + return nil, nil, err + } + subgidRanges, err := parseSubgid(groupname) + if err != nil { + return nil, nil, err + } + if len(subuidRanges) == 0 { + return nil, nil, fmt.Errorf("No subuid ranges found for user %q", username) + } + if len(subgidRanges) == 0 { + return nil, nil, fmt.Errorf("No subgid ranges found for group %q", groupname) + } + + return createIDMap(subuidRanges), createIDMap(subgidRanges), nil +} + +func createIDMap(subidRanges ranges) []IDMap { + idMap := []IDMap{} + + // sort the ranges by lowest ID first + sort.Sort(subidRanges) + containerID := 0 + for _, idrange := range subidRanges { + idMap = append(idMap, IDMap{ + ContainerID: containerID, + HostID: idrange.Start, + Size: idrange.Length, + }) + containerID = containerID + idrange.Length + } + return idMap +} + +func parseSubuid(username string) (ranges, error) { + return parseSubidFile(subuidFileName, username) +} + +func parseSubgid(username string) (ranges, error) { + return parseSubidFile(subgidFileName, username) +} + +// parseSubidFile will read the appropriate file (/etc/subuid or /etc/subgid) +// and return all found ranges for a specified username. If the special value +// "ALL" is supplied for username, then all ranges in the file will be returned +func parseSubidFile(path, username string) (ranges, error) { + var rangeList ranges + + subidFile, err := os.Open(path) + if err != nil { + return rangeList, err + } + defer subidFile.Close() + + s := bufio.NewScanner(subidFile) + for s.Scan() { + if err := s.Err(); err != nil { + return rangeList, err + } + + text := strings.TrimSpace(s.Text()) + if text == "" || strings.HasPrefix(text, "#") { + continue + } + parts := strings.Split(text, ":") + if len(parts) != 3 { + return rangeList, fmt.Errorf("Cannot parse subuid/gid information: Format not correct for %s file", path) + } + if parts[0] == username || username == "ALL" { + startid, err := strconv.Atoi(parts[1]) + if err != nil { + return rangeList, fmt.Errorf("String to int conversion failed during subuid/gid parsing of %s: %v", path, err) + } + length, err := strconv.Atoi(parts[2]) + if err != nil { + return rangeList, fmt.Errorf("String to int conversion failed during subuid/gid parsing of %s: %v", path, err) + } + rangeList = append(rangeList, subIDRange{startid, length}) + } + } + return rangeList, nil +} diff --git a/vendor/github.com/containers/storage/pkg/idtools/idtools_unix.go b/vendor/github.com/containers/storage/pkg/idtools/idtools_unix.go new file mode 100644 index 00000000..b2cfb05e --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/idtools/idtools_unix.go @@ -0,0 +1,60 @@ +// +build !windows + +package idtools + +import ( + "os" + "path/filepath" + + "github.com/containers/storage/pkg/system" +) + +func mkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int, mkAll, chownExisting bool) error { + // make an array containing the original path asked for, plus (for mkAll == true) + // all path components leading up to the complete path that don't exist before we MkdirAll + // so that we can chown all of them properly at the end. If chownExisting is false, we won't + // chown the full directory path if it exists + var paths []string + if _, err := os.Stat(path); err != nil && os.IsNotExist(err) { + paths = []string{path} + } else if err == nil && chownExisting { + if err := os.Chown(path, ownerUID, ownerGID); err != nil { + return err + } + // short-circuit--we were called with an existing directory and chown was requested + return nil + } else if err == nil { + // nothing to do; directory path fully exists already and chown was NOT requested + return nil + } + + if mkAll { + // walk back to "/" looking for directories which do not exist + // and add them to the paths array for chown after creation + dirPath := path + for { + dirPath = filepath.Dir(dirPath) + if dirPath == "/" { + break + } + if _, err := os.Stat(dirPath); err != nil && os.IsNotExist(err) { + paths = append(paths, dirPath) + } + } + if err := system.MkdirAll(path, mode); err != nil && !os.IsExist(err) { + return err + } + } else { + if err := os.Mkdir(path, mode); err != nil && !os.IsExist(err) { + return err + } + } + // even if it existed, we will chown the requested path + any subpaths that + // didn't exist when we called MkdirAll + for _, pathComponent := range paths { + if err := os.Chown(pathComponent, ownerUID, ownerGID); err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/idtools/idtools_windows.go b/vendor/github.com/containers/storage/pkg/idtools/idtools_windows.go new file mode 100644 index 00000000..0cad1736 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/idtools/idtools_windows.go @@ -0,0 +1,18 @@ +// +build windows + +package idtools + +import ( + "os" + + "github.com/containers/storage/pkg/system" +) + +// Platforms such as Windows do not support the UID/GID concept. So make this +// just a wrapper around system.MkdirAll. +func mkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int, mkAll, chownExisting bool) error { + if err := system.MkdirAll(path, mode); err != nil && !os.IsExist(err) { + return err + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/idtools/usergroupadd_linux.go b/vendor/github.com/containers/storage/pkg/idtools/usergroupadd_linux.go new file mode 100644 index 00000000..4a4aaed0 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/idtools/usergroupadd_linux.go @@ -0,0 +1,188 @@ +package idtools + +import ( + "fmt" + "os/exec" + "path/filepath" + "regexp" + "sort" + "strconv" + "strings" + "sync" +) + +// add a user and/or group to Linux /etc/passwd, /etc/group using standard +// Linux distribution commands: +// adduser --system --shell /bin/false --disabled-login --disabled-password --no-create-home --group +// useradd -r -s /bin/false + +var ( + once sync.Once + userCommand string + + cmdTemplates = map[string]string{ + "adduser": "--system --shell /bin/false --no-create-home --disabled-login --disabled-password --group %s", + "useradd": "-r -s /bin/false %s", + "usermod": "-%s %d-%d %s", + } + + idOutRegexp = regexp.MustCompile(`uid=([0-9]+).*gid=([0-9]+)`) + // default length for a UID/GID subordinate range + defaultRangeLen = 65536 + defaultRangeStart = 100000 + userMod = "usermod" +) + +func resolveBinary(binname string) (string, error) { + binaryPath, err := exec.LookPath(binname) + if err != nil { + return "", err + } + resolvedPath, err := filepath.EvalSymlinks(binaryPath) + if err != nil { + return "", err + } + //only return no error if the final resolved binary basename + //matches what was searched for + if filepath.Base(resolvedPath) == binname { + return resolvedPath, nil + } + return "", fmt.Errorf("Binary %q does not resolve to a binary of that name in $PATH (%q)", binname, resolvedPath) +} + +// AddNamespaceRangesUser takes a username and uses the standard system +// utility to create a system user/group pair used to hold the +// /etc/sub{uid,gid} ranges which will be used for user namespace +// mapping ranges in containers. +func AddNamespaceRangesUser(name string) (int, int, error) { + if err := addUser(name); err != nil { + return -1, -1, fmt.Errorf("Error adding user %q: %v", name, err) + } + + // Query the system for the created uid and gid pair + out, err := execCmd("id", name) + if err != nil { + return -1, -1, fmt.Errorf("Error trying to find uid/gid for new user %q: %v", name, err) + } + matches := idOutRegexp.FindStringSubmatch(strings.TrimSpace(string(out))) + if len(matches) != 3 { + return -1, -1, fmt.Errorf("Can't find uid, gid from `id` output: %q", string(out)) + } + uid, err := strconv.Atoi(matches[1]) + if err != nil { + return -1, -1, fmt.Errorf("Can't convert found uid (%s) to int: %v", matches[1], err) + } + gid, err := strconv.Atoi(matches[2]) + if err != nil { + return -1, -1, fmt.Errorf("Can't convert found gid (%s) to int: %v", matches[2], err) + } + + // Now we need to create the subuid/subgid ranges for our new user/group (system users + // do not get auto-created ranges in subuid/subgid) + + if err := createSubordinateRanges(name); err != nil { + return -1, -1, fmt.Errorf("Couldn't create subordinate ID ranges: %v", err) + } + return uid, gid, nil +} + +func addUser(userName string) error { + once.Do(func() { + // set up which commands are used for adding users/groups dependent on distro + if _, err := resolveBinary("adduser"); err == nil { + userCommand = "adduser" + } else if _, err := resolveBinary("useradd"); err == nil { + userCommand = "useradd" + } + }) + if userCommand == "" { + return fmt.Errorf("Cannot add user; no useradd/adduser binary found") + } + args := fmt.Sprintf(cmdTemplates[userCommand], userName) + out, err := execCmd(userCommand, args) + if err != nil { + return fmt.Errorf("Failed to add user with error: %v; output: %q", err, string(out)) + } + return nil +} + +func createSubordinateRanges(name string) error { + + // first, we should verify that ranges weren't automatically created + // by the distro tooling + ranges, err := parseSubuid(name) + if err != nil { + return fmt.Errorf("Error while looking for subuid ranges for user %q: %v", name, err) + } + if len(ranges) == 0 { + // no UID ranges; let's create one + startID, err := findNextUIDRange() + if err != nil { + return fmt.Errorf("Can't find available subuid range: %v", err) + } + out, err := execCmd(userMod, fmt.Sprintf(cmdTemplates[userMod], "v", startID, startID+defaultRangeLen-1, name)) + if err != nil { + return fmt.Errorf("Unable to add subuid range to user: %q; output: %s, err: %v", name, out, err) + } + } + + ranges, err = parseSubgid(name) + if err != nil { + return fmt.Errorf("Error while looking for subgid ranges for user %q: %v", name, err) + } + if len(ranges) == 0 { + // no GID ranges; let's create one + startID, err := findNextGIDRange() + if err != nil { + return fmt.Errorf("Can't find available subgid range: %v", err) + } + out, err := execCmd(userMod, fmt.Sprintf(cmdTemplates[userMod], "w", startID, startID+defaultRangeLen-1, name)) + if err != nil { + return fmt.Errorf("Unable to add subgid range to user: %q; output: %s, err: %v", name, out, err) + } + } + return nil +} + +func findNextUIDRange() (int, error) { + ranges, err := parseSubuid("ALL") + if err != nil { + return -1, fmt.Errorf("Couldn't parse all ranges in /etc/subuid file: %v", err) + } + sort.Sort(ranges) + return findNextRangeStart(ranges) +} + +func findNextGIDRange() (int, error) { + ranges, err := parseSubgid("ALL") + if err != nil { + return -1, fmt.Errorf("Couldn't parse all ranges in /etc/subgid file: %v", err) + } + sort.Sort(ranges) + return findNextRangeStart(ranges) +} + +func findNextRangeStart(rangeList ranges) (int, error) { + startID := defaultRangeStart + for _, arange := range rangeList { + if wouldOverlap(arange, startID) { + startID = arange.Start + arange.Length + } + } + return startID, nil +} + +func wouldOverlap(arange subIDRange, ID int) bool { + low := ID + high := ID + defaultRangeLen + if (low >= arange.Start && low <= arange.Start+arange.Length) || + (high <= arange.Start+arange.Length && high >= arange.Start) { + return true + } + return false +} + +func execCmd(cmd, args string) ([]byte, error) { + execCmd := exec.Command(cmd, strings.Split(args, " ")...) + return execCmd.CombinedOutput() +} diff --git a/vendor/github.com/containers/storage/pkg/idtools/usergroupadd_unsupported.go b/vendor/github.com/containers/storage/pkg/idtools/usergroupadd_unsupported.go new file mode 100644 index 00000000..d98b354c --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/idtools/usergroupadd_unsupported.go @@ -0,0 +1,12 @@ +// +build !linux + +package idtools + +import "fmt" + +// AddNamespaceRangesUser takes a name and finds an unused uid, gid pair +// and calls the appropriate helper function to add the group and then +// the user to the group in /etc/group and /etc/passwd respectively. +func AddNamespaceRangesUser(name string) (int, int, error) { + return -1, -1, fmt.Errorf("No support for adding users or groups on this OS") +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/buffer.go b/vendor/github.com/containers/storage/pkg/ioutils/buffer.go new file mode 100644 index 00000000..3d737b3e --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/buffer.go @@ -0,0 +1,51 @@ +package ioutils + +import ( + "errors" + "io" +) + +var errBufferFull = errors.New("buffer is full") + +type fixedBuffer struct { + buf []byte + pos int + lastRead int +} + +func (b *fixedBuffer) Write(p []byte) (int, error) { + n := copy(b.buf[b.pos:cap(b.buf)], p) + b.pos += n + + if n < len(p) { + if b.pos == cap(b.buf) { + return n, errBufferFull + } + return n, io.ErrShortWrite + } + return n, nil +} + +func (b *fixedBuffer) Read(p []byte) (int, error) { + n := copy(p, b.buf[b.lastRead:b.pos]) + b.lastRead += n + return n, nil +} + +func (b *fixedBuffer) Len() int { + return b.pos - b.lastRead +} + +func (b *fixedBuffer) Cap() int { + return cap(b.buf) +} + +func (b *fixedBuffer) Reset() { + b.pos = 0 + b.lastRead = 0 + b.buf = b.buf[:0] +} + +func (b *fixedBuffer) String() string { + return string(b.buf[b.lastRead:b.pos]) +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/fmt.go b/vendor/github.com/containers/storage/pkg/ioutils/fmt.go new file mode 100644 index 00000000..0b04b0ba --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/fmt.go @@ -0,0 +1,22 @@ +package ioutils + +import ( + "fmt" + "io" +) + +// FprintfIfNotEmpty prints the string value if it's not empty +func FprintfIfNotEmpty(w io.Writer, format, value string) (int, error) { + if value != "" { + return fmt.Fprintf(w, format, value) + } + return 0, nil +} + +// FprintfIfTrue prints the boolean value if it's true +func FprintfIfTrue(w io.Writer, format string, ok bool) (int, error) { + if ok { + return fmt.Fprintf(w, format, ok) + } + return 0, nil +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/fswriters.go b/vendor/github.com/containers/storage/pkg/ioutils/fswriters.go new file mode 100644 index 00000000..6dc50a03 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/fswriters.go @@ -0,0 +1,82 @@ +package ioutils + +import ( + "io" + "io/ioutil" + "os" + "path/filepath" +) + +// NewAtomicFileWriter returns WriteCloser so that writing to it writes to a +// temporary file and closing it atomically changes the temporary file to +// destination path. Writing and closing concurrently is not allowed. +func NewAtomicFileWriter(filename string, perm os.FileMode) (io.WriteCloser, error) { + f, err := ioutil.TempFile(filepath.Dir(filename), ".tmp-"+filepath.Base(filename)) + if err != nil { + return nil, err + } + + abspath, err := filepath.Abs(filename) + if err != nil { + return nil, err + } + return &atomicFileWriter{ + f: f, + fn: abspath, + perm: perm, + }, nil +} + +// AtomicWriteFile atomically writes data to a file named by filename. +func AtomicWriteFile(filename string, data []byte, perm os.FileMode) error { + f, err := NewAtomicFileWriter(filename, perm) + if err != nil { + return err + } + n, err := f.Write(data) + if err == nil && n < len(data) { + err = io.ErrShortWrite + f.(*atomicFileWriter).writeErr = err + } + if err1 := f.Close(); err == nil { + err = err1 + } + return err +} + +type atomicFileWriter struct { + f *os.File + fn string + writeErr error + perm os.FileMode +} + +func (w *atomicFileWriter) Write(dt []byte) (int, error) { + n, err := w.f.Write(dt) + if err != nil { + w.writeErr = err + } + return n, err +} + +func (w *atomicFileWriter) Close() (retErr error) { + defer func() { + if retErr != nil || w.writeErr != nil { + os.Remove(w.f.Name()) + } + }() + if err := w.f.Sync(); err != nil { + w.f.Close() + return err + } + if err := w.f.Close(); err != nil { + return err + } + if err := os.Chmod(w.f.Name(), w.perm); err != nil { + return err + } + if w.writeErr == nil { + return os.Rename(w.f.Name(), w.fn) + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/multireader.go b/vendor/github.com/containers/storage/pkg/ioutils/multireader.go new file mode 100644 index 00000000..0d2d76b4 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/multireader.go @@ -0,0 +1,226 @@ +package ioutils + +import ( + "bytes" + "fmt" + "io" + "os" +) + +type pos struct { + idx int + offset int64 +} + +type multiReadSeeker struct { + readers []io.ReadSeeker + pos *pos + posIdx map[io.ReadSeeker]int +} + +func (r *multiReadSeeker) Seek(offset int64, whence int) (int64, error) { + var tmpOffset int64 + switch whence { + case os.SEEK_SET: + for i, rdr := range r.readers { + // get size of the current reader + s, err := rdr.Seek(0, os.SEEK_END) + if err != nil { + return -1, err + } + + if offset > tmpOffset+s { + if i == len(r.readers)-1 { + rdrOffset := s + (offset - tmpOffset) + if _, err := rdr.Seek(rdrOffset, os.SEEK_SET); err != nil { + return -1, err + } + r.pos = &pos{i, rdrOffset} + return offset, nil + } + + tmpOffset += s + continue + } + + rdrOffset := offset - tmpOffset + idx := i + + rdr.Seek(rdrOffset, os.SEEK_SET) + // make sure all following readers are at 0 + for _, rdr := range r.readers[i+1:] { + rdr.Seek(0, os.SEEK_SET) + } + + if rdrOffset == s && i != len(r.readers)-1 { + idx++ + rdrOffset = 0 + } + r.pos = &pos{idx, rdrOffset} + return offset, nil + } + case os.SEEK_END: + for _, rdr := range r.readers { + s, err := rdr.Seek(0, os.SEEK_END) + if err != nil { + return -1, err + } + tmpOffset += s + } + r.Seek(tmpOffset+offset, os.SEEK_SET) + return tmpOffset + offset, nil + case os.SEEK_CUR: + if r.pos == nil { + return r.Seek(offset, os.SEEK_SET) + } + // Just return the current offset + if offset == 0 { + return r.getCurOffset() + } + + curOffset, err := r.getCurOffset() + if err != nil { + return -1, err + } + rdr, rdrOffset, err := r.getReaderForOffset(curOffset + offset) + if err != nil { + return -1, err + } + + r.pos = &pos{r.posIdx[rdr], rdrOffset} + return curOffset + offset, nil + default: + return -1, fmt.Errorf("Invalid whence: %d", whence) + } + + return -1, fmt.Errorf("Error seeking for whence: %d, offset: %d", whence, offset) +} + +func (r *multiReadSeeker) getReaderForOffset(offset int64) (io.ReadSeeker, int64, error) { + var rdr io.ReadSeeker + var rdrOffset int64 + + for i, rdr := range r.readers { + offsetTo, err := r.getOffsetToReader(rdr) + if err != nil { + return nil, -1, err + } + if offsetTo > offset { + rdr = r.readers[i-1] + rdrOffset = offsetTo - offset + break + } + + if rdr == r.readers[len(r.readers)-1] { + rdrOffset = offsetTo + offset + break + } + } + + return rdr, rdrOffset, nil +} + +func (r *multiReadSeeker) getCurOffset() (int64, error) { + var totalSize int64 + for _, rdr := range r.readers[:r.pos.idx+1] { + if r.posIdx[rdr] == r.pos.idx { + totalSize += r.pos.offset + break + } + + size, err := getReadSeekerSize(rdr) + if err != nil { + return -1, fmt.Errorf("error getting seeker size: %v", err) + } + totalSize += size + } + return totalSize, nil +} + +func (r *multiReadSeeker) getOffsetToReader(rdr io.ReadSeeker) (int64, error) { + var offset int64 + for _, r := range r.readers { + if r == rdr { + break + } + + size, err := getReadSeekerSize(rdr) + if err != nil { + return -1, err + } + offset += size + } + return offset, nil +} + +func (r *multiReadSeeker) Read(b []byte) (int, error) { + if r.pos == nil { + r.pos = &pos{0, 0} + } + + bCap := int64(cap(b)) + buf := bytes.NewBuffer(nil) + var rdr io.ReadSeeker + + for _, rdr = range r.readers[r.pos.idx:] { + readBytes, err := io.CopyN(buf, rdr, bCap) + if err != nil && err != io.EOF { + return -1, err + } + bCap -= readBytes + + if bCap == 0 { + break + } + } + + rdrPos, err := rdr.Seek(0, os.SEEK_CUR) + if err != nil { + return -1, err + } + r.pos = &pos{r.posIdx[rdr], rdrPos} + return buf.Read(b) +} + +func getReadSeekerSize(rdr io.ReadSeeker) (int64, error) { + // save the current position + pos, err := rdr.Seek(0, os.SEEK_CUR) + if err != nil { + return -1, err + } + + // get the size + size, err := rdr.Seek(0, os.SEEK_END) + if err != nil { + return -1, err + } + + // reset the position + if _, err := rdr.Seek(pos, os.SEEK_SET); err != nil { + return -1, err + } + return size, nil +} + +// MultiReadSeeker returns a ReadSeeker that's the logical concatenation of the provided +// input readseekers. After calling this method the initial position is set to the +// beginning of the first ReadSeeker. At the end of a ReadSeeker, Read always advances +// to the beginning of the next ReadSeeker and returns EOF at the end of the last ReadSeeker. +// Seek can be used over the sum of lengths of all readseekers. +// +// When a MultiReadSeeker is used, no Read and Seek operations should be made on +// its ReadSeeker components. Also, users should make no assumption on the state +// of individual readseekers while the MultiReadSeeker is used. +func MultiReadSeeker(readers ...io.ReadSeeker) io.ReadSeeker { + if len(readers) == 1 { + return readers[0] + } + idx := make(map[io.ReadSeeker]int) + for i, rdr := range readers { + idx[rdr] = i + } + return &multiReadSeeker{ + readers: readers, + posIdx: idx, + } +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/readers.go b/vendor/github.com/containers/storage/pkg/ioutils/readers.go new file mode 100644 index 00000000..63f3c07f --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/readers.go @@ -0,0 +1,154 @@ +package ioutils + +import ( + "crypto/sha256" + "encoding/hex" + "io" + + "golang.org/x/net/context" +) + +type readCloserWrapper struct { + io.Reader + closer func() error +} + +func (r *readCloserWrapper) Close() error { + return r.closer() +} + +// NewReadCloserWrapper returns a new io.ReadCloser. +func NewReadCloserWrapper(r io.Reader, closer func() error) io.ReadCloser { + return &readCloserWrapper{ + Reader: r, + closer: closer, + } +} + +type readerErrWrapper struct { + reader io.Reader + closer func() +} + +func (r *readerErrWrapper) Read(p []byte) (int, error) { + n, err := r.reader.Read(p) + if err != nil { + r.closer() + } + return n, err +} + +// NewReaderErrWrapper returns a new io.Reader. +func NewReaderErrWrapper(r io.Reader, closer func()) io.Reader { + return &readerErrWrapper{ + reader: r, + closer: closer, + } +} + +// HashData returns the sha256 sum of src. +func HashData(src io.Reader) (string, error) { + h := sha256.New() + if _, err := io.Copy(h, src); err != nil { + return "", err + } + return "sha256:" + hex.EncodeToString(h.Sum(nil)), nil +} + +// OnEOFReader wraps an io.ReadCloser and a function +// the function will run at the end of file or close the file. +type OnEOFReader struct { + Rc io.ReadCloser + Fn func() +} + +func (r *OnEOFReader) Read(p []byte) (n int, err error) { + n, err = r.Rc.Read(p) + if err == io.EOF { + r.runFunc() + } + return +} + +// Close closes the file and run the function. +func (r *OnEOFReader) Close() error { + err := r.Rc.Close() + r.runFunc() + return err +} + +func (r *OnEOFReader) runFunc() { + if fn := r.Fn; fn != nil { + fn() + r.Fn = nil + } +} + +// cancelReadCloser wraps an io.ReadCloser with a context for cancelling read +// operations. +type cancelReadCloser struct { + cancel func() + pR *io.PipeReader // Stream to read from + pW *io.PipeWriter +} + +// NewCancelReadCloser creates a wrapper that closes the ReadCloser when the +// context is cancelled. The returned io.ReadCloser must be closed when it is +// no longer needed. +func NewCancelReadCloser(ctx context.Context, in io.ReadCloser) io.ReadCloser { + pR, pW := io.Pipe() + + // Create a context used to signal when the pipe is closed + doneCtx, cancel := context.WithCancel(context.Background()) + + p := &cancelReadCloser{ + cancel: cancel, + pR: pR, + pW: pW, + } + + go func() { + _, err := io.Copy(pW, in) + select { + case <-ctx.Done(): + // If the context was closed, p.closeWithError + // was already called. Calling it again would + // change the error that Read returns. + default: + p.closeWithError(err) + } + in.Close() + }() + go func() { + for { + select { + case <-ctx.Done(): + p.closeWithError(ctx.Err()) + case <-doneCtx.Done(): + return + } + } + }() + + return p +} + +// Read wraps the Read method of the pipe that provides data from the wrapped +// ReadCloser. +func (p *cancelReadCloser) Read(buf []byte) (n int, err error) { + return p.pR.Read(buf) +} + +// closeWithError closes the wrapper and its underlying reader. It will +// cause future calls to Read to return err. +func (p *cancelReadCloser) closeWithError(err error) { + p.pW.CloseWithError(err) + p.cancel() +} + +// Close closes the wrapper its underlying reader. It will cause +// future calls to Read to return io.EOF. +func (p *cancelReadCloser) Close() error { + p.closeWithError(io.EOF) + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/temp_unix.go b/vendor/github.com/containers/storage/pkg/ioutils/temp_unix.go new file mode 100644 index 00000000..1539ad21 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/temp_unix.go @@ -0,0 +1,10 @@ +// +build !windows + +package ioutils + +import "io/ioutil" + +// TempDir on Unix systems is equivalent to ioutil.TempDir. +func TempDir(dir, prefix string) (string, error) { + return ioutil.TempDir(dir, prefix) +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/temp_windows.go b/vendor/github.com/containers/storage/pkg/ioutils/temp_windows.go new file mode 100644 index 00000000..c719c120 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/temp_windows.go @@ -0,0 +1,18 @@ +// +build windows + +package ioutils + +import ( + "io/ioutil" + + "github.com/containers/storage/pkg/longpath" +) + +// TempDir is the equivalent of ioutil.TempDir, except that the result is in Windows longpath format. +func TempDir(dir, prefix string) (string, error) { + tempDir, err := ioutil.TempDir(dir, prefix) + if err != nil { + return "", err + } + return longpath.AddPrefix(tempDir), nil +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/writeflusher.go b/vendor/github.com/containers/storage/pkg/ioutils/writeflusher.go new file mode 100644 index 00000000..52a4901a --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/writeflusher.go @@ -0,0 +1,92 @@ +package ioutils + +import ( + "io" + "sync" +) + +// WriteFlusher wraps the Write and Flush operation ensuring that every write +// is a flush. In addition, the Close method can be called to intercept +// Read/Write calls if the targets lifecycle has already ended. +type WriteFlusher struct { + w io.Writer + flusher flusher + flushed chan struct{} + flushedOnce sync.Once + closed chan struct{} + closeLock sync.Mutex +} + +type flusher interface { + Flush() +} + +var errWriteFlusherClosed = io.EOF + +func (wf *WriteFlusher) Write(b []byte) (n int, err error) { + select { + case <-wf.closed: + return 0, errWriteFlusherClosed + default: + } + + n, err = wf.w.Write(b) + wf.Flush() // every write is a flush. + return n, err +} + +// Flush the stream immediately. +func (wf *WriteFlusher) Flush() { + select { + case <-wf.closed: + return + default: + } + + wf.flushedOnce.Do(func() { + close(wf.flushed) + }) + wf.flusher.Flush() +} + +// Flushed returns the state of flushed. +// If it's flushed, return true, or else it return false. +func (wf *WriteFlusher) Flushed() bool { + // BUG(stevvooe): Remove this method. Its use is inherently racy. Seems to + // be used to detect whether or a response code has been issued or not. + // Another hook should be used instead. + var flushed bool + select { + case <-wf.flushed: + flushed = true + default: + } + return flushed +} + +// Close closes the write flusher, disallowing any further writes to the +// target. After the flusher is closed, all calls to write or flush will +// result in an error. +func (wf *WriteFlusher) Close() error { + wf.closeLock.Lock() + defer wf.closeLock.Unlock() + + select { + case <-wf.closed: + return errWriteFlusherClosed + default: + close(wf.closed) + } + return nil +} + +// NewWriteFlusher returns a new WriteFlusher. +func NewWriteFlusher(w io.Writer) *WriteFlusher { + var fl flusher + if f, ok := w.(flusher); ok { + fl = f + } else { + fl = &NopFlusher{} + } + return &WriteFlusher{w: w, flusher: fl, closed: make(chan struct{}), flushed: make(chan struct{})} +} diff --git a/vendor/github.com/containers/storage/pkg/ioutils/writers.go b/vendor/github.com/containers/storage/pkg/ioutils/writers.go new file mode 100644 index 00000000..ccc7f9c2 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/ioutils/writers.go @@ -0,0 +1,66 @@ +package ioutils + +import "io" + +// NopWriter represents a type which write operation is nop. +type NopWriter struct{} + +func (*NopWriter) Write(buf []byte) (int, error) { + return len(buf), nil +} + +type nopWriteCloser struct { + io.Writer +} + +func (w *nopWriteCloser) Close() error { return nil } + +// NopWriteCloser returns a nopWriteCloser. +func NopWriteCloser(w io.Writer) io.WriteCloser { + return &nopWriteCloser{w} +} + +// NopFlusher represents a type which flush operation is nop. +type NopFlusher struct{} + +// Flush is a nop operation. +func (f *NopFlusher) Flush() {} + +type writeCloserWrapper struct { + io.Writer + closer func() error +} + +func (r *writeCloserWrapper) Close() error { + return r.closer() +} + +// NewWriteCloserWrapper returns a new io.WriteCloser. +func NewWriteCloserWrapper(r io.Writer, closer func() error) io.WriteCloser { + return &writeCloserWrapper{ + Writer: r, + closer: closer, + } +} + +// WriteCounter wraps a concrete io.Writer and hold a count of the number +// of bytes written to the writer during a "session". +// This can be convenient when write return is masked +// (e.g., json.Encoder.Encode()) +type WriteCounter struct { + Count int64 + Writer io.Writer +} + +// NewWriteCounter returns a new WriteCounter. +func NewWriteCounter(w io.Writer) *WriteCounter { + return &WriteCounter{ + Writer: w, + } +} + +func (wc *WriteCounter) Write(p []byte) (count int, err error) { + count, err = wc.Writer.Write(p) + wc.Count += int64(count) + return +} diff --git a/vendor/github.com/containers/storage/pkg/longpath/longpath.go b/vendor/github.com/containers/storage/pkg/longpath/longpath.go new file mode 100644 index 00000000..9b15bfff --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/longpath/longpath.go @@ -0,0 +1,26 @@ +// longpath introduces some constants and helper functions for handling long paths +// in Windows, which are expected to be prepended with `\\?\` and followed by either +// a drive letter, a UNC server\share, or a volume identifier. + +package longpath + +import ( + "strings" +) + +// Prefix is the longpath prefix for Windows file paths. +const Prefix = `\\?\` + +// AddPrefix will add the Windows long path prefix to the path provided if +// it does not already have it. +func AddPrefix(path string) string { + if !strings.HasPrefix(path, Prefix) { + if strings.HasPrefix(path, `\\`) { + // This is a UNC path, so we need to add 'UNC' to the path as well. + path = Prefix + `UNC` + path[1:] + } else { + path = Prefix + path + } + } + return path +} diff --git a/vendor/github.com/containers/storage/pkg/loopback/attach_loopback.go b/vendor/github.com/containers/storage/pkg/loopback/attach_loopback.go new file mode 100644 index 00000000..971f45eb --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/loopback/attach_loopback.go @@ -0,0 +1,137 @@ +// +build linux + +package loopback + +import ( + "errors" + "fmt" + "os" + "syscall" + + "github.com/Sirupsen/logrus" +) + +// Loopback related errors +var ( + ErrAttachLoopbackDevice = errors.New("loopback attach failed") + ErrGetLoopbackBackingFile = errors.New("Unable to get loopback backing file") + ErrSetCapacity = errors.New("Unable set loopback capacity") +) + +func stringToLoopName(src string) [LoNameSize]uint8 { + var dst [LoNameSize]uint8 + copy(dst[:], src[:]) + return dst +} + +func getNextFreeLoopbackIndex() (int, error) { + f, err := os.OpenFile("/dev/loop-control", os.O_RDONLY, 0644) + if err != nil { + return 0, err + } + defer f.Close() + + index, err := ioctlLoopCtlGetFree(f.Fd()) + if index < 0 { + index = 0 + } + return index, err +} + +func openNextAvailableLoopback(index int, sparseFile *os.File) (loopFile *os.File, err error) { + // Start looking for a free /dev/loop + for { + target := fmt.Sprintf("/dev/loop%d", index) + index++ + + fi, err := os.Stat(target) + if err != nil { + if os.IsNotExist(err) { + logrus.Error("There are no more loopback devices available.") + } + return nil, ErrAttachLoopbackDevice + } + + if fi.Mode()&os.ModeDevice != os.ModeDevice { + logrus.Errorf("Loopback device %s is not a block device.", target) + continue + } + + // OpenFile adds O_CLOEXEC + loopFile, err = os.OpenFile(target, os.O_RDWR, 0644) + if err != nil { + logrus.Errorf("Error opening loopback device: %s", err) + return nil, ErrAttachLoopbackDevice + } + + // Try to attach to the loop file + if err := ioctlLoopSetFd(loopFile.Fd(), sparseFile.Fd()); err != nil { + loopFile.Close() + + // If the error is EBUSY, then try the next loopback + if err != syscall.EBUSY { + logrus.Errorf("Cannot set up loopback device %s: %s", target, err) + return nil, ErrAttachLoopbackDevice + } + + // Otherwise, we keep going with the loop + continue + } + // In case of success, we finished. Break the loop. + break + } + + // This can't happen, but let's be sure + if loopFile == nil { + logrus.Errorf("Unreachable code reached! Error attaching %s to a loopback device.", sparseFile.Name()) + return nil, ErrAttachLoopbackDevice + } + + return loopFile, nil +} + +// AttachLoopDevice attaches the given sparse file to the next +// available loopback device. It returns an opened *os.File. +func AttachLoopDevice(sparseName string) (loop *os.File, err error) { + + // Try to retrieve the next available loopback device via syscall. + // If it fails, we discard error and start looping for a + // loopback from index 0. + startIndex, err := getNextFreeLoopbackIndex() + if err != nil { + logrus.Debugf("Error retrieving the next available loopback: %s", err) + } + + // OpenFile adds O_CLOEXEC + sparseFile, err := os.OpenFile(sparseName, os.O_RDWR, 0644) + if err != nil { + logrus.Errorf("Error opening sparse file %s: %s", sparseName, err) + return nil, ErrAttachLoopbackDevice + } + defer sparseFile.Close() + + loopFile, err := openNextAvailableLoopback(startIndex, sparseFile) + if err != nil { + return nil, err + } + + // Set the status of the loopback device + loopInfo := &loopInfo64{ + loFileName: stringToLoopName(loopFile.Name()), + loOffset: 0, + loFlags: LoFlagsAutoClear, + } + + if err := ioctlLoopSetStatus64(loopFile.Fd(), loopInfo); err != nil { + logrus.Errorf("Cannot set up loopback device info: %s", err) + + // If the call failed, then free the loopback device + if err := ioctlLoopClrFd(loopFile.Fd()); err != nil { + logrus.Error("Error while cleaning up the loopback device") + } + loopFile.Close() + return nil, ErrAttachLoopbackDevice + } + + return loopFile, nil +} diff --git a/vendor/github.com/containers/storage/pkg/loopback/ioctl.go b/vendor/github.com/containers/storage/pkg/loopback/ioctl.go new file mode 100644 index 00000000..0714eb5f --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/loopback/ioctl.go @@ -0,0 +1,53 @@ +// +build linux + +package loopback + +import ( + "syscall" + "unsafe" +) + +func ioctlLoopCtlGetFree(fd uintptr) (int, error) { + index, _, err := syscall.Syscall(syscall.SYS_IOCTL, fd, LoopCtlGetFree, 0) + if err != 0 { + return 0, err + } + return int(index), nil +} + +func ioctlLoopSetFd(loopFd, sparseFd uintptr) error { + if _, _, err := syscall.Syscall(syscall.SYS_IOCTL, loopFd, LoopSetFd, sparseFd); err != 0 { + return err + } + return nil +} + +func ioctlLoopSetStatus64(loopFd uintptr, loopInfo *loopInfo64) error { + if _, _, err := syscall.Syscall(syscall.SYS_IOCTL, loopFd, LoopSetStatus64, uintptr(unsafe.Pointer(loopInfo))); err != 0 { + return err + } + return nil +} + +func ioctlLoopClrFd(loopFd uintptr) error { + if _, _, err := syscall.Syscall(syscall.SYS_IOCTL, loopFd, LoopClrFd, 0); err != 0 { + return err + } + return nil +} + +func ioctlLoopGetStatus64(loopFd uintptr) (*loopInfo64, error) { + loopInfo := &loopInfo64{} + + if _, _, err := syscall.Syscall(syscall.SYS_IOCTL, loopFd, LoopGetStatus64, uintptr(unsafe.Pointer(loopInfo))); err != 0 { + return nil, err + } + return loopInfo, nil +} + +func ioctlLoopSetCapacity(loopFd uintptr, value int) error { + if _, _, err := syscall.Syscall(syscall.SYS_IOCTL, loopFd, LoopSetCapacity, uintptr(value)); err != 0 { + return err + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/loopback/loop_wrapper.go b/vendor/github.com/containers/storage/pkg/loopback/loop_wrapper.go new file mode 100644 index 00000000..e1100ce1 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/loopback/loop_wrapper.go @@ -0,0 +1,52 @@ +// +build linux + +package loopback + +/* +#include // FIXME: present only for defines, maybe we can remove it? + +#ifndef LOOP_CTL_GET_FREE + #define LOOP_CTL_GET_FREE 0x4C82 +#endif + +#ifndef LO_FLAGS_PARTSCAN + #define LO_FLAGS_PARTSCAN 8 +#endif + +*/ +import "C" + +type loopInfo64 struct { + loDevice uint64 /* ioctl r/o */ + loInode uint64 /* ioctl r/o */ + loRdevice uint64 /* ioctl r/o */ + loOffset uint64 + loSizelimit uint64 /* bytes, 0 == max available */ + loNumber uint32 /* ioctl r/o */ + loEncryptType uint32 + loEncryptKeySize uint32 /* ioctl w/o */ + loFlags uint32 /* ioctl r/o */ + loFileName [LoNameSize]uint8 + loCryptName [LoNameSize]uint8 + loEncryptKey [LoKeySize]uint8 /* ioctl w/o */ + loInit [2]uint64 +} + +// IOCTL consts +const ( + LoopSetFd = C.LOOP_SET_FD + LoopCtlGetFree = C.LOOP_CTL_GET_FREE + LoopGetStatus64 = C.LOOP_GET_STATUS64 + LoopSetStatus64 = C.LOOP_SET_STATUS64 + LoopClrFd = C.LOOP_CLR_FD + LoopSetCapacity = C.LOOP_SET_CAPACITY +) + +// LOOP consts. +const ( + LoFlagsAutoClear = C.LO_FLAGS_AUTOCLEAR + LoFlagsReadOnly = C.LO_FLAGS_READ_ONLY + LoFlagsPartScan = C.LO_FLAGS_PARTSCAN + LoKeySize = C.LO_KEY_SIZE + LoNameSize = C.LO_NAME_SIZE +) diff --git a/vendor/github.com/containers/storage/pkg/loopback/loopback.go b/vendor/github.com/containers/storage/pkg/loopback/loopback.go new file mode 100644 index 00000000..bc047928 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/loopback/loopback.go @@ -0,0 +1,63 @@ +// +build linux + +package loopback + +import ( + "fmt" + "os" + "syscall" + + "github.com/Sirupsen/logrus" +) + +func getLoopbackBackingFile(file *os.File) (uint64, uint64, error) { + loopInfo, err := ioctlLoopGetStatus64(file.Fd()) + if err != nil { + logrus.Errorf("Error get loopback backing file: %s", err) + return 0, 0, ErrGetLoopbackBackingFile + } + return loopInfo.loDevice, loopInfo.loInode, nil +} + +// SetCapacity reloads the size for the loopback device. +func SetCapacity(file *os.File) error { + if err := ioctlLoopSetCapacity(file.Fd(), 0); err != nil { + logrus.Errorf("Error loopbackSetCapacity: %s", err) + return ErrSetCapacity + } + return nil +} + +// FindLoopDeviceFor returns a loopback device file for the specified file which +// is backing file of a loop back device. +func FindLoopDeviceFor(file *os.File) *os.File { + stat, err := file.Stat() + if err != nil { + return nil + } + targetInode := stat.Sys().(*syscall.Stat_t).Ino + targetDevice := stat.Sys().(*syscall.Stat_t).Dev + + for i := 0; true; i++ { + path := fmt.Sprintf("/dev/loop%d", i) + + file, err := os.OpenFile(path, os.O_RDWR, 0) + if err != nil { + if os.IsNotExist(err) { + return nil + } + + // Ignore all errors until the first not-exist + // we want to continue looking for the file + continue + } + + dev, inode, err := getLoopbackBackingFile(file) + if err == nil && dev == targetDevice && inode == targetInode { + return file + } + file.Close() + } + + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/mount/flags.go b/vendor/github.com/containers/storage/pkg/mount/flags.go new file mode 100644 index 00000000..607dbed4 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/flags.go @@ -0,0 +1,149 @@ +package mount + +import ( + "fmt" + "strings" +) + +var flags = map[string]struct { + clear bool + flag int +}{ + "defaults": {false, 0}, + "ro": {false, RDONLY}, + "rw": {true, RDONLY}, + "suid": {true, NOSUID}, + "nosuid": {false, NOSUID}, + "dev": {true, NODEV}, + "nodev": {false, NODEV}, + "exec": {true, NOEXEC}, + "noexec": {false, NOEXEC}, + "sync": {false, SYNCHRONOUS}, + "async": {true, SYNCHRONOUS}, + "dirsync": {false, DIRSYNC}, + "remount": {false, REMOUNT}, + "mand": {false, MANDLOCK}, + "nomand": {true, MANDLOCK}, + "atime": {true, NOATIME}, + "noatime": {false, NOATIME}, + "diratime": {true, NODIRATIME}, + "nodiratime": {false, NODIRATIME}, + "bind": {false, BIND}, + "rbind": {false, RBIND}, + "unbindable": {false, UNBINDABLE}, + "runbindable": {false, RUNBINDABLE}, + "private": {false, PRIVATE}, + "rprivate": {false, RPRIVATE}, + "shared": {false, SHARED}, + "rshared": {false, RSHARED}, + "slave": {false, SLAVE}, + "rslave": {false, RSLAVE}, + "relatime": {false, RELATIME}, + "norelatime": {true, RELATIME}, + "strictatime": {false, STRICTATIME}, + "nostrictatime": {true, STRICTATIME}, +} + +var validFlags = map[string]bool{ + "": true, + "size": true, + "mode": true, + "uid": true, + "gid": true, + "nr_inodes": true, + "nr_blocks": true, + "mpol": true, +} + +var propagationFlags = map[string]bool{ + "bind": true, + "rbind": true, + "unbindable": true, + "runbindable": true, + "private": true, + "rprivate": true, + "shared": true, + "rshared": true, + "slave": true, + "rslave": true, +} + +// MergeTmpfsOptions merge mount options to make sure there is no duplicate. +func MergeTmpfsOptions(options []string) ([]string, error) { + // We use collisions maps to remove duplicates. + // For flag, the key is the flag value (the key for propagation flag is -1) + // For data=value, the key is the data + flagCollisions := map[int]bool{} + dataCollisions := map[string]bool{} + + var newOptions []string + // We process in reverse order + for i := len(options) - 1; i >= 0; i-- { + option := options[i] + if option == "defaults" { + continue + } + if f, ok := flags[option]; ok && f.flag != 0 { + // There is only one propagation mode + key := f.flag + if propagationFlags[option] { + key = -1 + } + // Check to see if there is collision for flag + if !flagCollisions[key] { + // We prepend the option and add to collision map + newOptions = append([]string{option}, newOptions...) + flagCollisions[key] = true + } + continue + } + opt := strings.SplitN(option, "=", 2) + if len(opt) != 2 || !validFlags[opt[0]] { + return nil, fmt.Errorf("Invalid tmpfs option %q", opt) + } + if !dataCollisions[opt[0]] { + // We prepend the option and add to collision map + newOptions = append([]string{option}, newOptions...) + dataCollisions[opt[0]] = true + } + } + + return newOptions, nil +} + +// Parse fstab type mount options into mount() flags +// and device specific data +func parseOptions(options string) (int, string) { + var ( + flag int + data []string + ) + + for _, o := range strings.Split(options, ",") { + // If the option does not exist in the flags table or the flag + // is not supported on the platform, + // then it is a data value for a specific fs type + if f, exists := flags[o]; exists && f.flag != 0 { + if f.clear { + flag &= ^f.flag + } else { + flag |= f.flag + } + } else { + data = append(data, o) + } + } + return flag, strings.Join(data, ",") +} + +// ParseTmpfsOptions parse fstab type mount options into flags and data +func ParseTmpfsOptions(options string) (int, string, error) { + flags, data := parseOptions(options) + for _, o := range strings.Split(data, ",") { + opt := strings.SplitN(o, "=", 2) + if !validFlags[opt[0]] { + return 0, "", fmt.Errorf("Invalid tmpfs option %q", opt) + } + } + return flags, data, nil +} diff --git a/vendor/github.com/containers/storage/pkg/mount/flags_freebsd.go b/vendor/github.com/containers/storage/pkg/mount/flags_freebsd.go new file mode 100644 index 00000000..f166cb2f --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/flags_freebsd.go @@ -0,0 +1,48 @@ +// +build freebsd,cgo + +package mount + +/* +#include +*/ +import "C" + +const ( + // RDONLY will mount the filesystem as read-only. + RDONLY = C.MNT_RDONLY + + // NOSUID will not allow set-user-identifier or set-group-identifier bits to + // take effect. + NOSUID = C.MNT_NOSUID + + // NOEXEC will not allow execution of any binaries on the mounted file system. + NOEXEC = C.MNT_NOEXEC + + // SYNCHRONOUS will allow any I/O to the file system to be done synchronously. + SYNCHRONOUS = C.MNT_SYNCHRONOUS + + // NOATIME will not update the file access time when reading from a file. + NOATIME = C.MNT_NOATIME +) + +// These flags are unsupported. +const ( + BIND = 0 + DIRSYNC = 0 + MANDLOCK = 0 + NODEV = 0 + NODIRATIME = 0 + UNBINDABLE = 0 + RUNBINDABLE = 0 + PRIVATE = 0 + RPRIVATE = 0 + SHARED = 0 + RSHARED = 0 + SLAVE = 0 + RSLAVE = 0 + RBIND = 0 + RELATIVE = 0 + RELATIME = 0 + REMOUNT = 0 + STRICTATIME = 0 +) diff --git a/vendor/github.com/containers/storage/pkg/mount/flags_linux.go b/vendor/github.com/containers/storage/pkg/mount/flags_linux.go new file mode 100644 index 00000000..dc696dce --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/flags_linux.go @@ -0,0 +1,85 @@ +package mount + +import ( + "syscall" +) + +const ( + // RDONLY will mount the file system read-only. + RDONLY = syscall.MS_RDONLY + + // NOSUID will not allow set-user-identifier or set-group-identifier bits to + // take effect. + NOSUID = syscall.MS_NOSUID + + // NODEV will not interpret character or block special devices on the file + // system. + NODEV = syscall.MS_NODEV + + // NOEXEC will not allow execution of any binaries on the mounted file system. + NOEXEC = syscall.MS_NOEXEC + + // SYNCHRONOUS will allow I/O to the file system to be done synchronously. + SYNCHRONOUS = syscall.MS_SYNCHRONOUS + + // DIRSYNC will force all directory updates within the file system to be done + // synchronously. This affects the following system calls: create, link, + // unlink, symlink, mkdir, rmdir, mknod and rename. + DIRSYNC = syscall.MS_DIRSYNC + + // REMOUNT will attempt to remount an already-mounted file system. This is + // commonly used to change the mount flags for a file system, especially to + // make a readonly file system writeable. It does not change device or mount + // point. + REMOUNT = syscall.MS_REMOUNT + + // MANDLOCK will force mandatory locks on a filesystem. + MANDLOCK = syscall.MS_MANDLOCK + + // NOATIME will not update the file access time when reading from a file. + NOATIME = syscall.MS_NOATIME + + // NODIRATIME will not update the directory access time. + NODIRATIME = syscall.MS_NODIRATIME + + // BIND remounts a subtree somewhere else. + BIND = syscall.MS_BIND + + // RBIND remounts a subtree and all possible submounts somewhere else. + RBIND = syscall.MS_BIND | syscall.MS_REC + + // UNBINDABLE creates a mount which cannot be cloned through a bind operation. + UNBINDABLE = syscall.MS_UNBINDABLE + + // RUNBINDABLE marks the entire mount tree as UNBINDABLE. + RUNBINDABLE = syscall.MS_UNBINDABLE | syscall.MS_REC + + // PRIVATE creates a mount which carries no propagation abilities. + PRIVATE = syscall.MS_PRIVATE + + // RPRIVATE marks the entire mount tree as PRIVATE. + RPRIVATE = syscall.MS_PRIVATE | syscall.MS_REC + + // SLAVE creates a mount which receives propagation from its master, but not + // vice versa. + SLAVE = syscall.MS_SLAVE + + // RSLAVE marks the entire mount tree as SLAVE. + RSLAVE = syscall.MS_SLAVE | syscall.MS_REC + + // SHARED creates a mount which provides the ability to create mirrors of + // that mount such that mounts and unmounts within any of the mirrors + // propagate to the other mirrors. + SHARED = syscall.MS_SHARED + + // RSHARED marks the entire mount tree as SHARED. + RSHARED = syscall.MS_SHARED | syscall.MS_REC + + // RELATIME updates inode access times relative to modify or change time. + RELATIME = syscall.MS_RELATIME + + // STRICTATIME allows to explicitly request full atime updates. This makes + // it possible for the kernel to default to relatime or noatime but still + // allow userspace to override it. + STRICTATIME = syscall.MS_STRICTATIME +) diff --git a/vendor/github.com/containers/storage/pkg/mount/flags_unsupported.go b/vendor/github.com/containers/storage/pkg/mount/flags_unsupported.go new file mode 100644 index 00000000..5564f7b3 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/flags_unsupported.go @@ -0,0 +1,30 @@ +// +build !linux,!freebsd freebsd,!cgo solaris,!cgo + +package mount + +// These flags are unsupported. +const ( + BIND = 0 + DIRSYNC = 0 + MANDLOCK = 0 + NOATIME = 0 + NODEV = 0 + NODIRATIME = 0 + NOEXEC = 0 + NOSUID = 0 + UNBINDABLE = 0 + RUNBINDABLE = 0 + PRIVATE = 0 + RPRIVATE = 0 + SHARED = 0 + RSHARED = 0 + SLAVE = 0 + RSLAVE = 0 + RBIND = 0 + RELATIME = 0 + RELATIVE = 0 + REMOUNT = 0 + STRICTATIME = 0 + SYNCHRONOUS = 0 + RDONLY = 0 +) diff --git a/vendor/github.com/containers/storage/pkg/mount/mount.go b/vendor/github.com/containers/storage/pkg/mount/mount.go new file mode 100644 index 00000000..66ac4bf4 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mount.go @@ -0,0 +1,74 @@ +package mount + +import ( + "time" +) + +// GetMounts retrieves a list of mounts for the current running process. +func GetMounts() ([]*Info, error) { + return parseMountTable() +} + +// Mounted determines if a specified mountpoint has been mounted. +// On Linux it looks at /proc/self/mountinfo and on Solaris at mnttab. +func Mounted(mountpoint string) (bool, error) { + entries, err := parseMountTable() + if err != nil { + return false, err + } + + // Search the table for the mountpoint + for _, e := range entries { + if e.Mountpoint == mountpoint { + return true, nil + } + } + return false, nil +} + +// Mount will mount filesystem according to the specified configuration, on the +// condition that the target path is *not* already mounted. Options must be +// specified like the mount or fstab unix commands: "opt1=val1,opt2=val2". See +// flags.go for supported option flags. +func Mount(device, target, mType, options string) error { + flag, _ := parseOptions(options) + if flag&REMOUNT != REMOUNT { + if mounted, err := Mounted(target); err != nil || mounted { + return err + } + } + return ForceMount(device, target, mType, options) +} + +// ForceMount will mount a filesystem according to the specified configuration, +// *regardless* if the target path is not already mounted. Options must be +// specified like the mount or fstab unix commands: "opt1=val1,opt2=val2". See +// flags.go for supported option flags. +func ForceMount(device, target, mType, options string) error { + flag, data := parseOptions(options) + if err := mount(device, target, mType, uintptr(flag), data); err != nil { + return err + } + return nil +} + +// Unmount will unmount the target filesystem, so long as it is mounted. +func Unmount(target string) error { + if mounted, err := Mounted(target); err != nil || !mounted { + return err + } + return ForceUnmount(target) +} + +// ForceUnmount will force an unmount of the target filesystem, regardless if +// it is mounted or not. +func ForceUnmount(target string) (err error) { + // Simple retry logic for unmount + for i := 0; i < 10; i++ { + if err = unmount(target, 0); err == nil { + return nil + } + time.Sleep(100 * time.Millisecond) + } + return +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mounter_freebsd.go b/vendor/github.com/containers/storage/pkg/mount/mounter_freebsd.go new file mode 100644 index 00000000..bb870e6f --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mounter_freebsd.go @@ -0,0 +1,59 @@ +package mount + +/* +#include +#include +#include +#include +#include +#include +*/ +import "C" + +import ( + "fmt" + "strings" + "syscall" + "unsafe" +) + +func allocateIOVecs(options []string) []C.struct_iovec { + out := make([]C.struct_iovec, len(options)) + for i, option := range options { + out[i].iov_base = unsafe.Pointer(C.CString(option)) + out[i].iov_len = C.size_t(len(option) + 1) + } + return out +} + +func mount(device, target, mType string, flag uintptr, data string) error { + isNullFS := false + + xs := strings.Split(data, ",") + for _, x := range xs { + if x == "bind" { + isNullFS = true + } + } + + options := []string{"fspath", target} + if isNullFS { + options = append(options, "fstype", "nullfs", "target", device) + } else { + options = append(options, "fstype", mType, "from", device) + } + rawOptions := allocateIOVecs(options) + for _, rawOption := range rawOptions { + defer C.free(rawOption.iov_base) + } + + if errno := C.nmount(&rawOptions[0], C.uint(len(options)), C.int(flag)); errno != 0 { + reason := C.GoString(C.strerror(*C.__error())) + return fmt.Errorf("Failed to call nmount: %s", reason) + } + return nil +} + +func unmount(target string, flag int) error { + return syscall.Unmount(target, flag) +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mounter_linux.go b/vendor/github.com/containers/storage/pkg/mount/mounter_linux.go new file mode 100644 index 00000000..dd4280c7 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mounter_linux.go @@ -0,0 +1,21 @@ +package mount + +import ( + "syscall" +) + +func mount(device, target, mType string, flag uintptr, data string) error { + if err := syscall.Mount(device, target, mType, flag, data); err != nil { + return err + } + + // If we have a bind mount or remount, remount... + if flag&syscall.MS_BIND == syscall.MS_BIND && flag&syscall.MS_RDONLY == syscall.MS_RDONLY { + return syscall.Mount(device, target, mType, flag|syscall.MS_REMOUNT, data) + } + return nil +} + +func unmount(target string, flag int) error { + return syscall.Unmount(target, flag) +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mounter_solaris.go b/vendor/github.com/containers/storage/pkg/mount/mounter_solaris.go new file mode 100644 index 00000000..c684aa81 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mounter_solaris.go @@ -0,0 +1,33 @@ +// +build solaris,cgo + +package mount + +import ( + "golang.org/x/sys/unix" + "unsafe" +) + +// #include +// #include +// #include +// int Mount(const char *spec, const char *dir, int mflag, +// char *fstype, char *dataptr, int datalen, char *optptr, int optlen) { +// return mount(spec, dir, mflag, fstype, dataptr, datalen, optptr, optlen); +// } +import "C" + +func mount(device, target, mType string, flag uintptr, data string) error { + spec := C.CString(device) + dir := C.CString(target) + fstype := C.CString(mType) + _, err := C.Mount(spec, dir, C.int(flag), fstype, nil, 0, nil, 0) + C.free(unsafe.Pointer(spec)) + C.free(unsafe.Pointer(dir)) + C.free(unsafe.Pointer(fstype)) + return err +} + +func unmount(target string, flag int) error { + err := unix.Unmount(target, flag) + return err +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mounter_unsupported.go b/vendor/github.com/containers/storage/pkg/mount/mounter_unsupported.go new file mode 100644 index 00000000..a2a3bb45 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mounter_unsupported.go @@ -0,0 +1,11 @@ +// +build !linux,!freebsd,!solaris freebsd,!cgo solaris,!cgo + +package mount + +func mount(device, target, mType string, flag uintptr, data string) error { + panic("Not implemented") +} + +func unmount(target string, flag int) error { + panic("Not implemented") +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mountinfo.go b/vendor/github.com/containers/storage/pkg/mount/mountinfo.go new file mode 100644 index 00000000..e3fc3535 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mountinfo.go @@ -0,0 +1,40 @@ +package mount + +// Info reveals information about a particular mounted filesystem. This +// struct is populated from the content in the /proc//mountinfo file. +type Info struct { + // ID is a unique identifier of the mount (may be reused after umount). + ID int + + // Parent indicates the ID of the mount parent (or of self for the top of the + // mount tree). + Parent int + + // Major indicates one half of the device ID which identifies the device class. + Major int + + // Minor indicates one half of the device ID which identifies a specific + // instance of device. + Minor int + + // Root of the mount within the filesystem. + Root string + + // Mountpoint indicates the mount point relative to the process's root. + Mountpoint string + + // Opts represents mount-specific options. + Opts string + + // Optional represents optional fields. + Optional string + + // Fstype indicates the type of filesystem, such as EXT3. + Fstype string + + // Source indicates filesystem specific information or "none". + Source string + + // VfsOpts represents per super block options. + VfsOpts string +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mountinfo_freebsd.go b/vendor/github.com/containers/storage/pkg/mount/mountinfo_freebsd.go new file mode 100644 index 00000000..4f32edcd --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mountinfo_freebsd.go @@ -0,0 +1,41 @@ +package mount + +/* +#include +#include +#include +*/ +import "C" + +import ( + "fmt" + "reflect" + "unsafe" +) + +// Parse /proc/self/mountinfo because comparing Dev and ino does not work from +// bind mounts. +func parseMountTable() ([]*Info, error) { + var rawEntries *C.struct_statfs + + count := int(C.getmntinfo(&rawEntries, C.MNT_WAIT)) + if count == 0 { + return nil, fmt.Errorf("Failed to call getmntinfo") + } + + var entries []C.struct_statfs + header := (*reflect.SliceHeader)(unsafe.Pointer(&entries)) + header.Cap = count + header.Len = count + header.Data = uintptr(unsafe.Pointer(rawEntries)) + + var out []*Info + for _, entry := range entries { + var mountinfo Info + mountinfo.Mountpoint = C.GoString(&entry.f_mntonname[0]) + mountinfo.Source = C.GoString(&entry.f_mntfromname[0]) + mountinfo.Fstype = C.GoString(&entry.f_fstypename[0]) + out = append(out, &mountinfo) + } + return out, nil +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mountinfo_linux.go b/vendor/github.com/containers/storage/pkg/mount/mountinfo_linux.go new file mode 100644 index 00000000..be69fee1 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mountinfo_linux.go @@ -0,0 +1,95 @@ +// +build linux + +package mount + +import ( + "bufio" + "fmt" + "io" + "os" + "strings" +) + +const ( + /* 36 35 98:0 /mnt1 /mnt2 rw,noatime master:1 - ext3 /dev/root rw,errors=continue + (1)(2)(3) (4) (5) (6) (7) (8) (9) (10) (11) + + (1) mount ID: unique identifier of the mount (may be reused after umount) + (2) parent ID: ID of parent (or of self for the top of the mount tree) + (3) major:minor: value of st_dev for files on filesystem + (4) root: root of the mount within the filesystem + (5) mount point: mount point relative to the process's root + (6) mount options: per mount options + (7) optional fields: zero or more fields of the form "tag[:value]" + (8) separator: marks the end of the optional fields + (9) filesystem type: name of filesystem of the form "type[.subtype]" + (10) mount source: filesystem specific information or "none" + (11) super options: per super block options*/ + mountinfoFormat = "%d %d %d:%d %s %s %s %s" +) + +// Parse /proc/self/mountinfo because comparing Dev and ino does not work from +// bind mounts +func parseMountTable() ([]*Info, error) { + f, err := os.Open("/proc/self/mountinfo") + if err != nil { + return nil, err + } + defer f.Close() + + return parseInfoFile(f) +} + +func parseInfoFile(r io.Reader) ([]*Info, error) { + var ( + s = bufio.NewScanner(r) + out = []*Info{} + ) + + for s.Scan() { + if err := s.Err(); err != nil { + return nil, err + } + + var ( + p = &Info{} + text = s.Text() + optionalFields string + ) + + if _, err := fmt.Sscanf(text, mountinfoFormat, + &p.ID, &p.Parent, &p.Major, &p.Minor, + &p.Root, &p.Mountpoint, &p.Opts, &optionalFields); err != nil { + return nil, fmt.Errorf("Scanning '%s' failed: %s", text, err) + } + // Safe as mountinfo encodes mountpoints with spaces as \040. + index := strings.Index(text, " - ") + postSeparatorFields := strings.Fields(text[index+3:]) + if len(postSeparatorFields) < 3 { + return nil, fmt.Errorf("Error found less than 3 fields post '-' in %q", text) + } + + if optionalFields != "-" { + p.Optional = optionalFields + } + + p.Fstype = postSeparatorFields[0] + p.Source = postSeparatorFields[1] + p.VfsOpts = strings.Join(postSeparatorFields[2:], " ") + out = append(out, p) + } + return out, nil +} + +// PidMountInfo collects the mounts for a specific process ID. If the process +// ID is unknown, it is better to use `GetMounts` which will inspect +// "/proc/self/mountinfo" instead. +func PidMountInfo(pid int) ([]*Info, error) { + f, err := os.Open(fmt.Sprintf("/proc/%d/mountinfo", pid)) + if err != nil { + return nil, err + } + defer f.Close() + + return parseInfoFile(f) +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mountinfo_solaris.go b/vendor/github.com/containers/storage/pkg/mount/mountinfo_solaris.go new file mode 100644 index 00000000..ad9ab57f --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mountinfo_solaris.go @@ -0,0 +1,37 @@ +// +build solaris,cgo + +package mount + +/* +#include +#include +*/ +import "C" + +import ( + "fmt" +) + +func parseMountTable() ([]*Info, error) { + mnttab := C.fopen(C.CString(C.MNTTAB), C.CString("r")) + if mnttab == nil { + return nil, fmt.Errorf("Failed to open %s", C.MNTTAB) + } + + var out []*Info + var mp C.struct_mnttab + + ret := C.getmntent(mnttab, &mp) + for ret == 0 { + var mountinfo Info + mountinfo.Mountpoint = C.GoString(mp.mnt_mountp) + mountinfo.Source = C.GoString(mp.mnt_special) + mountinfo.Fstype = C.GoString(mp.mnt_fstype) + mountinfo.Opts = C.GoString(mp.mnt_mntopts) + out = append(out, &mountinfo) + ret = C.getmntent(mnttab, &mp) + } + + C.fclose(mnttab) + return out, nil +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mountinfo_unsupported.go b/vendor/github.com/containers/storage/pkg/mount/mountinfo_unsupported.go new file mode 100644 index 00000000..7fbcf192 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mountinfo_unsupported.go @@ -0,0 +1,12 @@ +// +build !windows,!linux,!freebsd,!solaris freebsd,!cgo solaris,!cgo + +package mount + +import ( + "fmt" + "runtime" +) + +func parseMountTable() ([]*Info, error) { + return nil, fmt.Errorf("mount.parseMountTable is not implemented on %s/%s", runtime.GOOS, runtime.GOARCH) +} diff --git a/vendor/github.com/containers/storage/pkg/mount/mountinfo_windows.go b/vendor/github.com/containers/storage/pkg/mount/mountinfo_windows.go new file mode 100644 index 00000000..dab8a37e --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/mountinfo_windows.go @@ -0,0 +1,6 @@ +package mount + +func parseMountTable() ([]*Info, error) { + // Do NOT return an error! + return nil, nil +} diff --git a/vendor/github.com/containers/storage/pkg/mount/sharedsubtree_linux.go b/vendor/github.com/containers/storage/pkg/mount/sharedsubtree_linux.go new file mode 100644 index 00000000..8ceec84b --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/mount/sharedsubtree_linux.go @@ -0,0 +1,69 @@ +// +build linux + +package mount + +// MakeShared ensures a mounted filesystem has the SHARED mount option enabled. +// See the supported options in flags.go for further reference. +func MakeShared(mountPoint string) error { + return ensureMountedAs(mountPoint, "shared") +} + +// MakeRShared ensures a mounted filesystem has the RSHARED mount option enabled. +// See the supported options in flags.go for further reference. +func MakeRShared(mountPoint string) error { + return ensureMountedAs(mountPoint, "rshared") +} + +// MakePrivate ensures a mounted filesystem has the PRIVATE mount option enabled. +// See the supported options in flags.go for further reference. +func MakePrivate(mountPoint string) error { + return ensureMountedAs(mountPoint, "private") +} + +// MakeRPrivate ensures a mounted filesystem has the RPRIVATE mount option +// enabled. See the supported options in flags.go for further reference. +func MakeRPrivate(mountPoint string) error { + return ensureMountedAs(mountPoint, "rprivate") +} + +// MakeSlave ensures a mounted filesystem has the SLAVE mount option enabled. +// See the supported options in flags.go for further reference. +func MakeSlave(mountPoint string) error { + return ensureMountedAs(mountPoint, "slave") +} + +// MakeRSlave ensures a mounted filesystem has the RSLAVE mount option enabled. +// See the supported options in flags.go for further reference. +func MakeRSlave(mountPoint string) error { + return ensureMountedAs(mountPoint, "rslave") +} + +// MakeUnbindable ensures a mounted filesystem has the UNBINDABLE mount option +// enabled. See the supported options in flags.go for further reference. +func MakeUnbindable(mountPoint string) error { + return ensureMountedAs(mountPoint, "unbindable") +} + +// MakeRUnbindable ensures a mounted filesystem has the RUNBINDABLE mount +// option enabled. See the supported options in flags.go for further reference. +func MakeRUnbindable(mountPoint string) error { + return ensureMountedAs(mountPoint, "runbindable") +} + +func ensureMountedAs(mountPoint, options string) error { + mounted, err := Mounted(mountPoint) + if err != nil { + return err + } + + if !mounted { + if err := Mount(mountPoint, mountPoint, "none", "bind,rw"); err != nil { + return err + } + } + if _, err = Mounted(mountPoint); err != nil { + return err + } + + return ForceMount("", mountPoint, "none", options) +} diff --git a/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel.go b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel.go new file mode 100644 index 00000000..7738fc74 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel.go @@ -0,0 +1,74 @@ +// +build !windows + +// Package kernel provides helper function to get, parse and compare kernel +// versions for different platforms. +package kernel + +import ( + "errors" + "fmt" +) + +// VersionInfo holds information about the kernel. +type VersionInfo struct { + Kernel int // Version of the kernel (e.g. 4.1.2-generic -> 4) + Major int // Major part of the kernel version (e.g. 4.1.2-generic -> 1) + Minor int // Minor part of the kernel version (e.g. 4.1.2-generic -> 2) + Flavor string // Flavor of the kernel version (e.g. 4.1.2-generic -> generic) +} + +func (k *VersionInfo) String() string { + return fmt.Sprintf("%d.%d.%d%s", k.Kernel, k.Major, k.Minor, k.Flavor) +} + +// CompareKernelVersion compares two kernel.VersionInfo structs. +// Returns -1 if a < b, 0 if a == b, 1 it a > b +func CompareKernelVersion(a, b VersionInfo) int { + if a.Kernel < b.Kernel { + return -1 + } else if a.Kernel > b.Kernel { + return 1 + } + + if a.Major < b.Major { + return -1 + } else if a.Major > b.Major { + return 1 + } + + if a.Minor < b.Minor { + return -1 + } else if a.Minor > b.Minor { + return 1 + } + + return 0 +} + +// ParseRelease parses a string and creates a VersionInfo based on it. +func ParseRelease(release string) (*VersionInfo, error) { + var ( + kernel, major, minor, parsed int + flavor, partial string + ) + + // Ignore error from Sscanf to allow an empty flavor. Instead, just + // make sure we got all the version numbers. + parsed, _ = fmt.Sscanf(release, "%d.%d%s", &kernel, &major, &partial) + if parsed < 2 { + return nil, errors.New("Can't parse kernel version " + release) + } + + // sometimes we have 3.12.25-gentoo, but sometimes we just have 3.12-1-amd64 + parsed, _ = fmt.Sscanf(partial, ".%d%s", &minor, &flavor) + if parsed < 1 { + flavor = partial + } + + return &VersionInfo{ + Kernel: kernel, + Major: major, + Minor: minor, + Flavor: flavor, + }, nil +} diff --git a/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_darwin.go b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_darwin.go new file mode 100644 index 00000000..71f205b2 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_darwin.go @@ -0,0 +1,56 @@ +// +build darwin + +// Package kernel provides helper function to get, parse and compare kernel +// versions for different platforms. +package kernel + +import ( + "fmt" + "os/exec" + "strings" + + "github.com/mattn/go-shellwords" +) + +// GetKernelVersion gets the current kernel version. +func GetKernelVersion() (*VersionInfo, error) { + release, err := getRelease() + if err != nil { + return nil, err + } + + return ParseRelease(release) +} + +// getRelease uses `system_profiler SPSoftwareDataType` to get OSX kernel version +func getRelease() (string, error) { + cmd := exec.Command("system_profiler", "SPSoftwareDataType") + osName, err := cmd.Output() + if err != nil { + return "", err + } + + var release string + data := strings.Split(string(osName), "\n") + for _, line := range data { + if strings.Contains(line, "Kernel Version") { + // It has the format like ' Kernel Version: Darwin 14.5.0' + content := strings.SplitN(line, ":", 2) + if len(content) != 2 { + return "", fmt.Errorf("Kernel Version is invalid") + } + + prettyNames, err := shellwords.Parse(content[1]) + if err != nil { + return "", fmt.Errorf("Kernel Version is invalid: %s", err.Error()) + } + + if len(prettyNames) != 2 { + return "", fmt.Errorf("Kernel Version needs to be 'Darwin x.x.x' ") + } + release = prettyNames[1] + } + } + + return release, nil +} diff --git a/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_unix.go b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_unix.go new file mode 100644 index 00000000..54a89d28 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_unix.go @@ -0,0 +1,30 @@ +// +build linux freebsd solaris + +// Package kernel provides helper function to get, parse and compare kernel +// versions for different platforms. +package kernel + +import ( + "bytes" +) + +// GetKernelVersion gets the current kernel version. +func GetKernelVersion() (*VersionInfo, error) { + uts, err := uname() + if err != nil { + return nil, err + } + + release := make([]byte, len(uts.Release)) + + i := 0 + for _, c := range uts.Release { + release[i] = byte(c) + i++ + } + + // Remove the \x00 from the release for Atoi to parse correctly + release = release[:bytes.IndexByte(release, 0)] + + return ParseRelease(string(release)) +} diff --git a/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_windows.go b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_windows.go new file mode 100644 index 00000000..80fab8ff --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/parsers/kernel/kernel_windows.go @@ -0,0 +1,69 @@ +// +build windows + +package kernel + +import ( + "fmt" + "syscall" + "unsafe" +) + +// VersionInfo holds information about the kernel. +type VersionInfo struct { + kvi string // Version of the kernel (e.g. 6.1.7601.17592 -> 6) + major int // Major part of the kernel version (e.g. 6.1.7601.17592 -> 1) + minor int // Minor part of the kernel version (e.g. 6.1.7601.17592 -> 7601) + build int // Build number of the kernel version (e.g. 6.1.7601.17592 -> 17592) +} + +func (k *VersionInfo) String() string { + return fmt.Sprintf("%d.%d %d (%s)", k.major, k.minor, k.build, k.kvi) +} + +// GetKernelVersion gets the current kernel version. +func GetKernelVersion() (*VersionInfo, error) { + + var ( + h syscall.Handle + dwVersion uint32 + err error + ) + + KVI := &VersionInfo{"Unknown", 0, 0, 0} + + if err = syscall.RegOpenKeyEx(syscall.HKEY_LOCAL_MACHINE, + syscall.StringToUTF16Ptr(`SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion\\`), + 0, + syscall.KEY_READ, + &h); err != nil { + return KVI, err + } + defer syscall.RegCloseKey(h) + + var buf [1 << 10]uint16 + var typ uint32 + n := uint32(len(buf) * 2) // api expects array of bytes, not uint16 + + if err = syscall.RegQueryValueEx(h, + syscall.StringToUTF16Ptr("BuildLabEx"), + nil, + &typ, + (*byte)(unsafe.Pointer(&buf[0])), + &n); err != nil { + return KVI, err + } + + KVI.kvi = syscall.UTF16ToString(buf[:]) + + // Important - docker.exe MUST be manifested for this API to return + // the correct information. + if dwVersion, err = syscall.GetVersion(); err != nil { + return KVI, err + } + + KVI.major = int(dwVersion & 0xFF) + KVI.minor = int((dwVersion & 0XFF00) >> 8) + KVI.build = int((dwVersion & 0xFFFF0000) >> 16) + + return KVI, nil +} diff --git a/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_linux.go b/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_linux.go new file mode 100644 index 00000000..bb9b3264 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_linux.go @@ -0,0 +1,19 @@ +package kernel + +import ( + "syscall" +) + +// Utsname represents the system name structure. +// It is passthrough for syscall.Utsname in order to make it portable with +// other platforms where it is not available. +type Utsname syscall.Utsname + +func uname() (*syscall.Utsname, error) { + uts := &syscall.Utsname{} + + if err := syscall.Uname(uts); err != nil { + return nil, err + } + return uts, nil +} diff --git a/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_solaris.go b/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_solaris.go new file mode 100644 index 00000000..49370bd3 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_solaris.go @@ -0,0 +1,14 @@ +package kernel + +import ( + "golang.org/x/sys/unix" +) + +func uname() (*unix.Utsname, error) { + uts := &unix.Utsname{} + + if err := unix.Uname(uts); err != nil { + return nil, err + } + return uts, nil +} diff --git a/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_unsupported.go b/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_unsupported.go new file mode 100644 index 00000000..1da3f239 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/parsers/kernel/uname_unsupported.go @@ -0,0 +1,18 @@ +// +build !linux,!solaris + +package kernel + +import ( + "errors" +) + +// Utsname represents the system name structure. +// It is defined here to make it portable as it is available on linux but not +// on windows. +type Utsname struct { + Release [65]byte +} + +func uname() (*Utsname, error) { + return nil, errors.New("Kernel version detection is available only on linux") +} diff --git a/vendor/github.com/containers/storage/pkg/parsers/parsers.go b/vendor/github.com/containers/storage/pkg/parsers/parsers.go new file mode 100644 index 00000000..acc89716 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/parsers/parsers.go @@ -0,0 +1,69 @@ +// Package parsers provides helper functions to parse and validate different type +// of string. It can be hosts, unix addresses, tcp addresses, filters, kernel +// operating system versions. +package parsers + +import ( + "fmt" + "strconv" + "strings" +) + +// ParseKeyValueOpt parses and validates the specified string as a key/value pair (key=value) +func ParseKeyValueOpt(opt string) (string, string, error) { + parts := strings.SplitN(opt, "=", 2) + if len(parts) != 2 { + return "", "", fmt.Errorf("Unable to parse key/value option: %s", opt) + } + return strings.TrimSpace(parts[0]), strings.TrimSpace(parts[1]), nil +} + +// ParseUintList parses and validates the specified string as the value +// found in some cgroup file (e.g. `cpuset.cpus`, `cpuset.mems`), which could be +// one of the formats below. Note that duplicates are actually allowed in the +// input string. It returns a `map[int]bool` with available elements from `val` +// set to `true`. +// Supported formats: +// 7 +// 1-6 +// 0,3-4,7,8-10 +// 0-0,0,1-7 +// 03,1-3 <- this is gonna get parsed as [1,2,3] +// 3,2,1 +// 0-2,3,1 +func ParseUintList(val string) (map[int]bool, error) { + if val == "" { + return map[int]bool{}, nil + } + + availableInts := make(map[int]bool) + split := strings.Split(val, ",") + errInvalidFormat := fmt.Errorf("invalid format: %s", val) + + for _, r := range split { + if !strings.Contains(r, "-") { + v, err := strconv.Atoi(r) + if err != nil { + return nil, errInvalidFormat + } + availableInts[v] = true + } else { + split := strings.SplitN(r, "-", 2) + min, err := strconv.Atoi(split[0]) + if err != nil { + return nil, errInvalidFormat + } + max, err := strconv.Atoi(split[1]) + if err != nil { + return nil, errInvalidFormat + } + if max < min { + return nil, errInvalidFormat + } + for i := min; i <= max; i++ { + availableInts[i] = true + } + } + } + return availableInts, nil +} diff --git a/vendor/github.com/containers/storage/pkg/plugins/client.go b/vendor/github.com/containers/storage/pkg/plugins/client.go new file mode 100644 index 00000000..a8865a07 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/plugins/client.go @@ -0,0 +1,188 @@ +package plugins + +import ( + "bytes" + "encoding/json" + "io" + "io/ioutil" + "net/http" + "net/url" + "time" + + "github.com/Sirupsen/logrus" + "github.com/containers/storage/pkg/plugins/transport" + "github.com/docker/go-connections/sockets" + "github.com/docker/go-connections/tlsconfig" +) + +const ( + defaultTimeOut = 30 +) + +// NewClient creates a new plugin client (http). +func NewClient(addr string, tlsConfig *tlsconfig.Options) (*Client, error) { + tr := &http.Transport{} + + if tlsConfig != nil { + c, err := tlsconfig.Client(*tlsConfig) + if err != nil { + return nil, err + } + tr.TLSClientConfig = c + } + + u, err := url.Parse(addr) + if err != nil { + return nil, err + } + socket := u.Host + if socket == "" { + // valid local socket addresses have the host empty. + socket = u.Path + } + if err := sockets.ConfigureTransport(tr, u.Scheme, socket); err != nil { + return nil, err + } + scheme := httpScheme(u) + + clientTransport := transport.NewHTTPTransport(tr, scheme, socket) + return NewClientWithTransport(clientTransport), nil +} + +// NewClientWithTransport creates a new plugin client with a given transport. +func NewClientWithTransport(tr transport.Transport) *Client { + return &Client{ + http: &http.Client{ + Transport: tr, + }, + requestFactory: tr, + } +} + +// Client represents a plugin client. +type Client struct { + http *http.Client // http client to use + requestFactory transport.RequestFactory +} + +// Call calls the specified method with the specified arguments for the plugin. +// It will retry for 30 seconds if a failure occurs when calling. +func (c *Client) Call(serviceMethod string, args interface{}, ret interface{}) error { + var buf bytes.Buffer + if args != nil { + if err := json.NewEncoder(&buf).Encode(args); err != nil { + return err + } + } + body, err := c.callWithRetry(serviceMethod, &buf, true) + if err != nil { + return err + } + defer body.Close() + if ret != nil { + if err := json.NewDecoder(body).Decode(&ret); err != nil { + logrus.Errorf("%s: error reading plugin resp: %v", serviceMethod, err) + return err + } + } + return nil +} + +// Stream calls the specified method with the specified arguments for the plugin and returns the response body +func (c *Client) Stream(serviceMethod string, args interface{}) (io.ReadCloser, error) { + var buf bytes.Buffer + if err := json.NewEncoder(&buf).Encode(args); err != nil { + return nil, err + } + return c.callWithRetry(serviceMethod, &buf, true) +} + +// SendFile calls the specified method, and passes through the IO stream +func (c *Client) SendFile(serviceMethod string, data io.Reader, ret interface{}) error { + body, err := c.callWithRetry(serviceMethod, data, true) + if err != nil { + return err + } + defer body.Close() + if err := json.NewDecoder(body).Decode(&ret); err != nil { + logrus.Errorf("%s: error reading plugin resp: %v", serviceMethod, err) + return err + } + return nil +} + +func (c *Client) callWithRetry(serviceMethod string, data io.Reader, retry bool) (io.ReadCloser, error) { + req, err := c.requestFactory.NewRequest(serviceMethod, data) + if err != nil { + return nil, err + } + + var retries int + start := time.Now() + + for { + resp, err := c.http.Do(req) + if err != nil { + if !retry { + return nil, err + } + + timeOff := backoff(retries) + if abort(start, timeOff) { + return nil, err + } + retries++ + logrus.Warnf("Unable to connect to plugin: %s%s: %v, retrying in %v", req.URL.Host, req.URL.Path, err, timeOff) + time.Sleep(timeOff) + continue + } + + if resp.StatusCode != http.StatusOK { + b, err := ioutil.ReadAll(resp.Body) + resp.Body.Close() + if err != nil { + return nil, &statusError{resp.StatusCode, serviceMethod, err.Error()} + } + + // Plugins' Response(s) should have an Err field indicating what went + // wrong. Try to unmarshal into ResponseErr. Otherwise fallback to just + // return the string(body) + type responseErr struct { + Err string + } + remoteErr := responseErr{} + if err := json.Unmarshal(b, &remoteErr); err == nil { + if remoteErr.Err != "" { + return nil, &statusError{resp.StatusCode, serviceMethod, remoteErr.Err} + } + } + // old way... + return nil, &statusError{resp.StatusCode, serviceMethod, string(b)} + } + return resp.Body, nil + } +} + +func backoff(retries int) time.Duration { + b, max := 1, defaultTimeOut + for b < max && retries > 0 { + b *= 2 + retries-- + } + if b > max { + b = max + } + return time.Duration(b) * time.Second +} + +func abort(start time.Time, timeOff time.Duration) bool { + return timeOff+time.Since(start) >= time.Duration(defaultTimeOut)*time.Second +} + +func httpScheme(u *url.URL) string { + scheme := u.Scheme + if scheme != "https" { + scheme = "http" + } + return scheme +} diff --git a/vendor/github.com/containers/storage/pkg/plugins/discovery.go b/vendor/github.com/containers/storage/pkg/plugins/discovery.go new file mode 100644 index 00000000..fdff71cf --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/plugins/discovery.go @@ -0,0 +1,132 @@ +package plugins + +import ( + "encoding/json" + "errors" + "fmt" + "io/ioutil" + "net/url" + "os" + "path/filepath" + "strings" + "sync" +) + +var ( + // ErrNotFound plugin not found + ErrNotFound = errors.New("plugin not found") + socketsPath = "/run/oci-storage/plugins" + specsPaths = []string{"/etc/oci-storage/plugins", "/usr/lib/oci-storage/plugins"} +) + +// localRegistry defines a registry that is local (using unix socket). +type localRegistry struct{} + +func newLocalRegistry() localRegistry { + return localRegistry{} +} + +// Scan scans all the plugin paths and returns all the names it found +func Scan() ([]string, error) { + var names []string + if err := filepath.Walk(socketsPath, func(path string, fi os.FileInfo, err error) error { + if err != nil { + return nil + } + + if fi.Mode()&os.ModeSocket != 0 { + name := strings.TrimSuffix(fi.Name(), filepath.Ext(fi.Name())) + names = append(names, name) + } + return nil + }); err != nil { + return nil, err + } + + for _, path := range specsPaths { + if err := filepath.Walk(path, func(p string, fi os.FileInfo, err error) error { + if err != nil || fi.IsDir() { + return nil + } + name := strings.TrimSuffix(fi.Name(), filepath.Ext(fi.Name())) + names = append(names, name) + return nil + }); err != nil { + return nil, err + } + } + return names, nil +} + +// Plugin returns the plugin registered with the given name (or returns an error). +func (l *localRegistry) Plugin(name string) (*Plugin, error) { + socketpaths := pluginPaths(socketsPath, name, ".sock") + + for _, p := range socketpaths { + if fi, err := os.Stat(p); err == nil && fi.Mode()&os.ModeSocket != 0 { + return NewLocalPlugin(name, "unix://"+p), nil + } + } + + var txtspecpaths []string + for _, p := range specsPaths { + txtspecpaths = append(txtspecpaths, pluginPaths(p, name, ".spec")...) + txtspecpaths = append(txtspecpaths, pluginPaths(p, name, ".json")...) + } + + for _, p := range txtspecpaths { + if _, err := os.Stat(p); err == nil { + if strings.HasSuffix(p, ".json") { + return readPluginJSONInfo(name, p) + } + return readPluginInfo(name, p) + } + } + return nil, ErrNotFound +} + +func readPluginInfo(name, path string) (*Plugin, error) { + content, err := ioutil.ReadFile(path) + if err != nil { + return nil, err + } + addr := strings.TrimSpace(string(content)) + + u, err := url.Parse(addr) + if err != nil { + return nil, err + } + + if len(u.Scheme) == 0 { + return nil, fmt.Errorf("Unknown protocol") + } + + return NewLocalPlugin(name, addr), nil +} + +func readPluginJSONInfo(name, path string) (*Plugin, error) { + f, err := os.Open(path) + if err != nil { + return nil, err + } + defer f.Close() + + var p Plugin + if err := json.NewDecoder(f).Decode(&p); err != nil { + return nil, err + } + p.name = name + if len(p.TLSConfig.CAFile) == 0 { + p.TLSConfig.InsecureSkipVerify = true + } + p.activateWait = sync.NewCond(&sync.Mutex{}) + + return &p, nil +} + +func pluginPaths(base, name, ext string) []string { + return []string{ + filepath.Join(base, name+ext), + filepath.Join(base, name, name+ext), + } +} diff --git a/vendor/github.com/containers/storage/pkg/plugins/errors.go b/vendor/github.com/containers/storage/pkg/plugins/errors.go new file mode 100644 index 00000000..79884710 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/plugins/errors.go @@ -0,0 +1,33 @@ +package plugins + +import ( + "fmt" + "net/http" +) + +type statusError struct { + status int + method string + err string +} + +// Error returns a formatted string for this error type +func (e *statusError) Error() string { + return fmt.Sprintf("%s: %v", e.method, e.err) +} + +// IsNotFound indicates if the passed in error is from an http.StatusNotFound from the plugin +func IsNotFound(err error) bool { + return isStatusError(err, http.StatusNotFound) +} + +func isStatusError(err error, status int) bool { + if err == nil { + return false + } + e, ok := err.(*statusError) + if !ok { + return false + } + return e.status == status +} diff --git a/vendor/github.com/containers/storage/pkg/plugins/plugins.go b/vendor/github.com/containers/storage/pkg/plugins/plugins.go new file mode 100644 index 00000000..9cf8aecf --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/plugins/plugins.go @@ -0,0 +1,270 @@ +// Package plugins provides structures and helper functions to manage Docker +// plugins. +// +// Storage discovers plugins by looking for them in the plugin directory whenever +// a user or container tries to use one by name. UNIX domain socket files must +// be located under /run/oci-storage/plugins, whereas spec files can be located +// either under /etc/oci-storage/plugins or /usr/lib/oci-storage/plugins. This +// is handled by the Registry interface, which lets you list all plugins or get +// a plugin by its name if it exists. +// +// The plugins need to implement an HTTP server and bind this to the UNIX socket +// or the address specified in the spec files. +// A handshake is send at /Plugin.Activate, and plugins are expected to return +// a Manifest with a list of subsystems which this plugin implements. As of +// this writing, the known subsystem is "GraphDriver". +// +// In order to use a plugins, you can use the ``Get`` with the name of the +// plugin and the subsystem it implements. +// +// plugin, err := plugins.Get("example", "VolumeDriver") +// if err != nil { +// return fmt.Errorf("Error looking up volume plugin example: %v", err) +// } +package plugins + +import ( + "errors" + "sync" + "time" + + "github.com/Sirupsen/logrus" + "github.com/docker/go-connections/tlsconfig" +) + +var ( + // ErrNotImplements is returned if the plugin does not implement the requested driver. + ErrNotImplements = errors.New("Plugin does not implement the requested driver") +) + +type plugins struct { + sync.Mutex + plugins map[string]*Plugin +} + +var ( + storage = plugins{plugins: make(map[string]*Plugin)} + extpointHandlers = make(map[string]func(string, *Client)) +) + +// Manifest lists what a plugin implements. +type Manifest struct { + // List of subsystem the plugin implements. + Implements []string +} + +// Plugin is the definition of a storage plugin. +type Plugin struct { + // Name of the plugin + name string + // Address of the plugin + Addr string + // TLS configuration of the plugin + TLSConfig *tlsconfig.Options + // Client attached to the plugin + client *Client + // Manifest of the plugin (see above) + Manifest *Manifest `json:"-"` + + // error produced by activation + activateErr error + // specifies if the activation sequence is completed (not if it is successful or not) + activated bool + // wait for activation to finish + activateWait *sync.Cond +} + +// Name returns the name of the plugin. +func (p *Plugin) Name() string { + return p.name +} + +// Client returns a ready-to-use plugin client that can be used to communicate with the plugin. +func (p *Plugin) Client() *Client { + return p.client +} + +// NewLocalPlugin creates a new local plugin. +func NewLocalPlugin(name, addr string) *Plugin { + return &Plugin{ + name: name, + Addr: addr, + // TODO: change to nil + TLSConfig: &tlsconfig.Options{InsecureSkipVerify: true}, + activateWait: sync.NewCond(&sync.Mutex{}), + } +} + +func (p *Plugin) activate() error { + p.activateWait.L.Lock() + if p.activated { + p.activateWait.L.Unlock() + return p.activateErr + } + + p.activateErr = p.activateWithLock() + p.activated = true + + p.activateWait.L.Unlock() + p.activateWait.Broadcast() + return p.activateErr +} + +func (p *Plugin) activateWithLock() error { + c, err := NewClient(p.Addr, p.TLSConfig) + if err != nil { + return err + } + p.client = c + + m := new(Manifest) + if err = p.client.Call("Plugin.Activate", nil, m); err != nil { + return err + } + + p.Manifest = m + + for _, iface := range m.Implements { + handler, handled := extpointHandlers[iface] + if !handled { + continue + } + handler(p.name, p.client) + } + return nil +} + +func (p *Plugin) waitActive() error { + p.activateWait.L.Lock() + for !p.activated { + p.activateWait.Wait() + } + p.activateWait.L.Unlock() + return p.activateErr +} + +func (p *Plugin) implements(kind string) bool { + if err := p.waitActive(); err != nil { + return false + } + for _, driver := range p.Manifest.Implements { + if driver == kind { + return true + } + } + return false +} + +func load(name string) (*Plugin, error) { + return loadWithRetry(name, true) +} + +func loadWithRetry(name string, retry bool) (*Plugin, error) { + registry := newLocalRegistry() + start := time.Now() + + var retries int + for { + pl, err := registry.Plugin(name) + if err != nil { + if !retry { + return nil, err + } + + timeOff := backoff(retries) + if abort(start, timeOff) { + return nil, err + } + retries++ + logrus.Warnf("Unable to locate plugin: %s, retrying in %v", name, timeOff) + time.Sleep(timeOff) + continue + } + + storage.Lock() + storage.plugins[name] = pl + storage.Unlock() + + err = pl.activate() + + if err != nil { + storage.Lock() + delete(storage.plugins, name) + storage.Unlock() + } + + return pl, err + } +} + +func get(name string) (*Plugin, error) { + storage.Lock() + pl, ok := storage.plugins[name] + storage.Unlock() + if ok { + return pl, pl.activate() + } + return load(name) +} + +// Get returns the plugin given the specified name and requested implementation. +func Get(name, imp string) (*Plugin, error) { + pl, err := get(name) + if err != nil { + return nil, err + } + if pl.implements(imp) { + logrus.Debugf("%s implements: %s", name, imp) + return pl, nil + } + return nil, ErrNotImplements +} + +// Handle adds the specified function to the extpointHandlers. +func Handle(iface string, fn func(string, *Client)) { + extpointHandlers[iface] = fn +} + +// GetAll returns all the plugins for the specified implementation +func GetAll(imp string) ([]*Plugin, error) { + pluginNames, err := Scan() + if err != nil { + return nil, err + } + + type plLoad struct { + pl *Plugin + err error + } + + chPl := make(chan *plLoad, len(pluginNames)) + var wg sync.WaitGroup + for _, name := range pluginNames { + if pl, ok := storage.plugins[name]; ok { + chPl <- &plLoad{pl, nil} + continue + } + + wg.Add(1) + go func(name string) { + defer wg.Done() + pl, err := loadWithRetry(name, false) + chPl <- &plLoad{pl, err} + }(name) + } + + wg.Wait() + close(chPl) + + var out []*Plugin + for pl := range chPl { + if pl.err != nil { + logrus.Error(pl.err) + continue + } + if pl.pl.implements(imp) { + out = append(out, pl.pl) + } + } + return out, nil +} diff --git a/vendor/github.com/containers/storage/pkg/plugins/transport/http.go b/vendor/github.com/containers/storage/pkg/plugins/transport/http.go new file mode 100644 index 00000000..5be146af --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/plugins/transport/http.go @@ -0,0 +1,36 @@ +package transport + +import ( + "io" + "net/http" +) + +// httpTransport holds an http.RoundTripper +// and information about the scheme and address the transport +// sends request to. +type httpTransport struct { + http.RoundTripper + scheme string + addr string +} + +// NewHTTPTransport creates a new httpTransport. +func NewHTTPTransport(r http.RoundTripper, scheme, addr string) Transport { + return httpTransport{ + RoundTripper: r, + scheme: scheme, + addr: addr, + } +} + +// NewRequest creates a new http.Request and sets the URL +// scheme and address with the transport's fields. +func (t httpTransport) NewRequest(path string, data io.Reader) (*http.Request, error) { + req, err := newHTTPRequest(path, data) + if err != nil { + return nil, err + } + req.URL.Scheme = t.scheme + req.URL.Host = t.addr + return req, nil +} diff --git a/vendor/github.com/containers/storage/pkg/plugins/transport/transport.go b/vendor/github.com/containers/storage/pkg/plugins/transport/transport.go new file mode 100644 index 00000000..d7f1e210 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/plugins/transport/transport.go @@ -0,0 +1,36 @@ +package transport + +import ( + "io" + "net/http" + "strings" +) + +// VersionMimetype is the Content-Type the engine sends to plugins. +const VersionMimetype = "application/vnd.docker.plugins.v1.2+json" + +// RequestFactory defines an interface that +// transports can implement to create new requests. +type RequestFactory interface { + NewRequest(path string, data io.Reader) (*http.Request, error) +} + +// Transport defines an interface that plugin transports +// must implement. +type Transport interface { + http.RoundTripper + RequestFactory +} + +// newHTTPRequest creates a new request with a path and a body. +func newHTTPRequest(path string, data io.Reader) (*http.Request, error) { + if !strings.HasPrefix(path, "/") { + path = "/" + path + } + req, err := http.NewRequest("POST", path, data) + if err != nil { + return nil, err + } + req.Header.Add("Accept", VersionMimetype) + return req, nil +} diff --git a/vendor/github.com/containers/storage/pkg/pools/pools.go b/vendor/github.com/containers/storage/pkg/pools/pools.go new file mode 100644 index 00000000..a15e3688 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/pools/pools.go @@ -0,0 +1,119 @@ +// Package pools provides a collection of pools which provide various +// data types with buffers. These can be used to lower the number of +// memory allocations and reuse buffers. +// +// New pools should be added to this package to allow them to be +// shared across packages. +// +// Utility functions which operate on pools should be added to this +// package to allow them to be reused. +package pools + +import ( + "bufio" + "io" + "sync" + + "github.com/containers/storage/pkg/ioutils" +) + +var ( + // BufioReader32KPool is a pool which returns bufio.Reader with a 32K buffer. + BufioReader32KPool *BufioReaderPool + // BufioWriter32KPool is a pool which returns bufio.Writer with a 32K buffer. + BufioWriter32KPool *BufioWriterPool +) + +const buffer32K = 32 * 1024 + +// BufioReaderPool is a bufio reader that uses sync.Pool. +type BufioReaderPool struct { + pool *sync.Pool +} + +func init() { + BufioReader32KPool = newBufioReaderPoolWithSize(buffer32K) + BufioWriter32KPool = newBufioWriterPoolWithSize(buffer32K) +} + +// newBufioReaderPoolWithSize is unexported because new pools should be +// added here to be shared where required. +func newBufioReaderPoolWithSize(size int) *BufioReaderPool { + pool := &sync.Pool{ + New: func() interface{} { return bufio.NewReaderSize(nil, size) }, + } + return &BufioReaderPool{pool: pool} +} + +// Get returns a bufio.Reader which reads from r. The buffer size is that of the pool. +func (bufPool *BufioReaderPool) Get(r io.Reader) *bufio.Reader { + buf := bufPool.pool.Get().(*bufio.Reader) + buf.Reset(r) + return buf +} + +// Put puts the bufio.Reader back into the pool. +func (bufPool *BufioReaderPool) Put(b *bufio.Reader) { + b.Reset(nil) + bufPool.pool.Put(b) +} + +// Copy is a convenience wrapper which uses a buffer to avoid allocation in io.Copy. +func Copy(dst io.Writer, src io.Reader) (written int64, err error) { + buf := BufioReader32KPool.Get(src) + written, err = io.Copy(dst, buf) + BufioReader32KPool.Put(buf) + return +} + +// NewReadCloserWrapper returns a wrapper which puts the bufio.Reader back +// into the pool and closes the reader if it's an io.ReadCloser. +func (bufPool *BufioReaderPool) NewReadCloserWrapper(buf *bufio.Reader, r io.Reader) io.ReadCloser { + return ioutils.NewReadCloserWrapper(r, func() error { + if readCloser, ok := r.(io.ReadCloser); ok { + readCloser.Close() + } + bufPool.Put(buf) + return nil + }) +} + +// BufioWriterPool is a bufio writer that uses sync.Pool. +type BufioWriterPool struct { + pool *sync.Pool +} + +// newBufioWriterPoolWithSize is unexported because new pools should be +// added here to be shared where required. +func newBufioWriterPoolWithSize(size int) *BufioWriterPool { + pool := &sync.Pool{ + New: func() interface{} { return bufio.NewWriterSize(nil, size) }, + } + return &BufioWriterPool{pool: pool} +} + +// Get returns a bufio.Writer which writes to w. The buffer size is that of the pool. +func (bufPool *BufioWriterPool) Get(w io.Writer) *bufio.Writer { + buf := bufPool.pool.Get().(*bufio.Writer) + buf.Reset(w) + return buf +} + +// Put puts the bufio.Writer back into the pool. +func (bufPool *BufioWriterPool) Put(b *bufio.Writer) { + b.Reset(nil) + bufPool.pool.Put(b) +} + +// NewWriteCloserWrapper returns a wrapper which puts the bufio.Writer back +// into the pool and closes the writer if it's an io.Writecloser. +func (bufPool *BufioWriterPool) NewWriteCloserWrapper(buf *bufio.Writer, w io.Writer) io.WriteCloser { + return ioutils.NewWriteCloserWrapper(w, func() error { + buf.Flush() + if writeCloser, ok := w.(io.WriteCloser); ok { + writeCloser.Close() + } + bufPool.Put(buf) + return nil + }) +} diff --git a/vendor/github.com/containers/storage/pkg/promise/promise.go b/vendor/github.com/containers/storage/pkg/promise/promise.go new file mode 100644 index 00000000..dd52b908 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/promise/promise.go @@ -0,0 +1,11 @@ +package promise + +// Go is a basic promise implementation: it wraps calls a function in a goroutine, +// and returns a channel which will later return the function's return value. +func Go(f func() error) chan error { + ch := make(chan error, 1) + go func() { + ch <- f() + }() + return ch +} diff --git a/vendor/github.com/containers/storage/pkg/random/random.go b/vendor/github.com/containers/storage/pkg/random/random.go new file mode 100644 index 00000000..70de4d13 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/random/random.go @@ -0,0 +1,71 @@ +package random + +import ( + cryptorand "crypto/rand" + "io" + "math" + "math/big" + "math/rand" + "sync" + "time" +) + +// Rand is a global *rand.Rand instance, which initialized with NewSource() source. +var Rand = rand.New(NewSource()) + +// Reader is a global, shared instance of a pseudorandom bytes generator. +// It doesn't consume entropy. +var Reader io.Reader = &reader{rnd: Rand} + +// copypaste from standard math/rand +type lockedSource struct { + lk sync.Mutex + src rand.Source +} + +func (r *lockedSource) Int63() (n int64) { + r.lk.Lock() + n = r.src.Int63() + r.lk.Unlock() + return +} + +func (r *lockedSource) Seed(seed int64) { + r.lk.Lock() + r.src.Seed(seed) + r.lk.Unlock() +} + +// NewSource returns math/rand.Source safe for concurrent use and initialized +// with current unix-nano timestamp +func NewSource() rand.Source { + var seed int64 + if cryptoseed, err := cryptorand.Int(cryptorand.Reader, big.NewInt(math.MaxInt64)); err != nil { + // This should not happen, but worst-case fallback to time-based seed. + seed = time.Now().UnixNano() + } else { + seed = cryptoseed.Int64() + } + return &lockedSource{ + src: rand.NewSource(seed), + } +} + +type reader struct { + rnd *rand.Rand +} + +func (r *reader) Read(b []byte) (int, error) { + i := 0 + for { + val := r.rnd.Int63() + for val > 0 { + b[i] = byte(val) + i++ + if i == len(b) { + return i, nil + } + val >>= 8 + } + } +} diff --git a/vendor/github.com/containers/storage/pkg/reexec/command_linux.go b/vendor/github.com/containers/storage/pkg/reexec/command_linux.go new file mode 100644 index 00000000..3c3a73a9 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/reexec/command_linux.go @@ -0,0 +1,28 @@ +// +build linux + +package reexec + +import ( + "os/exec" + "syscall" +) + +// Self returns the path to the current process's binary. +// Returns "/proc/self/exe". +func Self() string { + return "/proc/self/exe" +} + +// Command returns *exec.Cmd which have Path as current binary. Also it setting +// SysProcAttr.Pdeathsig to SIGTERM. +// This will use the in-memory version (/proc/self/exe) of the current binary, +// it is thus safe to delete or replace the on-disk binary (os.Args[0]). +func Command(args ...string) *exec.Cmd { + return &exec.Cmd{ + Path: Self(), + Args: args, + SysProcAttr: &syscall.SysProcAttr{ + Pdeathsig: syscall.SIGTERM, + }, + } +} diff --git a/vendor/github.com/containers/storage/pkg/reexec/command_unix.go b/vendor/github.com/containers/storage/pkg/reexec/command_unix.go new file mode 100644 index 00000000..b70edcb3 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/reexec/command_unix.go @@ -0,0 +1,23 @@ +// +build freebsd solaris + +package reexec + +import ( + "os/exec" +) + +// Self returns the path to the current process's binary. +// Uses os.Args[0]. +func Self() string { + return naiveSelf() +} + +// Command returns *exec.Cmd which have Path as current binary. +// For example if current binary is "docker" at "/usr/bin/", then cmd.Path will +// be set to "/usr/bin/docker". +func Command(args ...string) *exec.Cmd { + return &exec.Cmd{ + Path: Self(), + Args: args, + } +} diff --git a/vendor/github.com/containers/storage/pkg/reexec/command_unsupported.go b/vendor/github.com/containers/storage/pkg/reexec/command_unsupported.go new file mode 100644 index 00000000..9aed004e --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/reexec/command_unsupported.go @@ -0,0 +1,12 @@ +// +build !linux,!windows,!freebsd,!solaris + +package reexec + +import ( + "os/exec" +) + +// Command is unsupported on operating systems apart from Linux and Windows. +func Command(args ...string) *exec.Cmd { + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/reexec/command_windows.go b/vendor/github.com/containers/storage/pkg/reexec/command_windows.go new file mode 100644 index 00000000..8d65e0ae --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/reexec/command_windows.go @@ -0,0 +1,23 @@ +// +build windows + +package reexec + +import ( + "os/exec" +) + +// Self returns the path to the current process's binary. +// Uses os.Args[0]. +func Self() string { + return naiveSelf() +} + +// Command returns *exec.Cmd which have Path as current binary. +// For example if current binary is "docker.exe" at "C:\", then cmd.Path will +// be set to "C:\docker.exe". +func Command(args ...string) *exec.Cmd { + return &exec.Cmd{ + Path: Self(), + Args: args, + } +} diff --git a/vendor/github.com/containers/storage/pkg/reexec/reexec.go b/vendor/github.com/containers/storage/pkg/reexec/reexec.go new file mode 100644 index 00000000..c56671d9 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/reexec/reexec.go @@ -0,0 +1,47 @@ +package reexec + +import ( + "fmt" + "os" + "os/exec" + "path/filepath" +) + +var registeredInitializers = make(map[string]func()) + +// Register adds an initialization func under the specified name +func Register(name string, initializer func()) { + if _, exists := registeredInitializers[name]; exists { + panic(fmt.Sprintf("reexec func already registered under name %q", name)) + } + + registeredInitializers[name] = initializer +} + +// Init is called as the first part of the exec process and returns true if an +// initialization function was called. +func Init() bool { + initializer, exists := registeredInitializers[os.Args[0]] + if exists { + initializer() + + return true + } + return false +} + +func naiveSelf() string { + name := os.Args[0] + if filepath.Base(name) == name { + if lp, err := exec.LookPath(name); err == nil { + return lp + } + } + // handle conversion of relative paths to absolute + if absName, err := filepath.Abs(name); err == nil { + return absName + } + // if we couldn't get absolute name, return original + // (NOTE: Go only errors on Abs() if os.Getwd fails) + return name +} diff --git a/vendor/github.com/containers/storage/pkg/stringid/stringid.go b/vendor/github.com/containers/storage/pkg/stringid/stringid.go new file mode 100644 index 00000000..74dfaaaa --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/stringid/stringid.go @@ -0,0 +1,71 @@ +// Package stringid provides helper functions for dealing with string identifiers +package stringid + +import ( + "crypto/rand" + "encoding/hex" + "io" + "regexp" + "strconv" + "strings" + + "github.com/containers/storage/pkg/random" +) + +const shortLen = 12 + +var validShortID = regexp.MustCompile("^[a-z0-9]{12}$") + +// IsShortID determines if an arbitrary string *looks like* a short ID. +func IsShortID(id string) bool { + return validShortID.MatchString(id) +} + +// TruncateID returns a shorthand version of a string identifier for convenience. +// A collision with other shorthands is very unlikely, but possible. +// In case of a collision a lookup with TruncIndex.Get() will fail, and the caller +// will need to use a longer prefix, or the full-length Id. +func TruncateID(id string) string { + if i := strings.IndexRune(id, ':'); i >= 0 { + id = id[i+1:] + } + trimTo := shortLen + if len(id) < shortLen { + trimTo = len(id) + } + return id[:trimTo] +} + +func generateID(crypto bool) string { + b := make([]byte, 32) + r := random.Reader + if crypto { + r = rand.Reader + } + for { + if _, err := io.ReadFull(r, b); err != nil { + panic(err) // This shouldn't happen + } + id := hex.EncodeToString(b) + // if we try to parse the truncated for as an int and we don't have + // an error then the value is all numeric and causes issues when + // used as a hostname. ref #3869 + if _, err := strconv.ParseInt(TruncateID(id), 10, 64); err == nil { + continue + } + return id + } +} + +// GenerateRandomID returns a unique id. +func GenerateRandomID() string { + return generateID(true) + +} + +// GenerateNonCryptoID generates unique id without using cryptographically +// secure sources of random. +// It helps you to save entropy. +func GenerateNonCryptoID() string { + return generateID(false) +} diff --git a/vendor/github.com/containers/storage/pkg/system/chtimes.go b/vendor/github.com/containers/storage/pkg/system/chtimes.go new file mode 100644 index 00000000..7637f12e --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/chtimes.go @@ -0,0 +1,52 @@ +package system + +import ( + "os" + "syscall" + "time" + "unsafe" +) + +var ( + maxTime time.Time +) + +func init() { + if unsafe.Sizeof(syscall.Timespec{}.Nsec) == 8 { + // This is a 64 bit timespec + // os.Chtimes limits time to the following + maxTime = time.Unix(0, 1<<63-1) + } else { + // This is a 32 bit timespec + maxTime = time.Unix(1<<31-1, 0) + } +} + +// Chtimes changes the access time and modified time of a file at the given path +func Chtimes(name string, atime time.Time, mtime time.Time) error { + unixMinTime := time.Unix(0, 0) + unixMaxTime := maxTime + + // If the modified time is prior to the Unix Epoch, or after the + // end of Unix Time, os.Chtimes has undefined behavior + // default to Unix Epoch in this case, just in case + + if atime.Before(unixMinTime) || atime.After(unixMaxTime) { + atime = unixMinTime + } + + if mtime.Before(unixMinTime) || mtime.After(unixMaxTime) { + mtime = unixMinTime + } + + if err := os.Chtimes(name, atime, mtime); err != nil { + return err + } + + // Take platform specific action for setting create time. + if err := setCTime(name, mtime); err != nil { + return err + } + + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/chtimes_unix.go b/vendor/github.com/containers/storage/pkg/system/chtimes_unix.go new file mode 100644 index 00000000..09d58bcb --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/chtimes_unix.go @@ -0,0 +1,14 @@ +// +build !windows + +package system + +import ( + "time" +) + +//setCTime will set the create time on a file. On Unix, the create +//time is updated as a side effect of setting the modified time, so +//no action is required. +func setCTime(path string, ctime time.Time) error { + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/chtimes_windows.go b/vendor/github.com/containers/storage/pkg/system/chtimes_windows.go new file mode 100644 index 00000000..29458684 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/chtimes_windows.go @@ -0,0 +1,27 @@ +// +build windows + +package system + +import ( + "syscall" + "time" +) + +//setCTime will set the create time on a file. On Windows, this requires +//calling SetFileTime and explicitly including the create time. +func setCTime(path string, ctime time.Time) error { + ctimespec := syscall.NsecToTimespec(ctime.UnixNano()) + pathp, e := syscall.UTF16PtrFromString(path) + if e != nil { + return e + } + h, e := syscall.CreateFile(pathp, + syscall.FILE_WRITE_ATTRIBUTES, syscall.FILE_SHARE_WRITE, nil, + syscall.OPEN_EXISTING, syscall.FILE_FLAG_BACKUP_SEMANTICS, 0) + if e != nil { + return e + } + defer syscall.Close(h) + c := syscall.NsecToFiletime(syscall.TimespecToNsec(ctimespec)) + return syscall.SetFileTime(h, &c, nil, nil) +} diff --git a/vendor/github.com/containers/storage/pkg/system/errors.go b/vendor/github.com/containers/storage/pkg/system/errors.go new file mode 100644 index 00000000..28831898 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/errors.go @@ -0,0 +1,10 @@ +package system + +import ( + "errors" +) + +var ( + // ErrNotSupportedPlatform means the platform is not supported. + ErrNotSupportedPlatform = errors.New("platform and architecture is not supported") +) diff --git a/vendor/github.com/containers/storage/pkg/system/events_windows.go b/vendor/github.com/containers/storage/pkg/system/events_windows.go new file mode 100644 index 00000000..04e2de78 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/events_windows.go @@ -0,0 +1,83 @@ +package system + +// This file implements syscalls for Win32 events which are not implemented +// in golang. + +import ( + "syscall" + "unsafe" +) + +var ( + procCreateEvent = modkernel32.NewProc("CreateEventW") + procOpenEvent = modkernel32.NewProc("OpenEventW") + procSetEvent = modkernel32.NewProc("SetEvent") + procResetEvent = modkernel32.NewProc("ResetEvent") + procPulseEvent = modkernel32.NewProc("PulseEvent") +) + +// CreateEvent implements win32 CreateEventW func in golang. It will create an event object. +func CreateEvent(eventAttributes *syscall.SecurityAttributes, manualReset bool, initialState bool, name string) (handle syscall.Handle, err error) { + namep, _ := syscall.UTF16PtrFromString(name) + var _p1 uint32 + if manualReset { + _p1 = 1 + } + var _p2 uint32 + if initialState { + _p2 = 1 + } + r0, _, e1 := procCreateEvent.Call(uintptr(unsafe.Pointer(eventAttributes)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(namep))) + use(unsafe.Pointer(namep)) + handle = syscall.Handle(r0) + if handle == syscall.InvalidHandle { + err = e1 + } + return +} + +// OpenEvent implements win32 OpenEventW func in golang. It opens an event object. +func OpenEvent(desiredAccess uint32, inheritHandle bool, name string) (handle syscall.Handle, err error) { + namep, _ := syscall.UTF16PtrFromString(name) + var _p1 uint32 + if inheritHandle { + _p1 = 1 + } + r0, _, e1 := procOpenEvent.Call(uintptr(desiredAccess), uintptr(_p1), uintptr(unsafe.Pointer(namep))) + use(unsafe.Pointer(namep)) + handle = syscall.Handle(r0) + if handle == syscall.InvalidHandle { + err = e1 + } + return +} + +// SetEvent implements win32 SetEvent func in golang. +func SetEvent(handle syscall.Handle) (err error) { + return setResetPulse(handle, procSetEvent) +} + +// ResetEvent implements win32 ResetEvent func in golang. +func ResetEvent(handle syscall.Handle) (err error) { + return setResetPulse(handle, procResetEvent) +} + +// PulseEvent implements win32 PulseEvent func in golang. +func PulseEvent(handle syscall.Handle) (err error) { + return setResetPulse(handle, procPulseEvent) +} + +func setResetPulse(handle syscall.Handle, proc *syscall.LazyProc) (err error) { + r0, _, _ := proc.Call(uintptr(handle)) + if r0 != 0 { + err = syscall.Errno(r0) + } + return +} + +var temp unsafe.Pointer + +// use ensures a variable is kept alive without the GC freeing while still needed +func use(p unsafe.Pointer) { + temp = p +} diff --git a/vendor/github.com/containers/storage/pkg/system/filesys.go b/vendor/github.com/containers/storage/pkg/system/filesys.go new file mode 100644 index 00000000..c14feb84 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/filesys.go @@ -0,0 +1,19 @@ +// +build !windows + +package system + +import ( + "os" + "path/filepath" +) + +// MkdirAll creates a directory named path along with any necessary parents, +// with permission specified by attribute perm for all dir created. +func MkdirAll(path string, perm os.FileMode) error { + return os.MkdirAll(path, perm) +} + +// IsAbs is a platform-specific wrapper for filepath.IsAbs. +func IsAbs(path string) bool { + return filepath.IsAbs(path) +} diff --git a/vendor/github.com/containers/storage/pkg/system/filesys_windows.go b/vendor/github.com/containers/storage/pkg/system/filesys_windows.go new file mode 100644 index 00000000..16823d55 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/filesys_windows.go @@ -0,0 +1,82 @@ +// +build windows + +package system + +import ( + "os" + "path/filepath" + "regexp" + "strings" + "syscall" +) + +// MkdirAll implementation that is volume path aware for Windows. +func MkdirAll(path string, perm os.FileMode) error { + if re := regexp.MustCompile(`^\\\\\?\\Volume{[a-z0-9-]+}$`); re.MatchString(path) { + return nil + } + + // The rest of this method is copied from os.MkdirAll and should be kept + // as-is to ensure compatibility. + + // Fast path: if we can tell whether path is a directory or file, stop with success or error. + dir, err := os.Stat(path) + if err == nil { + if dir.IsDir() { + return nil + } + return &os.PathError{ + Op: "mkdir", + Path: path, + Err: syscall.ENOTDIR, + } + } + + // Slow path: make sure parent exists and then call Mkdir for path. + i := len(path) + for i > 0 && os.IsPathSeparator(path[i-1]) { // Skip trailing path separator. + i-- + } + + j := i + for j > 0 && !os.IsPathSeparator(path[j-1]) { // Scan backward over element. + j-- + } + + if j > 1 { + // Create parent + err = MkdirAll(path[0:j-1], perm) + if err != nil { + return err + } + } + + // Parent now exists; invoke Mkdir and use its result. + err = os.Mkdir(path, perm) + if err != nil { + // Handle arguments like "foo/." by + // double-checking that directory doesn't exist. + dir, err1 := os.Lstat(path) + if err1 == nil && dir.IsDir() { + return nil + } + return err + } + return nil +} + +// IsAbs is a platform-specific wrapper for filepath.IsAbs. On Windows, +// golang filepath.IsAbs does not consider a path \windows\system32 as absolute +// as it doesn't start with a drive-letter/colon combination. However, in +// docker we need to verify things such as WORKDIR /windows/system32 in +// a Dockerfile (which gets translated to \windows\system32 when being processed +// by the daemon. This SHOULD be treated as absolute from a docker processing +// perspective. +func IsAbs(path string) bool { + if !filepath.IsAbs(path) { + if !strings.HasPrefix(path, string(os.PathSeparator)) { + return false + } + } + return true +} diff --git a/vendor/github.com/containers/storage/pkg/system/lstat.go b/vendor/github.com/containers/storage/pkg/system/lstat.go new file mode 100644 index 00000000..bd23c4d5 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/lstat.go @@ -0,0 +1,19 @@ +// +build !windows + +package system + +import ( + "syscall" +) + +// Lstat takes a path to a file and returns +// a system.StatT type pertaining to that file. +// +// Throws an error if the file does not exist +func Lstat(path string) (*StatT, error) { + s := &syscall.Stat_t{} + if err := syscall.Lstat(path, s); err != nil { + return nil, err + } + return fromStatT(s) +} diff --git a/vendor/github.com/containers/storage/pkg/system/lstat_windows.go b/vendor/github.com/containers/storage/pkg/system/lstat_windows.go new file mode 100644 index 00000000..49e87eb4 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/lstat_windows.go @@ -0,0 +1,25 @@ +// +build windows + +package system + +import ( + "os" +) + +// Lstat calls os.Lstat to get a fileinfo interface back. +// This is then copied into our own locally defined structure. +// Note the Linux version uses fromStatT to do the copy back, +// but that not strictly necessary when already in an OS specific module. +func Lstat(path string) (*StatT, error) { + fi, err := os.Lstat(path) + if err != nil { + return nil, err + } + + return &StatT{ + name: fi.Name(), + size: fi.Size(), + mode: fi.Mode(), + modTime: fi.ModTime(), + isDir: fi.IsDir()}, nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/meminfo.go b/vendor/github.com/containers/storage/pkg/system/meminfo.go new file mode 100644 index 00000000..3b6e947e --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/meminfo.go @@ -0,0 +1,17 @@ +package system + +// MemInfo contains memory statistics of the host system. +type MemInfo struct { + // Total usable RAM (i.e. physical RAM minus a few reserved bits and the + // kernel binary code). + MemTotal int64 + + // Amount of free memory. + MemFree int64 + + // Total amount of swap space available. + SwapTotal int64 + + // Amount of swap space that is currently unused. + SwapFree int64 +} diff --git a/vendor/github.com/containers/storage/pkg/system/meminfo_linux.go b/vendor/github.com/containers/storage/pkg/system/meminfo_linux.go new file mode 100644 index 00000000..385f1d5e --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/meminfo_linux.go @@ -0,0 +1,65 @@ +package system + +import ( + "bufio" + "io" + "os" + "strconv" + "strings" + + "github.com/docker/go-units" +) + +// ReadMemInfo retrieves memory statistics of the host system and returns a +// MemInfo type. +func ReadMemInfo() (*MemInfo, error) { + file, err := os.Open("/proc/meminfo") + if err != nil { + return nil, err + } + defer file.Close() + return parseMemInfo(file) +} + +// parseMemInfo parses the /proc/meminfo file into +// a MemInfo object given an io.Reader to the file. +// Throws error if there are problems reading from the file +func parseMemInfo(reader io.Reader) (*MemInfo, error) { + meminfo := &MemInfo{} + scanner := bufio.NewScanner(reader) + for scanner.Scan() { + // Expected format: ["MemTotal:", "1234", "kB"] + parts := strings.Fields(scanner.Text()) + + // Sanity checks: Skip malformed entries. + if len(parts) < 3 || parts[2] != "kB" { + continue + } + + // Convert to bytes. + size, err := strconv.Atoi(parts[1]) + if err != nil { + continue + } + bytes := int64(size) * units.KiB + + switch parts[0] { + case "MemTotal:": + meminfo.MemTotal = bytes + case "MemFree:": + meminfo.MemFree = bytes + case "SwapTotal:": + meminfo.SwapTotal = bytes + case "SwapFree:": + meminfo.SwapFree = bytes + } + + } + + // Handle errors that may have occurred during the reading of the file. + if err := scanner.Err(); err != nil { + return nil, err + } + + return meminfo, nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/meminfo_solaris.go b/vendor/github.com/containers/storage/pkg/system/meminfo_solaris.go new file mode 100644 index 00000000..313c601b --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/meminfo_solaris.go @@ -0,0 +1,128 @@ +// +build solaris,cgo + +package system + +import ( + "fmt" + "unsafe" +) + +// #cgo LDFLAGS: -lkstat +// #include +// #include +// #include +// #include +// #include +// #include +// struct swaptable *allocSwaptable(int num) { +// struct swaptable *st; +// struct swapent *swapent; +// st = (struct swaptable *)malloc(num * sizeof(swapent_t) + sizeof (int)); +// swapent = st->swt_ent; +// for (int i = 0; i < num; i++,swapent++) { +// swapent->ste_path = (char *)malloc(MAXPATHLEN * sizeof (char)); +// } +// st->swt_n = num; +// return st; +//} +// void freeSwaptable (struct swaptable *st) { +// struct swapent *swapent = st->swt_ent; +// for (int i = 0; i < st->swt_n; i++,swapent++) { +// free(swapent->ste_path); +// } +// free(st); +// } +// swapent_t getSwapEnt(swapent_t *ent, int i) { +// return ent[i]; +// } +// int64_t getPpKernel() { +// int64_t pp_kernel = 0; +// kstat_ctl_t *ksc; +// kstat_t *ks; +// kstat_named_t *knp; +// kid_t kid; +// +// if ((ksc = kstat_open()) == NULL) { +// return -1; +// } +// if ((ks = kstat_lookup(ksc, "unix", 0, "system_pages")) == NULL) { +// return -1; +// } +// if (((kid = kstat_read(ksc, ks, NULL)) == -1) || +// ((knp = kstat_data_lookup(ks, "pp_kernel")) == NULL)) { +// return -1; +// } +// switch (knp->data_type) { +// case KSTAT_DATA_UINT64: +// pp_kernel = knp->value.ui64; +// break; +// case KSTAT_DATA_UINT32: +// pp_kernel = knp->value.ui32; +// break; +// } +// pp_kernel *= sysconf(_SC_PAGESIZE); +// return (pp_kernel > 0 ? pp_kernel : -1); +// } +import "C" + +// Get the system memory info using sysconf same as prtconf +func getTotalMem() int64 { + pagesize := C.sysconf(C._SC_PAGESIZE) + npages := C.sysconf(C._SC_PHYS_PAGES) + return int64(pagesize * npages) +} + +func getFreeMem() int64 { + pagesize := C.sysconf(C._SC_PAGESIZE) + npages := C.sysconf(C._SC_AVPHYS_PAGES) + return int64(pagesize * npages) +} + +// ReadMemInfo retrieves memory statistics of the host system and returns a +// MemInfo type. +func ReadMemInfo() (*MemInfo, error) { + + ppKernel := C.getPpKernel() + MemTotal := getTotalMem() + MemFree := getFreeMem() + SwapTotal, SwapFree, err := getSysSwap() + + if ppKernel < 0 || MemTotal < 0 || MemFree < 0 || SwapTotal < 0 || + SwapFree < 0 { + return nil, fmt.Errorf("Error getting system memory info %v\n", err) + } + + meminfo := &MemInfo{} + // Total memory is total physical memory less than memory locked by kernel + meminfo.MemTotal = MemTotal - int64(ppKernel) + meminfo.MemFree = MemFree + meminfo.SwapTotal = SwapTotal + meminfo.SwapFree = SwapFree + + return meminfo, nil +} + +func getSysSwap() (int64, int64, error) { + var tSwap int64 + var fSwap int64 + var diskblksPerPage int64 + num, err := C.swapctl(C.SC_GETNSWP, nil) + if err != nil { + return -1, -1, err + } + st := C.allocSwaptable(num) + _, err = C.swapctl(C.SC_LIST, unsafe.Pointer(st)) + if err != nil { + C.freeSwaptable(st) + return -1, -1, err + } + + diskblksPerPage = int64(C.sysconf(C._SC_PAGESIZE) >> C.DEV_BSHIFT) + for i := 0; i < int(num); i++ { + swapent := C.getSwapEnt(&st.swt_ent[0], C.int(i)) + tSwap += int64(swapent.ste_pages) * diskblksPerPage + fSwap += int64(swapent.ste_free) * diskblksPerPage + } + C.freeSwaptable(st) + return tSwap, fSwap, nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/meminfo_unsupported.go b/vendor/github.com/containers/storage/pkg/system/meminfo_unsupported.go new file mode 100644 index 00000000..3ce019df --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/meminfo_unsupported.go @@ -0,0 +1,8 @@ +// +build !linux,!windows,!solaris + +package system + +// ReadMemInfo is not supported on platforms other than linux and windows. +func ReadMemInfo() (*MemInfo, error) { + return nil, ErrNotSupportedPlatform +} diff --git a/vendor/github.com/containers/storage/pkg/system/meminfo_windows.go b/vendor/github.com/containers/storage/pkg/system/meminfo_windows.go new file mode 100644 index 00000000..d4664259 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/meminfo_windows.go @@ -0,0 +1,44 @@ +package system + +import ( + "syscall" + "unsafe" +) + +var ( + modkernel32 = syscall.NewLazyDLL("kernel32.dll") + + procGlobalMemoryStatusEx = modkernel32.NewProc("GlobalMemoryStatusEx") +) + +// https://msdn.microsoft.com/en-us/library/windows/desktop/aa366589(v=vs.85).aspx +// https://msdn.microsoft.com/en-us/library/windows/desktop/aa366770(v=vs.85).aspx +type memorystatusex struct { + dwLength uint32 + dwMemoryLoad uint32 + ullTotalPhys uint64 + ullAvailPhys uint64 + ullTotalPageFile uint64 + ullAvailPageFile uint64 + ullTotalVirtual uint64 + ullAvailVirtual uint64 + ullAvailExtendedVirtual uint64 +} + +// ReadMemInfo retrieves memory statistics of the host system and returns a +// MemInfo type. +func ReadMemInfo() (*MemInfo, error) { + msi := &memorystatusex{ + dwLength: 64, + } + r1, _, _ := procGlobalMemoryStatusEx.Call(uintptr(unsafe.Pointer(msi))) + if r1 == 0 { + return &MemInfo{}, nil + } + return &MemInfo{ + MemTotal: int64(msi.ullTotalPhys), + MemFree: int64(msi.ullAvailPhys), + SwapTotal: int64(msi.ullTotalPageFile), + SwapFree: int64(msi.ullAvailPageFile), + }, nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/mknod.go b/vendor/github.com/containers/storage/pkg/system/mknod.go new file mode 100644 index 00000000..73958182 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/mknod.go @@ -0,0 +1,22 @@ +// +build !windows + +package system + +import ( + "syscall" +) + +// Mknod creates a filesystem node (file, device special file or named pipe) named path +// with attributes specified by mode and dev. +func Mknod(path string, mode uint32, dev int) error { + return syscall.Mknod(path, mode, dev) +} + +// Mkdev is used to build the value of linux devices (in /dev/) which specifies major +// and minor number of the newly created device special file. +// Linux device nodes are a bit weird due to backwards compat with 16 bit device nodes. +// They are, from low to high: the lower 8 bits of the minor, then 12 bits of the major, +// then the top 12 bits of the minor. +func Mkdev(major int64, minor int64) uint32 { + return uint32(((minor & 0xfff00) << 12) | ((major & 0xfff) << 8) | (minor & 0xff)) +} diff --git a/vendor/github.com/containers/storage/pkg/system/mknod_windows.go b/vendor/github.com/containers/storage/pkg/system/mknod_windows.go new file mode 100644 index 00000000..2e863c02 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/mknod_windows.go @@ -0,0 +1,13 @@ +// +build windows + +package system + +// Mknod is not implemented on Windows. +func Mknod(path string, mode uint32, dev int) error { + return ErrNotSupportedPlatform +} + +// Mkdev is not implemented on Windows. +func Mkdev(major int64, minor int64) uint32 { + panic("Mkdev not implemented on Windows.") +} diff --git a/vendor/github.com/containers/storage/pkg/system/path_unix.go b/vendor/github.com/containers/storage/pkg/system/path_unix.go new file mode 100644 index 00000000..c607c4db --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/path_unix.go @@ -0,0 +1,14 @@ +// +build !windows + +package system + +// DefaultPathEnv is unix style list of directories to search for +// executables. Each directory is separated from the next by a colon +// ':' character . +const DefaultPathEnv = "/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin" + +// CheckSystemDriveAndRemoveDriveLetter verifies that a path, if it includes a drive letter, +// is the system drive. This is a no-op on Linux. +func CheckSystemDriveAndRemoveDriveLetter(path string) (string, error) { + return path, nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/path_windows.go b/vendor/github.com/containers/storage/pkg/system/path_windows.go new file mode 100644 index 00000000..cbfe2c15 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/path_windows.go @@ -0,0 +1,37 @@ +// +build windows + +package system + +import ( + "fmt" + "path/filepath" + "strings" +) + +// DefaultPathEnv is deliberately empty on Windows as the default path will be set by +// the container. Docker has no context of what the default path should be. +const DefaultPathEnv = "" + +// CheckSystemDriveAndRemoveDriveLetter verifies and manipulates a Windows path. +// This is used, for example, when validating a user provided path in docker cp. +// If a drive letter is supplied, it must be the system drive. The drive letter +// is always removed. Also, it translates it to OS semantics (IOW / to \). We +// need the path in this syntax so that it can ultimately be contatenated with +// a Windows long-path which doesn't support drive-letters. Examples: +// C: --> Fail +// C:\ --> \ +// a --> a +// /a --> \a +// d:\ --> Fail +func CheckSystemDriveAndRemoveDriveLetter(path string) (string, error) { + if len(path) == 2 && string(path[1]) == ":" { + return "", fmt.Errorf("No relative path specified in %q", path) + } + if !filepath.IsAbs(path) || len(path) < 2 { + return filepath.FromSlash(path), nil + } + if string(path[1]) == ":" && !strings.EqualFold(string(path[0]), "c") { + return "", fmt.Errorf("The specified path is not on the system drive (C:)") + } + return filepath.FromSlash(path[2:]), nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/stat.go b/vendor/github.com/containers/storage/pkg/system/stat.go new file mode 100644 index 00000000..087034c5 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/stat.go @@ -0,0 +1,53 @@ +// +build !windows + +package system + +import ( + "syscall" +) + +// StatT type contains status of a file. It contains metadata +// like permission, owner, group, size, etc about a file. +type StatT struct { + mode uint32 + uid uint32 + gid uint32 + rdev uint64 + size int64 + mtim syscall.Timespec +} + +// Mode returns file's permission mode. +func (s StatT) Mode() uint32 { + return s.mode +} + +// UID returns file's user id of owner. +func (s StatT) UID() uint32 { + return s.uid +} + +// GID returns file's group id of owner. +func (s StatT) GID() uint32 { + return s.gid +} + +// Rdev returns file's device ID (if it's special file). +func (s StatT) Rdev() uint64 { + return s.rdev +} + +// Size returns file's size. +func (s StatT) Size() int64 { + return s.size +} + +// Mtim returns file's last modification time. +func (s StatT) Mtim() syscall.Timespec { + return s.mtim +} + +// GetLastModification returns file's last modification time. +func (s StatT) GetLastModification() syscall.Timespec { + return s.Mtim() +} diff --git a/vendor/github.com/containers/storage/pkg/system/stat_freebsd.go b/vendor/github.com/containers/storage/pkg/system/stat_freebsd.go new file mode 100644 index 00000000..d0fb6f15 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/stat_freebsd.go @@ -0,0 +1,27 @@ +package system + +import ( + "syscall" +) + +// fromStatT converts a syscall.Stat_t type to a system.Stat_t type +func fromStatT(s *syscall.Stat_t) (*StatT, error) { + return &StatT{size: s.Size, + mode: uint32(s.Mode), + uid: s.Uid, + gid: s.Gid, + rdev: uint64(s.Rdev), + mtim: s.Mtimespec}, nil +} + +// Stat takes a path to a file and returns +// a system.Stat_t type pertaining to that file. +// +// Throws an error if the file does not exist +func Stat(path string) (*StatT, error) { + s := &syscall.Stat_t{} + if err := syscall.Stat(path, s); err != nil { + return nil, err + } + return fromStatT(s) +} diff --git a/vendor/github.com/containers/storage/pkg/system/stat_linux.go b/vendor/github.com/containers/storage/pkg/system/stat_linux.go new file mode 100644 index 00000000..8b1eded1 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/stat_linux.go @@ -0,0 +1,33 @@ +package system + +import ( + "syscall" +) + +// fromStatT converts a syscall.Stat_t type to a system.Stat_t type +func fromStatT(s *syscall.Stat_t) (*StatT, error) { + return &StatT{size: s.Size, + mode: s.Mode, + uid: s.Uid, + gid: s.Gid, + rdev: s.Rdev, + mtim: s.Mtim}, nil +} + +// FromStatT exists only on linux, and loads a system.StatT from a +// syscal.Stat_t. +func FromStatT(s *syscall.Stat_t) (*StatT, error) { + return fromStatT(s) +} + +// Stat takes a path to a file and returns +// a system.StatT type pertaining to that file. +// +// Throws an error if the file does not exist +func Stat(path string) (*StatT, error) { + s := &syscall.Stat_t{} + if err := syscall.Stat(path, s); err != nil { + return nil, err + } + return fromStatT(s) +} diff --git a/vendor/github.com/containers/storage/pkg/system/stat_openbsd.go b/vendor/github.com/containers/storage/pkg/system/stat_openbsd.go new file mode 100644 index 00000000..3c3b71fb --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/stat_openbsd.go @@ -0,0 +1,15 @@ +package system + +import ( + "syscall" +) + +// fromStatT creates a system.StatT type from a syscall.Stat_t type +func fromStatT(s *syscall.Stat_t) (*StatT, error) { + return &StatT{size: s.Size, + mode: uint32(s.Mode), + uid: s.Uid, + gid: s.Gid, + rdev: uint64(s.Rdev), + mtim: s.Mtim}, nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/stat_solaris.go b/vendor/github.com/containers/storage/pkg/system/stat_solaris.go new file mode 100644 index 00000000..0216985a --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/stat_solaris.go @@ -0,0 +1,34 @@ +// +build solaris + +package system + +import ( + "syscall" +) + +// fromStatT creates a system.StatT type from a syscall.Stat_t type +func fromStatT(s *syscall.Stat_t) (*StatT, error) { + return &StatT{size: s.Size, + mode: uint32(s.Mode), + uid: s.Uid, + gid: s.Gid, + rdev: uint64(s.Rdev), + mtim: s.Mtim}, nil +} + +// FromStatT loads a system.StatT from a syscal.Stat_t. +func FromStatT(s *syscall.Stat_t) (*StatT, error) { + return fromStatT(s) +} + +// Stat takes a path to a file and returns +// a system.StatT type pertaining to that file. +// +// Throws an error if the file does not exist +func Stat(path string) (*StatT, error) { + s := &syscall.Stat_t{} + if err := syscall.Stat(path, s); err != nil { + return nil, err + } + return fromStatT(s) +} diff --git a/vendor/github.com/containers/storage/pkg/system/stat_unsupported.go b/vendor/github.com/containers/storage/pkg/system/stat_unsupported.go new file mode 100644 index 00000000..f53e9de4 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/stat_unsupported.go @@ -0,0 +1,17 @@ +// +build !linux,!windows,!freebsd,!solaris,!openbsd + +package system + +import ( + "syscall" +) + +// fromStatT creates a system.StatT type from a syscall.Stat_t type +func fromStatT(s *syscall.Stat_t) (*StatT, error) { + return &StatT{size: s.Size, + mode: uint32(s.Mode), + uid: s.Uid, + gid: s.Gid, + rdev: uint64(s.Rdev), + mtim: s.Mtimespec}, nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/stat_windows.go b/vendor/github.com/containers/storage/pkg/system/stat_windows.go new file mode 100644 index 00000000..39490c62 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/stat_windows.go @@ -0,0 +1,43 @@ +// +build windows + +package system + +import ( + "os" + "time" +) + +// StatT type contains status of a file. It contains metadata +// like name, permission, size, etc about a file. +type StatT struct { + name string + size int64 + mode os.FileMode + modTime time.Time + isDir bool +} + +// Name returns file's name. +func (s StatT) Name() string { + return s.name +} + +// Size returns file's size. +func (s StatT) Size() int64 { + return s.size +} + +// Mode returns file's permission mode. +func (s StatT) Mode() os.FileMode { + return s.mode +} + +// ModTime returns file's last modification time. +func (s StatT) ModTime() time.Time { + return s.modTime +} + +// IsDir returns whether file is actually a directory. +func (s StatT) IsDir() bool { + return s.isDir +} diff --git a/vendor/github.com/containers/storage/pkg/system/syscall_unix.go b/vendor/github.com/containers/storage/pkg/system/syscall_unix.go new file mode 100644 index 00000000..3ae91284 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/syscall_unix.go @@ -0,0 +1,17 @@ +// +build linux freebsd + +package system + +import "syscall" + +// Unmount is a platform-specific helper function to call +// the unmount syscall. +func Unmount(dest string) error { + return syscall.Unmount(dest, 0) +} + +// CommandLineToArgv should not be used on Unix. +// It simply returns commandLine in the only element in the returned array. +func CommandLineToArgv(commandLine string) ([]string, error) { + return []string{commandLine}, nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/syscall_windows.go b/vendor/github.com/containers/storage/pkg/system/syscall_windows.go new file mode 100644 index 00000000..f5f2d569 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/syscall_windows.go @@ -0,0 +1,103 @@ +package system + +import ( + "syscall" + "unsafe" + + "github.com/Sirupsen/logrus" +) + +var ( + ntuserApiset = syscall.NewLazyDLL("ext-ms-win-ntuser-window-l1-1-0") + procGetVersionExW = modkernel32.NewProc("GetVersionExW") +) + +// OSVersion is a wrapper for Windows version information +// https://msdn.microsoft.com/en-us/library/windows/desktop/ms724439(v=vs.85).aspx +type OSVersion struct { + Version uint32 + MajorVersion uint8 + MinorVersion uint8 + Build uint16 +} + +// https://msdn.microsoft.com/en-us/library/windows/desktop/ms724833(v=vs.85).aspx +type osVersionInfoEx struct { + OSVersionInfoSize uint32 + MajorVersion uint32 + MinorVersion uint32 + BuildNumber uint32 + PlatformID uint32 + CSDVersion [128]uint16 + ServicePackMajor uint16 + ServicePackMinor uint16 + SuiteMask uint16 + ProductType byte + Reserve byte +} + +// GetOSVersion gets the operating system version on Windows. Note that +// docker.exe must be manifested to get the correct version information. +func GetOSVersion() OSVersion { + var err error + osv := OSVersion{} + osv.Version, err = syscall.GetVersion() + if err != nil { + // GetVersion never fails. + panic(err) + } + osv.MajorVersion = uint8(osv.Version & 0xFF) + osv.MinorVersion = uint8(osv.Version >> 8 & 0xFF) + osv.Build = uint16(osv.Version >> 16) + return osv +} + +// IsWindowsClient returns true if the SKU is client +func IsWindowsClient() bool { + osviex := &osVersionInfoEx{OSVersionInfoSize: 284} + r1, _, err := procGetVersionExW.Call(uintptr(unsafe.Pointer(osviex))) + if r1 == 0 { + logrus.Warnf("GetVersionExW failed - assuming server SKU: %v", err) + return false + } + const verNTWorkstation = 0x00000001 + return osviex.ProductType == verNTWorkstation +} + +// Unmount is a platform-specific helper function to call +// the unmount syscall. Not supported on Windows +func Unmount(dest string) error { + return nil +} + +// CommandLineToArgv wraps the Windows syscall to turn a commandline into an argument array. +func CommandLineToArgv(commandLine string) ([]string, error) { + var argc int32 + + argsPtr, err := syscall.UTF16PtrFromString(commandLine) + if err != nil { + return nil, err + } + + argv, err := syscall.CommandLineToArgv(argsPtr, &argc) + if err != nil { + return nil, err + } + defer syscall.LocalFree(syscall.Handle(uintptr(unsafe.Pointer(argv)))) + + newArgs := make([]string, argc) + for i, v := range (*argv)[:argc] { + newArgs[i] = string(syscall.UTF16ToString((*v)[:])) + } + + return newArgs, nil +} + +// HasWin32KSupport determines whether containers that depend on win32k can +// run on this machine. Win32k is the driver used to implement windowing. +func HasWin32KSupport() bool { + // For now, check for ntuser API support on the host. In the future, a host + // may support win32k in containers even if the host does not support ntuser + // APIs. + return ntuserApiset.Load() == nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/umask.go b/vendor/github.com/containers/storage/pkg/system/umask.go new file mode 100644 index 00000000..3d0146b0 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/umask.go @@ -0,0 +1,13 @@ +// +build !windows + +package system + +import ( + "syscall" +) + +// Umask sets current process's file mode creation mask to newmask +// and returns oldmask. +func Umask(newmask int) (oldmask int, err error) { + return syscall.Umask(newmask), nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/umask_windows.go b/vendor/github.com/containers/storage/pkg/system/umask_windows.go new file mode 100644 index 00000000..13f1de17 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/umask_windows.go @@ -0,0 +1,9 @@ +// +build windows + +package system + +// Umask is not supported on the windows platform. +func Umask(newmask int) (oldmask int, err error) { + // should not be called on cli code path + return 0, ErrNotSupportedPlatform +} diff --git a/vendor/github.com/containers/storage/pkg/system/utimes_darwin.go b/vendor/github.com/containers/storage/pkg/system/utimes_darwin.go new file mode 100644 index 00000000..0a161975 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/utimes_darwin.go @@ -0,0 +1,8 @@ +package system + +import "syscall" + +// LUtimesNano is not supported by darwin platform. +func LUtimesNano(path string, ts []syscall.Timespec) error { + return ErrNotSupportedPlatform +} diff --git a/vendor/github.com/containers/storage/pkg/system/utimes_freebsd.go b/vendor/github.com/containers/storage/pkg/system/utimes_freebsd.go new file mode 100644 index 00000000..e2eac3b5 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/utimes_freebsd.go @@ -0,0 +1,22 @@ +package system + +import ( + "syscall" + "unsafe" +) + +// LUtimesNano is used to change access and modification time of the specified path. +// It's used for symbol link file because syscall.UtimesNano doesn't support a NOFOLLOW flag atm. +func LUtimesNano(path string, ts []syscall.Timespec) error { + var _path *byte + _path, err := syscall.BytePtrFromString(path) + if err != nil { + return err + } + + if _, _, err := syscall.Syscall(syscall.SYS_LUTIMES, uintptr(unsafe.Pointer(_path)), uintptr(unsafe.Pointer(&ts[0])), 0); err != 0 && err != syscall.ENOSYS { + return err + } + + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/utimes_linux.go b/vendor/github.com/containers/storage/pkg/system/utimes_linux.go new file mode 100644 index 00000000..fc8a1aba --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/utimes_linux.go @@ -0,0 +1,26 @@ +package system + +import ( + "syscall" + "unsafe" +) + +// LUtimesNano is used to change access and modification time of the specified path. +// It's used for symbol link file because syscall.UtimesNano doesn't support a NOFOLLOW flag atm. +func LUtimesNano(path string, ts []syscall.Timespec) error { + // These are not currently available in syscall + atFdCwd := -100 + atSymLinkNoFollow := 0x100 + + var _path *byte + _path, err := syscall.BytePtrFromString(path) + if err != nil { + return err + } + + if _, _, err := syscall.Syscall6(syscall.SYS_UTIMENSAT, uintptr(atFdCwd), uintptr(unsafe.Pointer(_path)), uintptr(unsafe.Pointer(&ts[0])), uintptr(atSymLinkNoFollow), 0, 0); err != 0 && err != syscall.ENOSYS { + return err + } + + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/utimes_unsupported.go b/vendor/github.com/containers/storage/pkg/system/utimes_unsupported.go new file mode 100644 index 00000000..50c3a043 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/utimes_unsupported.go @@ -0,0 +1,10 @@ +// +build !linux,!freebsd,!darwin + +package system + +import "syscall" + +// LUtimesNano is not supported on platforms other than linux, freebsd and darwin. +func LUtimesNano(path string, ts []syscall.Timespec) error { + return ErrNotSupportedPlatform +} diff --git a/vendor/github.com/containers/storage/pkg/system/xattrs_linux.go b/vendor/github.com/containers/storage/pkg/system/xattrs_linux.go new file mode 100644 index 00000000..d2e2c057 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/xattrs_linux.go @@ -0,0 +1,63 @@ +package system + +import ( + "syscall" + "unsafe" +) + +// Lgetxattr retrieves the value of the extended attribute identified by attr +// and associated with the given path in the file system. +// It will returns a nil slice and nil error if the xattr is not set. +func Lgetxattr(path string, attr string) ([]byte, error) { + pathBytes, err := syscall.BytePtrFromString(path) + if err != nil { + return nil, err + } + attrBytes, err := syscall.BytePtrFromString(attr) + if err != nil { + return nil, err + } + + dest := make([]byte, 128) + destBytes := unsafe.Pointer(&dest[0]) + sz, _, errno := syscall.Syscall6(syscall.SYS_LGETXATTR, uintptr(unsafe.Pointer(pathBytes)), uintptr(unsafe.Pointer(attrBytes)), uintptr(destBytes), uintptr(len(dest)), 0, 0) + if errno == syscall.ENODATA { + return nil, nil + } + if errno == syscall.ERANGE { + dest = make([]byte, sz) + destBytes := unsafe.Pointer(&dest[0]) + sz, _, errno = syscall.Syscall6(syscall.SYS_LGETXATTR, uintptr(unsafe.Pointer(pathBytes)), uintptr(unsafe.Pointer(attrBytes)), uintptr(destBytes), uintptr(len(dest)), 0, 0) + } + if errno != 0 { + return nil, errno + } + + return dest[:sz], nil +} + +var _zero uintptr + +// Lsetxattr sets the value of the extended attribute identified by attr +// and associated with the given path in the file system. +func Lsetxattr(path string, attr string, data []byte, flags int) error { + pathBytes, err := syscall.BytePtrFromString(path) + if err != nil { + return err + } + attrBytes, err := syscall.BytePtrFromString(attr) + if err != nil { + return err + } + var dataBytes unsafe.Pointer + if len(data) > 0 { + dataBytes = unsafe.Pointer(&data[0]) + } else { + dataBytes = unsafe.Pointer(&_zero) + } + _, _, errno := syscall.Syscall6(syscall.SYS_LSETXATTR, uintptr(unsafe.Pointer(pathBytes)), uintptr(unsafe.Pointer(attrBytes)), uintptr(dataBytes), uintptr(len(data)), uintptr(flags), 0) + if errno != 0 { + return errno + } + return nil +} diff --git a/vendor/github.com/containers/storage/pkg/system/xattrs_unsupported.go b/vendor/github.com/containers/storage/pkg/system/xattrs_unsupported.go new file mode 100644 index 00000000..0114f222 --- /dev/null +++ b/vendor/github.com/containers/storage/pkg/system/xattrs_unsupported.go @@ -0,0 +1,13 @@ +// +build !linux + +package system + +// Lgetxattr is not supported on platforms other than linux. +func Lgetxattr(path string, attr string) ([]byte, error) { + return nil, ErrNotSupportedPlatform +} + +// Lsetxattr is not supported on platforms other than linux. +func Lsetxattr(path string, attr string, data []byte, flags int) error { + return ErrNotSupportedPlatform +} diff --git a/vendor/github.com/containers/storage/storage/containers.go b/vendor/github.com/containers/storage/storage/containers.go new file mode 100644 index 00000000..2eb0a39e --- /dev/null +++ b/vendor/github.com/containers/storage/storage/containers.go @@ -0,0 +1,415 @@ +package storage + +import ( + "encoding/base64" + "encoding/json" + "errors" + "io/ioutil" + "os" + "path/filepath" + + "github.com/containers/storage/pkg/ioutils" + "github.com/containers/storage/pkg/stringid" +) + +var ( + // ErrContainerUnknown indicates that there was no container with the specified name or ID + ErrContainerUnknown = errors.New("container not known") +) + +// A Container is a reference to a read-write layer with a metadata string. +// ID is either one specified at create-time or a randomly-generated value. +// Names is an optional set of user-defined convenience values. +// ImageID is the ID of the image which was used to create the container. +// LayerID is the ID of the read-write layer for the container itself. +// It is assumed that the image's top layer is the parent of the container's +// read-write layer. +type Container struct { + ID string `json:"id"` + Names []string `json:"names,omitempty"` + ImageID string `json:"image"` + LayerID string `json:"layer"` + Metadata string `json:"metadata,omitempty"` + BigDataNames []string `json:"big-data-names,omitempty"` + Flags map[string]interface{} `json:"flags,omitempty"` +} + +// ContainerStore provides bookkeeping for information about Containers. +// +// Create creates a container that has a specified ID (or a random one) and an +// optional name, based on the specified image, using the specified layer as +// its read-write layer. +// +// GetMetadata retrieves a container's metadata. +// +// SetMetadata replaces the metadata associated with a container with the +// supplied value. +// +// Exists checks if there is a container with the given ID or name. +// +// Get retrieves information about a container given an ID or name. +// +// Delete removes the record of the container. +// +// Wipe removes records of all containers. +// +// Lookup attempts to translate a name to an ID. Most methods do this +// implicitly. +// +// Containers returns a slice enumerating the known containers. +type ContainerStore interface { + FileBasedStore + MetadataStore + BigDataStore + FlaggableStore + Create(id string, names []string, image, layer, metadata string) (*Container, error) + SetNames(id string, names []string) error + Get(id string) (*Container, error) + Exists(id string) bool + Delete(id string) error + Wipe() error + Lookup(name string) (string, error) + Containers() ([]Container, error) +} + +type containerStore struct { + lockfile Locker + dir string + containers []Container + byid map[string]*Container + bylayer map[string]*Container + byname map[string]*Container +} + +func (r *containerStore) Containers() ([]Container, error) { + return r.containers, nil +} + +func (r *containerStore) containerspath() string { + return filepath.Join(r.dir, "containers.json") +} + +func (r *containerStore) datadir(id string) string { + return filepath.Join(r.dir, id) +} + +func (r *containerStore) datapath(id, key string) string { + return filepath.Join(r.datadir(id), base64.StdEncoding.EncodeToString([]byte(key))) +} + +func (r *containerStore) Load() error { + rpath := r.containerspath() + data, err := ioutil.ReadFile(rpath) + if err != nil && !os.IsNotExist(err) { + return err + } + containers := []Container{} + layers := make(map[string]*Container) + ids := make(map[string]*Container) + names := make(map[string]*Container) + if err = json.Unmarshal(data, &containers); len(data) == 0 || err == nil { + for n, container := range containers { + ids[container.ID] = &containers[n] + layers[container.LayerID] = &containers[n] + for _, name := range container.Names { + names[name] = &containers[n] + } + } + } + r.containers = containers + r.byid = ids + r.bylayer = layers + r.byname = names + return nil +} + +func (r *containerStore) Save() error { + rpath := r.containerspath() + jdata, err := json.Marshal(&r.containers) + if err != nil { + return err + } + return ioutils.AtomicWriteFile(rpath, jdata, 0600) +} + +func newContainerStore(dir string) (ContainerStore, error) { + if err := os.MkdirAll(dir, 0700); err != nil { + return nil, err + } + lockfile, err := GetLockfile(filepath.Join(dir, "containers.lock")) + if err != nil { + return nil, err + } + lockfile.Lock() + defer lockfile.Unlock() + cstore := containerStore{ + lockfile: lockfile, + dir: dir, + containers: []Container{}, + byid: make(map[string]*Container), + bylayer: make(map[string]*Container), + byname: make(map[string]*Container), + } + if err := cstore.Load(); err != nil { + return nil, err + } + return &cstore, nil +} + +func (r *containerStore) ClearFlag(id string, flag string) error { + if container, ok := r.byname[id]; ok { + id = container.ID + } else if container, ok := r.bylayer[id]; ok { + id = container.ID + } + if _, ok := r.byid[id]; !ok { + return ErrImageUnknown + } + container := r.byid[id] + delete(container.Flags, flag) + return r.Save() +} + +func (r *containerStore) SetFlag(id string, flag string, value interface{}) error { + if container, ok := r.byname[id]; ok { + id = container.ID + } else if container, ok := r.bylayer[id]; ok { + id = container.ID + } + if _, ok := r.byid[id]; !ok { + return ErrImageUnknown + } + container := r.byid[id] + container.Flags[flag] = value + return r.Save() +} + +func (r *containerStore) Create(id string, names []string, image, layer, metadata string) (container *Container, err error) { + if id == "" { + id = stringid.GenerateRandomID() + } + if _, idInUse := r.byid[id]; idInUse { + return nil, ErrDuplicateID + } + for _, name := range names { + if _, nameInUse := r.byname[name]; nameInUse { + return nil, ErrDuplicateName + } + } + if err == nil { + newContainer := Container{ + ID: id, + Names: names, + ImageID: image, + LayerID: layer, + Metadata: metadata, + BigDataNames: []string{}, + Flags: make(map[string]interface{}), + } + r.containers = append(r.containers, newContainer) + container = &r.containers[len(r.containers)-1] + r.byid[id] = container + r.bylayer[layer] = container + for _, name := range names { + r.byname[name] = container + } + err = r.Save() + } + return container, err +} + +func (r *containerStore) GetMetadata(id string) (string, error) { + if container, ok := r.byname[id]; ok { + id = container.ID + } else if container, ok := r.bylayer[id]; ok { + id = container.ID + } + if container, ok := r.byid[id]; ok { + return container.Metadata, nil + } + return "", ErrContainerUnknown +} + +func (r *containerStore) SetMetadata(id, metadata string) error { + if container, ok := r.byname[id]; ok { + id = container.ID + } else if container, ok := r.bylayer[id]; ok { + id = container.ID + } + if container, ok := r.byid[id]; ok { + container.Metadata = metadata + return r.Save() + } + return ErrContainerUnknown +} + +func (r *containerStore) removeName(container *Container, name string) { + newNames := []string{} + for _, oldName := range container.Names { + if oldName != name { + newNames = append(newNames, oldName) + } + } + container.Names = newNames +} + +func (r *containerStore) SetNames(id string, names []string) error { + if container, ok := r.byname[id]; ok { + id = container.ID + } else if container, ok := r.bylayer[id]; ok { + id = container.ID + } + if container, ok := r.byid[id]; ok { + for _, name := range container.Names { + delete(r.byname, name) + } + for _, name := range names { + if otherContainer, ok := r.byname[name]; ok { + r.removeName(otherContainer, name) + } + r.byname[name] = container + } + container.Names = names + return r.Save() + } + return ErrContainerUnknown +} + +func (r *containerStore) Delete(id string) error { + if container, ok := r.byname[id]; ok { + id = container.ID + } else if container, ok := r.bylayer[id]; ok { + id = container.ID + } + if _, ok := r.byid[id]; !ok { + return ErrContainerUnknown + } + if container, ok := r.byid[id]; ok { + newContainers := []Container{} + for _, candidate := range r.containers { + if candidate.ID != id { + newContainers = append(newContainers, candidate) + } + } + for _, name := range container.Names { + delete(r.byname, name) + } + r.containers = newContainers + if err := r.Save(); err != nil { + return err + } + if err := os.RemoveAll(r.datadir(id)); err != nil { + return err + } + } + return nil +} + +func (r *containerStore) Get(id string) (*Container, error) { + if c, ok := r.byname[id]; ok { + return c, nil + } else if c, ok := r.bylayer[id]; ok { + return c, nil + } + if c, ok := r.byid[id]; ok { + return c, nil + } + return nil, ErrContainerUnknown +} + +func (r *containerStore) Lookup(name string) (id string, err error) { + container, ok := r.byname[name] + if !ok { + return "", ErrContainerUnknown + } + return container.ID, nil +} + +func (r *containerStore) Exists(id string) bool { + if _, ok := r.byname[id]; ok { + return true + } + if _, ok := r.bylayer[id]; ok { + return true + } + if _, ok := r.byid[id]; ok { + return true + } + return false +} + +func (r *containerStore) GetBigData(id, key string) ([]byte, error) { + if img, ok := r.byname[id]; ok { + id = img.ID + } + if _, ok := r.byid[id]; !ok { + return nil, ErrImageUnknown + } + return ioutil.ReadFile(r.datapath(id, key)) +} + +func (r *containerStore) GetBigDataNames(id string) ([]string, error) { + if img, ok := r.byname[id]; ok { + id = img.ID + } + if _, ok := r.byid[id]; !ok { + return nil, ErrImageUnknown + } + return r.byid[id].BigDataNames, nil +} + +func (r *containerStore) SetBigData(id, key string, data []byte) error { + if img, ok := r.byname[id]; ok { + id = img.ID + } + if _, ok := r.byid[id]; !ok { + return ErrImageUnknown + } + if err := os.MkdirAll(r.datadir(id), 0700); err != nil { + return err + } + err := ioutils.AtomicWriteFile(r.datapath(id, key), data, 0600) + if err == nil { + add := true + for _, name := range r.byid[id].BigDataNames { + if name == key { + add = false + break + } + } + if add { + r.byid[id].BigDataNames = append(r.byid[id].BigDataNames, key) + err = r.Save() + } + } + return err +} + +func (r *containerStore) Wipe() error { + ids := []string{} + for id := range r.byid { + ids = append(ids, id) + } + for _, id := range ids { + if err := r.Delete(id); err != nil { + return err + } + } + return nil +} + +func (r *containerStore) Lock() { + r.lockfile.Lock() +} + +func (r *containerStore) Unlock() { + r.lockfile.Unlock() +} + +func (r *containerStore) Touch() error { + return r.lockfile.Touch() +} + +func (r *containerStore) Modified() (bool, error) { + return r.lockfile.Modified() +} diff --git a/vendor/github.com/containers/storage/storage/images.go b/vendor/github.com/containers/storage/storage/images.go new file mode 100644 index 00000000..f27bf8e1 --- /dev/null +++ b/vendor/github.com/containers/storage/storage/images.go @@ -0,0 +1,390 @@ +package storage + +import ( + "encoding/base64" + "encoding/json" + "errors" + "io/ioutil" + "os" + "path/filepath" + + "github.com/containers/storage/pkg/ioutils" + "github.com/containers/storage/pkg/stringid" +) + +var ( + // ErrImageUnknown indicates that there was no image with the specified name or ID + ErrImageUnknown = errors.New("image not known") +) + +// An Image is a reference to a layer and an associated metadata string. +// ID is either one specified at import-time or a randomly-generated value. +// Names is an optional set of user-defined convenience values. +// TopLayer is the ID of the topmost layer of the image itself. +type Image struct { + ID string `json:"id"` + Names []string `json:"names,omitempty"` + TopLayer string `json:"layer"` + Metadata string `json:"metadata,omitempty"` + BigDataNames []string `json:"big-data-names,omitempty"` + Flags map[string]interface{} `json:"flags,omitempty"` +} + +// ImageStore provides bookkeeping for information about Images. +// +// Create creates an image that has a specified ID (or a random one) and an +// optional name, using the specified layer as its topmost (hopefully +// read-only) layer. That layer can be referenced by multiple images. +// +// GetMetadata retrieves an image's metadata. +// +// SetMetadata replaces the metadata associated with an image with the supplied +// value. +// +// SetNames replaces the list of names associated with an image with the +// supplied values. +// +// Exists checks if there is an image with the given ID or name. +// +// Get retrieves information about an image given an ID or name. +// +// Delete removes the record of the image. +// +// Wipe removes records of all images. +// +// Lookup attempts to translate a name to an ID. Most methods do this +// implicitly. +// +// Images returns a slice enumerating the known images. +type ImageStore interface { + FileBasedStore + MetadataStore + BigDataStore + FlaggableStore + Create(id string, names []string, layer, metadata string) (*Image, error) + SetNames(id string, names []string) error + Exists(id string) bool + Get(id string) (*Image, error) + Delete(id string) error + Wipe() error + Lookup(name string) (string, error) + Images() ([]Image, error) +} + +type imageStore struct { + lockfile Locker + dir string + images []Image + byid map[string]*Image + byname map[string]*Image +} + +func (r *imageStore) Images() ([]Image, error) { + return r.images, nil +} + +func (r *imageStore) imagespath() string { + return filepath.Join(r.dir, "images.json") +} + +func (r *imageStore) datadir(id string) string { + return filepath.Join(r.dir, id) +} + +func (r *imageStore) datapath(id, key string) string { + return filepath.Join(r.datadir(id), base64.StdEncoding.EncodeToString([]byte(key))) +} + +func (r *imageStore) Load() error { + rpath := r.imagespath() + data, err := ioutil.ReadFile(rpath) + if err != nil && !os.IsNotExist(err) { + return err + } + images := []Image{} + ids := make(map[string]*Image) + names := make(map[string]*Image) + if err = json.Unmarshal(data, &images); len(data) == 0 || err == nil { + for n, image := range images { + ids[image.ID] = &images[n] + for _, name := range image.Names { + names[name] = &images[n] + } + } + } + r.images = images + r.byid = ids + r.byname = names + return nil +} + +func (r *imageStore) Save() error { + rpath := r.imagespath() + jdata, err := json.Marshal(&r.images) + if err != nil { + return err + } + return ioutils.AtomicWriteFile(rpath, jdata, 0600) +} + +func newImageStore(dir string) (ImageStore, error) { + if err := os.MkdirAll(dir, 0700); err != nil { + return nil, err + } + lockfile, err := GetLockfile(filepath.Join(dir, "images.lock")) + if err != nil { + return nil, err + } + lockfile.Lock() + defer lockfile.Unlock() + istore := imageStore{ + lockfile: lockfile, + dir: dir, + images: []Image{}, + byid: make(map[string]*Image), + byname: make(map[string]*Image), + } + if err := istore.Load(); err != nil { + return nil, err + } + return &istore, nil +} + +func (r *imageStore) ClearFlag(id string, flag string) error { + if image, ok := r.byname[id]; ok { + id = image.ID + } + if _, ok := r.byid[id]; !ok { + return ErrImageUnknown + } + image := r.byid[id] + delete(image.Flags, flag) + return r.Save() +} + +func (r *imageStore) SetFlag(id string, flag string, value interface{}) error { + if image, ok := r.byname[id]; ok { + id = image.ID + } + if _, ok := r.byid[id]; !ok { + return ErrImageUnknown + } + image := r.byid[id] + image.Flags[flag] = value + return r.Save() +} + +func (r *imageStore) Create(id string, names []string, layer, metadata string) (image *Image, err error) { + if id == "" { + id = stringid.GenerateRandomID() + } + if _, idInUse := r.byid[id]; idInUse { + return nil, ErrDuplicateID + } + for _, name := range names { + if _, nameInUse := r.byname[name]; nameInUse { + return nil, ErrDuplicateName + } + } + if err == nil { + newImage := Image{ + ID: id, + Names: names, + TopLayer: layer, + Metadata: metadata, + BigDataNames: []string{}, + Flags: make(map[string]interface{}), + } + r.images = append(r.images, newImage) + image = &r.images[len(r.images)-1] + r.byid[id] = image + for _, name := range names { + r.byname[name] = image + } + err = r.Save() + } + return image, err +} + +func (r *imageStore) GetMetadata(id string) (string, error) { + if image, ok := r.byname[id]; ok { + id = image.ID + } + if image, ok := r.byid[id]; ok { + return image.Metadata, nil + } + return "", ErrImageUnknown +} + +func (r *imageStore) SetMetadata(id, metadata string) error { + if image, ok := r.byname[id]; ok { + id = image.ID + } + if image, ok := r.byid[id]; ok { + image.Metadata = metadata + return r.Save() + } + return ErrImageUnknown +} + +func (r *imageStore) removeName(image *Image, name string) { + newNames := []string{} + for _, oldName := range image.Names { + if oldName != name { + newNames = append(newNames, oldName) + } + } + image.Names = newNames +} + +func (r *imageStore) SetNames(id string, names []string) error { + if image, ok := r.byname[id]; ok { + id = image.ID + } + if image, ok := r.byid[id]; ok { + for _, name := range image.Names { + delete(r.byname, name) + } + for _, name := range names { + if otherImage, ok := r.byname[name]; ok { + r.removeName(otherImage, name) + } + r.byname[name] = image + } + image.Names = names + return r.Save() + } + return ErrImageUnknown +} + +func (r *imageStore) Delete(id string) error { + if image, ok := r.byname[id]; ok { + id = image.ID + } + if _, ok := r.byid[id]; !ok { + return ErrImageUnknown + } + if image, ok := r.byid[id]; ok { + newImages := []Image{} + for _, candidate := range r.images { + if candidate.ID != id { + newImages = append(newImages, candidate) + } + } + r.images = newImages + for _, name := range image.Names { + delete(r.byname, name) + } + if err := r.Save(); err != nil { + return err + } + if err := os.RemoveAll(r.datadir(id)); err != nil { + return err + } + } + return nil +} + +func (r *imageStore) Get(id string) (*Image, error) { + if image, ok := r.byname[id]; ok { + return image, nil + } + if image, ok := r.byid[id]; ok { + return image, nil + } + return nil, ErrImageUnknown +} + +func (r *imageStore) Lookup(name string) (id string, err error) { + image, ok := r.byname[name] + if !ok { + return "", ErrImageUnknown + } + return image.ID, nil +} + +func (r *imageStore) Exists(id string) bool { + if _, ok := r.byname[id]; ok { + return true + } + if _, ok := r.byid[id]; ok { + return true + } + return false +} + +func (r *imageStore) GetBigData(id, key string) ([]byte, error) { + if img, ok := r.byname[id]; ok { + id = img.ID + } + if _, ok := r.byid[id]; !ok { + return nil, ErrImageUnknown + } + return ioutil.ReadFile(r.datapath(id, key)) +} + +func (r *imageStore) GetBigDataNames(id string) ([]string, error) { + if img, ok := r.byname[id]; ok { + id = img.ID + } + if _, ok := r.byid[id]; !ok { + return nil, ErrImageUnknown + } + return r.byid[id].BigDataNames, nil +} + +func (r *imageStore) SetBigData(id, key string, data []byte) error { + if img, ok := r.byname[id]; ok { + id = img.ID + } + if _, ok := r.byid[id]; !ok { + return ErrImageUnknown + } + if err := os.MkdirAll(r.datadir(id), 0700); err != nil { + return err + } + err := ioutils.AtomicWriteFile(r.datapath(id, key), data, 0600) + if err == nil { + add := true + for _, name := range r.byid[id].BigDataNames { + if name == key { + add = false + break + } + } + if add { + r.byid[id].BigDataNames = append(r.byid[id].BigDataNames, key) + err = r.Save() + } + } + return err +} + +func (r *imageStore) Wipe() error { + ids := []string{} + for id := range r.byid { + ids = append(ids, id) + } + for _, id := range ids { + if err := r.Delete(id); err != nil { + return err + } + } + return nil +} + +func (r *imageStore) Lock() { + r.lockfile.Lock() +} + +func (r *imageStore) Unlock() { + r.lockfile.Unlock() +} + +func (r *imageStore) Touch() error { + return r.lockfile.Touch() +} + +func (r *imageStore) Modified() (bool, error) { + return r.lockfile.Modified() +} diff --git a/vendor/github.com/containers/storage/storage/layers.go b/vendor/github.com/containers/storage/storage/layers.go new file mode 100644 index 00000000..c1395d5a --- /dev/null +++ b/vendor/github.com/containers/storage/storage/layers.go @@ -0,0 +1,831 @@ +package storage + +import ( + "bytes" + "compress/gzip" + "encoding/json" + "errors" + "io" + "io/ioutil" + "os" + "path/filepath" + + drivers "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/ioutils" + "github.com/containers/storage/pkg/stringid" + "github.com/vbatts/tar-split/tar/asm" + "github.com/vbatts/tar-split/tar/storage" +) + +const ( + tarSplitSuffix = ".tar-split.gz" + incompleteFlag = "incomplete" + compressionFlag = "diff-compression" +) + +var ( + // ErrParentUnknown indicates that we didn't record the ID of the parent of the specified layer + ErrParentUnknown = errors.New("parent of layer not known") + // ErrLayerUnknown indicates that there was no layer with the specified name or ID + ErrLayerUnknown = errors.New("layer not known") +) + +// A Layer is a record of a copy-on-write layer that's stored by the lower +// level graph driver. +// ID is either one specified at import-time or a randomly-generated value. +// Names is an optional set of user-defined convenience values. Parent is the +// ID of a layer from which this layer inherits data. MountLabel is an SELinux +// label which should be used when attempting to mount the layer. MountPoint +// is the path where the layer is mounted, or where it was most recently +// mounted. +type Layer struct { + ID string `json:"id"` + Names []string `json:"names,omitempty"` + Parent string `json:"parent,omitempty"` + Metadata string `json:"metadata,omitempty"` + MountLabel string `json:"mountlabel,omitempty"` + MountPoint string `json:"-"` + MountCount int `json:"-"` + Flags map[string]interface{} `json:"flags,omitempty"` +} + +type layerMountPoint struct { + ID string `json:"id"` + MountPoint string `json:"path"` + MountCount int `json:"count"` +} + +// LayerStore wraps a graph driver, adding the ability to refer to layers by +// name, and keeping track of parent-child relationships, along with a list of +// all known layers. +// +// Create creates a new layer, optionally giving it a specified ID rather than +// a randomly-generated one, either inheriting data from another specified +// layer or the empty base layer. The new layer can optionally be given a name +// and have an SELinux label specified for use when mounting it. Some +// underlying drivers can accept a "size" option. At this time, drivers do not +// themselves distinguish between writeable and read-only layers. +// +// CreateWithFlags combines the functions of Create and SetFlag. +// +// Put combines the functions of CreateWithFlags and ApplyDiff. +// +// Exists checks if a layer with the specified name or ID is known. +// +// GetMetadata retrieves a layer's metadata. +// +// SetMetadata replaces the metadata associated with a layer with the supplied +// value. +// +// SetNames replaces the list of names associated with a layer with the +// supplied values. +// +// Status returns an slice of key-value pairs, suitable for human consumption, +// relaying whatever status information the driver can share. +// +// Delete deletes a layer with the specified name or ID. +// +// Wipe deletes all layers. +// +// Mount mounts a layer for use. If the specified layer is the parent of other +// layers, it should not be written to. An SELinux label to be applied to the +// mount can be specified to override the one configured for the layer. +// +// Unmount unmounts a layer when it is no longer in use. +// +// Changes returns a slice of Change structures, which contain a pathname +// (Path) and a description of what sort of change (Kind) was made by the +// layer (either ChangeModify, ChangeAdd, or ChangeDelete), relative to a +// specified layer. By default, the layer's parent is used as a reference. +// +// Diff produces a tarstream which can be applied to a layer with the contents +// of the first layer to produce a layer with the contents of the second layer. +// By default, the parent of the second layer is used as the first layer. +// +// DiffSize produces an estimate of the length of the tarstream which would be +// produced by Diff. +// +// ApplyDiff reads a tarstream which was created by a previous call to Diff and +// applies its changes to a specified layer. +// +// Lookup attempts to translate a name to an ID. Most methods do this +// implicitly. +// +// Layers returns a slice of the known layers. +type LayerStore interface { + FileBasedStore + MetadataStore + FlaggableStore + Create(id, parent string, names []string, mountLabel string, options map[string]string, writeable bool) (*Layer, error) + CreateWithFlags(id, parent string, names []string, mountLabel string, options map[string]string, writeable bool, flags map[string]interface{}) (layer *Layer, err error) + Put(id, parent string, names []string, mountLabel string, options map[string]string, writeable bool, flags map[string]interface{}, diff archive.Reader) (layer *Layer, err error) + Exists(id string) bool + Get(id string) (*Layer, error) + SetNames(id string, names []string) error + Status() ([][2]string, error) + Delete(id string) error + Wipe() error + Mount(id, mountLabel string) (string, error) + Unmount(id string) error + Changes(from, to string) ([]archive.Change, error) + Diff(from, to string) (io.ReadCloser, error) + DiffSize(from, to string) (int64, error) + ApplyDiff(to string, diff archive.Reader) (int64, error) + Lookup(name string) (string, error) + Layers() ([]Layer, error) +} + +type layerStore struct { + lockfile Locker + rundir string + driver drivers.Driver + layerdir string + layers []Layer + byid map[string]*Layer + byname map[string]*Layer + byparent map[string][]*Layer + bymount map[string]*Layer +} + +func (r *layerStore) Layers() ([]Layer, error) { + return r.layers, nil +} + +func (r *layerStore) mountspath() string { + return filepath.Join(r.rundir, "mountpoints.json") +} + +func (r *layerStore) layerspath() string { + return filepath.Join(r.layerdir, "layers.json") +} + +func (r *layerStore) Load() error { + rpath := r.layerspath() + data, err := ioutil.ReadFile(rpath) + if err != nil && !os.IsNotExist(err) { + return err + } + layers := []Layer{} + ids := make(map[string]*Layer) + names := make(map[string]*Layer) + mounts := make(map[string]*Layer) + parents := make(map[string][]*Layer) + if err = json.Unmarshal(data, &layers); len(data) == 0 || err == nil { + for n, layer := range layers { + ids[layer.ID] = &layers[n] + for _, name := range layer.Names { + names[name] = &layers[n] + } + if pslice, ok := parents[layer.Parent]; ok { + parents[layer.Parent] = append(pslice, &layers[n]) + } else { + parents[layer.Parent] = []*Layer{&layers[n]} + } + } + } + mpath := r.mountspath() + data, err = ioutil.ReadFile(mpath) + if err != nil && !os.IsNotExist(err) { + return err + } + layerMounts := []layerMountPoint{} + if err = json.Unmarshal(data, &layerMounts); len(data) == 0 || err == nil { + for _, mount := range layerMounts { + if mount.MountPoint != "" { + if layer, ok := ids[mount.ID]; ok { + mounts[mount.MountPoint] = layer + layer.MountPoint = mount.MountPoint + layer.MountCount = mount.MountCount + } + } + } + } + r.layers = layers + r.byid = ids + r.byname = names + r.byparent = parents + r.bymount = mounts + err = nil + // Last step: try to remove anything that a previous user of this + // storage area marked for deletion but didn't manage to actually + // delete. + for _, layer := range r.layers { + if cleanup, ok := layer.Flags[incompleteFlag]; ok { + if b, ok := cleanup.(bool); ok && b { + err = r.Delete(layer.ID) + if err != nil { + break + } + } + } + } + return err +} + +func (r *layerStore) Save() error { + rpath := r.layerspath() + jldata, err := json.Marshal(&r.layers) + if err != nil { + return err + } + mpath := r.mountspath() + mounts := []layerMountPoint{} + for _, layer := range r.layers { + if layer.MountPoint != "" && layer.MountCount > 0 { + mounts = append(mounts, layerMountPoint{ + ID: layer.ID, + MountPoint: layer.MountPoint, + MountCount: layer.MountCount, + }) + } + } + jmdata, err := json.Marshal(&mounts) + if err != nil { + return err + } + if err := ioutils.AtomicWriteFile(rpath, jldata, 0600); err != nil { + return err + } + return ioutils.AtomicWriteFile(mpath, jmdata, 0600) +} + +func newLayerStore(rundir string, layerdir string, driver drivers.Driver) (LayerStore, error) { + if err := os.MkdirAll(rundir, 0700); err != nil { + return nil, err + } + if err := os.MkdirAll(layerdir, 0700); err != nil { + return nil, err + } + lockfile, err := GetLockfile(filepath.Join(layerdir, "layers.lock")) + if err != nil { + return nil, err + } + lockfile.Lock() + defer lockfile.Unlock() + rlstore := layerStore{ + lockfile: lockfile, + driver: driver, + rundir: rundir, + layerdir: layerdir, + byid: make(map[string]*Layer), + bymount: make(map[string]*Layer), + byname: make(map[string]*Layer), + byparent: make(map[string][]*Layer), + } + if err := rlstore.Load(); err != nil { + return nil, err + } + return &rlstore, nil +} + +func (r *layerStore) ClearFlag(id string, flag string) error { + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + if _, ok := r.byid[id]; !ok { + return ErrLayerUnknown + } + layer := r.byid[id] + delete(layer.Flags, flag) + return r.Save() +} + +func (r *layerStore) SetFlag(id string, flag string, value interface{}) error { + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + if _, ok := r.byid[id]; !ok { + return ErrLayerUnknown + } + layer := r.byid[id] + layer.Flags[flag] = value + return r.Save() +} + +func (r *layerStore) Status() ([][2]string, error) { + return r.driver.Status(), nil +} + +func (r *layerStore) Put(id, parent string, names []string, mountLabel string, options map[string]string, writeable bool, flags map[string]interface{}, diff archive.Reader) (layer *Layer, err error) { + if parentLayer, ok := r.byname[parent]; ok { + parent = parentLayer.ID + } + if id == "" { + id = stringid.GenerateRandomID() + } + if _, idInUse := r.byid[id]; idInUse { + return nil, ErrDuplicateID + } + for _, name := range names { + if _, nameInUse := r.byname[name]; nameInUse { + return nil, ErrDuplicateName + } + } + if writeable { + err = r.driver.CreateReadWrite(id, parent, mountLabel, options) + } else { + err = r.driver.Create(id, parent, mountLabel, options) + } + if err == nil { + newLayer := Layer{ + ID: id, + Parent: parent, + Names: names, + MountLabel: mountLabel, + Flags: make(map[string]interface{}), + } + r.layers = append(r.layers, newLayer) + layer = &r.layers[len(r.layers)-1] + r.byid[id] = layer + for _, name := range names { + r.byname[name] = layer + } + if pslice, ok := r.byparent[parent]; ok { + pslice = append(pslice, layer) + r.byparent[parent] = pslice + } else { + r.byparent[parent] = []*Layer{layer} + } + for flag, value := range flags { + layer.Flags[flag] = value + } + if diff != nil { + layer.Flags[incompleteFlag] = true + } + err = r.Save() + if err != nil { + // We don't have a record of this layer, but at least + // try to clean it up underneath us. + r.driver.Remove(id) + return nil, err + } + _, err = r.ApplyDiff(layer.ID, diff) + if err != nil { + if r.Delete(layer.ID) != nil { + // Either a driver error or an error saving. + // We now have a layer that's been marked for + // deletion but which we failed to remove. + } + return nil, err + } + delete(layer.Flags, incompleteFlag) + err = r.Save() + if err != nil { + // We don't have a record of this layer, but at least + // try to clean it up underneath us. + r.driver.Remove(id) + return nil, err + } + } + return layer, err +} + +func (r *layerStore) CreateWithFlags(id, parent string, names []string, mountLabel string, options map[string]string, writeable bool, flags map[string]interface{}) (layer *Layer, err error) { + return r.Put(id, parent, names, mountLabel, options, writeable, flags, nil) +} + +func (r *layerStore) Create(id, parent string, names []string, mountLabel string, options map[string]string, writeable bool) (layer *Layer, err error) { + return r.CreateWithFlags(id, parent, names, mountLabel, options, writeable, nil) +} + +func (r *layerStore) Mount(id, mountLabel string) (string, error) { + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + if _, ok := r.byid[id]; !ok { + return "", ErrLayerUnknown + } + layer := r.byid[id] + if layer.MountCount > 0 { + layer.MountCount++ + return layer.MountPoint, r.Save() + } + if mountLabel == "" { + if layer, ok := r.byid[id]; ok { + mountLabel = layer.MountLabel + } + } + mountpoint, err := r.driver.Get(id, mountLabel) + if mountpoint != "" && err == nil { + if layer, ok := r.byid[id]; ok { + if layer.MountPoint != "" { + delete(r.bymount, layer.MountPoint) + } + layer.MountPoint = filepath.Clean(mountpoint) + layer.MountCount++ + r.bymount[layer.MountPoint] = layer + err = r.Save() + } + } + return mountpoint, err +} + +func (r *layerStore) Unmount(id string) error { + if layer, ok := r.bymount[filepath.Clean(id)]; ok { + id = layer.ID + } + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + if _, ok := r.byid[id]; !ok { + return ErrLayerUnknown + } + layer := r.byid[id] + if layer.MountCount > 1 { + layer.MountCount-- + return r.Save() + } + err := r.driver.Put(id) + if err == nil || os.IsNotExist(err) { + if layer.MountPoint != "" { + delete(r.bymount, layer.MountPoint) + } + layer.MountCount-- + layer.MountPoint = "" + err = r.Save() + } + return err +} + +func (r *layerStore) removeName(layer *Layer, name string) { + newNames := []string{} + for _, oldName := range layer.Names { + if oldName != name { + newNames = append(newNames, oldName) + } + } + layer.Names = newNames +} + +func (r *layerStore) SetNames(id string, names []string) error { + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + if layer, ok := r.byid[id]; ok { + for _, name := range layer.Names { + delete(r.byname, name) + } + for _, name := range names { + if otherLayer, ok := r.byname[name]; ok { + r.removeName(otherLayer, name) + } + r.byname[name] = layer + } + layer.Names = names + return r.Save() + } + return ErrLayerUnknown +} + +func (r *layerStore) GetMetadata(id string) (string, error) { + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + if layer, ok := r.byid[id]; ok { + return layer.Metadata, nil + } + return "", ErrLayerUnknown +} + +func (r *layerStore) SetMetadata(id, metadata string) error { + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + if layer, ok := r.byid[id]; ok { + layer.Metadata = metadata + return r.Save() + } + return ErrLayerUnknown +} + +func (r *layerStore) tspath(id string) string { + return filepath.Join(r.layerdir, id+tarSplitSuffix) +} + +func (r *layerStore) Delete(id string) error { + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + if _, ok := r.byid[id]; !ok { + return ErrLayerUnknown + } + for r.byid[id].MountCount > 0 { + if err := r.Unmount(id); err != nil { + return err + } + } + err := r.driver.Remove(id) + if err == nil { + os.Remove(r.tspath(id)) + if layer, ok := r.byid[id]; ok { + pslice := r.byparent[layer.Parent] + newPslice := []*Layer{} + for _, candidate := range pslice { + if candidate.ID != id { + newPslice = append(newPslice, candidate) + } + } + if len(newPslice) > 0 { + r.byparent[layer.Parent] = newPslice + } else { + delete(r.byparent, layer.Parent) + } + for _, name := range layer.Names { + delete(r.byname, name) + } + if layer.MountPoint != "" { + delete(r.bymount, layer.MountPoint) + } + delete(r.byid, layer.ID) + newLayers := []Layer{} + for _, candidate := range r.layers { + if candidate.ID != id { + newLayers = append(newLayers, candidate) + } + } + r.layers = newLayers + if err = r.Save(); err != nil { + return err + } + } + } + return err +} + +func (r *layerStore) Lookup(name string) (id string, err error) { + layer, ok := r.byname[name] + if !ok { + return "", ErrLayerUnknown + } + return layer.ID, nil +} + +func (r *layerStore) Exists(id string) bool { + if layer, ok := r.byname[id]; ok { + id = layer.ID + } + return r.driver.Exists(id) +} + +func (r *layerStore) Get(id string) (*Layer, error) { + if l, ok := r.byname[id]; ok { + return l, nil + } + if l, ok := r.byid[id]; ok { + return l, nil + } + return nil, ErrLayerUnknown +} + +func (r *layerStore) Wipe() error { + ids := []string{} + for id := range r.byid { + ids = append(ids, id) + } + for _, id := range ids { + if err := r.Delete(id); err != nil { + return err + } + } + return nil +} + +func (r *layerStore) Changes(from, to string) ([]archive.Change, error) { + if layer, ok := r.byname[from]; ok { + from = layer.ID + } + if layer, ok := r.byname[to]; ok { + to = layer.ID + } + if from == "" { + if layer, ok := r.byid[to]; ok { + from = layer.Parent + } + } + if to == "" { + return nil, ErrLayerUnknown + } + if _, ok := r.byid[to]; !ok { + return nil, ErrLayerUnknown + } + return r.driver.Changes(to, from) +} + +type simpleGetCloser struct { + r *layerStore + path string + id string +} + +func (s *simpleGetCloser) Get(path string) (io.ReadCloser, error) { + return os.Open(filepath.Join(s.path, path)) +} + +func (s *simpleGetCloser) Close() error { + return s.r.Unmount(s.id) +} + +func (r *layerStore) newFileGetter(id string) (drivers.FileGetCloser, error) { + if getter, ok := r.driver.(drivers.DiffGetterDriver); ok { + return getter.DiffGetter(id) + } + path, err := r.Mount(id, "") + if err != nil { + return nil, err + } + return &simpleGetCloser{ + r: r, + path: path, + id: id, + }, nil +} + +func (r *layerStore) Diff(from, to string) (io.ReadCloser, error) { + var metadata storage.Unpacker + + if layer, ok := r.byname[from]; ok { + from = layer.ID + } + if layer, ok := r.byname[to]; ok { + to = layer.ID + } + if from == "" { + if layer, ok := r.byid[to]; ok { + from = layer.Parent + } + } + if to == "" { + return nil, ErrParentUnknown + } + if _, ok := r.byid[to]; !ok { + return nil, ErrLayerUnknown + } + compression := archive.Uncompressed + if cflag, ok := r.byid[to].Flags[compressionFlag]; ok { + if ctype, ok := cflag.(float64); ok { + compression = archive.Compression(ctype) + } + } + if from != r.byid[to].Parent { + diff, err := r.driver.Diff(to, from) + if err == nil && (compression != archive.Uncompressed) { + preader, pwriter := io.Pipe() + compressor, err := archive.CompressStream(pwriter, compression) + if err != nil { + diff.Close() + pwriter.Close() + return nil, err + } + go func() { + io.Copy(compressor, diff) + diff.Close() + compressor.Close() + pwriter.Close() + }() + diff = preader + } + return diff, err + } + + tsfile, err := os.Open(r.tspath(to)) + if err != nil { + if os.IsNotExist(err) { + return r.driver.Diff(to, from) + } + return nil, err + } + defer tsfile.Close() + + decompressor, err := gzip.NewReader(tsfile) + if err != nil { + return nil, err + } + defer decompressor.Close() + + tsbytes, err := ioutil.ReadAll(decompressor) + if err != nil { + return nil, err + } + + metadata = storage.NewJSONUnpacker(bytes.NewBuffer(tsbytes)) + + if fgetter, err := r.newFileGetter(to); err != nil { + return nil, err + } else { + var stream io.ReadCloser + if compression != archive.Uncompressed { + preader, pwriter := io.Pipe() + compressor, err := archive.CompressStream(pwriter, compression) + if err != nil { + fgetter.Close() + pwriter.Close() + preader.Close() + return nil, err + } + go func() { + asm.WriteOutputTarStream(fgetter, metadata, compressor) + compressor.Close() + pwriter.Close() + }() + stream = preader + } else { + stream = asm.NewOutputTarStream(fgetter, metadata) + } + return ioutils.NewReadCloserWrapper(stream, func() error { + err1 := stream.Close() + err2 := fgetter.Close() + if err2 == nil { + return err1 + } + return err2 + }), nil + } +} + +func (r *layerStore) DiffSize(from, to string) (size int64, err error) { + if layer, ok := r.byname[from]; ok { + from = layer.ID + } + if layer, ok := r.byname[to]; ok { + to = layer.ID + } + if from == "" { + if layer, ok := r.byid[to]; ok { + from = layer.Parent + } + } + if to == "" { + return -1, ErrParentUnknown + } + if _, ok := r.byid[to]; !ok { + return -1, ErrLayerUnknown + } + return r.driver.DiffSize(to, from) +} + +func (r *layerStore) ApplyDiff(to string, diff archive.Reader) (size int64, err error) { + if layer, ok := r.byname[to]; ok { + to = layer.ID + } + layer, ok := r.byid[to] + if !ok { + return -1, ErrLayerUnknown + } + + header := make([]byte, 10240) + n, err := diff.Read(header) + if err != nil && err != io.EOF { + return -1, err + } + + compression := archive.DetectCompression(header[:n]) + defragmented := io.MultiReader(bytes.NewBuffer(header[:n]), diff) + + tsdata := bytes.Buffer{} + compressor, err := gzip.NewWriterLevel(&tsdata, gzip.BestSpeed) + if err != nil { + compressor = gzip.NewWriter(&tsdata) + } + metadata := storage.NewJSONPacker(compressor) + if c, err := archive.DecompressStream(defragmented); err != nil { + return -1, err + } else { + defragmented = c + } + payload, err := asm.NewInputTarStream(defragmented, metadata, storage.NewDiscardFilePutter()) + if err != nil { + return -1, err + } + size, err = r.driver.ApplyDiff(layer.ID, layer.Parent, payload) + compressor.Close() + if err == nil { + if err := ioutils.AtomicWriteFile(r.tspath(layer.ID), tsdata.Bytes(), 0600); err != nil { + return -1, err + } + } + + if compression != archive.Uncompressed { + layer.Flags[compressionFlag] = compression + } else { + delete(layer.Flags, compressionFlag) + } + + return size, err +} + +func (r *layerStore) Lock() { + r.lockfile.Lock() +} + +func (r *layerStore) Unlock() { + r.lockfile.Unlock() +} + +func (r *layerStore) Touch() error { + return r.lockfile.Touch() +} + +func (r *layerStore) Modified() (bool, error) { + return r.lockfile.Modified() +} diff --git a/vendor/github.com/containers/storage/storage/lockfile.go b/vendor/github.com/containers/storage/storage/lockfile.go new file mode 100644 index 00000000..77283110 --- /dev/null +++ b/vendor/github.com/containers/storage/storage/lockfile.go @@ -0,0 +1,100 @@ +package storage + +import ( + "os" + "sync" + "syscall" + "time" + + "github.com/containers/storage/pkg/stringid" +) + +// A Locker represents a file lock where the file is used to cache an +// identifier of the last party that made changes to whatever's being protected +// by the lock. +// +// Touch() records, for others sharing the lock, that it was updated by the +// caller. It should only be called with the lock held. +// +// Modified() checks if the most recent writer was a party other than the +// caller. It should only be called with the lock held. +type Locker interface { + sync.Locker + Touch() error + Modified() (bool, error) +} + +type lockfile struct { + file string + fd uintptr + me string +} + +// GetLockfile opens a lock file, creating it if necessary. The Locker object +// return will be returned unlocked. +func GetLockfile(path string) (Locker, error) { + fd, err := syscall.Open(path, os.O_RDWR|os.O_CREATE, syscall.S_IRUSR|syscall.S_IWUSR) + if err != nil { + return nil, err + } + return &lockfile{file: path, fd: uintptr(fd)}, nil +} + +func (l *lockfile) Lock() { + lk := syscall.Flock_t{ + Type: syscall.F_WRLCK, + Whence: int16(os.SEEK_SET), + Start: 0, + Len: 0, + Pid: int32(os.Getpid()), + } + for syscall.FcntlFlock(l.fd, syscall.F_SETLKW, &lk) != nil { + time.Sleep(10 * time.Millisecond) + } +} + +func (l *lockfile) Unlock() { + lk := syscall.Flock_t{ + Type: syscall.F_UNLCK, + Whence: int16(os.SEEK_SET), + Start: 0, + Len: 0, + Pid: int32(os.Getpid()), + } + for syscall.FcntlFlock(l.fd, syscall.F_SETLKW, &lk) != nil { + time.Sleep(10 * time.Millisecond) + } +} + +func (l *lockfile) Touch() error { + l.me = stringid.GenerateRandomID() + id := []byte(l.me) + _, err := syscall.Seek(int(l.fd), 0, os.SEEK_SET) + if err != nil { + return err + } + n, err := syscall.Write(int(l.fd), id) + if err != nil { + return err + } + if n != len(id) { + return syscall.ENOSPC + } + return nil +} + +func (l *lockfile) Modified() (bool, error) { + id := []byte(l.me) + _, err := syscall.Seek(int(l.fd), 0, os.SEEK_SET) + if err != nil { + return true, err + } + n, err := syscall.Read(int(l.fd), id) + if err != nil { + return true, err + } + if n != len(id) { + return true, syscall.ENOSPC + } + return string(id) != l.me, nil +} diff --git a/vendor/github.com/containers/storage/storage/store.go b/vendor/github.com/containers/storage/storage/store.go new file mode 100644 index 00000000..df0c0ce9 --- /dev/null +++ b/vendor/github.com/containers/storage/storage/store.go @@ -0,0 +1,1888 @@ +package storage + +import ( + "errors" + "io" + "os" + "path/filepath" + "strings" + "sync" + + // register all of the built-in drivers + _ "github.com/containers/storage/drivers/register" + + drivers "github.com/containers/storage/drivers" + "github.com/containers/storage/pkg/archive" + "github.com/containers/storage/pkg/idtools" + "github.com/containers/storage/pkg/stringid" + "github.com/containers/storage/storageversion" +) + +var ( + ErrLoadError = errors.New("error loading storage metadata") + ErrDuplicateID = errors.New("that ID is already in use") + ErrDuplicateName = errors.New("that name is already in use") + ErrParentIsContainer = errors.New("would-be parent layer is a container") + ErrNotAContainer = errors.New("identifier is not a container") + ErrNotAnImage = errors.New("identifier is not an image") + ErrNotALayer = errors.New("identifier is not a layer") + ErrNotAnID = errors.New("identifier is not a layer, image, or container") + ErrLayerHasChildren = errors.New("layer has children") + ErrLayerUsedByImage = errors.New("layer is in use by an image") + ErrLayerUsedByContainer = errors.New("layer is in use by a container") + ErrImageUsedByContainer = errors.New("image is in use by a container") +) + +// FileBasedStore wraps up the most common methods of the various types of file-based +// data stores that we implement. +// +// Load() reloads the contents of the store from disk. It should be called +// with the lock held. +// +// Save() saves the contents of the store to disk. It should be called with +// the lock held, and Touch() should be called afterward before releasing the +// lock. +type FileBasedStore interface { + Locker + Load() error + Save() error +} + +// MetadataStore wraps up methods for getting and setting metadata associated with IDs. +// +// GetMetadata() reads metadata associated with an item with the specified ID. +// +// SetMetadata() updates the metadata associated with the item with the specified ID. +type MetadataStore interface { + GetMetadata(id string) (string, error) + SetMetadata(id, metadata string) error +} + +// A BigDataStore wraps up the most common methods of the various types of +// file-based lookaside stores that we implement. +// +// SetBigData stores a (potentially large) piece of data associated with this +// ID. +// +// GetBigData retrieves a (potentially large) piece of data associated with +// this ID, if it has previously been set. +// +// GetBigDataNames() returns a list of the names of previously-stored pieces of +// data. +type BigDataStore interface { + SetBigData(id, key string, data []byte) error + GetBigData(id, key string) ([]byte, error) + GetBigDataNames(id string) ([]string, error) +} + +// A FlaggableStore can have flags set and cleared on items which it manages. +// +// ClearFlag removes a named flag from an item in the store. +// +// SetFlag sets a named flag and its value on an item in the store. +type FlaggableStore interface { + ClearFlag(id string, flag string) error + SetFlag(id string, flag string, value interface{}) error +} + +// Store wraps up the various types of file-based stores that we use into a +// singleton object that initializes and manages them all together. +// +// GetRunRoot, GetGraphRoot, GetGraphDriverName, and GetGraphOptions retrieve +// settings that were passed to MakeStore() when the object was created. +// +// GetGraphDriver obtains and returns a handle to the graph Driver object used +// by the Store. +// +// GetLayerStore obtains and returns a handle to the layer store object used by +// the Store. +// +// GetImageStore obtains and returns a handle to the image store object used by +// the Store. +// +// GetContainerStore obtains and returns a handle to the container store object +// used by the Store. +// +// CreateLayer creates a new layer in the underlying storage driver, optionally +// having the specified ID (one will be assigned if none is specified), with +// the specified layer (or no layer) as its parent, and with an optional name. +// (The writeable flag is ignored.) +// +// PutLayer combines the functions of CreateLayer and ApplyDiff, marking the +// layer for automatic removal if applying the diff fails for any reason. +// +// CreateImage creates a new image, optionally with the specified ID (one will +// be assigned if none is specified), with an optional name, and referring to a +// specified image and with optional metadata. An image is a record which +// associates the ID of a layer with a caller-supplied metadata string which +// the library stores for the convenience of the caller. +// +// CreateContainer creates a new container, optionally with the specified ID +// (one will be assigned if none is specified), with an optional name, using +// the specified image's top layer as the basis for the container's layer, and +// assigning the specified ID to that layer (one will be created if none is +// specified). A container is a layer which is associated with a metadata +// string which the library stores for the convenience of the caller. +// +// GetMetadata retrieves the metadata which is associated with a layer, image, +// or container (whichever the passed-in ID refers to). +// +// SetMetadata updates the metadata which is associated with a layer, image, or +// container (whichever the passed-in ID refers to) to match the specified +// value. The metadata value can be retrieved at any time using GetMetadata, +// or using GetLayer, GetImage, or GetContainer and reading the object directly. +// +// Exists checks if there is a layer, image, or container which has the +// passed-in ID or name. +// +// Status asks for a status report, in the form of key-value pairs, from the +// underlying storage driver. The contents vary from driver to driver. +// +// Delete removes the layer, image, or container which has the passed-in ID or +// name. Note that no safety checks are performed, so this can leave images +// with references to layers which do not exist, and layers with references to +// parents which no longer exist. +// +// DeleteLayer attempts to remove the specified layer. If the layer is the +// parent of any other layer, or is referred to by any images, it will return +// an error. +// +// DeleteImage removes the specified image if it is not referred to by any +// containers. If its top layer is then no longer referred to by any other +// images or the parent of any other layers, its top layer will be removed. If +// that layer's parent is no longer referred to by any other images or the +// parent of any other layers, then it, too, will be removed. This procedure +// will be repeated until a layer which should not be removed, or the base +// layer, is reached, at which point the list of removed layers is returned. +// If the commit argument is false, the image and layers are not removed, but +// the list of layers which would be removed is still returned. +// +// DeleteContainer removes the specified container and its layer. If there is +// no matching container, or if the container exists but its layer does not, an +// error will be returned. +// +// Wipe removes all known layers, images, and containers. +// +// Mount attempts to mount a layer, image, or container for access, and returns +// the pathname if it succeeds. +// +// Unmount attempts to unmount a layer, image, or container, given an ID, a +// name, or a mount path. +// +// Changes returns a summary of the changes which would need to be made to one +// layer to make its contents the same as a second layer. If the first layer +// is not specified, the second layer's parent is assumed. Each Change +// structure contains a Path relative to the layer's root directory, and a Kind +// which is either ChangeAdd, ChangeModify, or ChangeDelete. +// +// DiffSize returns a count of the size of the tarstream which would specify +// the changes returned by Changes. +// +// Diff returns the tarstream which would specify the changes returned by +// Changes. +// +// ApplyDiff applies a tarstream to a layer. Information about the tarstream +// is cached with the layer. Typically, a layer which is populated using a +// tarstream will be expected to not be modified in any other way, either +// before or after the diff is applied. +// +// Layers returns a list of the currently known layers. +// +// Images returns a list of the currently known images. +// +// Containers returns a list of the currently known containers. +// +// GetNames returns the list of names for a layer, image, or container. +// +// SetNames changes the list of names for a layer, image, or container. +// +// ListImageBigData retrieves a list of the (possibly large) chunks of named +// data associated with an image. +// +// GetImageBigData retrieves a (possibly large) chunk of named data associated +// with an image. +// +// SetImageBigData stores a (possibly large) chunk of named data associated +// with an image. +// +// ListContainerBigData retrieves a list of the (possibly large) chunks of +// named data associated with a container. +// +// GetContainerBigData retrieves a (possibly large) chunk of named data +// associated with an image. +// +// SetContainerBigData stores a (possibly large) chunk of named data associated +// with an image. +// +// GetLayer returns a specific layer. +// +// GetImage returns a specific image. +// +// GetImagesByTopLayer returns a list of images which reference the specified +// layer as their top layer. They will have different names and may have +// different metadata. +// +// GetContainer returns a specific container. +// +// GetContainerByLayer returns a specific container based on its layer ID or +// name. +// +// Lookup returns the ID of a layer, image, or container with the specified +// name. +// +// Crawl enumerates all of the layers, images, and containers which depend on +// or refer to, either directly or indirectly, the specified layer, top layer +// of an image, or container layer. +// +// Version returns version information, in the form of key-value pairs, from +// the storage package. +type Store interface { + GetRunRoot() string + GetGraphRoot() string + GetGraphDriverName() string + GetGraphOptions() []string + GetGraphDriver() (drivers.Driver, error) + GetLayerStore() (LayerStore, error) + GetImageStore() (ImageStore, error) + GetContainerStore() (ContainerStore, error) + + CreateLayer(id, parent string, names []string, mountLabel string, writeable bool) (*Layer, error) + PutLayer(id, parent string, names []string, mountLabel string, writeable bool, diff archive.Reader) (*Layer, error) + CreateImage(id string, names []string, layer, metadata string) (*Image, error) + CreateContainer(id string, names []string, image, layer, metadata string) (*Container, error) + GetMetadata(id string) (string, error) + SetMetadata(id, metadata string) error + Exists(id string) bool + Status() ([][2]string, error) + Delete(id string) error + DeleteLayer(id string) error + DeleteImage(id string, commit bool) (layers []string, err error) + DeleteContainer(id string) error + Wipe() error + Mount(id, mountLabel string) (string, error) + Unmount(id string) error + Changes(from, to string) ([]archive.Change, error) + DiffSize(from, to string) (int64, error) + Diff(from, to string) (io.ReadCloser, error) + ApplyDiff(to string, diff archive.Reader) (int64, error) + Layers() ([]Layer, error) + Images() ([]Image, error) + Containers() ([]Container, error) + GetNames(id string) ([]string, error) + SetNames(id string, names []string) error + ListImageBigData(id string) ([]string, error) + GetImageBigData(id, key string) ([]byte, error) + SetImageBigData(id, key string, data []byte) error + ListContainerBigData(id string) ([]string, error) + GetContainerBigData(id, key string) ([]byte, error) + SetContainerBigData(id, key string, data []byte) error + GetLayer(id string) (*Layer, error) + GetImage(id string) (*Image, error) + GetImagesByTopLayer(id string) ([]*Image, error) + GetContainer(id string) (*Container, error) + GetContainerByLayer(id string) (*Container, error) + Lookup(name string) (string, error) + Crawl(layerID string) (*Users, error) + Version() ([][2]string, error) +} + +// Mall is just an old name for Store. This will be dropped at some point. +type Mall interface { + Store +} + +// Users holds an analysis of which layers, images, and containers depend on a +// given layer, either directly or indirectly. +type Users struct { + ID string `json:"id"` + LayerID string `json:"layer"` + LayersDirect []string `json:"directlayers,omitempty"` + LayersIndirect []string `json:"indirectlayers,omitempty"` + ImagesDirect []string `json:"directimages,omitempty"` + ImagesIndirect []string `json:"indirectimages,omitempty"` + ContainersDirect []string `json:"directcontainers,omitempty"` + ContainersIndirect []string `json:"indirectcontainers,omitempty"` +} + +type store struct { + runRoot string + graphLock sync.Locker + graphRoot string + graphDriverName string + graphOptions []string + uidMap []idtools.IDMap + gidMap []idtools.IDMap + graphDriver drivers.Driver + layerStore LayerStore + imageStore ImageStore + containerStore ContainerStore +} + +// MakeStore creates and initializes a new Store object, and the underlying +// storage that it controls. +func MakeStore(runRoot, graphRoot, graphDriverName string, graphOptions []string, uidMap, gidMap []idtools.IDMap) (Mall, error) { + if runRoot == "" && graphRoot == "" && graphDriverName == "" && len(graphOptions) == 0 { + runRoot = "/var/run/oci-storage" + graphRoot = "/var/lib/oci-storage" + graphDriverName = os.Getenv("STORAGE_DRIVER") + graphOptions = strings.Split(os.Getenv("STORAGE_OPTS"), ",") + if len(graphOptions) == 1 && graphOptions[0] == "" { + graphOptions = nil + } + } + if err := os.MkdirAll(runRoot, 0700); err != nil && !os.IsExist(err) { + return nil, err + } + for _, subdir := range []string{} { + if err := os.MkdirAll(filepath.Join(runRoot, subdir), 0700); err != nil && !os.IsExist(err) { + return nil, err + } + } + if err := os.MkdirAll(graphRoot, 0700); err != nil && !os.IsExist(err) { + return nil, err + } + for _, subdir := range []string{"mounts", "tmp", graphDriverName} { + if err := os.MkdirAll(filepath.Join(graphRoot, subdir), 0700); err != nil && !os.IsExist(err) { + return nil, err + } + } + graphLock, err := GetLockfile(filepath.Join(graphRoot, "storage.lock")) + if err != nil { + return nil, err + } + s := &store{ + runRoot: runRoot, + graphLock: graphLock, + graphRoot: graphRoot, + graphDriverName: graphDriverName, + graphOptions: graphOptions, + uidMap: copyIDMap(uidMap), + gidMap: copyIDMap(gidMap), + } + if err := s.load(); err != nil { + return nil, err + } + return s, nil +} + +func copyIDMap(idmap []idtools.IDMap) []idtools.IDMap { + m := []idtools.IDMap{} + if idmap != nil { + m = make([]idtools.IDMap, len(idmap)) + copy(m, idmap) + } + if len(m) > 0 { + return m[:] + } + return nil +} + +func (s *store) GetRunRoot() string { + return s.runRoot +} + +func (s *store) GetGraphDriverName() string { + return s.graphDriverName +} + +func (s *store) GetGraphRoot() string { + return s.graphRoot +} + +func (s *store) GetGraphOptions() []string { + return s.graphOptions +} + +func (s *store) load() error { + driver, err := drivers.New(s.graphRoot, s.graphDriverName, s.graphOptions, s.uidMap, s.gidMap) + if err != nil { + return err + } + driverPrefix := driver.String() + "-" + + rrpath := filepath.Join(s.runRoot, driverPrefix+"layers") + if err := os.MkdirAll(rrpath, 0700); err != nil { + return err + } + rlpath := filepath.Join(s.graphRoot, driverPrefix+"layers") + if err := os.MkdirAll(rlpath, 0700); err != nil { + return err + } + rls, err := newLayerStore(rrpath, rlpath, driver) + if err != nil { + return err + } + s.layerStore = rls + ripath := filepath.Join(s.graphRoot, driverPrefix+"images") + if err := os.MkdirAll(ripath, 0700); err != nil { + return err + } + ris, err := newImageStore(ripath) + if err != nil { + return err + } + s.imageStore = ris + rcpath := filepath.Join(s.graphRoot, driverPrefix+"containers") + if err := os.MkdirAll(rcpath, 0700); err != nil { + return err + } + rcs, err := newContainerStore(rcpath) + if err != nil { + return err + } + s.containerStore = rcs + return nil +} + +func (s *store) GetGraphDriver() (drivers.Driver, error) { + if s.graphDriver != nil { + return s.graphDriver, nil + } + return nil, ErrLoadError +} + +func (s *store) GetLayerStore() (LayerStore, error) { + if s.layerStore != nil { + return s.layerStore, nil + } + return nil, ErrLoadError +} + +func (s *store) GetImageStore() (ImageStore, error) { + if s.imageStore != nil { + return s.imageStore, nil + } + return nil, ErrLoadError +} + +func (s *store) GetContainerStore() (ContainerStore, error) { + if s.containerStore != nil { + return s.containerStore, nil + } + return nil, ErrLoadError +} + +func (s *store) PutLayer(id, parent string, names []string, mountLabel string, writeable bool, diff archive.Reader) (*Layer, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + defer rlstore.Touch() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + defer ristore.Touch() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + defer rcstore.Touch() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + if id == "" { + id = stringid.GenerateRandomID() + } + if parent != "" { + if l, err := rlstore.Get(parent); err == nil && l != nil { + parent = l.ID + } else { + return nil, ErrLayerUnknown + } + containers, err := rcstore.Containers() + if err != nil { + return nil, err + } + for _, container := range containers { + if container.LayerID == parent { + return nil, ErrParentIsContainer + } + } + } + return rlstore.Put(id, parent, names, mountLabel, nil, writeable, nil, diff) +} + +func (s *store) CreateLayer(id, parent string, names []string, mountLabel string, writeable bool) (*Layer, error) { + return s.PutLayer(id, parent, names, mountLabel, writeable, nil) +} + +func (s *store) CreateImage(id string, names []string, layer, metadata string) (*Image, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + defer ristore.Touch() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + defer rcstore.Touch() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + if id == "" { + id = stringid.GenerateRandomID() + } + + ilayer, err := rlstore.Get(layer) + if err != nil { + return nil, err + } + if ilayer == nil { + return nil, ErrLayerUnknown + } + layer = ilayer.ID + return ristore.Create(id, names, layer, metadata) +} + +func (s *store) CreateContainer(id string, names []string, image, layer, metadata string) (*Container, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + defer rlstore.Touch() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + defer rcstore.Touch() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if id == "" { + id = stringid.GenerateRandomID() + } + + cimage, err := ristore.Get(image) + if err != nil { + return nil, err + } + if cimage == nil { + return nil, ErrImageUnknown + } + clayer, err := rlstore.Create(layer, cimage.TopLayer, nil, "", nil, true) + if err != nil { + return nil, err + } + layer = clayer.ID + container, err := rcstore.Create(id, names, cimage.ID, layer, metadata) + if err != nil || container == nil { + rlstore.Delete(layer) + } + return container, err +} + +func (s *store) SetMetadata(id, metadata string) error { + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + ristore, err := s.GetImageStore() + if err != nil { + return err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if rcstore.Exists(id) { + defer rcstore.Touch() + return rcstore.SetMetadata(id, metadata) + } + if ristore.Exists(id) { + defer ristore.Touch() + return ristore.SetMetadata(id, metadata) + } + if rlstore.Exists(id) { + defer rlstore.Touch() + return rlstore.SetMetadata(id, metadata) + } + return ErrNotAnID +} + +func (s *store) GetMetadata(id string) (string, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return "", err + } + ristore, err := s.GetImageStore() + if err != nil { + return "", err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return "", err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if rcstore.Exists(id) { + return rcstore.GetMetadata(id) + } + if ristore.Exists(id) { + return ristore.GetMetadata(id) + } + if rlstore.Exists(id) { + return rlstore.GetMetadata(id) + } + return "", ErrNotAnID +} + +func (s *store) ListImageBigData(id string) ([]string, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + + return ristore.GetBigDataNames(id) +} + +func (s *store) GetImageBigData(id, key string) ([]byte, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + + return ristore.GetBigData(id, key) +} + +func (s *store) SetImageBigData(id, key string, data []byte) error { + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + ristore, err := s.GetImageStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + + return ristore.SetBigData(id, key, data) +} + +func (s *store) ListContainerBigData(id string) ([]string, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + return rcstore.GetBigDataNames(id) +} + +func (s *store) GetContainerBigData(id, key string) ([]byte, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + return rcstore.GetBigData(id, key) +} + +func (s *store) SetContainerBigData(id, key string, data []byte) error { + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + ristore, err := s.GetImageStore() + if err != nil { + return err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + return rcstore.SetBigData(id, key, data) +} + +func (s *store) Exists(id string) bool { + rcstore, err := s.GetContainerStore() + if err != nil { + return false + } + ristore, err := s.GetImageStore() + if err != nil { + return false + } + rlstore, err := s.GetLayerStore() + if err != nil { + return false + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if rcstore.Exists(id) { + return true + } + if ristore.Exists(id) { + return true + } + return rlstore.Exists(id) +} + +func (s *store) SetNames(id string, names []string) error { + rcstore, err := s.GetContainerStore() + if err != nil { + return err + } + ristore, err := s.GetImageStore() + if err != nil { + return err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + deduped := []string{} + seen := make(map[string]bool) + for _, name := range names { + if _, wasSeen := seen[name]; !wasSeen { + seen[name] = true + deduped = append(deduped, name) + } + } + + if rcstore.Exists(id) { + return rcstore.SetNames(id, deduped) + } + if ristore.Exists(id) { + return ristore.SetNames(id, deduped) + } + if rlstore.Exists(id) { + return rlstore.SetNames(id, deduped) + } + return ErrLayerUnknown +} + +func (s *store) GetNames(id string) ([]string, error) { + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if c, err := rcstore.Get(id); c != nil && err == nil { + return c.Names, nil + } + if i, err := ristore.Get(id); i != nil && err == nil { + return i.Names, nil + } + if l, err := rlstore.Get(id); l != nil && err == nil { + return l.Names, nil + } + return nil, ErrLayerUnknown +} + +func (s *store) Lookup(name string) (string, error) { + rcstore, err := s.GetContainerStore() + if err != nil { + return "", err + } + ristore, err := s.GetImageStore() + if err != nil { + return "", err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return "", err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if c, err := rcstore.Get(name); c != nil && err == nil { + return c.ID, nil + } + if i, err := ristore.Get(name); i != nil && err == nil { + return i.ID, nil + } + if l, err := rlstore.Get(name); l != nil && err == nil { + return l.ID, nil + } + return "", ErrLayerUnknown +} + +func (s *store) DeleteLayer(id string) error { + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + ristore, err := s.GetImageStore() + if err != nil { + return err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if rlstore.Exists(id) { + defer rlstore.Touch() + defer rcstore.Touch() + if l, err := rlstore.Get(id); err != nil { + id = l.ID + } + layers, err := rlstore.Layers() + if err != nil { + return err + } + for _, layer := range layers { + if layer.Parent == id { + return ErrLayerHasChildren + } + } + images, err := ristore.Images() + if err != nil { + return err + } + for _, image := range images { + if image.TopLayer == id { + return ErrLayerUsedByImage + } + } + containers, err := rcstore.Containers() + if err != nil { + return err + } + for _, container := range containers { + if container.LayerID == id { + return ErrLayerUsedByContainer + } + } + return rlstore.Delete(id) + } else { + return ErrNotALayer + } +} + +func (s *store) DeleteImage(id string, commit bool) (layers []string, err error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + layersToRemove := []string{} + if ristore.Exists(id) { + image, err := ristore.Get(id) + if err != nil { + return nil, err + } + id = image.ID + defer rlstore.Touch() + defer ristore.Touch() + containers, err := rcstore.Containers() + if err != nil { + return nil, err + } + aContainerByImage := make(map[string]string) + for _, container := range containers { + aContainerByImage[container.ImageID] = container.ID + } + if _, ok := aContainerByImage[id]; ok { + return nil, ErrImageUsedByContainer + } + images, err := ristore.Images() + if err != nil { + return nil, err + } + layers, err := rlstore.Layers() + if err != nil { + return nil, err + } + childrenByParent := make(map[string]*[]string) + for _, layer := range layers { + parent := layer.Parent + if list, ok := childrenByParent[parent]; ok { + newList := append(*list, layer.ID) + childrenByParent[parent] = &newList + } else { + childrenByParent[parent] = &([]string{layer.ID}) + } + } + anyImageByTopLayer := make(map[string]string) + for _, img := range images { + if img.ID != id { + anyImageByTopLayer[img.TopLayer] = img.ID + } + } + if commit { + if err = ristore.Delete(id); err != nil { + return nil, err + } + } + layer := image.TopLayer + lastRemoved := "" + for layer != "" { + if rcstore.Exists(layer) { + break + } + if _, ok := anyImageByTopLayer[layer]; ok { + break + } + parent := "" + if l, err := rlstore.Get(layer); err == nil { + parent = l.Parent + } + otherRefs := 0 + if childList, ok := childrenByParent[layer]; ok && childList != nil { + children := *childList + for _, child := range children { + if child != lastRemoved { + otherRefs++ + } + } + } + if otherRefs != 0 { + break + } + lastRemoved = layer + layersToRemove = append(layersToRemove, lastRemoved) + layer = parent + } + } else { + return nil, ErrNotAnImage + } + if commit { + for _, layer := range layersToRemove { + if err = rlstore.Delete(layer); err != nil { + return nil, err + } + } + } + return layersToRemove, nil +} + +func (s *store) DeleteContainer(id string) error { + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + ristore, err := s.GetImageStore() + if err != nil { + return err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if rcstore.Exists(id) { + defer rlstore.Touch() + defer rcstore.Touch() + if container, err := rcstore.Get(id); err == nil { + if rlstore.Exists(container.LayerID) { + if err := rlstore.Delete(container.LayerID); err != nil { + return err + } + return rcstore.Delete(id) + } else { + return ErrNotALayer + } + } + } else { + return ErrNotAContainer + } + return nil +} + +func (s *store) Delete(id string) error { + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + ristore, err := s.GetImageStore() + if err != nil { + return err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if rcstore.Exists(id) { + defer rlstore.Touch() + defer rcstore.Touch() + if container, err := rcstore.Get(id); err == nil { + if rlstore.Exists(container.LayerID) { + if err := rlstore.Delete(container.LayerID); err != nil { + return err + } + return rcstore.Delete(id) + } else { + return ErrNotALayer + } + } + } + if ristore.Exists(id) { + defer ristore.Touch() + return ristore.Delete(id) + } + if rlstore.Exists(id) { + defer rlstore.Touch() + return rlstore.Delete(id) + } + return ErrLayerUnknown +} + +func (s *store) Wipe() error { + rcstore, err := s.GetContainerStore() + if err != nil { + return err + } + ristore, err := s.GetImageStore() + if err != nil { + return err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + defer rlstore.Touch() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + defer ristore.Touch() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + defer rcstore.Touch() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if err = rcstore.Wipe(); err != nil { + return err + } + if err = ristore.Wipe(); err != nil { + return err + } + return rlstore.Wipe() +} + +func (s *store) Status() ([][2]string, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + return rlstore.Status() +} + +func (s *store) Version() ([][2]string, error) { + return [][2]string{ + {"GitCommit", storageversion.GitCommit}, + {"Version", storageversion.Version}, + {"BuildTime", storageversion.BuildTime}, + }, nil +} + +func (s *store) Mount(id, mountLabel string) (string, error) { + rcstore, err := s.GetContainerStore() + if err != nil { + return "", err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return "", err + } + + rlstore.Lock() + defer rlstore.Unlock() + defer rlstore.Touch() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if c, err := rcstore.Get(id); c != nil && err == nil { + id = c.LayerID + } + return rlstore.Mount(id, mountLabel) +} + +func (s *store) Unmount(id string) error { + rcstore, err := s.GetContainerStore() + if err != nil { + return err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return err + } + + rlstore.Lock() + defer rlstore.Unlock() + defer rlstore.Touch() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + if c, err := rcstore.Get(id); c != nil && err == nil { + id = c.LayerID + } + return rlstore.Unmount(id) +} + +func (s *store) Changes(from, to string) ([]archive.Change, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + + return rlstore.Changes(from, to) +} + +func (s *store) DiffSize(from, to string) (int64, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return -1, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + + return rlstore.DiffSize(from, to) +} + +func (s *store) Diff(from, to string) (io.ReadCloser, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + + return rlstore.Diff(from, to) +} + +func (s *store) ApplyDiff(to string, diff archive.Reader) (int64, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return -1, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + + return rlstore.ApplyDiff(to, diff) +} + +func (s *store) Layers() ([]Layer, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + + return rlstore.Layers() +} + +func (s *store) Images() ([]Image, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + + return ristore.Images() +} + +func (s *store) Containers() ([]Container, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + return rcstore.Containers() +} + +func (s *store) GetLayer(id string) (*Layer, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + + return rlstore.Get(id) +} + +func (s *store) GetImage(id string) (*Image, error) { + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + + return ristore.Get(id) +} + +func (s *store) GetImagesByTopLayer(id string) ([]*Image, error) { + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + + layer, err := rlstore.Get(id) + if err != nil { + return nil, err + } + images := []*Image{} + imageList, err := ristore.Images() + if err != nil { + return nil, err + } + for _, image := range imageList { + if image.TopLayer == layer.ID { + images = append(images, &image) + } + } + + return images, nil +} + +func (s *store) GetContainer(id string) (*Container, error) { + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + return rcstore.Get(id) +} + +func (s *store) GetContainerByLayer(id string) (*Container, error) { + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + layer, err := rlstore.Get(id) + if err != nil { + return nil, err + } + containerList, err := rcstore.Containers() + if err != nil { + return nil, err + } + for _, container := range containerList { + if container.LayerID == layer.ID { + return &container, nil + } + } + + return nil, ErrContainerUnknown +} + +func (s *store) Crawl(layerID string) (*Users, error) { + rlstore, err := s.GetLayerStore() + if err != nil { + return nil, err + } + ristore, err := s.GetImageStore() + if err != nil { + return nil, err + } + rcstore, err := s.GetContainerStore() + if err != nil { + return nil, err + } + + rlstore.Lock() + defer rlstore.Unlock() + if modified, err := rlstore.Modified(); modified || err != nil { + rlstore.Load() + } + ristore.Lock() + defer ristore.Unlock() + if modified, err := ristore.Modified(); modified || err != nil { + ristore.Load() + } + rcstore.Lock() + defer rcstore.Unlock() + if modified, err := rcstore.Modified(); modified || err != nil { + rcstore.Load() + } + + u := &Users{} + if container, err := rcstore.Get(layerID); err == nil { + u.ID = container.ID + layerID = container.LayerID + } + if image, err := ristore.Get(layerID); err == nil { + u.ID = image.ID + layerID = image.TopLayer + } + if layer, err := rlstore.Get(layerID); err == nil { + u.ID = layer.ID + layerID = layer.ID + } + if u.ID == "" { + return nil, ErrLayerUnknown + } + u.LayerID = layerID + layers, err := rlstore.Layers() + if err != nil { + return nil, err + } + images, err := ristore.Images() + if err != nil { + return nil, err + } + containers, err := rcstore.Containers() + if err != nil { + return nil, err + } + children := make(map[string][]string) +nextLayer: + for _, layer := range layers { + for _, container := range containers { + if container.LayerID == layer.ID { + break nextLayer + } + } + if childs, known := children[layer.Parent]; known { + newChildren := append(childs, layer.ID) + children[layer.Parent] = newChildren + } else { + children[layer.Parent] = []string{layer.ID} + } + } + if childs, known := children[layerID]; known { + u.LayersDirect = childs + } + indirects := []string{} + examined := make(map[string]bool) + queue := u.LayersDirect + for n := 0; n < len(queue); n++ { + if _, skip := examined[queue[n]]; skip { + continue + } + examined[queue[n]] = true + for _, child := range children[queue[n]] { + queue = append(queue, child) + indirects = append(indirects, child) + } + } + u.LayersIndirect = indirects + for _, image := range images { + if image.TopLayer == layerID { + if u.ImagesDirect == nil { + u.ImagesDirect = []string{image.ID} + } else { + u.ImagesDirect = append(u.ImagesDirect, image.ID) + } + } else { + if _, isDescended := examined[image.TopLayer]; isDescended { + if u.ImagesIndirect == nil { + u.ImagesIndirect = []string{image.ID} + } else { + u.ImagesIndirect = append(u.ImagesIndirect, image.ID) + } + } + } + } + for _, container := range containers { + parent := "" + if l, _ := rlstore.Get(container.LayerID); l != nil { + parent = l.Parent + } + if parent == layerID { + if u.ContainersDirect == nil { + u.ContainersDirect = []string{container.ID} + } else { + u.ContainersDirect = append(u.ContainersDirect, container.ID) + } + } else { + if _, isDescended := examined[parent]; isDescended { + if u.ContainersIndirect == nil { + u.ContainersIndirect = []string{container.ID} + } else { + u.ContainersIndirect = append(u.ContainersIndirect, container.ID) + } + } + } + } + return u, nil +} + +// MakeMall was the old name of MakeStore. It will be dropped at some point. +func MakeMall(runRoot, graphRoot, graphDriverName string, graphOptions []string) (Mall, error) { + return MakeStore(runRoot, graphRoot, graphDriverName, graphOptions, nil, nil) +} diff --git a/vendor/github.com/containers/storage/storageversion/version_lib.go b/vendor/github.com/containers/storage/storageversion/version_lib.go new file mode 100644 index 00000000..761868e3 --- /dev/null +++ b/vendor/github.com/containers/storage/storageversion/version_lib.go @@ -0,0 +1,13 @@ +// +build !autogen + +// Package storageversion is auto-generated at build-time +package storageversion + +// Default build-time variable for library-import. +// This file is overridden on build with build-time informations. +const ( + GitCommit string = "library-import" + Version string = "library-import" + BuildTime string = "library-import" + IAmStatic string = "library-import" +) diff --git a/vendor/github.com/mattn/go-shellwords/shellwords.go b/vendor/github.com/mattn/go-shellwords/shellwords.go new file mode 100644 index 00000000..1abaa6c9 --- /dev/null +++ b/vendor/github.com/mattn/go-shellwords/shellwords.go @@ -0,0 +1,134 @@ +package shellwords + +import ( + "errors" + "os" + "regexp" + "strings" +) + +var ( + ParseEnv bool = false + ParseBacktick bool = false +) + +var envRe = regexp.MustCompile(`\$({[a-zA-Z0-9_]+}|[a-zA-Z0-9_]+)`) + +func isSpace(r rune) bool { + switch r { + case ' ', '\t', '\r', '\n': + return true + } + return false +} + +func replaceEnv(s string) string { + return envRe.ReplaceAllStringFunc(s, func(s string) string { + s = s[1:] + if s[0] == '{' { + s = s[1 : len(s)-1] + } + return os.Getenv(s) + }) +} + +type Parser struct { + ParseEnv bool + ParseBacktick bool +} + +func NewParser() *Parser { + return &Parser{ParseEnv, ParseBacktick} +} + +func (p *Parser) Parse(line string) ([]string, error) { + line = strings.TrimSpace(line) + + args := []string{} + buf := "" + var escaped, doubleQuoted, singleQuoted, backQuote bool + backtick := "" + + for _, r := range line { + if escaped { + buf += string(r) + escaped = false + continue + } + + if r == '\\' { + if singleQuoted { + buf += string(r) + } else { + escaped = true + } + continue + } + + if isSpace(r) { + if singleQuoted || doubleQuoted || backQuote { + buf += string(r) + backtick += string(r) + } else if buf != "" { + if p.ParseEnv { + buf = replaceEnv(buf) + } + args = append(args, buf) + buf = "" + } + continue + } + + switch r { + case '`': + if !singleQuoted && !doubleQuoted { + if p.ParseBacktick { + if backQuote { + out, err := shellRun(backtick) + if err != nil { + return nil, err + } + buf = out + } + backtick = "" + backQuote = !backQuote + continue + } + backtick = "" + backQuote = !backQuote + } + case '"': + if !singleQuoted { + doubleQuoted = !doubleQuoted + continue + } + case '\'': + if !doubleQuoted { + singleQuoted = !singleQuoted + continue + } + } + + buf += string(r) + if backQuote { + backtick += string(r) + } + } + + if buf != "" { + if p.ParseEnv { + buf = replaceEnv(buf) + } + args = append(args, buf) + } + + if escaped || singleQuoted || doubleQuoted || backQuote { + return nil, errors.New("invalid command line string") + } + + return args, nil +} + +func Parse(line string) ([]string, error) { + return NewParser().Parse(line) +} diff --git a/vendor/github.com/mattn/go-shellwords/util_posix.go b/vendor/github.com/mattn/go-shellwords/util_posix.go new file mode 100644 index 00000000..4f8ac55e --- /dev/null +++ b/vendor/github.com/mattn/go-shellwords/util_posix.go @@ -0,0 +1,19 @@ +// +build !windows + +package shellwords + +import ( + "errors" + "os" + "os/exec" + "strings" +) + +func shellRun(line string) (string, error) { + shell := os.Getenv("SHELL") + b, err := exec.Command(shell, "-c", line).Output() + if err != nil { + return "", errors.New(err.Error() + ":" + string(b)) + } + return strings.TrimSpace(string(b)), nil +} diff --git a/vendor/github.com/mattn/go-shellwords/util_windows.go b/vendor/github.com/mattn/go-shellwords/util_windows.go new file mode 100644 index 00000000..7cad4cf0 --- /dev/null +++ b/vendor/github.com/mattn/go-shellwords/util_windows.go @@ -0,0 +1,17 @@ +package shellwords + +import ( + "errors" + "os" + "os/exec" + "strings" +) + +func shellRun(line string) (string, error) { + shell := os.Getenv("COMSPEC") + b, err := exec.Command(shell, "/c", line).Output() + if err != nil { + return "", errors.New(err.Error() + ":" + string(b)) + } + return strings.TrimSpace(string(b)), nil +} diff --git a/vendor/github.com/mistifyio/go-zfs/LICENSE b/vendor/github.com/mistifyio/go-zfs/LICENSE new file mode 100644 index 00000000..f4c265cf --- /dev/null +++ b/vendor/github.com/mistifyio/go-zfs/LICENSE @@ -0,0 +1,201 @@ +Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "{}" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright (c) 2014, OmniTI Computer Consulting, Inc. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/vendor/github.com/mistifyio/go-zfs/error.go b/vendor/github.com/mistifyio/go-zfs/error.go new file mode 100644 index 00000000..5408ccdb --- /dev/null +++ b/vendor/github.com/mistifyio/go-zfs/error.go @@ -0,0 +1,18 @@ +package zfs + +import ( + "fmt" +) + +// Error is an error which is returned when the `zfs` or `zpool` shell +// commands return with a non-zero exit code. +type Error struct { + Err error + Debug string + Stderr string +} + +// Error returns the string representation of an Error. +func (e Error) Error() string { + return fmt.Sprintf("%s: %q => %s", e.Err, e.Debug, e.Stderr) +} diff --git a/vendor/github.com/mistifyio/go-zfs/utils.go b/vendor/github.com/mistifyio/go-zfs/utils.go new file mode 100644 index 00000000..404ab2b5 --- /dev/null +++ b/vendor/github.com/mistifyio/go-zfs/utils.go @@ -0,0 +1,323 @@ +package zfs + +import ( + "bytes" + "fmt" + "io" + "os/exec" + "regexp" + "strconv" + "strings" + + "github.com/pborman/uuid" +) + +type command struct { + Command string + Stdin io.Reader + Stdout io.Writer +} + +func (c *command) Run(arg ...string) ([][]string, error) { + + cmd := exec.Command(c.Command, arg...) + + var stdout, stderr bytes.Buffer + + if c.Stdout == nil { + cmd.Stdout = &stdout + } else { + cmd.Stdout = c.Stdout + } + + if c.Stdin != nil { + cmd.Stdin = c.Stdin + + } + cmd.Stderr = &stderr + + id := uuid.New() + joinedArgs := strings.Join(cmd.Args, " ") + + logger.Log([]string{"ID:" + id, "START", joinedArgs}) + err := cmd.Run() + logger.Log([]string{"ID:" + id, "FINISH"}) + + if err != nil { + return nil, &Error{ + Err: err, + Debug: strings.Join([]string{cmd.Path, joinedArgs}, " "), + Stderr: stderr.String(), + } + } + + // assume if you passed in something for stdout, that you know what to do with it + if c.Stdout != nil { + return nil, nil + } + + lines := strings.Split(stdout.String(), "\n") + + //last line is always blank + lines = lines[0 : len(lines)-1] + output := make([][]string, len(lines)) + + for i, l := range lines { + output[i] = strings.Fields(l) + } + + return output, nil +} + +func setString(field *string, value string) { + v := "" + if value != "-" { + v = value + } + *field = v +} + +func setUint(field *uint64, value string) error { + var v uint64 + if value != "-" { + var err error + v, err = strconv.ParseUint(value, 10, 64) + if err != nil { + return err + } + } + *field = v + return nil +} + +func (ds *Dataset) parseLine(line []string) error { + prop := line[1] + val := line[2] + + var err error + + switch prop { + case "available": + err = setUint(&ds.Avail, val) + case "compression": + setString(&ds.Compression, val) + case "mountpoint": + setString(&ds.Mountpoint, val) + case "quota": + err = setUint(&ds.Quota, val) + case "type": + setString(&ds.Type, val) + case "origin": + setString(&ds.Origin, val) + case "used": + err = setUint(&ds.Used, val) + case "volsize": + err = setUint(&ds.Volsize, val) + case "written": + err = setUint(&ds.Written, val) + case "logicalused": + err = setUint(&ds.Logicalused, val) + } + return err +} + +/* + * from zfs diff`s escape function: + * + * Prints a file name out a character at a time. If the character is + * not in the range of what we consider "printable" ASCII, display it + * as an escaped 3-digit octal value. ASCII values less than a space + * are all control characters and we declare the upper end as the + * DELete character. This also is the last 7-bit ASCII character. + * We choose to treat all 8-bit ASCII as not printable for this + * application. + */ +func unescapeFilepath(path string) (string, error) { + buf := make([]byte, 0, len(path)) + llen := len(path) + for i := 0; i < llen; { + if path[i] == '\\' { + if llen < i+4 { + return "", fmt.Errorf("Invalid octal code: too short") + } + octalCode := path[(i + 1):(i + 4)] + val, err := strconv.ParseUint(octalCode, 8, 8) + if err != nil { + return "", fmt.Errorf("Invalid octal code: %v", err) + } + buf = append(buf, byte(val)) + i += 4 + } else { + buf = append(buf, path[i]) + i++ + } + } + return string(buf), nil +} + +var changeTypeMap = map[string]ChangeType{ + "-": Removed, + "+": Created, + "M": Modified, + "R": Renamed, +} +var inodeTypeMap = map[string]InodeType{ + "B": BlockDevice, + "C": CharacterDevice, + "/": Directory, + ">": Door, + "|": NamedPipe, + "@": SymbolicLink, + "P": EventPort, + "=": Socket, + "F": File, +} + +// matches (+1) or (-1) +var referenceCountRegex = regexp.MustCompile("\\(([+-]\\d+?)\\)") + +func parseReferenceCount(field string) (int, error) { + matches := referenceCountRegex.FindStringSubmatch(field) + if matches == nil { + return 0, fmt.Errorf("Regexp does not match") + } + return strconv.Atoi(matches[1]) +} + +func parseInodeChange(line []string) (*InodeChange, error) { + llen := len(line) + if llen < 1 { + return nil, fmt.Errorf("Empty line passed") + } + + changeType := changeTypeMap[line[0]] + if changeType == 0 { + return nil, fmt.Errorf("Unknown change type '%s'", line[0]) + } + + switch changeType { + case Renamed: + if llen != 4 { + return nil, fmt.Errorf("Mismatching number of fields: expect 4, got: %d", llen) + } + case Modified: + if llen != 4 && llen != 3 { + return nil, fmt.Errorf("Mismatching number of fields: expect 3..4, got: %d", llen) + } + default: + if llen != 3 { + return nil, fmt.Errorf("Mismatching number of fields: expect 3, got: %d", llen) + } + } + + inodeType := inodeTypeMap[line[1]] + if inodeType == 0 { + return nil, fmt.Errorf("Unknown inode type '%s'", line[1]) + } + + path, err := unescapeFilepath(line[2]) + if err != nil { + return nil, fmt.Errorf("Failed to parse filename: %v", err) + } + + var newPath string + var referenceCount int + switch changeType { + case Renamed: + newPath, err = unescapeFilepath(line[3]) + if err != nil { + return nil, fmt.Errorf("Failed to parse filename: %v", err) + } + case Modified: + if llen == 4 { + referenceCount, err = parseReferenceCount(line[3]) + if err != nil { + return nil, fmt.Errorf("Failed to parse reference count: %v", err) + } + } + default: + newPath = "" + } + + return &InodeChange{ + Change: changeType, + Type: inodeType, + Path: path, + NewPath: newPath, + ReferenceCountChange: referenceCount, + }, nil +} + +// example input +//M / /testpool/bar/ +//+ F /testpool/bar/hello.txt +//M / /testpool/bar/hello.txt (+1) +//M / /testpool/bar/hello-hardlink +func parseInodeChanges(lines [][]string) ([]*InodeChange, error) { + changes := make([]*InodeChange, len(lines)) + + for i, line := range lines { + c, err := parseInodeChange(line) + if err != nil { + return nil, fmt.Errorf("Failed to parse line %d of zfs diff: %v, got: '%s'", i, err, line) + } + changes[i] = c + } + return changes, nil +} + +func listByType(t, filter string) ([]*Dataset, error) { + args := []string{"get", "-rHp", "-t", t, "all"} + if filter != "" { + args = append(args, filter) + } + out, err := zfs(args...) + if err != nil { + return nil, err + } + + var datasets []*Dataset + + name := "" + var ds *Dataset + for _, line := range out { + if name != line[0] { + name = line[0] + ds = &Dataset{Name: name} + datasets = append(datasets, ds) + } + if err := ds.parseLine(line); err != nil { + return nil, err + } + } + + return datasets, nil +} + +func propsSlice(properties map[string]string) []string { + args := make([]string, 0, len(properties)*3) + for k, v := range properties { + args = append(args, "-o") + args = append(args, fmt.Sprintf("%s=%s", k, v)) + } + return args +} + +func (z *Zpool) parseLine(line []string) error { + prop := line[1] + val := line[2] + + var err error + + switch prop { + case "health": + setString(&z.Health, val) + case "allocated": + err = setUint(&z.Allocated, val) + case "size": + err = setUint(&z.Size, val) + case "free": + err = setUint(&z.Free, val) + } + return err +} diff --git a/vendor/github.com/mistifyio/go-zfs/zfs.go b/vendor/github.com/mistifyio/go-zfs/zfs.go new file mode 100644 index 00000000..3d0dd66a --- /dev/null +++ b/vendor/github.com/mistifyio/go-zfs/zfs.go @@ -0,0 +1,390 @@ +// Package zfs provides wrappers around the ZFS command line tools. +package zfs + +import ( + "errors" + "fmt" + "io" + "strconv" + "strings" +) + +// ZFS dataset types, which can indicate if a dataset is a filesystem, +// snapshot, or volume. +const ( + DatasetFilesystem = "filesystem" + DatasetSnapshot = "snapshot" + DatasetVolume = "volume" +) + +// Dataset is a ZFS dataset. A dataset could be a clone, filesystem, snapshot, +// or volume. The Type struct member can be used to determine a dataset's type. +// +// The field definitions can be found in the ZFS manual: +// http://www.freebsd.org/cgi/man.cgi?zfs(8). +type Dataset struct { + Name string + Origin string + Used uint64 + Avail uint64 + Mountpoint string + Compression string + Type string + Written uint64 + Volsize uint64 + Usedbydataset uint64 + Logicalused uint64 + Quota uint64 +} + +// InodeType is the type of inode as reported by Diff +type InodeType int + +// Types of Inodes +const ( + _ = iota // 0 == unknown type + BlockDevice InodeType = iota + CharacterDevice + Directory + Door + NamedPipe + SymbolicLink + EventPort + Socket + File +) + +// ChangeType is the type of inode change as reported by Diff +type ChangeType int + +// Types of Changes +const ( + _ = iota // 0 == unknown type + Removed ChangeType = iota + Created + Modified + Renamed +) + +// DestroyFlag is the options flag passed to Destroy +type DestroyFlag int + +// Valid destroy options +const ( + DestroyDefault DestroyFlag = 1 << iota + DestroyRecursive = 1 << iota + DestroyRecursiveClones = 1 << iota + DestroyDeferDeletion = 1 << iota + DestroyForceUmount = 1 << iota +) + +// InodeChange represents a change as reported by Diff +type InodeChange struct { + Change ChangeType + Type InodeType + Path string + NewPath string + ReferenceCountChange int +} + +// Logger can be used to log commands/actions +type Logger interface { + Log(cmd []string) +} + +type defaultLogger struct{} + +func (*defaultLogger) Log(cmd []string) { + return +} + +var logger Logger = &defaultLogger{} + +// SetLogger set a log handler to log all commands including arguments before +// they are executed +func SetLogger(l Logger) { + if l != nil { + logger = l + } +} + +// zfs is a helper function to wrap typical calls to zfs. +func zfs(arg ...string) ([][]string, error) { + c := command{Command: "zfs"} + return c.Run(arg...) +} + +// Datasets returns a slice of ZFS datasets, regardless of type. +// A filter argument may be passed to select a dataset with the matching name, +// or empty string ("") may be used to select all datasets. +func Datasets(filter string) ([]*Dataset, error) { + return listByType("all", filter) +} + +// Snapshots returns a slice of ZFS snapshots. +// A filter argument may be passed to select a snapshot with the matching name, +// or empty string ("") may be used to select all snapshots. +func Snapshots(filter string) ([]*Dataset, error) { + return listByType(DatasetSnapshot, filter) +} + +// Filesystems returns a slice of ZFS filesystems. +// A filter argument may be passed to select a filesystem with the matching name, +// or empty string ("") may be used to select all filesystems. +func Filesystems(filter string) ([]*Dataset, error) { + return listByType(DatasetFilesystem, filter) +} + +// Volumes returns a slice of ZFS volumes. +// A filter argument may be passed to select a volume with the matching name, +// or empty string ("") may be used to select all volumes. +func Volumes(filter string) ([]*Dataset, error) { + return listByType(DatasetVolume, filter) +} + +// GetDataset retrieves a single ZFS dataset by name. This dataset could be +// any valid ZFS dataset type, such as a clone, filesystem, snapshot, or volume. +func GetDataset(name string) (*Dataset, error) { + out, err := zfs("get", "-Hp", "all", name) + if err != nil { + return nil, err + } + + ds := &Dataset{Name: name} + for _, line := range out { + if err := ds.parseLine(line); err != nil { + return nil, err + } + } + + return ds, nil +} + +// Clone clones a ZFS snapshot and returns a clone dataset. +// An error will be returned if the input dataset is not of snapshot type. +func (d *Dataset) Clone(dest string, properties map[string]string) (*Dataset, error) { + if d.Type != DatasetSnapshot { + return nil, errors.New("can only clone snapshots") + } + args := make([]string, 2, 4) + args[0] = "clone" + args[1] = "-p" + if properties != nil { + args = append(args, propsSlice(properties)...) + } + args = append(args, []string{d.Name, dest}...) + _, err := zfs(args...) + if err != nil { + return nil, err + } + return GetDataset(dest) +} + +// ReceiveSnapshot receives a ZFS stream from the input io.Reader, creates a +// new snapshot with the specified name, and streams the input data into the +// newly-created snapshot. +func ReceiveSnapshot(input io.Reader, name string) (*Dataset, error) { + c := command{Command: "zfs", Stdin: input} + _, err := c.Run("receive", name) + if err != nil { + return nil, err + } + return GetDataset(name) +} + +// SendSnapshot sends a ZFS stream of a snapshot to the input io.Writer. +// An error will be returned if the input dataset is not of snapshot type. +func (d *Dataset) SendSnapshot(output io.Writer) error { + if d.Type != DatasetSnapshot { + return errors.New("can only send snapshots") + } + + c := command{Command: "zfs", Stdout: output} + _, err := c.Run("send", d.Name) + return err +} + +// CreateVolume creates a new ZFS volume with the specified name, size, and +// properties. +// A full list of available ZFS properties may be found here: +// https://www.freebsd.org/cgi/man.cgi?zfs(8). +func CreateVolume(name string, size uint64, properties map[string]string) (*Dataset, error) { + args := make([]string, 4, 5) + args[0] = "create" + args[1] = "-p" + args[2] = "-V" + args[3] = strconv.FormatUint(size, 10) + if properties != nil { + args = append(args, propsSlice(properties)...) + } + args = append(args, name) + _, err := zfs(args...) + if err != nil { + return nil, err + } + return GetDataset(name) +} + +// Destroy destroys a ZFS dataset. If the destroy bit flag is set, any +// descendents of the dataset will be recursively destroyed, including snapshots. +// If the deferred bit flag is set, the snapshot is marked for deferred +// deletion. +func (d *Dataset) Destroy(flags DestroyFlag) error { + args := make([]string, 1, 3) + args[0] = "destroy" + if flags&DestroyRecursive != 0 { + args = append(args, "-r") + } + + if flags&DestroyRecursiveClones != 0 { + args = append(args, "-R") + } + + if flags&DestroyDeferDeletion != 0 { + args = append(args, "-d") + } + + if flags&DestroyForceUmount != 0 { + args = append(args, "-f") + } + + args = append(args, d.Name) + _, err := zfs(args...) + return err +} + +// SetProperty sets a ZFS property on the receiving dataset. +// A full list of available ZFS properties may be found here: +// https://www.freebsd.org/cgi/man.cgi?zfs(8). +func (d *Dataset) SetProperty(key, val string) error { + prop := strings.Join([]string{key, val}, "=") + _, err := zfs("set", prop, d.Name) + return err +} + +// GetProperty returns the current value of a ZFS property from the +// receiving dataset. +// A full list of available ZFS properties may be found here: +// https://www.freebsd.org/cgi/man.cgi?zfs(8). +func (d *Dataset) GetProperty(key string) (string, error) { + out, err := zfs("get", key, d.Name) + if err != nil { + return "", err + } + + return out[0][2], nil +} + +// Snapshots returns a slice of all ZFS snapshots of a given dataset. +func (d *Dataset) Snapshots() ([]*Dataset, error) { + return Snapshots(d.Name) +} + +// CreateFilesystem creates a new ZFS filesystem with the specified name and +// properties. +// A full list of available ZFS properties may be found here: +// https://www.freebsd.org/cgi/man.cgi?zfs(8). +func CreateFilesystem(name string, properties map[string]string) (*Dataset, error) { + args := make([]string, 1, 4) + args[0] = "create" + + if properties != nil { + args = append(args, propsSlice(properties)...) + } + + args = append(args, name) + _, err := zfs(args...) + if err != nil { + return nil, err + } + return GetDataset(name) +} + +// Snapshot creates a new ZFS snapshot of the receiving dataset, using the +// specified name. Optionally, the snapshot can be taken recursively, creating +// snapshots of all descendent filesystems in a single, atomic operation. +func (d *Dataset) Snapshot(name string, recursive bool) (*Dataset, error) { + args := make([]string, 1, 4) + args[0] = "snapshot" + if recursive { + args = append(args, "-r") + } + snapName := fmt.Sprintf("%s@%s", d.Name, name) + args = append(args, snapName) + _, err := zfs(args...) + if err != nil { + return nil, err + } + return GetDataset(snapName) +} + +// Rollback rolls back the receiving ZFS dataset to a previous snapshot. +// Optionally, intermediate snapshots can be destroyed. A ZFS snapshot +// rollback cannot be completed without this option, if more recent +// snapshots exist. +// An error will be returned if the input dataset is not of snapshot type. +func (d *Dataset) Rollback(destroyMoreRecent bool) error { + if d.Type != DatasetSnapshot { + return errors.New("can only rollback snapshots") + } + + args := make([]string, 1, 3) + args[0] = "rollback" + if destroyMoreRecent { + args = append(args, "-r") + } + args = append(args, d.Name) + + _, err := zfs(args...) + return err +} + +// Children returns a slice of children of the receiving ZFS dataset. +// A recursion depth may be specified, or a depth of 0 allows unlimited +// recursion. +func (d *Dataset) Children(depth uint64) ([]*Dataset, error) { + args := []string{"get", "-t", "all", "-Hp", "all"} + if depth > 0 { + args = append(args, "-d") + args = append(args, strconv.FormatUint(depth, 10)) + } else { + args = append(args, "-r") + } + args = append(args, d.Name) + + out, err := zfs(args...) + if err != nil { + return nil, err + } + + var datasets []*Dataset + name := "" + var ds *Dataset + for _, line := range out { + if name != line[0] { + name = line[0] + ds = &Dataset{Name: name} + datasets = append(datasets, ds) + } + if err := ds.parseLine(line); err != nil { + return nil, err + } + } + return datasets[1:], nil +} + +// Diff returns changes between a snapshot and the given ZFS dataset. +// The snapshot name must include the filesystem part as it is possible to +// compare clones with their origin snapshots. +func (d *Dataset) Diff(snapshot string) ([]*InodeChange, error) { + args := []string{"diff", "-FH", snapshot, d.Name}[:] + out, err := zfs(args...) + if err != nil { + return nil, err + } + inodeChanges, err := parseInodeChanges(out) + if err != nil { + return nil, err + } + return inodeChanges, nil +} diff --git a/vendor/github.com/mistifyio/go-zfs/zpool.go b/vendor/github.com/mistifyio/go-zfs/zpool.go new file mode 100644 index 00000000..6ba52d30 --- /dev/null +++ b/vendor/github.com/mistifyio/go-zfs/zpool.go @@ -0,0 +1,105 @@ +package zfs + +// ZFS zpool states, which can indicate if a pool is online, offline, +// degraded, etc. More information regarding zpool states can be found here: +// https://docs.oracle.com/cd/E19253-01/819-5461/gamno/index.html. +const ( + ZpoolOnline = "ONLINE" + ZpoolDegraded = "DEGRADED" + ZpoolFaulted = "FAULTED" + ZpoolOffline = "OFFLINE" + ZpoolUnavail = "UNAVAIL" + ZpoolRemoved = "REMOVED" +) + +// Zpool is a ZFS zpool. A pool is a top-level structure in ZFS, and can +// contain many descendent datasets. +type Zpool struct { + Name string + Health string + Allocated uint64 + Size uint64 + Free uint64 +} + +// zpool is a helper function to wrap typical calls to zpool. +func zpool(arg ...string) ([][]string, error) { + c := command{Command: "zpool"} + return c.Run(arg...) +} + +// GetZpool retrieves a single ZFS zpool by name. +func GetZpool(name string) (*Zpool, error) { + out, err := zpool("get", "all", "-p", name) + if err != nil { + return nil, err + } + + // there is no -H + out = out[1:] + + z := &Zpool{Name: name} + for _, line := range out { + if err := z.parseLine(line); err != nil { + return nil, err + } + } + + return z, nil +} + +// Datasets returns a slice of all ZFS datasets in a zpool. +func (z *Zpool) Datasets() ([]*Dataset, error) { + return Datasets(z.Name) +} + +// Snapshots returns a slice of all ZFS snapshots in a zpool. +func (z *Zpool) Snapshots() ([]*Dataset, error) { + return Snapshots(z.Name) +} + +// CreateZpool creates a new ZFS zpool with the specified name, properties, +// and optional arguments. +// A full list of available ZFS properties and command-line arguments may be +// found here: https://www.freebsd.org/cgi/man.cgi?zfs(8). +func CreateZpool(name string, properties map[string]string, args ...string) (*Zpool, error) { + cli := make([]string, 1, 4) + cli[0] = "create" + if properties != nil { + cli = append(cli, propsSlice(properties)...) + } + cli = append(cli, name) + cli = append(cli, args...) + _, err := zpool(cli...) + if err != nil { + return nil, err + } + + return &Zpool{Name: name}, nil +} + +// Destroy destroys a ZFS zpool by name. +func (z *Zpool) Destroy() error { + _, err := zpool("destroy", z.Name) + return err +} + +// ListZpools list all ZFS zpools accessible on the current system. +func ListZpools() ([]*Zpool, error) { + args := []string{"list", "-Ho", "name"} + out, err := zpool(args...) + if err != nil { + return nil, err + } + + var pools []*Zpool + + for _, line := range out { + z, err := GetZpool(line[0]) + if err != nil { + return nil, err + } + pools = append(pools, z) + } + return pools, nil +} diff --git a/vendor/github.com/pborman/uuid/LICENSE b/vendor/github.com/pborman/uuid/LICENSE new file mode 100644 index 00000000..5dc68268 --- /dev/null +++ b/vendor/github.com/pborman/uuid/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009,2014 Google Inc. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/github.com/pborman/uuid/dce.go b/vendor/github.com/pborman/uuid/dce.go new file mode 100755 index 00000000..50a0f2d0 --- /dev/null +++ b/vendor/github.com/pborman/uuid/dce.go @@ -0,0 +1,84 @@ +// Copyright 2011 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +import ( + "encoding/binary" + "fmt" + "os" +) + +// A Domain represents a Version 2 domain +type Domain byte + +// Domain constants for DCE Security (Version 2) UUIDs. +const ( + Person = Domain(0) + Group = Domain(1) + Org = Domain(2) +) + +// NewDCESecurity returns a DCE Security (Version 2) UUID. +// +// The domain should be one of Person, Group or Org. +// On a POSIX system the id should be the users UID for the Person +// domain and the users GID for the Group. The meaning of id for +// the domain Org or on non-POSIX systems is site defined. +// +// For a given domain/id pair the same token may be returned for up to +// 7 minutes and 10 seconds. +func NewDCESecurity(domain Domain, id uint32) UUID { + uuid := NewUUID() + if uuid != nil { + uuid[6] = (uuid[6] & 0x0f) | 0x20 // Version 2 + uuid[9] = byte(domain) + binary.BigEndian.PutUint32(uuid[0:], id) + } + return uuid +} + +// NewDCEPerson returns a DCE Security (Version 2) UUID in the person +// domain with the id returned by os.Getuid. +// +// NewDCEPerson(Person, uint32(os.Getuid())) +func NewDCEPerson() UUID { + return NewDCESecurity(Person, uint32(os.Getuid())) +} + +// NewDCEGroup returns a DCE Security (Version 2) UUID in the group +// domain with the id returned by os.Getgid. +// +// NewDCEGroup(Group, uint32(os.Getgid())) +func NewDCEGroup() UUID { + return NewDCESecurity(Group, uint32(os.Getgid())) +} + +// Domain returns the domain for a Version 2 UUID or false. +func (uuid UUID) Domain() (Domain, bool) { + if v, _ := uuid.Version(); v != 2 { + return 0, false + } + return Domain(uuid[9]), true +} + +// Id returns the id for a Version 2 UUID or false. +func (uuid UUID) Id() (uint32, bool) { + if v, _ := uuid.Version(); v != 2 { + return 0, false + } + return binary.BigEndian.Uint32(uuid[0:4]), true +} + +func (d Domain) String() string { + switch d { + case Person: + return "Person" + case Group: + return "Group" + case Org: + return "Org" + } + return fmt.Sprintf("Domain%d", int(d)) +} diff --git a/vendor/github.com/pborman/uuid/doc.go b/vendor/github.com/pborman/uuid/doc.go new file mode 100755 index 00000000..d8bd013e --- /dev/null +++ b/vendor/github.com/pborman/uuid/doc.go @@ -0,0 +1,8 @@ +// Copyright 2011 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// The uuid package generates and inspects UUIDs. +// +// UUIDs are based on RFC 4122 and DCE 1.1: Authentication and Security Services. +package uuid diff --git a/vendor/github.com/pborman/uuid/hash.go b/vendor/github.com/pborman/uuid/hash.go new file mode 100644 index 00000000..cdd4192f --- /dev/null +++ b/vendor/github.com/pborman/uuid/hash.go @@ -0,0 +1,53 @@ +// Copyright 2011 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +import ( + "crypto/md5" + "crypto/sha1" + "hash" +) + +// Well known Name Space IDs and UUIDs +var ( + NameSpace_DNS = Parse("6ba7b810-9dad-11d1-80b4-00c04fd430c8") + NameSpace_URL = Parse("6ba7b811-9dad-11d1-80b4-00c04fd430c8") + NameSpace_OID = Parse("6ba7b812-9dad-11d1-80b4-00c04fd430c8") + NameSpace_X500 = Parse("6ba7b814-9dad-11d1-80b4-00c04fd430c8") + NIL = Parse("00000000-0000-0000-0000-000000000000") +) + +// NewHash returns a new UUID dervied from the hash of space concatenated with +// data generated by h. The hash should be at least 16 byte in length. The +// first 16 bytes of the hash are used to form the UUID. The version of the +// UUID will be the lower 4 bits of version. NewHash is used to implement +// NewMD5 and NewSHA1. +func NewHash(h hash.Hash, space UUID, data []byte, version int) UUID { + h.Reset() + h.Write(space) + h.Write([]byte(data)) + s := h.Sum(nil) + uuid := make([]byte, 16) + copy(uuid, s) + uuid[6] = (uuid[6] & 0x0f) | uint8((version&0xf)<<4) + uuid[8] = (uuid[8] & 0x3f) | 0x80 // RFC 4122 variant + return uuid +} + +// NewMD5 returns a new MD5 (Version 3) UUID based on the +// supplied name space and data. +// +// NewHash(md5.New(), space, data, 3) +func NewMD5(space UUID, data []byte) UUID { + return NewHash(md5.New(), space, data, 3) +} + +// NewSHA1 returns a new SHA1 (Version 5) UUID based on the +// supplied name space and data. +// +// NewHash(sha1.New(), space, data, 5) +func NewSHA1(space UUID, data []byte) UUID { + return NewHash(sha1.New(), space, data, 5) +} diff --git a/vendor/github.com/pborman/uuid/json.go b/vendor/github.com/pborman/uuid/json.go new file mode 100644 index 00000000..760580a5 --- /dev/null +++ b/vendor/github.com/pborman/uuid/json.go @@ -0,0 +1,30 @@ +// Copyright 2014 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +import "errors" + +func (u UUID) MarshalJSON() ([]byte, error) { + if len(u) == 0 { + return []byte(`""`), nil + } + return []byte(`"` + u.String() + `"`), nil +} + +func (u *UUID) UnmarshalJSON(data []byte) error { + if len(data) == 0 || string(data) == `""` { + return nil + } + if len(data) < 2 || data[0] != '"' || data[len(data)-1] != '"' { + return errors.New("invalid UUID format") + } + data = data[1 : len(data)-1] + uu := Parse(string(data)) + if uu == nil { + return errors.New("invalid UUID format") + } + *u = uu + return nil +} diff --git a/vendor/github.com/pborman/uuid/node.go b/vendor/github.com/pborman/uuid/node.go new file mode 100755 index 00000000..dd0a8ac1 --- /dev/null +++ b/vendor/github.com/pborman/uuid/node.go @@ -0,0 +1,101 @@ +// Copyright 2011 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +import "net" + +var ( + interfaces []net.Interface // cached list of interfaces + ifname string // name of interface being used + nodeID []byte // hardware for version 1 UUIDs +) + +// NodeInterface returns the name of the interface from which the NodeID was +// derived. The interface "user" is returned if the NodeID was set by +// SetNodeID. +func NodeInterface() string { + return ifname +} + +// SetNodeInterface selects the hardware address to be used for Version 1 UUIDs. +// If name is "" then the first usable interface found will be used or a random +// Node ID will be generated. If a named interface cannot be found then false +// is returned. +// +// SetNodeInterface never fails when name is "". +func SetNodeInterface(name string) bool { + if interfaces == nil { + var err error + interfaces, err = net.Interfaces() + if err != nil && name != "" { + return false + } + } + + for _, ifs := range interfaces { + if len(ifs.HardwareAddr) >= 6 && (name == "" || name == ifs.Name) { + if setNodeID(ifs.HardwareAddr) { + ifname = ifs.Name + return true + } + } + } + + // We found no interfaces with a valid hardware address. If name + // does not specify a specific interface generate a random Node ID + // (section 4.1.6) + if name == "" { + if nodeID == nil { + nodeID = make([]byte, 6) + } + randomBits(nodeID) + return true + } + return false +} + +// NodeID returns a slice of a copy of the current Node ID, setting the Node ID +// if not already set. +func NodeID() []byte { + if nodeID == nil { + SetNodeInterface("") + } + nid := make([]byte, 6) + copy(nid, nodeID) + return nid +} + +// SetNodeID sets the Node ID to be used for Version 1 UUIDs. The first 6 bytes +// of id are used. If id is less than 6 bytes then false is returned and the +// Node ID is not set. +func SetNodeID(id []byte) bool { + if setNodeID(id) { + ifname = "user" + return true + } + return false +} + +func setNodeID(id []byte) bool { + if len(id) < 6 { + return false + } + if nodeID == nil { + nodeID = make([]byte, 6) + } + copy(nodeID, id) + return true +} + +// NodeID returns the 6 byte node id encoded in uuid. It returns nil if uuid is +// not valid. The NodeID is only well defined for version 1 and 2 UUIDs. +func (uuid UUID) NodeID() []byte { + if len(uuid) != 16 { + return nil + } + node := make([]byte, 6) + copy(node, uuid[10:]) + return node +} diff --git a/vendor/github.com/pborman/uuid/time.go b/vendor/github.com/pborman/uuid/time.go new file mode 100755 index 00000000..7ebc9bef --- /dev/null +++ b/vendor/github.com/pborman/uuid/time.go @@ -0,0 +1,132 @@ +// Copyright 2014 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +import ( + "encoding/binary" + "sync" + "time" +) + +// A Time represents a time as the number of 100's of nanoseconds since 15 Oct +// 1582. +type Time int64 + +const ( + lillian = 2299160 // Julian day of 15 Oct 1582 + unix = 2440587 // Julian day of 1 Jan 1970 + epoch = unix - lillian // Days between epochs + g1582 = epoch * 86400 // seconds between epochs + g1582ns100 = g1582 * 10000000 // 100s of a nanoseconds between epochs +) + +var ( + mu sync.Mutex + lasttime uint64 // last time we returned + clock_seq uint16 // clock sequence for this run + + timeNow = time.Now // for testing +) + +// UnixTime converts t the number of seconds and nanoseconds using the Unix +// epoch of 1 Jan 1970. +func (t Time) UnixTime() (sec, nsec int64) { + sec = int64(t - g1582ns100) + nsec = (sec % 10000000) * 100 + sec /= 10000000 + return sec, nsec +} + +// GetTime returns the current Time (100s of nanoseconds since 15 Oct 1582) and +// clock sequence as well as adjusting the clock sequence as needed. An error +// is returned if the current time cannot be determined. +func GetTime() (Time, uint16, error) { + defer mu.Unlock() + mu.Lock() + return getTime() +} + +func getTime() (Time, uint16, error) { + t := timeNow() + + // If we don't have a clock sequence already, set one. + if clock_seq == 0 { + setClockSequence(-1) + } + now := uint64(t.UnixNano()/100) + g1582ns100 + + // If time has gone backwards with this clock sequence then we + // increment the clock sequence + if now <= lasttime { + clock_seq = ((clock_seq + 1) & 0x3fff) | 0x8000 + } + lasttime = now + return Time(now), clock_seq, nil +} + +// ClockSequence returns the current clock sequence, generating one if not +// already set. The clock sequence is only used for Version 1 UUIDs. +// +// The uuid package does not use global static storage for the clock sequence or +// the last time a UUID was generated. Unless SetClockSequence a new random +// clock sequence is generated the first time a clock sequence is requested by +// ClockSequence, GetTime, or NewUUID. (section 4.2.1.1) sequence is generated +// for +func ClockSequence() int { + defer mu.Unlock() + mu.Lock() + return clockSequence() +} + +func clockSequence() int { + if clock_seq == 0 { + setClockSequence(-1) + } + return int(clock_seq & 0x3fff) +} + +// SetClockSeq sets the clock sequence to the lower 14 bits of seq. Setting to +// -1 causes a new sequence to be generated. +func SetClockSequence(seq int) { + defer mu.Unlock() + mu.Lock() + setClockSequence(seq) +} + +func setClockSequence(seq int) { + if seq == -1 { + var b [2]byte + randomBits(b[:]) // clock sequence + seq = int(b[0])<<8 | int(b[1]) + } + old_seq := clock_seq + clock_seq = uint16(seq&0x3fff) | 0x8000 // Set our variant + if old_seq != clock_seq { + lasttime = 0 + } +} + +// Time returns the time in 100s of nanoseconds since 15 Oct 1582 encoded in +// uuid. It returns false if uuid is not valid. The time is only well defined +// for version 1 and 2 UUIDs. +func (uuid UUID) Time() (Time, bool) { + if len(uuid) != 16 { + return 0, false + } + time := int64(binary.BigEndian.Uint32(uuid[0:4])) + time |= int64(binary.BigEndian.Uint16(uuid[4:6])) << 32 + time |= int64(binary.BigEndian.Uint16(uuid[6:8])&0xfff) << 48 + return Time(time), true +} + +// ClockSequence returns the clock sequence encoded in uuid. It returns false +// if uuid is not valid. The clock sequence is only well defined for version 1 +// and 2 UUIDs. +func (uuid UUID) ClockSequence() (int, bool) { + if len(uuid) != 16 { + return 0, false + } + return int(binary.BigEndian.Uint16(uuid[8:10])) & 0x3fff, true +} diff --git a/vendor/github.com/pborman/uuid/util.go b/vendor/github.com/pborman/uuid/util.go new file mode 100644 index 00000000..de40b102 --- /dev/null +++ b/vendor/github.com/pborman/uuid/util.go @@ -0,0 +1,43 @@ +// Copyright 2011 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +import ( + "io" +) + +// randomBits completely fills slice b with random data. +func randomBits(b []byte) { + if _, err := io.ReadFull(rander, b); err != nil { + panic(err.Error()) // rand should never fail + } +} + +// xvalues returns the value of a byte as a hexadecimal digit or 255. +var xvalues = []byte{ + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 255, 255, 255, 255, 255, 255, + 255, 10, 11, 12, 13, 14, 15, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 10, 11, 12, 13, 14, 15, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, + 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +} + +// xtob converts the the first two hex bytes of x into a byte. +func xtob(x string) (byte, bool) { + b1 := xvalues[x[0]] + b2 := xvalues[x[1]] + return (b1 << 4) | b2, b1 != 255 && b2 != 255 +} diff --git a/vendor/github.com/pborman/uuid/uuid.go b/vendor/github.com/pborman/uuid/uuid.go new file mode 100755 index 00000000..2920fae6 --- /dev/null +++ b/vendor/github.com/pborman/uuid/uuid.go @@ -0,0 +1,163 @@ +// Copyright 2011 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +import ( + "bytes" + "crypto/rand" + "fmt" + "io" + "strings" +) + +// A UUID is a 128 bit (16 byte) Universal Unique IDentifier as defined in RFC +// 4122. +type UUID []byte + +// A Version represents a UUIDs version. +type Version byte + +// A Variant represents a UUIDs variant. +type Variant byte + +// Constants returned by Variant. +const ( + Invalid = Variant(iota) // Invalid UUID + RFC4122 // The variant specified in RFC4122 + Reserved // Reserved, NCS backward compatibility. + Microsoft // Reserved, Microsoft Corporation backward compatibility. + Future // Reserved for future definition. +) + +var rander = rand.Reader // random function + +// New returns a new random (version 4) UUID as a string. It is a convenience +// function for NewRandom().String(). +func New() string { + return NewRandom().String() +} + +// Parse decodes s into a UUID or returns nil. Both the UUID form of +// xxxxxxxx-xxxx-xxxx-xxxx-xxxxxxxxxxxx and +// urn:uuid:xxxxxxxx-xxxx-xxxx-xxxx-xxxxxxxxxxxx are decoded. +func Parse(s string) UUID { + if len(s) == 36+9 { + if strings.ToLower(s[:9]) != "urn:uuid:" { + return nil + } + s = s[9:] + } else if len(s) != 36 { + return nil + } + if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { + return nil + } + uuid := make([]byte, 16) + for i, x := range []int{ + 0, 2, 4, 6, + 9, 11, + 14, 16, + 19, 21, + 24, 26, 28, 30, 32, 34} { + if v, ok := xtob(s[x:]); !ok { + return nil + } else { + uuid[i] = v + } + } + return uuid +} + +// Equal returns true if uuid1 and uuid2 are equal. +func Equal(uuid1, uuid2 UUID) bool { + return bytes.Equal(uuid1, uuid2) +} + +// String returns the string form of uuid, xxxxxxxx-xxxx-xxxx-xxxx-xxxxxxxxxxxx +// , or "" if uuid is invalid. +func (uuid UUID) String() string { + if uuid == nil || len(uuid) != 16 { + return "" + } + b := []byte(uuid) + return fmt.Sprintf("%08x-%04x-%04x-%04x-%012x", + b[:4], b[4:6], b[6:8], b[8:10], b[10:]) +} + +// URN returns the RFC 2141 URN form of uuid, +// urn:uuid:xxxxxxxx-xxxx-xxxx-xxxx-xxxxxxxxxxxx, or "" if uuid is invalid. +func (uuid UUID) URN() string { + if uuid == nil || len(uuid) != 16 { + return "" + } + b := []byte(uuid) + return fmt.Sprintf("urn:uuid:%08x-%04x-%04x-%04x-%012x", + b[:4], b[4:6], b[6:8], b[8:10], b[10:]) +} + +// Variant returns the variant encoded in uuid. It returns Invalid if +// uuid is invalid. +func (uuid UUID) Variant() Variant { + if len(uuid) != 16 { + return Invalid + } + switch { + case (uuid[8] & 0xc0) == 0x80: + return RFC4122 + case (uuid[8] & 0xe0) == 0xc0: + return Microsoft + case (uuid[8] & 0xe0) == 0xe0: + return Future + default: + return Reserved + } + panic("unreachable") +} + +// Version returns the verison of uuid. It returns false if uuid is not +// valid. +func (uuid UUID) Version() (Version, bool) { + if len(uuid) != 16 { + return 0, false + } + return Version(uuid[6] >> 4), true +} + +func (v Version) String() string { + if v > 15 { + return fmt.Sprintf("BAD_VERSION_%d", v) + } + return fmt.Sprintf("VERSION_%d", v) +} + +func (v Variant) String() string { + switch v { + case RFC4122: + return "RFC4122" + case Reserved: + return "Reserved" + case Microsoft: + return "Microsoft" + case Future: + return "Future" + case Invalid: + return "Invalid" + } + return fmt.Sprintf("BadVariant%d", int(v)) +} + +// SetRand sets the random number generator to r, which implents io.Reader. +// If r.Read returns an error when the package requests random data then +// a panic will be issued. +// +// Calling SetRand with nil sets the random number generator to the default +// generator. +func SetRand(r io.Reader) { + if r == nil { + rander = rand.Reader + return + } + rander = r +} diff --git a/vendor/github.com/pborman/uuid/version1.go b/vendor/github.com/pborman/uuid/version1.go new file mode 100644 index 00000000..0127eacf --- /dev/null +++ b/vendor/github.com/pborman/uuid/version1.go @@ -0,0 +1,41 @@ +// Copyright 2011 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +import ( + "encoding/binary" +) + +// NewUUID returns a Version 1 UUID based on the current NodeID and clock +// sequence, and the current time. If the NodeID has not been set by SetNodeID +// or SetNodeInterface then it will be set automatically. If the NodeID cannot +// be set NewUUID returns nil. If clock sequence has not been set by +// SetClockSequence then it will be set automatically. If GetTime fails to +// return the current NewUUID returns nil. +func NewUUID() UUID { + if nodeID == nil { + SetNodeInterface("") + } + + now, seq, err := GetTime() + if err != nil { + return nil + } + + uuid := make([]byte, 16) + + time_low := uint32(now & 0xffffffff) + time_mid := uint16((now >> 32) & 0xffff) + time_hi := uint16((now >> 48) & 0x0fff) + time_hi |= 0x1000 // Version 1 + + binary.BigEndian.PutUint32(uuid[0:], time_low) + binary.BigEndian.PutUint16(uuid[4:], time_mid) + binary.BigEndian.PutUint16(uuid[6:], time_hi) + binary.BigEndian.PutUint16(uuid[8:], seq) + copy(uuid[10:], nodeID) + + return uuid +} diff --git a/vendor/github.com/pborman/uuid/version4.go b/vendor/github.com/pborman/uuid/version4.go new file mode 100644 index 00000000..b3d4a368 --- /dev/null +++ b/vendor/github.com/pborman/uuid/version4.go @@ -0,0 +1,25 @@ +// Copyright 2011 Google Inc. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package uuid + +// Random returns a Random (Version 4) UUID or panics. +// +// The strength of the UUIDs is based on the strength of the crypto/rand +// package. +// +// A note about uniqueness derived from from the UUID Wikipedia entry: +// +// Randomly generated UUIDs have 122 random bits. One's annual risk of being +// hit by a meteorite is estimated to be one chance in 17 billion, that +// means the probability is about 0.00000000006 (6 × 10−11), +// equivalent to the odds of creating a few tens of trillions of UUIDs in a +// year and having one duplicate. +func NewRandom() UUID { + uuid := make([]byte, 16) + randomBits([]byte(uuid)) + uuid[6] = (uuid[6] & 0x0f) | 0x40 // Version 4 + uuid[8] = (uuid[8] & 0x3f) | 0x80 // Variant is 10 + return uuid +}